IE34314B1 - Dibenzodioxocine derivatives - Google Patents
Dibenzodioxocine derivativesInfo
- Publication number
- IE34314B1 IE34314B1 IE791/70A IE79170A IE34314B1 IE 34314 B1 IE34314 B1 IE 34314B1 IE 791/70 A IE791/70 A IE 791/70A IE 79170 A IE79170 A IE 79170A IE 34314 B1 IE34314 B1 IE 34314B1
- Authority
- IE
- Ireland
- Prior art keywords
- hydrogen atom
- salt
- dioxocine
- dibenzo
- pharmaceutically acceptable
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 abstract 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 4
- XGAQKWXFPHTYFT-UHFFFAOYSA-N 5h-benzo[d][1,3]benzodioxocine-11-carboxylic acid Chemical class O1C(C(=O)O)OC2=CC=CC=C2CC2=CC=CC=C21 XGAQKWXFPHTYFT-UHFFFAOYSA-N 0.000 abstract 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 2
- 239000002253 acid Substances 0.000 abstract 2
- 238000006243 chemical reaction Methods 0.000 abstract 2
- 150000007529 inorganic bases Chemical class 0.000 abstract 2
- 150000007530 organic bases Chemical class 0.000 abstract 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 125000005907 alkyl ester group Chemical group 0.000 abstract 1
- 239000003937 drug carrier Substances 0.000 abstract 1
- 230000032050 esterification Effects 0.000 abstract 1
- 238000005886 esterification reaction Methods 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 230000000055 hyoplipidemic effect Effects 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D321/00—Heterocyclic compounds containing rings having two oxygen atoms as the only ring hetero atoms, not provided for by groups C07D317/00 - C07D319/00
- C07D321/12—Eight-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US83455469A | 1969-06-18 | 1969-06-18 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE34314L IE34314L (en) | 1970-12-18 |
| IE34314B1 true IE34314B1 (en) | 1975-04-02 |
Family
ID=25267192
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE791/70A IE34314B1 (en) | 1969-06-18 | 1970-06-17 | Dibenzodioxocine derivatives |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3553234A (enExample) |
| BE (1) | BE752209A (enExample) |
| CH (1) | CH518926A (enExample) |
| DE (1) | DE2029796A1 (enExample) |
| ES (1) | ES380859A1 (enExample) |
| FR (1) | FR2052986B1 (enExample) |
| GB (1) | GB1265279A (enExample) |
| IE (1) | IE34314B1 (enExample) |
| IL (1) | IL34685A (enExample) |
| LU (1) | LU61155A1 (enExample) |
| NL (1) | NL7008743A (enExample) |
| NO (1) | NO127149B (enExample) |
| SE (1) | SE367821B (enExample) |
| ZA (1) | ZA703904B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3931173A (en) * | 1971-07-22 | 1976-01-06 | Richardson-Merrell Inc. | Dioxocin carboxamide derivatives |
| FR2146895B1 (enExample) * | 1971-07-23 | 1974-09-06 | Crt | |
| BE788770A (fr) * | 1971-09-13 | 1973-01-02 | Richardson Merrell Inc | Nouveaux acides dioxathiocinecarboxyliques et leurs derives utiles notamment comme hypolipemiants et agents antiinfectieux |
| US3872105A (en) * | 1973-06-11 | 1975-03-18 | Merrell Inc Richard | Derivatives of 1,3-benzodioxole-2-carboxylic acid |
| US5158597A (en) * | 1989-06-15 | 1992-10-27 | The Dow Chemical Company | Herbicidal 12-substituted 12H-dibenzo[d,g]dioxocin-6-carboxylic acids |
| US4938790A (en) * | 1989-06-15 | 1990-07-03 | The Dow Chemical Company | Herbicidal 12-substituted 12H-dibenzo(D,G)(1,3)dioxocin-6-carboxylic acids |
| US4979978A (en) * | 1989-06-15 | 1990-12-25 | The Dow Chemical Company | Herbicidal 12H-dibenzo[d,g][1,3]dioxocin-6-carboxylic acids |
| CA2035024C (en) * | 1989-06-29 | 2001-05-29 | Keith D. Barnes | Novel glyoxylates and herbicidal and plant growth regulant activity of glyoxylates |
| US4976770A (en) * | 1989-06-29 | 1990-12-11 | Fermenta Asc Corporation | Herbicidal and plant growth regulant activity of glyoxylates |
| US4999448A (en) * | 1990-04-12 | 1991-03-12 | The Dow Chemical Company | Method of preparing bis-phenol ethers |
-
1969
- 1969-06-18 US US834554A patent/US3553234A/en not_active Expired - Lifetime
-
1970
- 1970-06-08 ZA ZA703904A patent/ZA703904B/xx unknown
- 1970-06-09 IL IL34685A patent/IL34685A/xx unknown
- 1970-06-15 NL NL7008743A patent/NL7008743A/xx unknown
- 1970-06-16 DE DE19702029796 patent/DE2029796A1/de active Pending
- 1970-06-16 GB GB1265279D patent/GB1265279A/en not_active Expired
- 1970-06-17 ES ES380859A patent/ES380859A1/es not_active Expired
- 1970-06-17 IE IE791/70A patent/IE34314B1/xx unknown
- 1970-06-17 NO NO02353/70A patent/NO127149B/no unknown
- 1970-06-17 SE SE08425/70A patent/SE367821B/xx unknown
- 1970-06-18 BE BE752209D patent/BE752209A/xx unknown
- 1970-06-18 FR FR7022533A patent/FR2052986B1/fr not_active Expired
- 1970-06-18 CH CH926970A patent/CH518926A/fr not_active IP Right Cessation
- 1970-06-18 LU LU61155D patent/LU61155A1/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL34685A0 (en) | 1970-08-19 |
| GB1265279A (enExample) | 1972-03-01 |
| ES380859A1 (es) | 1973-04-01 |
| BE752209A (fr) | 1970-12-01 |
| IE34314L (en) | 1970-12-18 |
| IL34685A (en) | 1973-04-30 |
| FR2052986A1 (enExample) | 1971-04-16 |
| LU61155A1 (enExample) | 1971-07-02 |
| NL7008743A (enExample) | 1970-12-22 |
| NO127149B (enExample) | 1973-05-14 |
| DE2029796A1 (de) | 1971-01-07 |
| FR2052986B1 (enExample) | 1974-08-30 |
| SE367821B (enExample) | 1974-06-10 |
| ZA703904B (en) | 1971-03-31 |
| US3553234A (en) | 1971-01-05 |
| CH518926A (fr) | 1972-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE34314B1 (en) | Dibenzodioxocine derivatives | |
| IE45624L (en) | (pyrazol-1-yl)-phenylacetic acids. | |
| GB1355147A (en) | Oxoprostanoic acid derivatives | |
| GB1277239A (en) | Cycloalkane-carboxylic acid derivatives | |
| GB1496491A (en) | Dihydroergopeptine derivatives | |
| GB1252329A (enExample) | ||
| GB1448547A (en) | Derivative of phenylacetic acid | |
| GB1432503A (en) | Cycloalkylalkylesters and process for their preparation | |
| GB1158868A (en) | Novel 2,4-Disubstituted 7- and 8-Chloroquinolines, the preparation thereof and Compositions containing the same | |
| IE39576L (en) | DERIVATIVES OF 3- (p-CHLOROBENZOYL)-2-METHYL- PHENYLACETIC¹ACID | |
| GB1174880A (en) | Derivatives of alpha-Piperazinophenylacetonitrile and process for manufacture of same | |
| GB1126860A (en) | Novel 4-substituted-7- and 8-chloroquinolines and a process for the preparation thereof | |
| GB1414886A (en) | 2,10-dichloro-12-methyl-12h-dibenzo-d,g 1,3 dioxocine derivatives and a process for the preparation of same | |
| IE33870B1 (en) | Benzobenzofuranooxepine compounds and process for preparing the same | |
| GB1219387A (en) | Bicyclo[2.2.2]oct-2-ene-amino acid compounds | |
| GB1410275A (en) | Phenoxycarboxylic acid derivatives their preparation and compositions containing them | |
| IE33762L (en) | Adamantylcarboxamidophenylacetic acid derivatives | |
| GB1195491A (en) | 4-Substituted 7- and 8-Chloroquinolines, the Preparation thereof, and Compositions Containing the same | |
| GB1426200A (en) | Nahpthyridine derivatives | |
| GB1504683A (en) | Pharmaceutical compositions containing substituted pyrimido-quinoline derivatives | |
| GB1158954A (en) | N-(4-Carboxy-Phenyl)-Anthranilic Acid, derivatives thereof and a process for their preparation | |
| GB1264197A (enExample) | ||
| GB1369173A (en) | 5-cinnamoyl-pyrrole-2-acetic acids and esters and pharmaceutical compositions containing them | |
| GB1306511A (en) | Imidazoline derivatives | |
| GB1202110A (en) | Novel quinoline derivatives and their preparation |