GB2015995B - Herbicidal 4 - (2 - pyridyloxy) phenoxy valeric acid derivatives - Google Patents
Herbicidal 4 - (2 - pyridyloxy) phenoxy valeric acid derivativesInfo
- Publication number
- GB2015995B GB2015995B GB7908089A GB7908089A GB2015995B GB 2015995 B GB2015995 B GB 2015995B GB 7908089 A GB7908089 A GB 7908089A GB 7908089 A GB7908089 A GB 7908089A GB 2015995 B GB2015995 B GB 2015995B
- Authority
- GB
- United Kingdom
- Prior art keywords
- pyridyloxy
- herbicidal
- acid derivatives
- valeric acid
- phenoxy valeric
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- KWMHEUALYANCIG-UHFFFAOYSA-N 2-(4-pyridin-2-yloxyphenoxy)pentanoic acid Chemical class N1=C(C=CC=C1)OC1=CC=C(OC(C(=O)O)CCC)C=C1 KWMHEUALYANCIG-UHFFFAOYSA-N 0.000 title 1
- 230000002363 herbicidal effect Effects 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
- C07D213/643—2-Phenoxypyridines; Derivatives thereof
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/10—Carbamic acid derivatives, i.e. containing the group —O—CO—N<; Thio analogues thereof
- A01N47/12—Carbamic acid derivatives, i.e. containing the group —O—CO—N<; Thio analogues thereof containing a —O—CO—N< group, or a thio analogue thereof, neither directly attached to a ring nor the nitrogen atom being a member of a heterocyclic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2724478A JPS54119476A (en) | 1978-03-10 | 1978-03-10 | 4-(5-fluoromethyl-2-pyridyloxy)phenoxyalkanecarbocyic acid derivatives and their preparation |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| GB2015995A GB2015995A (en) | 1979-09-19 |
| GB2015995B true GB2015995B (en) | 1982-05-12 |
Family
ID=12215659
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB7908089A Expired GB2015995B (en) | 1978-03-10 | 1979-03-07 | Herbicidal 4 - (2 - pyridyloxy) phenoxy valeric acid derivatives |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS54119476A (esLanguage) |
| AU (1) | AU518848B2 (esLanguage) |
| BG (1) | BG30762A3 (esLanguage) |
| BR (1) | BR7901421A (esLanguage) |
| CH (1) | CH637640A5 (esLanguage) |
| DD (1) | DD142418A5 (esLanguage) |
| DE (1) | DE2908937A1 (esLanguage) |
| DK (1) | DK94979A (esLanguage) |
| EG (1) | EG13896A (esLanguage) |
| ES (1) | ES478499A1 (esLanguage) |
| FR (1) | FR2419285A1 (esLanguage) |
| GB (1) | GB2015995B (esLanguage) |
| IT (1) | IT1162481B (esLanguage) |
| NL (1) | NL7901876A (esLanguage) |
| PL (1) | PL114468B1 (esLanguage) |
| TR (1) | TR20591A (esLanguage) |
| ZA (1) | ZA79934B (esLanguage) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1247625A (en) * | 1977-07-22 | 1988-12-28 | Howard Johnston | Trifluoromethyl pyridinyloxyphenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| EP0001473B1 (en) * | 1977-08-12 | 1988-07-27 | Imperial Chemical Industries Plc | Herbicidal halogenomethyl--pyridyloxy-phenoxy-alkanecarboxylic acids and derivatives, and processes of controlling unwanted plants therewith |
| ZA784334B (en) * | 1977-08-12 | 1979-07-25 | Ici Ltd | Herbicidal pyridine compounds |
| JPS5832890A (ja) * | 1981-08-21 | 1983-02-25 | Sumitomo Chem Co Ltd | ホスホン酸エステル誘導体、その製造方法およびそれを有効成分とする除草剤 |
| ZA828142B (en) * | 1981-11-16 | 1984-06-27 | Dow Chemical Co | Inhibiting the antagonism between pyridyloxy-phenoxyalkanoate herbicides and benzothiadiazinone herbicides in post-emergent applications |
| US4505743A (en) * | 1981-12-31 | 1985-03-19 | Ciba-Geigy Corporation | α-[4-(3-Fluoro-5'-halopyridyl-2'-oxy)-phenoxy]-propionic acid derivatives having herbicidal activity |
| USRE33478E (en) * | 1982-06-18 | 1990-12-11 | The Dow Chemical Company | Pyridyl(oxy/thio)phenoxy compounds herbicidal compositions and methods |
| US4565568A (en) * | 1982-06-18 | 1986-01-21 | The Dow Chemical Company | Pyridyl(oxy/thio)phenoxy compounds, herbicidal compositions and methods |
| IL68822A (en) * | 1982-06-18 | 1990-07-12 | Dow Chemical Co | Pyridyl(oxy/thio)phenoxy compounds,herbicidal compositions and methods of using them |
| US4625035A (en) * | 1982-07-23 | 1986-11-25 | The Dow Chemical Company | 2,3-difluoro-5-(trifluoromethyl)pyridine |
| US4480102A (en) * | 1982-07-23 | 1984-10-30 | The Dow Chemical Company | 2,3-Difluoro-5-(trifluoromethyl)pyridine and methods of making and using the same |
| DE3678485D1 (de) * | 1985-04-01 | 1991-05-08 | Ciba Geigy Ag | 3-fluorpyridyl-2-oxy-phenoxy-derivate mit herbizider wirkung. |
| JPS62267274A (ja) * | 1986-05-16 | 1987-11-19 | Aguro Kanesho Kk | 1,2,4−オキサジアゾ−ル誘導体 |
| JPS62267275A (ja) * | 1986-05-16 | 1987-11-19 | Aguro Kanesho Kk | プロピオン酸チオ−ルエステル誘導体 |
| JPS62273954A (ja) * | 1986-05-21 | 1987-11-28 | Aguro Kanesho Kk | ヒドロキシ酢酸アミド誘導体 |
| BR8801855A (pt) * | 1987-04-20 | 1988-11-22 | Agro Kanesho Co Ltd | Composicao herbicida compreendendo como ingrediente ativo um derivado de ester de acido fenoxipropionico e processo para a producao de derivados de ester de acido fenoxipropionico |
| US5205855A (en) * | 1987-08-11 | 1993-04-27 | Suntory Limited | Herbicidally active phenoxyalkanecarboxylic acid derivatives |
| JPH0455813U (esLanguage) * | 1990-09-18 | 1992-05-13 | ||
| US20150203756A1 (en) * | 2012-07-06 | 2015-07-23 | Merck Patent Gmbh | Bimesogenic compounds and mesogenic media |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CS185694B2 (en) * | 1974-07-17 | 1978-10-31 | Ishihara Sangyo Kaisha | Herbicidal agent |
| DK154074C (da) * | 1974-10-17 | 1989-02-27 | Ishihara Sangyo Kaisha | Alfa-(4-(5 eller 3,5 substitueret pyridyl-2-oxy)-phenoxy)-alkan-carboxylsyrer eller derivater deraf til anvendelse som herbicider, herbicidt middel samt fremgangsmaader til bekaempelse af ukrudt |
| JPS52131540A (en) * | 1976-04-14 | 1977-11-04 | Ishihara Sangyo Kaisha Ltd | Phenoxyvaleric acid derivatives and herbicides therefrom |
| TR19824A (tr) * | 1977-07-21 | 1980-01-24 | Ishihara Sangyo Kaisha | Trilorometilpiridoksifenoksipropionik as tuerevleri ve bunlari ihtiva eden herbisidler |
| CA1247625A (en) * | 1977-07-22 | 1988-12-28 | Howard Johnston | Trifluoromethyl pyridinyloxyphenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| EP0001473B1 (en) * | 1977-08-12 | 1988-07-27 | Imperial Chemical Industries Plc | Herbicidal halogenomethyl--pyridyloxy-phenoxy-alkanecarboxylic acids and derivatives, and processes of controlling unwanted plants therewith |
| GB2002368A (en) * | 1977-08-12 | 1979-02-21 | Ici Ltd | Herbicidal 2-(4-Alkoxyphenyloxy) pyridine compounds |
| JPS5492970A (en) * | 1977-12-29 | 1979-07-23 | Ciba Geigy Ag | Pyridyloxyyphenoxyypropionic acid derivative* its manufacture and herbicide or plant growth regulating composition |
-
1978
- 1978-03-10 JP JP2724478A patent/JPS54119476A/ja active Granted
-
1979
- 1979-02-27 AU AU44629/79A patent/AU518848B2/en not_active Expired
- 1979-02-27 ZA ZA79934A patent/ZA79934B/xx unknown
- 1979-03-07 DE DE19792908937 patent/DE2908937A1/de not_active Ceased
- 1979-03-07 EG EG145/79A patent/EG13896A/xx active
- 1979-03-07 DK DK94979A patent/DK94979A/da not_active Application Discontinuation
- 1979-03-07 BG BG042777A patent/BG30762A3/xx unknown
- 1979-03-07 GB GB7908089A patent/GB2015995B/en not_active Expired
- 1979-03-08 NL NL7901876A patent/NL7901876A/xx not_active Application Discontinuation
- 1979-03-08 IT IT48265/79A patent/IT1162481B/it active
- 1979-03-09 CH CH227479A patent/CH637640A5/fr not_active IP Right Cessation
- 1979-03-09 FR FR7906161A patent/FR2419285A1/fr active Granted
- 1979-03-09 ES ES478499A patent/ES478499A1/es not_active Expired
- 1979-03-09 BR BR7901421A patent/BR7901421A/pt unknown
- 1979-03-09 TR TR20591A patent/TR20591A/xx unknown
- 1979-03-10 PL PL1979214045A patent/PL114468B1/pl unknown
- 1979-03-12 DD DD79211536A patent/DD142418A5/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6341905B2 (esLanguage) | 1988-08-19 |
| IT7948265A0 (it) | 1979-03-08 |
| BR7901421A (pt) | 1979-10-09 |
| FR2419285B1 (esLanguage) | 1983-12-09 |
| ZA79934B (en) | 1980-03-26 |
| CH637640A5 (fr) | 1983-08-15 |
| TR20591A (tr) | 1982-02-19 |
| IT1162481B (it) | 1987-04-01 |
| AU518848B2 (en) | 1981-10-22 |
| FR2419285A1 (fr) | 1979-10-05 |
| DE2908937A1 (de) | 1979-09-20 |
| PL114468B1 (en) | 1981-01-31 |
| DD142418A5 (de) | 1980-06-25 |
| EG13896A (en) | 1982-12-31 |
| BG30762A3 (en) | 1981-08-14 |
| DK94979A (da) | 1979-09-11 |
| ES478499A1 (es) | 1979-12-16 |
| PL214045A1 (pl) | 1979-12-17 |
| NL7901876A (nl) | 1979-09-12 |
| GB2015995A (en) | 1979-09-19 |
| JPS54119476A (en) | 1979-09-17 |
| AU4462979A (en) | 1979-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB2015995B (en) | Herbicidal 4 - (2 - pyridyloxy) phenoxy valeric acid derivatives | |
| AU533042B2 (en) | Heterocyclic ether phenoxy acid derivatives | |
| IL55089A (en) | 4-(5-trihalomethyl-2-pyridyloxy)phenoxyalkylcarboxylic acid derivatives,their preparation and herbicidal compositions containing them | |
| IL55300A (en) | P(pyridyl-2-oxy-)phenoxy propionic acid derivatives,their preparation and herbicidal compositions comprising them | |
| GB2087887B (en) | New herbicidal nicotinamide derivatives | |
| IL54930A (en) | Herbicidal preparations containing 1,2,3-thiadiazole-5-carboxylic acid derivatives | |
| ZA79797B (en) | Herbicidal pyridine derivative | |
| PH15878A (en) | Novel herbicidally active 2-substituted 5-phenoxyphenylphosphonic acid derivatives | |
| AU573167B2 (en) | Herbicidal pyridine derivatives | |
| GB2025945B (en) | 2-substituted phenoxy-3-chloro-5-trifluoromethyl pyridine compounds and herbicidal compositions thereof | |
| NZ192234A (en) | Pyrimidine derivatives and herbicidal compositions | |
| NZ189755A (en) | Substituted 1-phenyl-4,5-dialkoxypyridazones and herbicidal compositions | |
| GB2113212B (en) | Herbicidal 2-(substituted phenoxy) propionic acid derivatives | |
| IL52372A0 (en) | Phenoxypropionic acid derivatives and herbicidal and fungicidal compositions containing them | |
| KE3362A (en) | Herbicidal heterocyclically-substituted 4-oxyphenoxyalkanecarboxylic acid derivatives | |
| PH15584A (en) | Novel phenoxy-phenoxy-alkanecarboxylic acid derivatives having a herbicidal action,compositions containing them,and their use | |
| JPS54122239A (en) | Novel phenoxypropionic acid derivative*its manufacture and use as herbicide | |
| IL56348A (en) | 2-(1-(4-substituted phenoxy(or 4-substituted pyridyloxy))phenoxy)alkyl-2-oxazolines,their preparation and herbicidal compositions containing them | |
| IL56505A (en) | Herbicidal compositions containing derivatives of 4-(4-phenoxyphenoxy)-2-pentenoic acid and the corresponding alcohols thereof | |
| NZ189341A (en) | 4-(para-trifluoromethylphenoxy)-alpha-phenoxypropionic acid alkoxyalkylamides and herbicidal compositions | |
| IL51605A (en) | 2-(substituted-4-(trifluoromethylphenoxy)phenoxy)alkanecarboxylic acids,their derivatives and herbicidal compositions containing them | |
| JPS5748989A (en) | 2-substituted 5-phenoxy-phenylphosphinic acid derivative, manufacture and herbicide containing same | |
| AU529343B2 (en) | Heterocyclic phenoxyalkanoic acid derivatives having herbicidal activity | |
| EG13488A (en) | Phenoxy crotonic acid derivatives and herbicidal composition | |
| AU4513679A (en) | Herbicidal pyridine compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PCNP | Patent ceased through non-payment of renewal fee |
Effective date: 19980307 |