GB2090244B - B-(o-trifluoromethylanilino) propanoic acid - Google Patents
B-(o-trifluoromethylanilino) propanoic acidInfo
- Publication number
- GB2090244B GB2090244B GB8114390A GB8114390A GB2090244B GB 2090244 B GB2090244 B GB 2090244B GB 8114390 A GB8114390 A GB 8114390A GB 8114390 A GB8114390 A GB 8114390A GB 2090244 B GB2090244 B GB 2090244B
- Authority
- GB
- United Kingdom
- Prior art keywords
- trifluoromethylanilino
- propanoic acid
- propanoic
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 title 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 title 1
- 235000019260 propionic acid Nutrition 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Quinoline Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7730249A FR2421885A1 (fr) | 1977-10-07 | 1977-10-07 | Nouveau procede de preparation de 4-chloroquinoleines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| GB2090244A GB2090244A (en) | 1982-07-07 |
| GB2090244B true GB2090244B (en) | 1982-11-24 |
Family
ID=9196246
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB8114390A Expired GB2090244B (en) | 1977-10-07 | 1978-10-06 | B-(o-trifluoromethylanilino) propanoic acid |
| GB7839598A Expired GB2006764B (en) | 1977-10-07 | 1978-10-06 | Process for the preparation of 4-chloroquinolines |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB7839598A Expired GB2006764B (en) | 1977-10-07 | 1978-10-06 | Process for the preparation of 4-chloroquinolines |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4277607A (enExample) |
| JP (1) | JPS5461184A (enExample) |
| BE (1) | BE871068A (enExample) |
| CA (1) | CA1097348A (enExample) |
| CH (1) | CH633778A5 (enExample) |
| DE (1) | DE2843781A1 (enExample) |
| FR (1) | FR2421885A1 (enExample) |
| GB (2) | GB2090244B (enExample) |
| IT (1) | IT1109205B (enExample) |
| NL (1) | NL7810098A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1117604B (it) * | 1979-02-12 | 1986-02-17 | Alisyncro S A S Di Bruno E C | Impianto per la distribuzione di prodotti alimentari particolarmente dolciari |
| HU191508B (en) * | 1982-12-02 | 1987-02-27 | Alkaloida Vegyeszeti Gyar,Hu | Process for preparing new chloromethyl-quinoline derivatives |
| HU188235B (en) * | 1982-12-11 | 1986-03-28 | Alkaloida Vegyeszeti Gyar,Hu | Process for producing fluoro-methyl-quinoline derivatives |
| JP7269584B2 (ja) * | 2019-04-08 | 2023-05-09 | 国立大学法人千葉大学 | キノリン化合物の製造方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2451610A (en) * | 1944-08-09 | 1948-10-19 | Du Pont | Preparation of 4-alkyl-quinolines |
| US2478125A (en) * | 1944-10-09 | 1949-08-02 | American Cyanamid Co | Preparation of 4-hydroxyquinolines |
| US2785165A (en) * | 1953-12-22 | 1957-03-12 | Abbott Lab | Preparation of 4-aminoquinoline |
| FR1514280A (fr) * | 1967-01-10 | 1968-02-23 | Roussel Uclaf | Nouveau procédé de préparation de quinoléines substituées et produits ainsi obtenus |
| FR6935M (enExample) * | 1967-12-29 | 1969-05-05 |
-
1977
- 1977-10-07 FR FR7730249A patent/FR2421885A1/fr active Granted
-
1978
- 1978-09-15 US US05/942,652 patent/US4277607A/en not_active Expired - Lifetime
- 1978-10-06 DE DE19782843781 patent/DE2843781A1/de active Granted
- 1978-10-06 GB GB8114390A patent/GB2090244B/en not_active Expired
- 1978-10-06 JP JP12277378A patent/JPS5461184A/ja active Granted
- 1978-10-06 CH CH1041978A patent/CH633778A5/fr not_active IP Right Cessation
- 1978-10-06 BE BE190956A patent/BE871068A/xx not_active IP Right Cessation
- 1978-10-06 GB GB7839598A patent/GB2006764B/en not_active Expired
- 1978-10-06 NL NL7810098A patent/NL7810098A/xx not_active Application Discontinuation
- 1978-10-06 CA CA312,826A patent/CA1097348A/fr not_active Expired
- 1978-10-06 IT IT51411/78A patent/IT1109205B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| IT7851411A0 (it) | 1978-10-06 |
| JPH0137392B2 (enExample) | 1989-08-07 |
| BE871068A (fr) | 1979-04-06 |
| GB2006764A (en) | 1979-05-10 |
| FR2421885A1 (fr) | 1979-11-02 |
| DE2843781C2 (enExample) | 1988-09-29 |
| GB2090244A (en) | 1982-07-07 |
| CH633778A5 (fr) | 1982-12-31 |
| IT1109205B (it) | 1985-12-16 |
| FR2421885B1 (enExample) | 1980-10-03 |
| NL7810098A (nl) | 1979-04-10 |
| CA1097348A (fr) | 1981-03-10 |
| JPS5461184A (en) | 1979-05-17 |
| GB2006764B (en) | 1982-07-21 |
| DE2843781A1 (de) | 1979-04-12 |
| US4277607A (en) | 1981-07-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5481267A (en) | Interphenylenee99thiaa111oxoo122azaprostanic acid | |
| PH15435A (en) | Phthalazin-4-ylacetic acid derivatives | |
| JPS53141286A (en) | Novel substituted quinolinecarboxylic acid | |
| PH18510A (en) | Pyridyloxy-phenoxyalkanecarboxylic acid derivatives | |
| JPS5387346A (en) | Labelled bile acid | |
| GB2002762B (en) | Cycloalkylidenemethylphenylacetic acid derivatives | |
| GB2005264B (en) | Haloaminoalkanoic acid derivatives | |
| JPS549297A (en) | Novel amidinopenicillanic acid derivative | |
| GB1557553A (en) | Oxazolinoazetidinylbutyric acid derivatives | |
| IE781469L (en) | Alpha-substituted-thien-3-ylacetic acid | |
| GB2004469B (en) | Sulphuric acid concentration | |
| GB2075968B (en) | Benzylsulphonic acid derivatives | |
| JPS5484544A (en) | Alphaahalomethyl amino acid | |
| GB2090244B (en) | B-(o-trifluoromethylanilino) propanoic acid | |
| ZA78820B (en) | Novel benzoheterocyclylglyoxylic acid derivatives | |
| EG13319A (en) | Trace acid removal | |
| GB2004853B (en) | Concentrating suphuric acid | |
| JPS5470237A (en) | Arylthiocarboxylic acid thiocyanomethyl ester | |
| JPS5484817A (en) | Alloy for removing acid | |
| JPS5444661A (en) | Oxanilic acid derivative | |
| NZ187541A (en) | 2-acetylene-2-amino-3-phenylpropionic acid derivatives | |
| GB1555849A (en) | Carboxyphenlactic acid dervitives | |
| AU4248378A (en) | Phosphonic acid derivatives | |
| PH14928A (en) | 2-methyl-2-phenoxy-propionic acid derivatives | |
| GB1554118A (en) | 2-oxo-3-phenylbutanoic acid derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PCNP | Patent ceased through non-payment of renewal fee |
Effective date: 19921006 |