HU189690B - Process for preparing lysergic acid esters - Google Patents
Process for preparing lysergic acid esters Download PDFInfo
- Publication number
- HU189690B HU189690B HU831846A HU184683A HU189690B HU 189690 B HU189690 B HU 189690B HU 831846 A HU831846 A HU 831846A HU 184683 A HU184683 A HU 184683A HU 189690 B HU189690 B HU 189690B
- Authority
- HU
- Hungary
- Prior art keywords
- acid
- lysergic
- formula
- lysergic acid
- carbon atoms
- Prior art date
Links
- ZAGRKAFMISFKIO-QMTHXVAHSA-N lysergic acid Chemical class C1=CC(C2=C[C@H](CN([C@@H]2C2)C)C(O)=O)=C3C2=CNC3=C1 ZAGRKAFMISFKIO-QMTHXVAHSA-N 0.000 title claims abstract description 12
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 4
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 9
- 239000002253 acid Substances 0.000 claims abstract description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 239000011541 reaction mixture Substances 0.000 claims description 5
- 230000002378 acidificating effect Effects 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000003456 ion exchange resin Substances 0.000 claims description 2
- 229920003303 ion-exchange polymer Polymers 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- ZAGRKAFMISFKIO-UHFFFAOYSA-N Isolysergic acid Natural products C1=CC(C2=CC(CN(C2C2)C)C(O)=O)=C3C2=CNC3=C1 ZAGRKAFMISFKIO-UHFFFAOYSA-N 0.000 abstract description 8
- GENAHGKEFJLNJB-IINYFYTJSA-N (6ar,9s)-7-methyl-6,6a,8,9-tetrahydro-4h-indolo[4,3-fg]quinoline-9-carboxamide Chemical class C1=CC(C2=C[C@@H](CN([C@@H]2C2)C)C(N)=O)=C3C2=CNC3=C1 GENAHGKEFJLNJB-IINYFYTJSA-N 0.000 abstract 1
- 150000001298 alcohols Chemical class 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- 150000001408 amides Chemical class 0.000 description 11
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- GENAHGKEFJLNJB-QMTHXVAHSA-N lysergamide Chemical compound C1=CC(C2=C[C@H](CN([C@@H]2C2)C)C(N)=O)=C3C2=CNC3=C1 GENAHGKEFJLNJB-QMTHXVAHSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 238000000034 method Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- -1 lysergic acid esters Chemical class 0.000 description 3
- RNHDWLRHUJZABX-IAQYHMDHSA-N methyl (6ar,9r)-7-methyl-6,6a,8,9-tetrahydro-4h-indolo[4,3-fg]quinoline-9-carboxylate Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)OC)C2)=C3C2=CNC3=C1 RNHDWLRHUJZABX-IAQYHMDHSA-N 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 229920001429 chelating resin Polymers 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- YRRNUVUMQGZMMS-CRAIPNDOSA-N (6aR,9R)-9-ethyl-7-methyl-4,6,6a,8-tetrahydroindolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C1=CC(C=2[C@H](N(C)C[C@](C=2)(CC)C(O)=O)C2)=C3C2=CNC3=C1 YRRNUVUMQGZMMS-CRAIPNDOSA-N 0.000 description 1
- YREISLCRUMOYAY-BKQYHRSVSA-N (6ar)-n-(1-hydroxypropan-2-yl)-7-methyl-6,6a,8,9-tetrahydro-4h-indolo[4,3-fg]quinoline-9-carboxamide;(z)-but-2-enedioic acid Chemical compound OC(=O)\C=C/C(O)=O.C1=CC(C=2[C@H](N(C)CC(C=2)C(=O)NC(CO)C)C2)=C3C2=CNC3=C1 YREISLCRUMOYAY-BKQYHRSVSA-N 0.000 description 1
- OEVHDXFBOKGRLN-ZKYQVNSYSA-N (6ar,9s,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carboxamide Chemical compound C1=CC([C@H]2C[C@@H](CN([C@@H]2C2)C)C(N)=O)=C3C2=CNC3=C1 OEVHDXFBOKGRLN-ZKYQVNSYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- WVVSZNPYNCNODU-CJBNDPTMSA-N Ergometrine Natural products C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N[C@@H](CO)C)C2)=C3C2=CNC3=C1 WVVSZNPYNCNODU-CJBNDPTMSA-N 0.000 description 1
- WVVSZNPYNCNODU-XTQGRXLLSA-N Lysergic acid propanolamide Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N[C@H](CO)C)C2)=C3C2=CNC3=C1 WVVSZNPYNCNODU-XTQGRXLLSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 229960001405 ergometrine Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 150000002476 indolines Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229960003587 lisuride Drugs 0.000 description 1
- CVQFAMQDTWVJSV-BAXNFHPCSA-N lisuride maleate Chemical compound [H+].[H+].[O-]C(=O)\C=C/C([O-])=O.C1=CC(C=2[C@H](N(C)C[C@H](C=2)NC(=O)N(CC)CC)C2)=C3C2=CNC3=C1 CVQFAMQDTWVJSV-BAXNFHPCSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/04—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823220199 DE3220199A1 (de) | 1982-05-26 | 1982-05-26 | Verfahren zur herstellung von lysergsaeureestern |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU189690B true HU189690B (en) | 1986-07-28 |
Family
ID=6164797
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU831846A HU189690B (en) | 1982-05-26 | 1983-05-25 | Process for preparing lysergic acid esters |
Country Status (10)
| Country | Link |
|---|---|
| EP (1) | EP0095092B1 (enExample) |
| JP (1) | JPS58216187A (enExample) |
| AT (1) | ATE24507T1 (enExample) |
| CA (1) | CA1186685A (enExample) |
| CS (1) | CS235038B2 (enExample) |
| DE (2) | DE3220199A1 (enExample) |
| DK (1) | DK161599C (enExample) |
| ES (1) | ES8405397A1 (enExample) |
| HU (1) | HU189690B (enExample) |
| IE (1) | IE55311B1 (enExample) |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB759105A (en) * | 1953-07-30 | 1956-10-10 | Sandoz Ltd | Process for the production of a substituted indolo-quinoline |
| FR1115726A (fr) * | 1954-09-27 | 1956-04-27 | Lilly Co Eli | Perfectionnements à la synthèse de l'acide lysergique et de ses homologues et aux produits intermédiaires utilisés |
| CH452538A (de) * | 1964-10-27 | 1968-03-15 | Sandoz Ag | Verfahren zur Herstellung von neuen heterocyclischen Estern |
-
1982
- 1982-05-26 DE DE19823220199 patent/DE3220199A1/de not_active Withdrawn
-
1983
- 1983-05-11 EP EP83104636A patent/EP0095092B1/en not_active Expired
- 1983-05-11 AT AT83104636T patent/ATE24507T1/de not_active IP Right Cessation
- 1983-05-11 ES ES522297A patent/ES8405397A1/es not_active Expired
- 1983-05-11 DE DE8383104636T patent/DE3368632D1/de not_active Expired
- 1983-05-16 CS CS833404A patent/CS235038B2/cs unknown
- 1983-05-25 HU HU831846A patent/HU189690B/hu not_active IP Right Cessation
- 1983-05-25 DK DK235583A patent/DK161599C/da not_active IP Right Cessation
- 1983-05-25 CA CA000428877A patent/CA1186685A/en not_active Expired
- 1983-05-25 IE IE1235/83A patent/IE55311B1/en not_active IP Right Cessation
- 1983-05-26 JP JP58091647A patent/JPS58216187A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DK235583A (da) | 1983-11-27 |
| IE55311B1 (en) | 1990-08-01 |
| DK235583D0 (da) | 1983-05-25 |
| IE831235L (en) | 1983-11-26 |
| ES522297A0 (es) | 1984-06-16 |
| DE3368632D1 (en) | 1987-02-05 |
| EP0095092B1 (en) | 1986-12-30 |
| ES8405397A1 (es) | 1984-06-16 |
| ATE24507T1 (de) | 1987-01-15 |
| JPS58216187A (ja) | 1983-12-15 |
| CA1186685A (en) | 1985-05-07 |
| EP0095092A3 (en) | 1984-05-02 |
| JPH0367067B2 (enExample) | 1991-10-21 |
| EP0095092A2 (en) | 1983-11-30 |
| DE3220199A1 (de) | 1983-12-01 |
| CS235038B2 (en) | 1985-04-16 |
| DK161599B (da) | 1991-07-22 |
| DK161599C (da) | 1992-01-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US20080275237A1 (en) | Method for Obtaining Pure Tetrahydrocannabinol | |
| HU195957B (en) | Process for preparing betq-hydroxy-butyric acid ester derivatives | |
| US4849528A (en) | 4-benzyloxy-3-pyrrolin-2-on-1-yl acetamide | |
| HU202826B (en) | Process for producing (2,6-dichloro-phenyl)-amino-phenyl-acetic acid derivatives | |
| HU189690B (en) | Process for preparing lysergic acid esters | |
| HU186969B (en) | Process for producing ergoline derivatives | |
| GB2036744A (en) | Eburnane derivatives | |
| US3103513A (en) | Process for preparing hexadehy- | |
| US4524208A (en) | Process for the preparation of lysergic acid esters | |
| JPS6148839B2 (enExample) | ||
| KR19990008411A (ko) | 4-히드록시-2-피롤리돈의 개량 제법 | |
| Karady et al. | Synthesis of D-and L-. alpha.-(3, 4-dihydroxybenzyl)-. alpha.-hydrazinopropionic acid via resolution | |
| EP0095091B1 (en) | Process for the preparation of dihydrolysergic acid esters | |
| Atkinson et al. | A Total Synthesis of the Four Isomeric 2-Tropanols | |
| US3228939A (en) | Methyl and i,g-dimethyl-ergoline ii derivatives | |
| US3846433A (en) | Process for preparing ergot alkaloids | |
| JP2631668B2 (ja) | 新規ウロカニン酸誘導体 | |
| US6723844B1 (en) | Preparation of K-252a | |
| HU191693B (en) | Process for production of derivatives of 9-or-11 substituated apovincamin acid | |
| US2868836A (en) | 2, 4-dihydroxy-3-methylphenylglyoxylic acid and derivatives thereof | |
| US4156728A (en) | 3-Substituted-2(1H)pyridone-6-carboxylic acids | |
| HU202474B (en) | Process for producing methyl 3-aminocrotonate | |
| US2516251A (en) | Penilloic acid and preparation thereof | |
| KR810000454B1 (ko) | 치환 안식향산아미드 유도체의 제조방법 | |
| JPS6287599A (ja) | エリスロマイシン類のオキシム誘導体の製造法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |