HU172891B - Sposob poluchenija proizvodnykh 7-amino-cef-3-em-4-karbonovojj kisloty - Google Patents
Sposob poluchenija proizvodnykh 7-amino-cef-3-em-4-karbonovojj kislotyInfo
- Publication number
- HU172891B HU172891B HU75SO00001150A HUSO001150A HU172891B HU 172891 B HU172891 B HU 172891B HU 75SO00001150 A HU75SO00001150 A HU 75SO00001150A HU SO001150 A HUSO001150 A HU SO001150A HU 172891 B HU172891 B HU 172891B
- Authority
- HU
- Hungary
- Prior art keywords
- ceph
- eme
- amino
- producing
- carboxylic acid
- Prior art date
Links
- RJFPBECTFIUTHB-BAFYGKSASA-N (6r)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical class S1CC=C(C(O)=O)N2C(=O)C(N)[C@H]21 RJFPBECTFIUTHB-BAFYGKSASA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
- C07D205/09—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4
- C07D205/095—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4 and with a nitrogen atom directly attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2388774 | 1974-06-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU172891B true HU172891B (hu) | 1978-12-28 |
Family
ID=11210657
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU75SO00001150A HU172891B (hu) | 1974-06-12 | 1975-06-10 | Sposob poluchenija proizvodnykh 7-amino-cef-3-em-4-karbonovojj kisloty |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4012381A (show.php) |
| JP (1) | JPS6135199B2 (show.php) |
| AT (1) | AT341539B (show.php) |
| AU (1) | AU501660B2 (show.php) |
| BE (1) | BE830089A (show.php) |
| CA (1) | CA1057284A (show.php) |
| CH (1) | CH615189A5 (show.php) |
| DE (2) | DE2525510A1 (show.php) |
| DK (1) | DK256975A (show.php) |
| ES (1) | ES438429A1 (show.php) |
| FR (1) | FR2283140A1 (show.php) |
| GB (1) | GB1472866A (show.php) |
| HU (1) | HU172891B (show.php) |
| NL (1) | NL170416C (show.php) |
| NO (1) | NO752034L (show.php) |
| SE (1) | SE7506588L (show.php) |
| ZA (1) | ZA753723B (show.php) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5048181U (show.php) * | 1973-08-31 | 1975-05-13 | ||
| GB1472866A (en) * | 1974-06-12 | 1977-05-11 | Farmaceutici Italia | Cephalosporins and intermediates therefor |
| GB1472864A (en) * | 1975-04-05 | 1977-05-11 | Farmaceutici Italia | Method of preparing cephalosporins |
| US4218564A (en) * | 1975-06-18 | 1980-08-19 | Smithkline Corporation | 7β-Hydroxy-3-heterocyclicthio-methyl cephalosporin intermediates |
| US4112087A (en) * | 1976-11-04 | 1978-09-05 | Syntex (U.S.A.) Inc. | Cephalosporin type antibacterials having a substituted propenyl group in the 3-position |
| GB1576219A (en) | 1976-12-31 | 1980-10-01 | Connlab Holdings Ltd | Thiazoleneazetidinone derivatives |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BR6915080D0 (pt) * | 1969-06-12 | 1973-03-08 | Lilly Co Eli | Processo para a preparacao de um produto rearranjado de penicilina |
| US3905965A (en) * | 1969-10-17 | 1975-09-16 | Roussel Uclaf | Process of total synthesis of cephalosporin derivatives and intermediates |
| BE787618A (fr) * | 1971-08-17 | 1973-02-16 | Gist Brocades Nv | Procede pour preparer des composes heterocycliques |
| DE2243242A1 (de) * | 1972-09-02 | 1974-03-28 | Hoechst Ag | Verfahren zur herstellung von 7-amino3-cephem-4-carbonsaeurederivaten |
| GB1451459A (en) * | 1972-10-20 | 1976-10-06 | Fujisawa Pharamceutical Co Ltd | Process for preparing 3-alkyl-3-cephem-4-carboxylic acids and intermediates thereof |
| IT1043958B (it) | 1974-05-22 | 1980-02-29 | Farmaceutici Italia | Procedimento per la preparazione di cefalosporine |
| GB1472866A (en) | 1974-06-12 | 1977-05-11 | Farmaceutici Italia | Cephalosporins and intermediates therefor |
-
1975
- 1975-05-23 GB GB2246575A patent/GB1472866A/en not_active Expired
- 1975-06-06 NL NLAANVRAGE7506741,A patent/NL170416C/xx not_active IP Right Cessation
- 1975-06-07 DE DE19752525510 patent/DE2525510A1/de not_active Ceased
- 1975-06-07 DE DE2559976A patent/DE2559976C2/de not_active Expired - Lifetime
- 1975-06-09 DK DK256975A patent/DK256975A/da unknown
- 1975-06-09 FR FR7517880A patent/FR2283140A1/fr active Granted
- 1975-06-09 SE SE7506588A patent/SE7506588L/xx unknown
- 1975-06-09 AT AT437275A patent/AT341539B/de not_active IP Right Cessation
- 1975-06-09 NO NO752034A patent/NO752034L/no unknown
- 1975-06-10 CA CA229,024A patent/CA1057284A/en not_active Expired
- 1975-06-10 JP JP50069249A patent/JPS6135199B2/ja not_active Expired
- 1975-06-10 ZA ZA00753723A patent/ZA753723B/xx unknown
- 1975-06-10 AU AU81980/75A patent/AU501660B2/en not_active Ceased
- 1975-06-10 HU HU75SO00001150A patent/HU172891B/hu not_active IP Right Cessation
- 1975-06-11 CH CH756475A patent/CH615189A5/de not_active IP Right Cessation
- 1975-06-11 ES ES438429A patent/ES438429A1/es not_active Expired
- 1975-06-11 BE BE157204A patent/BE830089A/xx not_active IP Right Cessation
- 1975-06-12 US US05/586,376 patent/US4012381A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2283140B1 (show.php) | 1978-12-08 |
| DE2525510A1 (de) | 1976-01-02 |
| NL170416C (nl) | 1982-11-01 |
| ZA753723B (en) | 1976-05-26 |
| CH615189A5 (show.php) | 1980-01-15 |
| ES438429A1 (es) | 1977-02-16 |
| GB1472866A (en) | 1977-05-11 |
| JPS5111787A (show.php) | 1976-01-30 |
| AU8198075A (en) | 1976-12-16 |
| NO752034L (show.php) | 1975-12-15 |
| BE830089A (fr) | 1975-12-11 |
| JPS6135199B2 (show.php) | 1986-08-12 |
| DE2559976C2 (show.php) | 1991-12-19 |
| FR2283140A1 (fr) | 1976-03-26 |
| NL7506741A (nl) | 1975-12-16 |
| CA1057284A (en) | 1979-06-26 |
| US4012381A (en) | 1977-03-15 |
| AT341539B (de) | 1978-02-10 |
| ATA437275A (de) | 1977-06-15 |
| SE7506588L (sv) | 1975-12-15 |
| NL170416B (nl) | 1982-06-01 |
| DK256975A (da) | 1975-12-13 |
| AU501660B2 (en) | 1979-06-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU174973B (hu) | Sposob poluchenija proizvodnykh 16-alkil-16-gidroksi-prostanovykh kislot | |
| HU174077B (hu) | Sposob poluchenija proizvodnykh dekapeptidamidakh | |
| HU173052B (hu) | Sposob poluchenija proizvodnykh tienil-karbamida | |
| HU172448B (hu) | Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kisloty | |
| HU174153B (hu) | Sposob poluchenija proizvodnykh 2,4,6-triiodo-bis-2,4,6-triiodo-3,5-bis-skobka-karbamoil-skobka zakryta-fenil-karbamoil-metil-amino-acetamido-5-benzojjnojj kisloty | |
| HU172039B (hu) | Sposob poluchenija proizvodnykh 2-fenil-indola | |
| HU174378B (hu) | Sposob poluchenija proizvodnykh 7-beta-acilamino-7-al'fa-alkoksi-cefem-4-karbonovojj kisloty ili 6-beta-acilamino-6-al'fa-alkoksi-penam-3-karbonovojj kisloty | |
| HU170897B (hu) | Sposob poluchenija proizvodnykh 7-skobka-n-acilamino-al'fa-aril acetamido-3-cefem-4-karbonovyki kislot | |
| HU172103B (hu) | Sposob poluchenija proizvodnykh 2-skobka-zamehhennykh-skobka zakryta-3-cianamino-3-skobka-zamehhennykh amino-skobka zakryta-propionitrilov | |
| HU172906B (hu) | Sposob poluchenija proizvodnykh alkil-amino-glikopiranozida | |
| YU40266B (en) | Process for producing thienothiazepine derivatives | |
| HU174005B (hu) | Sposob poluchenija proizvodnykh analogov prostaglandina | |
| HU173386B (hu) | Sposob poluchenija makromolekuljarnykh proizvodnykh 4-skobka-nikotinamid-adenin-dinukleotid-n-6 vverkh-skobka zakryta-3-gidroksimasljanojj kisloty | |
| HU171512B (hu) | Sposob polucsenija proizvodnykh nikotinamid-adenin-dinukleotidov | |
| HU173609B (hu) | Sposob poluchenija novykh proizvodnykh salicilanilida | |
| HU172045B (hu) | Sposob poluchenija proizvodnykh 7-acilamido-3-skobka-1,2-dvojjno zamehhennykh-1,3,4-triazol-5-il-tiometil-skobka zakryta-3-cefem-4-karbonovykh kislot | |
| HU170859B (hu) | Sposob poluchenija novykh proizvodnykh 6-skobka-al'fa-ureido-fenilacetilamido-skobka zakryta-penam-3-karbonovojj kisloty | |
| HU171513B (hu) | Sposob poluchenija proizvodnykh 7-beta-acilamino-7al'fa-alkok-icef-3-em-4-karbonovojj kisloty | |
| HU171207B (hu) | Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kisloty | |
| HU172891B (hu) | Sposob poluchenija proizvodnykh 7-amino-cef-3-em-4-karbonovojj kisloty | |
| YU165781A (en) | Process for producing penzopyran derivatives | |
| HU171357B (hu) | Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kisloty | |
| HU173651B (hu) | Sposob poluchenija proizvodnykh beta-amino-7-al'fa-metoksi-cef-3-em-4-karbonovojj kisloty | |
| YU37170B (en) | Process for obtaining penicillnic acid derivatives | |
| HU172892B (hu) | Sposob poluchenija proizvodnykh cef-3-em-4-karbonovojj kisloty |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |