HU182956B - Process for producing styryl- and substituted-styryl-cyclopropane-carboxylates and insecticide preparations containing such compounds as agent - Google Patents
Process for producing styryl- and substituted-styryl-cyclopropane-carboxylates and insecticide preparations containing such compounds as agent Download PDFInfo
- Publication number
- HU182956B HU182956B HU77FE1005A HUFE001005A HU182956B HU 182956 B HU182956 B HU 182956B HU 77FE1005 A HU77FE1005 A HU 77FE1005A HU FE001005 A HUFE001005 A HU FE001005A HU 182956 B HU182956 B HU 182956B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- cyano
- alkyl
- active ingredient
- benzyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 45
- 239000002917 insecticide Substances 0.000 title claims abstract description 14
- -1 substituted-styryl-cyclopropane-carboxylates Chemical class 0.000 title claims description 57
- 238000002360 preparation method Methods 0.000 title claims description 28
- 238000000034 method Methods 0.000 title claims description 9
- 239000003795 chemical substances by application Substances 0.000 title description 3
- 239000004480 active ingredient Substances 0.000 claims abstract description 22
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims abstract description 13
- 239000002253 acid Substances 0.000 claims abstract description 10
- 150000002148 esters Chemical class 0.000 claims abstract description 7
- 150000004714 phosphonium salts Chemical class 0.000 claims abstract description 4
- 229920002554 vinyl polymer Polymers 0.000 claims description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 20
- 229910001868 water Inorganic materials 0.000 claims description 20
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 18
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 13
- 239000007787 solid Substances 0.000 claims description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 10
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 10
- 239000000460 chlorine Substances 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000007788 liquid Substances 0.000 claims description 10
- 239000002585 base Substances 0.000 claims description 9
- YMGUBTXCNDTFJI-UHFFFAOYSA-M cyclopropanecarboxylate Chemical compound [O-]C(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-M 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical group 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 239000000969 carrier Substances 0.000 claims description 5
- 125000005504 styryl group Chemical group 0.000 claims description 5
- 239000004094 surface-active agent Substances 0.000 claims description 5
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 4
- 239000012298 atmosphere Substances 0.000 claims description 4
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- 239000000454 talc Substances 0.000 claims description 4
- 229910052623 talc Inorganic materials 0.000 claims description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 3
- 125000006183 2,4-dimethyl benzyl group Chemical group [H]C1=C(C([H])=C(C(=C1[H])C([H])([H])*)C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 claims description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 3
- 239000000440 bentonite Substances 0.000 claims description 3
- 229910000278 bentonite Inorganic materials 0.000 claims description 3
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 150000007942 carboxylates Chemical class 0.000 claims description 3
- 239000007859 condensation product Substances 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims description 3
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 claims description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 229910000102 alkali metal hydride Inorganic materials 0.000 claims description 2
- 150000008046 alkali metal hydrides Chemical class 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 229920001521 polyalkylene glycol ether Polymers 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 125000003158 alcohol group Chemical group 0.000 claims 2
- 229910052783 alkali metal Inorganic materials 0.000 claims 2
- 125000003545 alkoxy group Chemical group 0.000 claims 2
- 125000004414 alkyl thio group Chemical group 0.000 claims 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 2
- 150000001340 alkali metals Chemical class 0.000 claims 1
- KWKXNDCHNDYVRT-UHFFFAOYSA-N dodecylbenzene Chemical compound CCCCCCCCCCCCC1=CC=CC=C1 KWKXNDCHNDYVRT-UHFFFAOYSA-N 0.000 claims 1
- 229910052744 lithium Inorganic materials 0.000 claims 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 44
- 150000004820 halides Chemical class 0.000 abstract description 2
- 239000004606 Fillers/Extenders Substances 0.000 abstract 1
- 230000003301 hydrolyzing effect Effects 0.000 abstract 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 72
- 239000000243 solution Substances 0.000 description 34
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 29
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 21
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 20
- 239000011541 reaction mixture Substances 0.000 description 20
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 18
- 241000238631 Hexapoda Species 0.000 description 17
- 230000000749 insecticidal effect Effects 0.000 description 15
- 239000000706 filtrate Substances 0.000 description 14
- 239000003921 oil Substances 0.000 description 13
- 235000019198 oils Nutrition 0.000 description 13
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 11
- 239000012141 concentrate Substances 0.000 description 10
- 235000008504 concentrate Nutrition 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- 238000001228 spectrum Methods 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 238000009472 formulation Methods 0.000 description 8
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 241000254173 Coleoptera Species 0.000 description 7
- 238000004458 analytical method Methods 0.000 description 7
- 241000238876 Acari Species 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 239000007921 spray Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 5
- 244000046052 Phaseolus vulgaris Species 0.000 description 5
- 239000012267 brine Substances 0.000 description 5
- JMYVMOUINOAAPA-UHFFFAOYSA-N cyclopropanecarbaldehyde Chemical compound O=CC1CC1 JMYVMOUINOAAPA-UHFFFAOYSA-N 0.000 description 5
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 4
- 241000238657 Blattella germanica Species 0.000 description 4
- 241000255925 Diptera Species 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 239000000575 pesticide Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- BFNMOMYTTGHNGJ-UHFFFAOYSA-N 2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)CC1C(O)=O BFNMOMYTTGHNGJ-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 3
- 241000607479 Yersinia pestis Species 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical class OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 235000013312 flour Nutrition 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- 241000253994 Acyrthosiphon pisum Species 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 241001521235 Spodoptera eridania Species 0.000 description 2
- 241001065719 Tetranychus ludeni Species 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 230000001804 emulsifying effect Effects 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 235000014666 liquid concentrate Nutrition 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 230000000361 pesticidal effect Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- KGANAERDZBAECK-UHFFFAOYSA-N (3-phenoxyphenyl)methanol Chemical compound OCC1=CC=CC(OC=2C=CC=CC=2)=C1 KGANAERDZBAECK-UHFFFAOYSA-N 0.000 description 1
- AFEOKIGLYCQHAZ-UHFFFAOYSA-N (5-benzylfuran-3-yl)methanol Chemical compound OCC1=COC(CC=2C=CC=CC=2)=C1 AFEOKIGLYCQHAZ-UHFFFAOYSA-N 0.000 description 1
- VEQMUQZKBLIXLT-UHFFFAOYSA-N 2,3-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1C(C)C1C(O)=O VEQMUQZKBLIXLT-UHFFFAOYSA-N 0.000 description 1
- DNRJTBAOUJJKDY-UHFFFAOYSA-N 2-Acetyl-3,5,5,6,8,8-hexamethyl-5,6,7,8- tetrahydronaphthalene Chemical compound CC(=O)C1=C(C)C=C2C(C)(C)C(C)CC(C)(C)C2=C1 DNRJTBAOUJJKDY-UHFFFAOYSA-N 0.000 description 1
- GUYVLQKVANFBQJ-UHFFFAOYSA-N 2-cyclopropylethenylbenzene Chemical compound C1CC1C=CC1=CC=CC=C1 GUYVLQKVANFBQJ-UHFFFAOYSA-N 0.000 description 1
- GXUQMKBQDGPMKZ-UHFFFAOYSA-N 2-hydroxy-2-(3-phenoxyphenyl)acetonitrile Chemical compound N#CC(O)C1=CC=CC(OC=2C=CC=CC=2)=C1 GXUQMKBQDGPMKZ-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241001674044 Blattodea Species 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 244000067602 Chamaesyce hirta Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 241000462639 Epilachna varivestis Species 0.000 description 1
- 241001150411 Grapholita prunivora Species 0.000 description 1
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 1
- 241000257159 Musca domestica Species 0.000 description 1
- 241000244206 Nematoda Species 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 241000258913 Oncopeltus fasciatus Species 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 1
- 241001674048 Phthiraptera Species 0.000 description 1
- 241000907661 Pieris rapae Species 0.000 description 1
- 241000500439 Plutella Species 0.000 description 1
- 241000500437 Plutella xylostella Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 241000254179 Sitophilus granarius Species 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 241001454293 Tetranychus urticae Species 0.000 description 1
- 241000254112 Tribolium confusum Species 0.000 description 1
- 241000255993 Trichoplusia ni Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- USFRYJRPHFMVBZ-UHFFFAOYSA-M benzyl(triphenyl)phosphanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)CC1=CC=CC=C1 USFRYJRPHFMVBZ-UHFFFAOYSA-M 0.000 description 1
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 1
- 235000001465 calcium Nutrition 0.000 description 1
- VTYYLEPIZMXCLO-UHFFFAOYSA-L calcium carbonate Substances [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- HCWYXKWQOMTBKY-UHFFFAOYSA-N calcium;dodecyl benzenesulfonate Chemical compound [Ca].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 HCWYXKWQOMTBKY-UHFFFAOYSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- USJRLGNYCQWLPF-UHFFFAOYSA-N chlorophosphane Chemical compound ClP USJRLGNYCQWLPF-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- AIPRAPZUGUTQKX-UHFFFAOYSA-N diethoxyphosphorylmethylbenzene Chemical compound CCOP(=O)(OCC)CC1=CC=CC=C1 AIPRAPZUGUTQKX-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 231100001252 long-term toxicity Toxicity 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000014380 magnesium carbonate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 238000010525 oxidative degradation reaction Methods 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical class N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- DAJSVUQLFFJUSX-UHFFFAOYSA-M sodium;dodecane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCCCS([O-])(=O)=O DAJSVUQLFFJUSX-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000012439 solid excipient Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 235000001508 sulfur Nutrition 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/42—Singly bound oxygen atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N53/00—Biocides, pest repellants or attractants, or plant growth regulators containing cyclopropane carboxylic acids or derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Agronomy & Crop Science (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US71825276A | 1976-08-27 | 1976-08-27 | |
| US05/718,254 US4157397A (en) | 1976-08-27 | 1976-08-27 | Insecticidal (β-phenylvinyl)cyclopropanecarboxylates |
| US05/718,253 US4160842A (en) | 1976-08-27 | 1976-08-27 | Insecticidal [β-(substituted-phenyl)vinyl]cyclopropanecarboxylates |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU182956B true HU182956B (en) | 1984-03-28 |
Family
ID=27418975
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU77FE1005A HU182956B (en) | 1976-08-27 | 1977-08-26 | Process for producing styryl- and substituted-styryl-cyclopropane-carboxylates and insecticide preparations containing such compounds as agent |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS5328152A (enExample) |
| AR (1) | AR222454A1 (enExample) |
| BR (1) | BR7705707A (enExample) |
| CA (1) | CA1260486A (enExample) |
| CH (1) | CH636246A5 (enExample) |
| DE (1) | DE2738150A1 (enExample) |
| DK (1) | DK379877A (enExample) |
| EG (1) | EG13343A (enExample) |
| FR (1) | FR2362588A1 (enExample) |
| GB (1) | GB1556783A (enExample) |
| HU (1) | HU182956B (enExample) |
| IE (1) | IE45656B1 (enExample) |
| IL (1) | IL52730A (enExample) |
| IT (1) | IT1085024B (enExample) |
| LU (1) | LU78041A1 (enExample) |
| NL (1) | NL7709392A (enExample) |
| TR (1) | TR19605A (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2730515A1 (de) * | 1977-07-06 | 1979-01-18 | Bayer Ag | Substituierte phenoxybenzyloxycarbonylderivate, verfahren zu ihrer herstellung und ihre verwendung als insektizide und akarizide |
| DE2827101A1 (de) * | 1978-06-21 | 1980-01-10 | Bayer Ag | Verfahren zur herstellung von chloro-styryl-cyclopropan-carbonsaeure- derivaten |
| DE2844271A1 (de) * | 1978-10-11 | 1980-04-24 | Bayer Ag | 3-chlorostyryl-2,2-dimethyl-cyclopropancarbonsaeure-(4-fluoro-3-phenoxy- alpha -cyano-benzyl)-ester, verfahren zu ihrer herstellung und ihre verwendung als ektoparasitizide |
| JPS5517301A (en) * | 1978-07-07 | 1980-02-06 | Sumitomo Chem Co Ltd | O/w suspension of pesticidal composition |
| CA1167858A (en) * | 1978-08-28 | 1984-05-22 | Dale G. Brown | Cyanovinyl pyrethroids acid intermediates and pesticidal use |
| DE2842542A1 (de) * | 1978-09-29 | 1980-04-17 | Bayer Ag | Substituierte bromostyryl-cyclopropancarbonsaeurephenoxybenzylester, verfahren zu ihrer herstellunnd ihre verwendung als insektizide und akarizide |
| DE2916357A1 (de) * | 1979-04-23 | 1980-11-06 | Bayer Ag | Verfahren zur herstellung von 3-(2-aryl-vinyl)-2,2-dimethyl-cyclopropan-1-carbonsaeureestern und neue zwischenprodukte dafuer |
| DE2916321A1 (de) | 1979-04-23 | 1980-11-06 | Bayer Ag | Verfahren zur herstellung von styryl- cyclopropan-carbonsaeureestern und neue zwischenprodukte dafuer |
| DE2916401A1 (de) * | 1979-04-23 | 1980-11-06 | Bayer Ag | Verfahren zur herstellung von 3-(2-arylvinyl)-2,2-dimethyl-cyclopropan-1-carbon- saeureestern und neue zwischenprodukte dafuer |
| DE2916375A1 (de) | 1979-04-23 | 1980-11-06 | Bayer Ag | Verfahren zur herstellung von styryl-cyclopropan-carbonsaeureestern und neue zwischenprodukte dafuer |
| DE2916358A1 (de) * | 1979-04-23 | 1980-11-06 | Bayer Ag | Substituierte styrylcyclopropancarbonsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als insektizide und akarizide |
| DE2916417A1 (de) | 1979-04-23 | 1980-11-06 | Bayer Ag | Verfahren zur herstellung von 3-(aryl- vinyl)-2,2-dimethyl-cyclopropan-1-carbonsaeureestern und neue zwischenprodukte dafuer |
| US4358409A (en) * | 1979-05-02 | 1982-11-09 | Bayer Aktiengesellschaft | Preparation of styryl cyclopropane insecticide intermediates |
| DE2920947A1 (de) * | 1979-05-23 | 1980-12-04 | Bayer Ag | 2-phenyl-alken-1-yl-cyclopropan- carbonsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als insektizide und akarizide und zwischenprodukte zu ihrer herstellung |
| DE2936864A1 (de) * | 1979-09-12 | 1981-04-02 | Bayer Ag, 5090 Leverkusen | (+-)-trans-3-(e, z-2-chlor-2-(4-chlorphenyl)-vinyl)-, 2,2-dimethyl-cyclopropan-carbonsaeure-(+-)-(alpha)-cyano-3-phenoxy-4-fluor-benzyl)-ester, die einzelnen e- und z-isomeren, verfahren zur herstellung dieser verbindungen und ihre verwendung als ektoparasitizide |
| DE3044010A1 (de) | 1980-11-22 | 1982-06-24 | Hoechst Ag, 6000 Frankfurt | Phenoxybenzylester, ihre herstellung und ihre verwendung als pflanzenschutzmittel und im veterinaermedizinischen bereich |
| JPH0621499U (ja) * | 1992-08-25 | 1994-03-22 | 良子 岡崎 | トイレ用カーペツト |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7701321A (nl) * | 1976-02-17 | 1977-08-19 | Ciba Geigy | Werkwijze voor de bereiding van een ester. |
-
1977
- 1977-08-08 CA CA000284272A patent/CA1260486A/en not_active Expired
- 1977-08-15 IL IL52730A patent/IL52730A/xx unknown
- 1977-08-15 IE IE1703/77A patent/IE45656B1/en unknown
- 1977-08-22 EG EG494/77A patent/EG13343A/xx active
- 1977-08-24 DE DE19772738150 patent/DE2738150A1/de not_active Withdrawn
- 1977-08-25 NL NL7709392A patent/NL7709392A/xx not_active Application Discontinuation
- 1977-08-25 GB GB35734/77A patent/GB1556783A/en not_active Expired
- 1977-08-25 AR AR268941A patent/AR222454A1/es active
- 1977-08-25 FR FR7725944A patent/FR2362588A1/fr active Granted
- 1977-08-26 JP JP10178877A patent/JPS5328152A/ja active Granted
- 1977-08-26 DK DK379877A patent/DK379877A/da not_active Application Discontinuation
- 1977-08-26 IT IT27015/77A patent/IT1085024B/it active
- 1977-08-26 TR TR19605A patent/TR19605A/xx unknown
- 1977-08-26 LU LU78041A patent/LU78041A1/xx unknown
- 1977-08-26 BR BR7705707A patent/BR7705707A/pt unknown
- 1977-08-26 HU HU77FE1005A patent/HU182956B/hu unknown
- 1977-08-26 CH CH1047177A patent/CH636246A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CH636246A5 (en) | 1983-05-31 |
| CA1260486A (en) | 1989-09-26 |
| IE45656L (en) | 1978-02-27 |
| EG13343A (en) | 1982-03-31 |
| IL52730A0 (en) | 1977-10-31 |
| BR7705707A (pt) | 1978-05-16 |
| IE45656B1 (en) | 1982-10-20 |
| JPS622574B2 (enExample) | 1987-01-20 |
| TR19605A (tr) | 1979-09-01 |
| AR222454A1 (es) | 1981-05-29 |
| JPS5328152A (en) | 1978-03-16 |
| IL52730A (en) | 1982-07-30 |
| FR2362588A1 (fr) | 1978-03-24 |
| FR2362588B1 (enExample) | 1984-02-10 |
| NL7709392A (nl) | 1978-03-01 |
| DK379877A (da) | 1978-02-28 |
| IT1085024B (it) | 1985-05-28 |
| GB1556783A (en) | 1979-11-28 |
| LU78041A1 (enExample) | 1978-04-27 |
| DE2738150A1 (de) | 1978-03-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4263319A (en) | 4-Substituted-2-indanol insecticidal ester derivatives | |
| HU182956B (en) | Process for producing styryl- and substituted-styryl-cyclopropane-carboxylates and insecticide preparations containing such compounds as agent | |
| US4157447A (en) | Intermediates for insecticidal (β-phenyl-β-substituted-vinyl)cyclopropanecarboxylates | |
| EP0049977B1 (en) | Insecticidal (1,1'-biphenyl)-3-ylmethyl esters, their production and use and compositions containing them | |
| HU176473B (en) | Insecticide and acaricide compositions containing substituted phenoxy-benzyloxy-carbonyl derivatives ann process for producing the active agents | |
| EP0060617A1 (en) | Fluorobenzyl cyclopropane carboxylates, their preparation, compositions and use as insecticides | |
| US4243677A (en) | Insecticidal perhaloalkylvinylcyclopropanecarboxylates | |
| US4200644A (en) | Arylthiovinylcyclopropanecarboxylate insecticides | |
| EP0001064B1 (de) | Fluorsubstituierte Phenoxybenzyl-oxycarbonylderivate,-alkohole und -halogenide, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| US4157397A (en) | Insecticidal (β-phenylvinyl)cyclopropanecarboxylates | |
| US5073564A (en) | Ethynylbenzothiophene pesticides | |
| US4341796A (en) | Control of acarids with biphenylmethyl perhaloalkylvinylcyclopropanecarboxylates | |
| DE69714145T2 (de) | 1,4-Diaryl-2-fluoro-2-butene als insectizide und akarizide Mittel | |
| US4235927A (en) | Insecticidal benzylfurylmethyl perhaloalkylvinylcyclopropanecarboxylates | |
| US4160842A (en) | Insecticidal [β-(substituted-phenyl)vinyl]cyclopropanecarboxylates | |
| US4152455A (en) | Insecticidal α-trifluoromethyl-3-phenoxybenzyl carboxylates | |
| DE2810634A1 (de) | Pentafluorbenzyloxycarbonylderivate, verfahren zu ihrer herstellung und ihre verwendung als insektizide und akarizide | |
| US4183942A (en) | Insecticidal (β-phenyl-β-substituted-vinyl)cyclopropanecarboxylates | |
| US4792567A (en) | Acaricidal aryl arylthien-2-yl ethenes | |
| US4335252A (en) | Insecticidal pyrethroid enantiomer pair | |
| US4162366A (en) | α-TRIFLUOROMETHYL-3-PHENOXYBENZYL ALCOHOL | |
| US4215069A (en) | Arylthiovinylcyclopropanecarboxylate intermediates | |
| US4279920A (en) | 2,2-Dimethyl-3-(2-bromo-2-phenyl-vinyl)-cyclopropanecarboxylic acid 3-phenoxybenzyl esters and pesticidal use | |
| US4346251A (en) | 4-Substituted-2-indanols | |
| US4239773A (en) | Insecticidal esters of certain substituted 7-oxabicyclo[2.2.1]2,5-heptadiene methanols |