IE32941B1 - Resolution process - Google Patents
Resolution processInfo
- Publication number
- IE32941B1 IE32941B1 IE67/69A IE6769A IE32941B1 IE 32941 B1 IE32941 B1 IE 32941B1 IE 67/69 A IE67/69 A IE 67/69A IE 6769 A IE6769 A IE 6769A IE 32941 B1 IE32941 B1 IE 32941B1
- Authority
- IE
- Ireland
- Prior art keywords
- acid
- pyroglutamic acid
- tartaric acid
- derivative
- iii
- Prior art date
Links
- ODHCTXKNWHHXJC-UHFFFAOYSA-N acide pyroglutamique Natural products OC(=O)C1CCC(=O)N1 ODHCTXKNWHHXJC-UHFFFAOYSA-N 0.000 abstract 3
- NTOIKDYVJIWVSU-UHFFFAOYSA-N 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid Chemical compound C1=CC(C)=CC=C1C(=O)C(O)(C(O)=O)C(O)(C(O)=O)C(=O)C1=CC=C(C)C=C1 NTOIKDYVJIWVSU-UHFFFAOYSA-N 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- YONLFQNRGZXBBF-ZIAGYGMSSA-N (2r,3r)-2,3-dibenzoyloxybutanedioic acid Chemical compound O([C@@H](C(=O)O)[C@@H](OC(=O)C=1C=CC=CC=1)C(O)=O)C(=O)C1=CC=CC=C1 YONLFQNRGZXBBF-ZIAGYGMSSA-N 0.000 abstract 1
- ODHCTXKNWHHXJC-VKHMYHEASA-N 5-oxo-L-proline Chemical class OC(=O)[C@@H]1CCC(=O)N1 ODHCTXKNWHHXJC-VKHMYHEASA-N 0.000 abstract 1
- HLFSDGLLUJUHTE-UHFFFAOYSA-N 6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole Chemical compound N1=C2SCCN2CC1C1=CC=CC=C1 HLFSDGLLUJUHTE-UHFFFAOYSA-N 0.000 abstract 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical class OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 230000003287 optical effect Effects 0.000 abstract 1
- 239000003960 organic solvent Substances 0.000 abstract 1
- 239000000376 reactant Substances 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7321/68A GB1183781A (en) | 1968-02-14 | 1968-02-14 | Resolution Process. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE32941L IE32941L (en) | 1969-08-14 |
| IE32941B1 true IE32941B1 (en) | 1974-01-23 |
Family
ID=9830899
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE67/69A IE32941B1 (en) | 1968-02-14 | 1969-01-17 | Resolution process |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3580923A (enExample) |
| AT (1) | AT283355B (enExample) |
| BE (1) | BE728371A (enExample) |
| BG (1) | BG19790A3 (enExample) |
| BR (1) | BR6906377D0 (enExample) |
| CH (1) | CH508657A (enExample) |
| DE (1) | DE1907609C3 (enExample) |
| DK (1) | DK134673B (enExample) |
| ES (1) | ES363602A1 (enExample) |
| FR (1) | FR2001916A1 (enExample) |
| GB (1) | GB1183781A (enExample) |
| IE (1) | IE32941B1 (enExample) |
| IL (1) | IL31556A (enExample) |
| IT (1) | IT1044177B (enExample) |
| NL (1) | NL6901620A (enExample) |
| PL (1) | PL80889B1 (enExample) |
| RO (1) | RO56601A (enExample) |
| SE (1) | SE371444B (enExample) |
| YU (1) | YU32397B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA735753B (en) * | 1972-09-14 | 1974-07-31 | American Cyanamid Co | Resolution of 6-substituted amino phenyl-2,3,5,6-tetrahydro(2,1-b)thiadiazoles |
| DE2854010A1 (de) * | 1977-12-21 | 1979-07-05 | Letraset International Ltd | Verfahren zur herstellung von schildern |
| PL221188A1 (enExample) * | 1979-01-05 | 1980-12-01 | Ciba Geigy Ag | |
| US4672126A (en) * | 1983-11-10 | 1987-06-09 | Janssen Pharmaceutica, N.V. | Process for isolating levamisole from tetramisole |
| US6713627B2 (en) | 1998-03-13 | 2004-03-30 | Aventis Pharmaceuticals Inc. | Processes for the preparation of (R)-α-(2,3-dimethoxyphenyl)-1-[2-(4-fluorophenyl)ethyl]-4-piperidinemethanol |
| US20050261341A1 (en) * | 1998-03-13 | 2005-11-24 | Aventis Pharmaceuticals Inc. | Novel processes for the preparation of (R)-alpha-(2,3-dimethoxyphenyl)-1-[2-(4-fluorophenyl)ethyl]-4-piperidinemethanol |
| CA2637542A1 (en) * | 2006-01-17 | 2007-07-26 | Glenmark Pharmaceuticals Limited | Improved process for the preparation of an optically active 5h-pyrrolo [3,4-b] pyrazine derivative |
| WO2008132128A2 (en) * | 2007-04-27 | 2008-11-06 | Solvay (Société Anonyme) | Synthesis of a pharmaceutically active compound |
| WO2009080708A1 (en) * | 2007-12-21 | 2009-07-02 | Solvay (Société Anonyme) | Use of enantiopure n-sulphonyl pyroglutamic acid as resolving agent |
| CN104557979A (zh) * | 2013-10-23 | 2015-04-29 | 丹阳恒安化学科技研究所有限公司 | 盐酸左旋咪唑的制备方法 |
-
1968
- 1968-02-14 GB GB7321/68A patent/GB1183781A/en not_active Expired
-
1969
- 1969-01-17 IE IE67/69A patent/IE32941B1/xx unknown
- 1969-01-20 PL PL1969131273A patent/PL80889B1/pl unknown
- 1969-01-22 US US793157*A patent/US3580923A/en not_active Expired - Lifetime
- 1969-01-24 IT IT11977/69A patent/IT1044177B/it active
- 1969-01-31 YU YU0235/69A patent/YU32397B/xx unknown
- 1969-01-31 NL NL6901620A patent/NL6901620A/xx unknown
- 1969-02-04 IL IL31556A patent/IL31556A/en unknown
- 1969-02-10 DK DK70369AA patent/DK134673B/da not_active IP Right Cessation
- 1969-02-13 BR BR206377/69A patent/BR6906377D0/pt unknown
- 1969-02-13 BG BG011661A patent/BG19790A3/xx unknown
- 1969-02-13 ES ES363602A patent/ES363602A1/es not_active Expired
- 1969-02-13 SE SE6901994A patent/SE371444B/xx unknown
- 1969-02-13 BE BE728371D patent/BE728371A/xx not_active IP Right Cessation
- 1969-02-14 CH CH227169A patent/CH508657A/de not_active IP Right Cessation
- 1969-02-14 AT AT151469A patent/AT283355B/de not_active IP Right Cessation
- 1969-02-14 FR FR6903748A patent/FR2001916A1/fr not_active Withdrawn
- 1969-02-14 DE DE1907609A patent/DE1907609C3/de not_active Expired
- 1969-02-14 RO RO59096A patent/RO56601A/ro unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AT283355B (de) | 1970-08-10 |
| US3580923A (en) | 1971-05-25 |
| SE371444B (enExample) | 1974-11-18 |
| IL31556A (en) | 1972-07-26 |
| DK134673C (enExample) | 1977-05-23 |
| DK134673B (da) | 1976-12-20 |
| IT1044177B (it) | 1980-03-20 |
| GB1183781A (en) | 1970-03-11 |
| PL80889B1 (enExample) | 1975-08-30 |
| RO56601A (enExample) | 1974-04-29 |
| BR6906377D0 (pt) | 1973-01-16 |
| IL31556A0 (en) | 1969-11-12 |
| DE1907609A1 (de) | 1970-09-03 |
| FR2001916A1 (enExample) | 1969-10-03 |
| CH508657A (de) | 1971-06-15 |
| YU23569A (en) | 1974-04-30 |
| NL6901620A (enExample) | 1969-08-18 |
| DE1907609C3 (de) | 1980-09-04 |
| YU32397B (en) | 1974-10-31 |
| BE728371A (enExample) | 1969-08-13 |
| BG19790A3 (bg) | 1975-10-10 |
| ES363602A1 (es) | 1971-01-01 |
| DE1907609B2 (de) | 1980-01-03 |
| IE32941L (en) | 1969-08-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE32941B1 (en) | Resolution process | |
| CA1001166A (en) | Process for the production of substantially anhydrous percarboxylic acid solutions in organic solvents | |
| GB1189720A (en) | Aromatic Sulfamoyl Compounds | |
| GB1533906A (en) | Process for reducing the water sensitivity of polyvinyl alcohol | |
| GB1285610A (en) | Quinacridone pigments | |
| GB1211589A (en) | Enantiomer isolation process | |
| AU4063472A (en) | Salts of iodomethanesulphonic acid with organic bases | |
| ES419016A1 (es) | Procedimiento para la produccion de compuesto del acido 13-bromo - lisergico. | |
| SU584771A3 (ru) | Способ получени замещенных хиноксалиндионов или их солей | |
| IE32639B1 (en) | Indole derivatives and a process for the production thereof | |
| GB1382998A (en) | Process for preparing 1,3,4-thiadiazole-2-thiol compounds | |
| GB901169A (en) | Preparation of 2-chloro-azacyclo-2.3-alkene-n-carbochlorides | |
| GB1284084A (en) | PROCESS FOR MAKING 1H-PYRAZOLO[3,4-d]PYRIMIDINES | |
| GB1357985A (en) | Anthraquinone compounds | |
| IE35780L (en) | Hydroxocobalamin-amino acid derivative | |
| GB1127852A (en) | Resolution of dl-6-phenyl-2,3,5,6-tetrahydroimidazo-[2,1-b]-thiazole | |
| GB1442302A (en) | Penicillin and cephalosporin derivatives | |
| GB1383612A (en) | Preparation of ethylamino pyrimidine derivatives | |
| IE34875L (en) | Bipyridylium compounds. | |
| IE33955L (en) | Penicillanic acids | |
| GB1331520A (en) | Aphidicolin and derivatives thereof | |
| IE32506L (en) | Tetramisole salts | |
| GB1459294A (en) | Isolation of 6-aminopenicillanic acid and salts thereof | |
| GB1349228A (en) | Tetramethyl dithiolpyrophosphoric acid ester process for its preparation and its use as an intermediate for pesticide synthesis | |
| GB1226492A (enExample) |