GB949371A - Alpha substituted benzaldoximes - Google Patents
Alpha substituted benzaldoximesInfo
- Publication number
- GB949371A GB949371A GB131/60A GB13160A GB949371A GB 949371 A GB949371 A GB 949371A GB 131/60 A GB131/60 A GB 131/60A GB 13160 A GB13160 A GB 13160A GB 949371 A GB949371 A GB 949371A
- Authority
- GB
- United Kingdom
- Prior art keywords
- hydrocarbyl
- halogen
- hydrogen
- hydroxy
- reacting
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- VTWKXBJHBHYJBI-UHFFFAOYSA-N n-benzylidenehydroxylamine Chemical class ON=CC1=CC=CC=C1 VTWKXBJHBHYJBI-UHFFFAOYSA-N 0.000 title abstract 2
- 229910052736 halogen Inorganic materials 0.000 abstract 15
- 150000002367 halogens Chemical group 0.000 abstract 15
- 125000001183 hydrocarbyl group Chemical group 0.000 abstract 15
- 239000001257 hydrogen Substances 0.000 abstract 15
- 229910052739 hydrogen Inorganic materials 0.000 abstract 15
- -1 hydrocarbyloxy Chemical group 0.000 abstract 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 9
- 239000002253 acid Substances 0.000 abstract 8
- 150000007513 acids Chemical class 0.000 abstract 8
- 150000001875 compounds Chemical class 0.000 abstract 8
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 abstract 6
- 150000002148 esters Chemical class 0.000 abstract 5
- VTWKXBJHBHYJBI-SOFGYWHQSA-N (ne)-n-benzylidenehydroxylamine Chemical class O\N=C\C1=CC=CC=C1 VTWKXBJHBHYJBI-SOFGYWHQSA-N 0.000 abstract 4
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 abstract 4
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 abstract 4
- 241000196324 Embryophyta Species 0.000 abstract 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 abstract 4
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 abstract 4
- 239000011149 active material Substances 0.000 abstract 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 abstract 4
- 239000007859 condensation product Substances 0.000 abstract 4
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 abstract 4
- 238000000034 method Methods 0.000 abstract 4
- 239000000203 mixture Substances 0.000 abstract 4
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 abstract 3
- 125000000623 heterocyclic group Chemical group 0.000 abstract 3
- 150000002431 hydrogen Chemical class 0.000 abstract 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 3
- 239000007788 liquid Substances 0.000 abstract 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 abstract 3
- 239000000575 pesticide Substances 0.000 abstract 3
- 150000003839 salts Chemical class 0.000 abstract 3
- CBQDTCDOVVBGMN-UHFFFAOYSA-N 2-methyl-3-octylphenol Chemical compound CCCCCCCCC1=CC=CC(O)=C1C CBQDTCDOVVBGMN-UHFFFAOYSA-N 0.000 abstract 2
- BTXXTMOWISPQSJ-UHFFFAOYSA-N 4,4,4-trifluorobutan-2-one Chemical compound CC(=O)CC(F)(F)F BTXXTMOWISPQSJ-UHFFFAOYSA-N 0.000 abstract 2
- BQACOLQNOUYJCE-FYZZASKESA-N Abietic acid Natural products CC(C)C1=CC2=CC[C@]3(C)[C@](C)(CCC[C@@]3(C)C(=O)O)[C@H]2CC1 BQACOLQNOUYJCE-FYZZASKESA-N 0.000 abstract 2
- 240000000972 Agathis dammara Species 0.000 abstract 2
- 229910021532 Calcite Inorganic materials 0.000 abstract 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 abstract 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 abstract 2
- 239000004859 Copal Substances 0.000 abstract 2
- 229920002871 Dammar gum Polymers 0.000 abstract 2
- 108010010803 Gelatin Proteins 0.000 abstract 2
- 241000782205 Guibourtia conjugata Species 0.000 abstract 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 abstract 2
- 208000031888 Mycoses Diseases 0.000 abstract 2
- 239000004372 Polyvinyl alcohol Substances 0.000 abstract 2
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 abstract 2
- 229920001800 Shellac Polymers 0.000 abstract 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 abstract 2
- 239000005864 Sulphur Substances 0.000 abstract 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 abstract 2
- 150000001298 alcohols Chemical class 0.000 abstract 2
- 229910052783 alkali metal Inorganic materials 0.000 abstract 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 abstract 2
- 125000005210 alkyl ammonium group Chemical group 0.000 abstract 2
- 125000002947 alkylene group Chemical group 0.000 abstract 2
- 150000001491 aromatic compounds Chemical class 0.000 abstract 2
- 125000003118 aryl group Chemical group 0.000 abstract 2
- 229960000892 attapulgite Drugs 0.000 abstract 2
- 229910052791 calcium Inorganic materials 0.000 abstract 2
- 239000011575 calcium Substances 0.000 abstract 2
- 159000000007 calcium salts Chemical class 0.000 abstract 2
- 235000012241 calcium silicate Nutrition 0.000 abstract 2
- 239000004202 carbamide Substances 0.000 abstract 2
- 229910052799 carbon Inorganic materials 0.000 abstract 2
- 239000000969 carrier Substances 0.000 abstract 2
- 239000005018 casein Substances 0.000 abstract 2
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 abstract 2
- 235000021240 caseins Nutrition 0.000 abstract 2
- 229920003086 cellulose ether Polymers 0.000 abstract 2
- 229920001577 copolymer Polymers 0.000 abstract 2
- 244000038559 crop plants Species 0.000 abstract 2
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 abstract 2
- 235000014113 dietary fatty acids Nutrition 0.000 abstract 2
- 239000002270 dispersing agent Substances 0.000 abstract 2
- 239000006185 dispersion Substances 0.000 abstract 2
- 239000010459 dolomite Substances 0.000 abstract 2
- 229910000514 dolomite Inorganic materials 0.000 abstract 2
- 239000003995 emulsifying agent Substances 0.000 abstract 2
- 239000000839 emulsion Substances 0.000 abstract 2
- 150000002170 ethers Chemical class 0.000 abstract 2
- 239000000194 fatty acid Substances 0.000 abstract 2
- 229930195729 fatty acid Natural products 0.000 abstract 2
- 150000004665 fatty acids Chemical class 0.000 abstract 2
- 239000003337 fertilizer Substances 0.000 abstract 2
- 229920000159 gelatin Polymers 0.000 abstract 2
- 239000008273 gelatin Substances 0.000 abstract 2
- 235000019322 gelatine Nutrition 0.000 abstract 2
- 235000011852 gelatine desserts Nutrition 0.000 abstract 2
- 239000003292 glue Substances 0.000 abstract 2
- 239000008187 granular material Substances 0.000 abstract 2
- 239000010440 gypsum Substances 0.000 abstract 2
- 229910052602 gypsum Inorganic materials 0.000 abstract 2
- 239000004009 herbicide Substances 0.000 abstract 2
- 235000010299 hexamethylene tetramine Nutrition 0.000 abstract 2
- 239000004312 hexamethylene tetramine Substances 0.000 abstract 2
- 229930195733 hydrocarbon Natural products 0.000 abstract 2
- 150000002430 hydrocarbons Chemical class 0.000 abstract 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 abstract 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical group O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 abstract 2
- 229910052622 kaolinite Inorganic materials 0.000 abstract 2
- 150000002576 ketones Chemical class 0.000 abstract 2
- 229920005610 lignin Polymers 0.000 abstract 2
- 239000011419 magnesium lime Substances 0.000 abstract 2
- 229960004011 methenamine Drugs 0.000 abstract 2
- 239000010445 mica Substances 0.000 abstract 2
- 229910052618 mica group Inorganic materials 0.000 abstract 2
- 125000005608 naphthenic acid group Chemical group 0.000 abstract 2
- 239000003921 oil Substances 0.000 abstract 2
- 229910052625 palygorskite Chemical group 0.000 abstract 2
- 239000008188 pellet Substances 0.000 abstract 2
- 239000003208 petroleum Substances 0.000 abstract 2
- 229920000233 poly(alkylene oxides) Polymers 0.000 abstract 2
- 229920001521 polyalkylene glycol ether Polymers 0.000 abstract 2
- 229920000642 polymer Polymers 0.000 abstract 2
- 229920002451 polyvinyl alcohol Polymers 0.000 abstract 2
- 229920000915 polyvinyl chloride Polymers 0.000 abstract 2
- 239000004800 polyvinyl chloride Substances 0.000 abstract 2
- 229910052903 pyrophyllite Inorganic materials 0.000 abstract 2
- 239000011347 resin Substances 0.000 abstract 2
- 229920005989 resin Polymers 0.000 abstract 2
- 239000004208 shellac Substances 0.000 abstract 2
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 abstract 2
- 229940113147 shellac Drugs 0.000 abstract 2
- 235000013874 shellac Nutrition 0.000 abstract 2
- 235000012239 silicon dioxide Nutrition 0.000 abstract 2
- 229910052708 sodium Inorganic materials 0.000 abstract 2
- 239000011734 sodium Substances 0.000 abstract 2
- 235000019830 sodium polyphosphate Nutrition 0.000 abstract 2
- 239000003381 stabilizer Substances 0.000 abstract 2
- 150000005846 sugar alcohols Polymers 0.000 abstract 2
- 239000000454 talc Substances 0.000 abstract 2
- 229910052623 talc Inorganic materials 0.000 abstract 2
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 abstract 2
- 229910052902 vermiculite Inorganic materials 0.000 abstract 2
- 239000010455 vermiculite Substances 0.000 abstract 2
- 235000019354 vermiculite Nutrition 0.000 abstract 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract 2
- 239000001993 wax Substances 0.000 abstract 2
- 239000000080 wetting agent Substances 0.000 abstract 2
- QQPXXHAEIGVZKQ-UHFFFAOYSA-N 1,3-dichloro-2-(dichloromethyl)benzene Chemical compound ClC(Cl)C1=C(Cl)C=CC=C1Cl QQPXXHAEIGVZKQ-UHFFFAOYSA-N 0.000 abstract 1
- XACGZMBUDCYGPB-UHFFFAOYSA-N 2,6-dichlorobenzonitrile oxide Chemical compound [O-][N+]#CC1=C(Cl)C=CC=C1Cl XACGZMBUDCYGPB-UHFFFAOYSA-N 0.000 abstract 1
- ODGRDDQOHGVCHQ-UHFFFAOYSA-N 2-chloro-6-methylbenzamide Chemical compound CC1=CC=CC(Cl)=C1C(N)=O ODGRDDQOHGVCHQ-UHFFFAOYSA-N 0.000 abstract 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 abstract 1
- 235000007319 Avena orientalis Nutrition 0.000 abstract 1
- 244000075850 Avena orientalis Species 0.000 abstract 1
- 244000056139 Brassica cretica Species 0.000 abstract 1
- 235000003351 Brassica cretica Nutrition 0.000 abstract 1
- 235000003343 Brassica rupestris Nutrition 0.000 abstract 1
- 241000233866 Fungi Species 0.000 abstract 1
- 241000237858 Gastropoda Species 0.000 abstract 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 abstract 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 abstract 1
- 244000046052 Phaseolus vulgaris Species 0.000 abstract 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 abstract 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 abstract 1
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 239000003513 alkali Substances 0.000 abstract 1
- 150000001342 alkaline earth metals Chemical class 0.000 abstract 1
- 150000004703 alkoxides Chemical class 0.000 abstract 1
- QUNPTMGXSSDZHZ-UHFFFAOYSA-N benzonitrile oxide Chemical compound O=N#CC1=CC=CC=C1 QUNPTMGXSSDZHZ-UHFFFAOYSA-N 0.000 abstract 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 abstract 1
- 239000006227 byproduct Substances 0.000 abstract 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 abstract 1
- 230000001276 controlling effect Effects 0.000 abstract 1
- 230000000249 desinfective effect Effects 0.000 abstract 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical group O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 abstract 1
- 230000000855 fungicidal effect Effects 0.000 abstract 1
- 230000002363 herbicidal effect Effects 0.000 abstract 1
- 229910052901 montmorillonite Inorganic materials 0.000 abstract 1
- 235000010460 mustard Nutrition 0.000 abstract 1
- 150000002823 nitrates Chemical class 0.000 abstract 1
- 230000000802 nitrating effect Effects 0.000 abstract 1
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 abstract 1
- 239000002689 soil Substances 0.000 abstract 1
- 239000007787 solid Substances 0.000 abstract 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 abstract 1
- 239000004094 surface-active agent Substances 0.000 abstract 1
- 150000003567 thiocyanates Chemical class 0.000 abstract 1
- HFFLGKNGCAIQMO-UHFFFAOYSA-N trichloroacetaldehyde Chemical compound ClC(Cl)(Cl)C=O HFFLGKNGCAIQMO-UHFFFAOYSA-N 0.000 abstract 1
- ZBZJXHCVGLJWFG-UHFFFAOYSA-N trichloromethyl(.) Chemical compound Cl[C](Cl)Cl ZBZJXHCVGLJWFG-UHFFFAOYSA-N 0.000 abstract 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical class OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 abstract 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical compound CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/48—Y being a hydrogen or a carbon atom
- C07C275/56—X being a nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT643195D IT643195A (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | 1960-01-01 | ||
| NL259617D NL259617A (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | 1960-01-01 | ||
| NL111264D NL111264C (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | 1960-01-01 | ||
| BE598730D BE598730A (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | 1960-01-01 | ||
| GB131/60A GB949371A (en) | 1960-01-01 | 1960-01-01 | Alpha substituted benzaldoximes |
| FR848469A FR1280847A (fr) | 1960-01-01 | 1960-12-30 | Procédé de préparation de benzaldoximes possédant d'excellentes propriétés pesticides et benzaldoximes obtenues par ce procédé |
| DES71895A DE1300728B (de) | 1960-01-01 | 1960-12-30 | Totales Voraulfaufherbizid |
| CH1459860A CH423350A (de) | 1960-01-01 | 1960-12-30 | Pestizides Mittel |
| DK661AA DK121023B (da) | 1960-01-01 | 1961-01-02 | α-Substituerede benzaldoximderivater og salte deraf med herbicid, fungicid og snegledræbende virkning. |
| US152923A US3234255A (en) | 1960-01-01 | 1961-11-16 | Alpha-substituted benzaldoximes |
| MY1964128A MY6400128A (en) | 1960-01-01 | 1964-12-31 | Alpha substituted benzaldoximes |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB131/60A GB949371A (en) | 1960-01-01 | 1960-01-01 | Alpha substituted benzaldoximes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB949371A true GB949371A (en) | 1964-02-12 |
Family
ID=9698964
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB131/60A Expired GB949371A (en) | 1960-01-01 | 1960-01-01 | Alpha substituted benzaldoximes |
Country Status (10)
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4887027A (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) * | 1972-02-26 | 1973-11-16 | ||
| US4018645A (en) | 1972-03-16 | 1977-04-19 | Somar Manufacturing Co., Ltd. | Method of controlling slime during paper manufacture using alpha-chloro-acylbenzaldoxime derivatives |
| JP3086062B2 (ja) | 1992-05-28 | 2000-09-11 | 株式会社片山化学工業研究所 | 海生付着生物の付着防止剤 |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3310566A (en) * | 1963-11-18 | 1967-03-21 | American Home Prod | Substituted 4-piperidino-butyrophenone oximes |
| US3394181A (en) * | 1964-06-29 | 1968-07-23 | Sterling Drug Inc | Phenoxy-lower-alkyl-amidoximes and phenylamino-lower-alkyl-amidoximes |
| US3448199A (en) * | 1966-01-20 | 1969-06-03 | American Cyanamid Co | Phthalaldehyde dioximes as microbiocides |
| US3408176A (en) * | 1966-06-27 | 1968-10-29 | Gulf Research Development Co | Chemical control of pigweed |
| US3493614A (en) * | 1966-10-17 | 1970-02-03 | Geigy Chem Corp | O-acrylyl- and o-methacrylyl amidoximes |
| US3483246A (en) * | 1966-12-05 | 1969-12-09 | Mobil Oil Corp | Aromatic glyoxynitrile oximino carbanates |
| US3655751A (en) * | 1968-01-03 | 1972-04-11 | Velsicol Chemical Corp | N o-dicarbamoyl-n-phenylhydroxyl-amines |
| US3687998A (en) * | 1968-12-16 | 1972-08-29 | Robert D Trepka | Aliphatic sulfonoxyphenylureas |
| US3495968A (en) * | 1969-04-17 | 1970-02-17 | Mobil Oil Corp | Herbicidal composition and method of use |
| US3694482A (en) * | 1970-04-15 | 1972-09-26 | Exxon Research Engineering Co | Malononitrile oxime derivatives |
| US3852339A (en) * | 1970-06-15 | 1974-12-03 | Squibb & Sons Inc | Aminoalkoxyphenylurea derivatives |
| GB1516404A (en) * | 1975-04-22 | 1978-07-05 | Fujisawa Pharmaceutical Co | Carbonic acid esters and the preparation thereof |
| US4014915A (en) * | 1975-04-22 | 1977-03-29 | Fujisawa Pharmaceutical Co., Ltd. | Oxime carbonates |
| CH624552A5 (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) * | 1975-09-04 | 1981-08-14 | Ciba Geigy Ag | |
| GB1538097A (en) * | 1976-01-26 | 1979-01-10 | Lafon Labor | Substituted phenyl-amidines |
| US4123255A (en) * | 1977-01-03 | 1978-10-31 | Chevron Research Company | O-sulfonyl-alpha-cyano 2,6-dihalobenzaldoximes |
| US4125397A (en) * | 1977-01-03 | 1978-11-14 | Chevron Research Company | O-Sulfonyl-alpha-halo-2,6-dihalobenzaldoximes |
| IT1110460B (it) * | 1977-03-02 | 1985-12-23 | Ciba Geigy Ag | Prodotti che favoriscono la crescita delle piante e prodotti che proteggono le piante a base di eteri di ossime e di esteri di ossime loro preparazione e loro impiego |
| CH632130A5 (en) * | 1977-03-02 | 1982-09-30 | Ciba Geigy Ag | Compositions on the basis of oxime ethers, oxime esters or oxime carbamates which are suitable in agriculture for crop protection |
| US4416686A (en) * | 1978-08-31 | 1983-11-22 | Ciba-Geigy Corporation | 3,4-Dichlorophenylacetonitrile-N-tert.butylcarbamoyloxy ether for the protection of crops against injury by herbicides |
| US4294772A (en) * | 1978-08-31 | 1981-10-13 | Ciba-Geigy Corporation | Oxime derivatives for protecting plant crops |
| US4347372A (en) * | 1978-09-01 | 1982-08-31 | Ciba-Geigy Corporation | Benzoxazolyl-glyoxylonitrile-2-oxime ether derivatives |
| IT1101444B (it) * | 1978-11-29 | 1985-09-28 | Montedison Spa | Arilidrazo-aldossime e derivati ad attivita' fungicida |
| US4270947A (en) * | 1979-07-02 | 1981-06-02 | Stauffer Chemical Company | α-(Phenylazo)-2,6-dichlorobenzaldimino esters and their use as herbicides |
| US4490167A (en) * | 1979-08-06 | 1984-12-25 | Ciba-Geigy Corporation | Oxime derivatives of diphenyl ethers and their use in herbicidal compositions |
| PH17601A (en) * | 1981-08-10 | 1984-10-05 | Sumitomo Chemical Co | Trifluoromethanessulfonanilides,and their use |
| US4564386A (en) * | 1982-08-03 | 1986-01-14 | Sumitomo Chemical Company, Limited | Trifluoromethanesulfonanilides, and their production and use |
| DE3520618A1 (de) * | 1985-06-08 | 1986-12-11 | Bayer Ag, 5090 Leverkusen | Fungizide mittel auf benzaldoxim-derivat-basis |
| DE3520943A1 (de) * | 1985-06-12 | 1986-12-18 | Bayer Ag, 5090 Leverkusen | Benzaldoxim-carbamat-derivate |
| DE3608382A1 (de) * | 1986-03-13 | 1987-09-17 | Bayer Ag | Phenylsulfonyl-pyridinaldoxime |
| DE3608383A1 (de) * | 1986-03-13 | 1987-09-17 | Bayer Ag | Arylsulfonyl-pyridinaldoxim-derivate |
| DE3707687A1 (de) * | 1987-03-11 | 1988-09-22 | Bayer Ag | Benzaldoxim-carbamat-derivate |
| DE3708320A1 (de) * | 1987-03-14 | 1988-09-22 | Bayer Ag | Benzaldoxim-derivate |
| DE3712632A1 (de) * | 1987-04-14 | 1988-10-27 | Bayer Ag | (alpha)-methylsulfonyl-benzaldoxim-carbamate |
| DE3712631A1 (de) * | 1987-04-14 | 1988-10-27 | Bayer Ag | (alpha)-methylsulfonyl-benzaldoxim-derivate |
| EP0941988A3 (de) * | 1998-03-10 | 2000-09-20 | Basf Aktiengesellschaft | Neue Benzamidoxim-Derivate, Zwischenprodukte und Verfahren zu deren Herstellung und deren Verwendung als Fungizide |
| US7781412B2 (en) * | 2006-02-24 | 2010-08-24 | Boise State University | Biphenyl inhibitors of carbonyl reductase |
| US7727967B2 (en) * | 2006-02-24 | 2010-06-01 | Boise State University | Cyanooxime inhibitors of carbonyl reductase and methods of using said inhibitors in treatments involving anthracyclines |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1996007A (en) * | 1933-07-27 | 1935-03-26 | Du Pont | Preparation of-2-chloro-6-nitro-benzaldoxime |
| US2201156A (en) * | 1939-04-22 | 1940-05-21 | Dow Chemical Co | Ethers |
| US2435274A (en) * | 1943-06-24 | 1948-02-03 | Rohm & Haas | Control of insects |
| US2486090A (en) * | 1946-09-20 | 1949-10-25 | American Cyanamid Co | Preparation of organic thiocyanates |
| US2668115A (en) * | 1952-08-05 | 1954-02-02 | Dow Chemical Co | Method of controlling stem-end decay and mold on citrus fruits |
| DE1163600B (de) * | 1958-11-28 | 1964-02-20 | Diamond Alkali Co | Fungizides und nematozides Pflanzenschutzmittel |
-
0
- NL NL259617D patent/NL259617A/xx unknown
- IT IT643195D patent/IT643195A/it unknown
- BE BE598730D patent/BE598730A/xx unknown
- NL NL111264D patent/NL111264C/xx active
-
1960
- 1960-01-01 GB GB131/60A patent/GB949371A/en not_active Expired
- 1960-12-30 DE DES71895A patent/DE1300728B/de active Pending
- 1960-12-30 CH CH1459860A patent/CH423350A/de unknown
- 1960-12-30 FR FR848469A patent/FR1280847A/fr not_active Expired
-
1961
- 1961-01-02 DK DK661AA patent/DK121023B/da unknown
- 1961-11-16 US US152923A patent/US3234255A/en not_active Expired - Lifetime
-
1964
- 1964-12-31 MY MY1964128A patent/MY6400128A/xx unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4887027A (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) * | 1972-02-26 | 1973-11-16 | ||
| US4018645A (en) | 1972-03-16 | 1977-04-19 | Somar Manufacturing Co., Ltd. | Method of controlling slime during paper manufacture using alpha-chloro-acylbenzaldoxime derivatives |
| JP3086062B2 (ja) | 1992-05-28 | 2000-09-11 | 株式会社片山化学工業研究所 | 海生付着生物の付着防止剤 |
Also Published As
| Publication number | Publication date |
|---|---|
| CH423350A (de) | 1966-10-31 |
| US3234255A (en) | 1966-02-08 |
| NL111264C (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | |
| DK121023B (da) | 1971-08-23 |
| DE1300728B (de) | 1969-08-07 |
| MY6400128A (en) | 1964-12-31 |
| BE598730A (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | |
| IT643195A (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | |
| NL259617A (c_deeref_Disk_and_Scratch_Disk_Pools_and_Their_Defaults.html) | |
| FR1280847A (fr) | 1962-01-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB949371A (en) | Alpha substituted benzaldoximes | |
| US3823161A (en) | Aminothiophene derivatives | |
| US2723192A (en) | Herbicidal process and product | |
| US3248400A (en) | Fungicidal agents containing dithiocarbamate and thiuram disulfide radicals | |
| US3284289A (en) | Method for protecting plants from fungi | |
| US2453983A (en) | Prevention and destruction of weeds | |
| US3268584A (en) | Herbicidal alpha-haloacetanilides | |
| US3694482A (en) | Malononitrile oxime derivatives | |
| US3285730A (en) | Method for controlling plant growth | |
| US3187041A (en) | N-alkoxy phenylacetamides | |
| US3472920A (en) | O-methyl - n - isopropylamido-o-(2-nitrophenyl)-thionophosphoric acid ester | |
| US3232736A (en) | Herbicidal use of n-benzoylanthranilic acid and 6-oxo-2-phenyl-4, 5-benzo-1,3-oxazine | |
| US3276855A (en) | N-alkylmercapto-ureas and a method for controlling weeds | |
| PT84854B (pt) | Processo para a preparacao de derivados da benzotiazinona | |
| US3453311A (en) | Aryl n-(aryl)-alkanoimidates | |
| US2498302A (en) | Prevention and destruction of weeds | |
| US3906062A (en) | Alpha,alpha-diphosphonato acetanilides | |
| US3728386A (en) | N-cycloalkylalkyl and n-cycloalkyl substituted phenyl ureas and halo acetamides | |
| US3856860A (en) | N-cyclopropylmethyl halo-acetamides | |
| US3031292A (en) | Method for the control of weeds | |
| US3089765A (en) | Herbicidal method | |
| US3555157A (en) | Methods of protecting plants from fungi | |
| US3231360A (en) | Herbicidal method | |
| US3781357A (en) | Alkylphenyl-and chlorophenoxy-phenyl-formamidines | |
| US3487156A (en) | Combating insects,their eggs,or acarids on plants |