HU207278B - Process for producing e/z mixtures from mainly e or z 2-/bicyclo-/3.3.0/ octane-3- -ilidine/acetic acid derivatives - Google Patents
Process for producing e/z mixtures from mainly e or z 2-/bicyclo-/3.3.0/ octane-3- -ilidine/acetic acid derivatives Download PDFInfo
- Publication number
- HU207278B HU207278B HU885394A HU539488A HU207278B HU 207278 B HU207278 B HU 207278B HU 885394 A HU885394 A HU 885394A HU 539488 A HU539488 A HU 539488A HU 207278 B HU207278 B HU 207278B
- Authority
- HU
- Hungary
- Prior art keywords
- bicyclo
- octan
- alkyl
- tert
- ester
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 13
- 239000000203 mixture Substances 0.000 title claims abstract description 10
- 150000001242 acetic acid derivatives Chemical class 0.000 title description 2
- IHIJMABTDBGLQA-UHFFFAOYSA-N 2-(3,3a,4,5,6,6a-hexahydro-1h-pentalen-2-ylidene)acetic acid Chemical class C1CCC2CC(=CC(=O)O)CC21 IHIJMABTDBGLQA-UHFFFAOYSA-N 0.000 claims abstract description 4
- -1 (-) - menthyl Chemical group 0.000 claims description 56
- 229910052783 alkali metal Inorganic materials 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000002947 alkylene group Chemical group 0.000 claims description 9
- 239000002585 base Substances 0.000 claims description 7
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 claims description 7
- 239000004305 biphenyl Substances 0.000 claims description 6
- 235000010290 biphenyl Nutrition 0.000 claims description 6
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical class C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 claims description 6
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 5
- 125000005103 alkyl silyl group Chemical group 0.000 claims description 5
- 125000006267 biphenyl group Chemical group 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 claims description 4
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 4
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 3
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 claims description 3
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 claims description 3
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 claims description 3
- ZOUYMLXOFDNVRK-UHFFFAOYSA-N 3,3a,4,5,6,6a-hexahydro-1h-pentalen-2-one Chemical compound C1CCC2CC(=O)CC21 ZOUYMLXOFDNVRK-UHFFFAOYSA-N 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 229910000102 alkali metal hydride Inorganic materials 0.000 claims description 3
- 150000008046 alkali metal hydrides Chemical class 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 claims description 3
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 125000004350 aryl cycloalkyl group Chemical group 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 60
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 45
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 44
- 150000001875 compounds Chemical class 0.000 description 36
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 31
- 238000004587 chromatography analysis Methods 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 20
- 150000002148 esters Chemical class 0.000 description 20
- 229940093499 ethyl acetate Drugs 0.000 description 20
- 238000004817 gas chromatography Methods 0.000 description 19
- 229910052698 phosphorus Inorganic materials 0.000 description 19
- 239000003480 eluent Substances 0.000 description 18
- 238000010626 work up procedure Methods 0.000 description 14
- 239000000243 solution Substances 0.000 description 13
- MSPCIZMDDUQPGJ-UHFFFAOYSA-N N-methyl-N-(trimethylsilyl)trifluoroacetamide Chemical compound C[Si](C)(C)N(C)C(=O)C(F)(F)F MSPCIZMDDUQPGJ-UHFFFAOYSA-N 0.000 description 12
- 229960000583 acetic acid Drugs 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 10
- 239000000377 silicon dioxide Substances 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 8
- 238000006884 silylation reaction Methods 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 239000003921 oil Substances 0.000 description 7
- 238000012545 processing Methods 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 230000000717 retained effect Effects 0.000 description 7
- RHLVCLIPMVJYKS-UHFFFAOYSA-N 3-octanone Chemical compound CCCCCC(=O)CC RHLVCLIPMVJYKS-UHFFFAOYSA-N 0.000 description 6
- 239000012230 colorless oil Substances 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 5
- 238000011109 contamination Methods 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical class [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- DWGDRWOWGOHUMI-UHFFFAOYSA-N 2-[hydroxy-(5-methyl-2-propan-2-ylcyclohexyl)oxyphosphoryl]acetic acid Chemical compound C1(CC(C(CC1)C(C)C)OP(=O)(O)CC(=O)O)C DWGDRWOWGOHUMI-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 229910004298 SiO 2 Inorganic materials 0.000 description 3
- FUVDQRFHOXIVOL-UHFFFAOYSA-N [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] acetate Chemical compound CC(=O)OC1CC(C)CCC1C(C)(C)C1=CC=CC=C1 FUVDQRFHOXIVOL-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- CWXVNRPGFLCKNR-ZQAWKMMESA-N (3as,4r,5r,6ar)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1h-pentalen-2-one Chemical compound C([C@H]1[C@H]2CC(=O)C[C@H]2C[C@H]1O)O[Si](C(C)(C)C)(C=1C=CC=CC=1)C1=CC=CC=C1 CWXVNRPGFLCKNR-ZQAWKMMESA-N 0.000 description 2
- KWKAKUADMBZCLK-UHFFFAOYSA-N 1-octene Chemical compound CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 2
- YDVJJQOXKDBYQF-QWHCGFSZSA-N 2-[hydroxy-[(1R,2S)-2-phenylcyclohexyl]oxyphosphoryl]acetic acid Chemical compound C1CC[C@H]([C@@H](C1)C2=CC=CC=C2)OP(=O)(CC(=O)O)O YDVJJQOXKDBYQF-QWHCGFSZSA-N 0.000 description 2
- NUEBVPUPKCUQJT-UHFFFAOYSA-N 2-[hydroxy-[5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxyphosphoryl]acetic acid Chemical compound OC(=O)CP(O)(=O)OC1CC(C)CCC1C(C)(C)C1=CC=CC=C1 NUEBVPUPKCUQJT-UHFFFAOYSA-N 0.000 description 2
- NICSDZQHMJNINX-UHFFFAOYSA-N 3-ethyloct-2-enoic acid Chemical class C(C)C(=CC(=O)O)CCCCC NICSDZQHMJNINX-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 238000013375 chromatographic separation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- XUYJLQHKOGNDPB-UHFFFAOYSA-N phosphonoacetic acid Chemical compound OC(=O)CP(O)(O)=O XUYJLQHKOGNDPB-UHFFFAOYSA-N 0.000 description 2
- 238000012746 preparative thin layer chromatography Methods 0.000 description 2
- 239000010453 quartz Substances 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- LJESULFGNUECSG-DOERSZECSA-N (3as,4r,5r,6ar)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1h-pentalen-2-one Chemical compound C1C(=O)C[C@@H]2[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)C[C@@H]21 LJESULFGNUECSG-DOERSZECSA-N 0.000 description 1
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- LPUCHTNHUHOTRY-UHFFFAOYSA-N 1-(3-bicyclo[2.2.1]heptanyl)ethanamine Chemical compound C1CC2C(C(N)C)CC1C2 LPUCHTNHUHOTRY-UHFFFAOYSA-N 0.000 description 1
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- VCDPHYIZVFJQCD-UHFFFAOYSA-N 2-benzylidenecyclohexan-1-one Chemical class O=C1CCCCC1=CC1=CC=CC=C1 VCDPHYIZVFJQCD-UHFFFAOYSA-N 0.000 description 1
- NLNKLAFDVIRWMA-UHFFFAOYSA-N 3-ethyloct-2-en-2-ol Chemical compound CCCCCC(CC)=C(C)O NLNKLAFDVIRWMA-UHFFFAOYSA-N 0.000 description 1
- MAUUNYHAXGTMMQ-AMXXQSRZSA-N 4-[(2e)-2-[(3as,4s,5r,6as)-5-hydroxy-4-[(3s,4s)-3-hydroxy-4-methylnona-1,6-diynyl]-3,3a,4,5,6,6a-hexahydro-1h-pentalen-2-ylidene]ethoxy]butanoic acid Chemical compound C1\C(=C/COCCCC(O)=O)C[C@@H]2[C@@H](C#C[C@@H](O)[C@@H](C)CC#CCC)[C@H](O)C[C@@H]21 MAUUNYHAXGTMMQ-AMXXQSRZSA-N 0.000 description 1
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 238000007239 Wittig reaction Methods 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- OCJKSUSNMXDOGL-UONOGXRCSA-N [(1r,2s)-2-phenylcyclohexyl] acetate Chemical compound CC(=O)O[C@@H]1CCCC[C@H]1C1=CC=CC=C1 OCJKSUSNMXDOGL-UONOGXRCSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000004808 allyl alcohols Chemical class 0.000 description 1
- HVTVYHGAQOOHPI-SFHVURJKSA-N benzylidene-methyl-phenyl-propyl-lambda5-phosphane Chemical compound C(C1=CC=CC=C1)=[P@](CCC)(C1=CC=CC=C1)C HVTVYHGAQOOHPI-SFHVURJKSA-N 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- ARUGKOZUKWAXDS-SEWALLKFSA-N cicaprost Chemical compound C1\C(=C/COCC(O)=O)C[C@@H]2[C@@H](C#C[C@@H](O)[C@@H](C)CC#CCC)[C@H](O)C[C@@H]21 ARUGKOZUKWAXDS-SEWALLKFSA-N 0.000 description 1
- 229950000634 cicaprost Drugs 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 208000031513 cyst Diseases 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- KAQKFAOMNZTLHT-VVUHWYTRSA-N epoprostenol Chemical compound O1C(=CCCCC(O)=O)C[C@@H]2[C@@H](/C=C/[C@@H](O)CCCCC)[C@H](O)C[C@@H]21 KAQKFAOMNZTLHT-VVUHWYTRSA-N 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- OVEHNNQXLPJPPL-UHFFFAOYSA-N lithium;n-propan-2-ylpropan-2-amine Chemical compound [Li].CC(C)NC(C)C OVEHNNQXLPJPPL-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 1
- GNWXVOQHLPBSSR-UHFFFAOYSA-N oxolane;toluene Chemical compound C1CCOC1.CC1=CC=CC=C1 GNWXVOQHLPBSSR-UHFFFAOYSA-N 0.000 description 1
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000005541 phosphonamide group Chemical group 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- FYRTWNBAZWPLOW-UHFFFAOYSA-N potassium;n-propan-2-ylpropan-2-amine Chemical compound [K].CC(C)NC(C)C FYRTWNBAZWPLOW-UHFFFAOYSA-N 0.000 description 1
- 150000003815 prostacyclins Chemical class 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- WWAYLSXXLXIQNN-UHFFFAOYSA-N spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxolane]-2-one Chemical compound C1C2CC(=O)CC2CC21OCCO2 WWAYLSXXLXIQNN-UHFFFAOYSA-N 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
- C07C405/005—Analogues or derivatives having the five membered ring replaced by other rings
- C07C405/0075—Analogues or derivatives having the five membered ring replaced by other rings having the side-chains or their analogues or derivatives attached to a condensed ring system
- C07C405/0083—Analogues or derivatives having the five membered ring replaced by other rings having the side-chains or their analogues or derivatives attached to a condensed ring system which is only ortho or peri condensed, e.g. carbacyclins
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19873727065 DE3727065A1 (de) | 1987-08-11 | 1987-08-11 | Verfahren zur herstellung von e/z-gemischen von 2-(bicyclo-(3.3.0)-octan-3-yliden) -essigsaeurederivaten mit ueberwiegendem e- oder z-anteil |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HU885394D0 HU885394D0 (en) | 1990-02-28 |
| HU207278B true HU207278B (en) | 1993-03-29 |
Family
ID=6333709
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU885394A HU207278B (en) | 1987-08-11 | 1988-08-11 | Process for producing e/z mixtures from mainly e or z 2-/bicyclo-/3.3.0/ octane-3- -ilidine/acetic acid derivatives |
Country Status (8)
| Country | Link |
|---|---|
| EP (1) | EP0303562B1 (enExample) |
| JP (1) | JP2608948B2 (enExample) |
| AT (1) | ATE71616T1 (enExample) |
| DE (2) | DE3727065A1 (enExample) |
| ES (1) | ES2038335T3 (enExample) |
| GR (1) | GR3004331T3 (enExample) |
| HU (1) | HU207278B (enExample) |
| WO (1) | WO1989001470A1 (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4028864A1 (de) * | 1990-09-07 | 1992-03-12 | Schering Ag | Verfahren zur herstellung von e/z-mischungen von 2-(6-alkyl-bicyclo-(3.3.0)-octan-3-yliden) -essigsaeure-derivaten mit ueberwiegendem anteil des e-isomeren |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3306123A1 (de) * | 1983-02-18 | 1984-09-06 | Schering AG, 1000 Berlin und 4709 Bergkamen | Neue carbacycline, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
-
1987
- 1987-08-11 DE DE19873727065 patent/DE3727065A1/de not_active Withdrawn
-
1988
- 1988-08-11 HU HU885394A patent/HU207278B/hu not_active IP Right Cessation
- 1988-08-11 EP EP88730179A patent/EP0303562B1/de not_active Expired - Lifetime
- 1988-08-11 AT AT88730179T patent/ATE71616T1/de not_active IP Right Cessation
- 1988-08-11 DE DE8888730179T patent/DE3867757D1/de not_active Expired - Lifetime
- 1988-08-11 WO PCT/DE1988/000503 patent/WO1989001470A1/de not_active Ceased
- 1988-08-11 ES ES198888730179T patent/ES2038335T3/es not_active Expired - Lifetime
- 1988-08-11 JP JP63506507A patent/JP2608948B2/ja not_active Expired - Lifetime
-
1992
- 1992-04-10 GR GR920400687T patent/GR3004331T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE3867757D1 (de) | 1992-02-27 |
| HU885394D0 (en) | 1990-02-28 |
| JPH02500914A (ja) | 1990-03-29 |
| WO1989001470A1 (fr) | 1989-02-23 |
| ES2038335T3 (es) | 1993-07-16 |
| JP2608948B2 (ja) | 1997-05-14 |
| ATE71616T1 (de) | 1992-02-15 |
| GR3004331T3 (enExample) | 1993-03-31 |
| EP0303562A1 (de) | 1989-02-15 |
| EP0303562B1 (de) | 1992-01-15 |
| DE3727065A1 (de) | 1989-02-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0054795B1 (en) | Novel halogenated prostacyclins, process for the production thereof, and pharmaceutical use thereof | |
| Studer et al. | The SHi Reaction at Silicon—A New Entry into Cyclic Alkoxysilanes | |
| HU207278B (en) | Process for producing e/z mixtures from mainly e or z 2-/bicyclo-/3.3.0/ octane-3- -ilidine/acetic acid derivatives | |
| KR940003361B1 (ko) | 이소카르바시클린류 및 그의 제조방법 | |
| Cooper et al. | Synthesis of the four stereoisomers of enprostil | |
| US5200530A (en) | Keto reduction of carbacyclin intermediates | |
| Matsumura et al. | Study on Efficient Synthetic Routes for 7-Fluoroprostaglandin F2. ALPHA. and 7-Fluoro-17, 20-dimethyl-2, 4-methyleneprostacyclin. | |
| US5538995A (en) | Difluoroprostacyclins | |
| US5283349A (en) | 2,6,7-trisubstituted-3-methylenebicyclo(3.3.0)-octanes, and process for production thereof | |
| US4079055A (en) | Chemical reduction process | |
| KR920004190B1 (ko) | 7-티아프로스타글란딘 e₁의 제조방법 | |
| JP2774381B2 (ja) | α鎖修飾イソカルバサイクリン類およびその製造法 | |
| JPH0645575B2 (ja) | 3―メチレン―2,6,7―三置換ビシクロ[3.3.0オクタン類 | |
| US5159102A (en) | 7-thiaprostaglandins E, and process for producing same | |
| JPH07324081A (ja) | ジハロゲン化プロスタサイクリン類の製造方法 | |
| JP2713333B2 (ja) | イソカルバサイクリン類及びその製造法 | |
| PL94475B1 (pl) | Sposob wytwarzania pochodnych prostaglandyny | |
| JPH025746B2 (enExample) | ||
| CA1313670C (en) | Carbacyclin analogs | |
| JPH0575755B2 (enExample) | ||
| US5169960A (en) | Process for the production of E/Z mixtures of 2-(bicyclo[3.3.0]octan-3-ylidene)-acetic acid derivatives with predominant E or Z portion | |
| JP2703392B2 (ja) | イソカルバサイクリン類の製造法 | |
| US5250715A (en) | Optically active 2-methylenepentane derivative and process for preparing same | |
| JP2705194B2 (ja) | β―ラクタム化合物の製造法 | |
| JPH0351695B2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HMM4 | Cancellation of final prot. due to non-payment of fee |