HU185991B - Process for producing trichloroformate - Google Patents
Process for producing trichloroformate Download PDFInfo
- Publication number
- HU185991B HU185991B HU813662A HU366281A HU185991B HU 185991 B HU185991 B HU 185991B HU 813662 A HU813662 A HU 813662A HU 366281 A HU366281 A HU 366281A HU 185991 B HU185991 B HU 185991B
- Authority
- HU
- Hungary
- Prior art keywords
- phosgene
- reaction
- formula
- preparation
- mercaptan
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 20
- 230000008569 process Effects 0.000 title claims description 19
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 34
- 239000003054 catalyst Substances 0.000 claims description 18
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims description 9
- 239000007795 chemical reaction product Substances 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 9
- RYXNTTXRPACDJA-UHFFFAOYSA-N sulfanyl carbonochloridate Chemical class SOC(Cl)=O RYXNTTXRPACDJA-UHFFFAOYSA-N 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 150000003672 ureas Chemical class 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 239000003153 chemical reaction reagent Substances 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 229910052717 sulfur Chemical group 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N urea group Chemical group NC(=O)N XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 1
- -1 octyl octyl ethyl- octyl Chemical group 0.000 description 7
- SNDGLCYYBKJSOT-UHFFFAOYSA-N 1,1,3,3-tetrabutylurea Chemical compound CCCCN(CCCC)C(=O)N(CCCC)CCCC SNDGLCYYBKJSOT-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- KZCOBXFFBQJQHH-UHFFFAOYSA-N octane-1-thiol Chemical compound CCCCCCCCS KZCOBXFFBQJQHH-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000012467 final product Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- TUMNHQRORINJKE-UHFFFAOYSA-N 1,1-diethylurea Chemical compound CCN(CC)C(N)=O TUMNHQRORINJKE-UHFFFAOYSA-N 0.000 description 2
- XKAFKUGMXFMRCC-UHFFFAOYSA-N 1,1-diphenylurea Chemical compound C=1C=CC=CC=1N(C(=O)N)C1=CC=CC=C1 XKAFKUGMXFMRCC-UHFFFAOYSA-N 0.000 description 2
- KREOCUNMMFZOOS-UHFFFAOYSA-N 1,3-di(propan-2-yl)thiourea Chemical compound CC(C)NC(S)=NC(C)C KREOCUNMMFZOOS-UHFFFAOYSA-N 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 150000002019 disulfides Chemical class 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000010802 sludge Substances 0.000 description 2
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 description 1
- AWNKVZGUFIUNQQ-UHFFFAOYSA-N 1,1,3,3-tetrabutylthiourea Chemical compound CCCCN(CCCC)C(=S)N(CCCC)CCCC AWNKVZGUFIUNQQ-UHFFFAOYSA-N 0.000 description 1
- ZSPQVOFATJEJMT-UHFFFAOYSA-N 1,1,3,3-tetraethylthiourea Chemical compound CCN(CC)C(=S)N(CC)CC ZSPQVOFATJEJMT-UHFFFAOYSA-N 0.000 description 1
- UWHSPZZUAYSGTB-UHFFFAOYSA-N 1,1,3,3-tetraethylurea Chemical compound CCN(CC)C(=O)N(CC)CC UWHSPZZUAYSGTB-UHFFFAOYSA-N 0.000 description 1
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- BUKFFNWRMNRRNF-UHFFFAOYSA-N 1,1-bis(2-methylpropyl)urea Chemical compound CC(C)CN(C(N)=O)CC(C)C BUKFFNWRMNRRNF-UHFFFAOYSA-N 0.000 description 1
- AROCLDYPZXMJPW-UHFFFAOYSA-N 1-(octyldisulfanyl)octane Chemical compound CCCCCCCCSSCCCCCCCC AROCLDYPZXMJPW-UHFFFAOYSA-N 0.000 description 1
- FARHYDJOXLCMRP-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]pyrazol-3-yl]oxyacetic acid Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(N1CC2=C(CC1)NN=N2)=O)OCC(=O)O FARHYDJOXLCMRP-UHFFFAOYSA-N 0.000 description 1
- JBQISKLHCCNZKW-UHFFFAOYSA-N CCCCCCCCSC(S)=O Chemical compound CCCCCCCCSC(S)=O JBQISKLHCCNZKW-UHFFFAOYSA-N 0.000 description 1
- GWEHVDNNLFDJLR-UHFFFAOYSA-N Carbanilide Natural products C=1C=CC=CC=1NC(=O)NC1=CC=CC=C1 GWEHVDNNLFDJLR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- DFCAFRGABIXSDS-UHFFFAOYSA-N Cycloate Chemical compound CCSC(=O)N(CC)C1CCCCC1 DFCAFRGABIXSDS-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- MNOILHPDHOHILI-UHFFFAOYSA-N Tetramethylthiourea Chemical compound CN(C)C(=S)N(C)C MNOILHPDHOHILI-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- DCAYPVUWAIABOU-UHFFFAOYSA-N alpha-n-hexadecene Natural products CCCCCCCCCCCCCCCC DCAYPVUWAIABOU-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000007872 degassing Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- QCMHWZUFWLOOGI-UHFFFAOYSA-N s-ethyl chloromethanethioate Chemical compound CCSC(Cl)=O QCMHWZUFWLOOGI-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 description 1
- 150000003573 thiols Chemical group 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C329/00—Thiocarbonic acids; Halides, esters or anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8025819A FR2495610A1 (fr) | 1980-12-05 | 1980-12-05 | Procede de fabrication de thiochloroformiates |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU185991B true HU185991B (en) | 1985-04-28 |
Family
ID=9248694
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU813662A HU185991B (en) | 1980-12-05 | 1981-12-04 | Process for producing trichloroformate |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4400329A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0053981B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPS57120567A (cg-RX-API-DMAC7.html) |
| AT (1) | ATE12633T1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU542171B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1161457A (cg-RX-API-DMAC7.html) |
| DE (1) | DE3169902D1 (cg-RX-API-DMAC7.html) |
| ES (1) | ES507694A0 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2495610A1 (cg-RX-API-DMAC7.html) |
| HU (1) | HU185991B (cg-RX-API-DMAC7.html) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2605317B1 (fr) * | 1986-10-17 | 1989-03-31 | Poudres & Explosifs Ste Nale | Procede de fabrication des thiochloroformiates d'alkyle. |
| DE19737619A1 (de) * | 1997-08-28 | 1999-03-04 | Basf Ag | Verfahren zur Herstellung von Thiochlorformiaten |
| DE19824929A1 (de) * | 1998-06-04 | 1999-12-09 | Basf Ag | Verfahren zur Herstellung von Alkyl-, Alkenyl- und Alkinylchloriden |
| JP2007204428A (ja) * | 2006-02-02 | 2007-08-16 | Sumitomo Chemical Co Ltd | クロロチオールホルメートの製造法 |
| JP2007290987A (ja) * | 2006-04-24 | 2007-11-08 | Sumitomo Chemical Co Ltd | クロロチオールホルメートの製造法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3299114A (en) * | 1962-08-20 | 1967-01-17 | Stauffer Chemical Co | Process for making chloroformates with amines as catalysts |
| US3277143A (en) * | 1962-08-20 | 1966-10-04 | Stauffer Chemical Co | Method for preparing chlorothiolformates |
| DE2934657A1 (de) * | 1979-08-28 | 1981-03-12 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von thiochlorformiaten. |
| US4320070A (en) * | 1979-09-24 | 1982-03-16 | Ppg Industries, Inc. | Process for preparing chlorothiolformates |
-
1980
- 1980-12-05 FR FR8025819A patent/FR2495610A1/fr active Granted
-
1981
- 1981-11-27 US US06/325,369 patent/US4400329A/en not_active Expired - Lifetime
- 1981-12-02 CA CA000391360A patent/CA1161457A/en not_active Expired
- 1981-12-03 ES ES507694A patent/ES507694A0/es active Granted
- 1981-12-04 HU HU813662A patent/HU185991B/hu unknown
- 1981-12-04 AT AT81401928T patent/ATE12633T1/de not_active IP Right Cessation
- 1981-12-04 DE DE8181401928T patent/DE3169902D1/de not_active Expired
- 1981-12-04 EP EP81401928A patent/EP0053981B1/fr not_active Expired
- 1981-12-04 JP JP56194631A patent/JPS57120567A/ja active Pending
- 1981-12-04 AU AU78284/81A patent/AU542171B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| US4400329A (en) | 1983-08-23 |
| EP0053981B1 (fr) | 1985-04-10 |
| DE3169902D1 (en) | 1985-05-15 |
| FR2495610B1 (cg-RX-API-DMAC7.html) | 1984-02-17 |
| AU542171B2 (en) | 1985-02-07 |
| JPS57120567A (en) | 1982-07-27 |
| ES8206461A1 (es) | 1982-09-01 |
| ATE12633T1 (de) | 1985-04-15 |
| ES507694A0 (es) | 1982-09-01 |
| EP0053981A1 (fr) | 1982-06-16 |
| AU7828481A (en) | 1982-06-10 |
| FR2495610A1 (fr) | 1982-06-11 |
| CA1161457A (en) | 1984-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4052440A (en) | Method for preparing mercapto propionic acid esters and polythio dipropionic acid esters | |
| CA1069529A (en) | Method for preparing mercapto propionic acid esters and polythio dipropionic acid esters | |
| US5196611A (en) | Preparation of alkyl, alkenyl, and alkynyl chlorides | |
| HU185991B (en) | Process for producing trichloroformate | |
| JPH0124142B2 (cg-RX-API-DMAC7.html) | ||
| SU1072800A3 (ru) | Способ получени гидрогалогенидов 2-меркаптоэтиламина и его вариант | |
| US4806286A (en) | Process for the preparation of acid chlorides by phosgenation of acids, and catalysts for this process | |
| US4155933A (en) | Process for halogenation of aldehydes and production of oximes therefrom | |
| US10717707B2 (en) | Synthesis of 2,2,2-trifluoroethanethiol | |
| US4316031A (en) | Process for the preparation of 2-mercaptobenzothiazole | |
| EP0903340B1 (en) | Process for production of alkoxycarbonylthioaryl compounds | |
| US4200749A (en) | Preparation of halogenated modified isocyanurates | |
| CA1212121A (en) | Process for the preparation of n-allyl-o-alkyl- thionocarbamates | |
| HU217360B (hu) | Eljárás o-(klór-metil)-benzoil-kloridok előállítására | |
| US5130478A (en) | Process for the preparation of chlorides of chlorinated carboxylic acids | |
| US3671556A (en) | Manufacturing process for esters of dihalo-hydroxybenzonitriles | |
| CA2329241A1 (en) | Process for producing dimethylacetamide | |
| KR19980018388A (ko) | 고순도 1,3-디알킬-2-이미다졸리디논 및 그 제조방법 | |
| HU204759B (en) | Process for producing chlorocarboxylic acid chlorides | |
| EP0200429A2 (en) | Process for preparing methylcarbamate insecticides | |
| GB1563360A (en) | A 4-methyl-imidazole-5-carboxylate and a process for its manufacture | |
| US5731465A (en) | Process for the preparation of tertiary butyl hydrazine hydrohalogenide | |
| US4297301A (en) | Process for the manufacture of organic acid chlorides | |
| EP0269315A2 (en) | Amine production | |
| JP2659667B2 (ja) | シスタミンの製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 |