GB1565616A - 4-phenylbutyric acid dervatives process for their preparation and pharmaceutical compostions containing them - Google Patents
4-phenylbutyric acid dervatives process for their preparation and pharmaceutical compostions containing them Download PDFInfo
- Publication number
- GB1565616A GB1565616A GB404378A GB404378A GB1565616A GB 1565616 A GB1565616 A GB 1565616A GB 404378 A GB404378 A GB 404378A GB 404378 A GB404378 A GB 404378A GB 1565616 A GB1565616 A GB 1565616A
- Authority
- GB
- United Kingdom
- Prior art keywords
- methyl
- salt
- acid
- compound
- excipient
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 15
- 238000002360 preparation method Methods 0.000 title claims description 7
- OBKXEAXTFZPCHS-UHFFFAOYSA-N 4-phenylbutyric acid Chemical compound OC(=O)CCCC1=CC=CC=C1 OBKXEAXTFZPCHS-UHFFFAOYSA-N 0.000 title description 3
- 229950009215 phenylbutanoic acid Drugs 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 36
- 239000000203 mixture Substances 0.000 claims abstract description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 6
- 239000001257 hydrogen Substances 0.000 claims abstract description 6
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 5
- 150000003839 salts Chemical class 0.000 claims description 12
- -1 Sodium 2 - methyl - 4 - biphenylyl4 - oxobutyrate Chemical compound 0.000 claims description 11
- LRXWDZFVRFYPGU-UHFFFAOYSA-N 2-methyl-4-oxo-4-(2-phenylphenyl)butanoic acid Chemical compound OC(=O)C(C)CC(=O)C1=CC=CC=C1C1=CC=CC=C1 LRXWDZFVRFYPGU-UHFFFAOYSA-N 0.000 claims description 10
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical group [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 6
- 239000004480 active ingredient Substances 0.000 claims description 6
- 239000000829 suppository Substances 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 239000006071 cream Substances 0.000 claims description 4
- 229920000159 gelatin Polymers 0.000 claims description 4
- 235000019322 gelatine Nutrition 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000005059 halophenyl group Chemical group 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 239000006187 pill Substances 0.000 claims description 4
- 159000000013 aluminium salts Chemical class 0.000 claims description 3
- 229910000329 aluminium sulfate Inorganic materials 0.000 claims description 3
- 159000000007 calcium salts Chemical class 0.000 claims description 3
- 229940102223 injectable solution Drugs 0.000 claims description 3
- 150000007529 inorganic bases Chemical class 0.000 claims description 3
- 150000007530 organic bases Chemical class 0.000 claims description 3
- 159000000000 sodium salts Chemical class 0.000 claims description 3
- JWDYCNIAQWPBHD-UHFFFAOYSA-N 1-(2-methylphenyl)glycerol Chemical compound CC1=CC=CC=C1OCC(O)CO JWDYCNIAQWPBHD-UHFFFAOYSA-N 0.000 claims description 2
- WOMMQCCRBNIOHF-UHFFFAOYSA-N 4-[4-(2-chlorophenyl)phenyl]-2-methyl-4-oxobutanoic acid Chemical compound ClC1=C(C=CC=C1)C1=CC=C(C=C1)C(CC(C(=O)O)C)=O WOMMQCCRBNIOHF-UHFFFAOYSA-N 0.000 claims description 2
- 108010010803 Gelatin Proteins 0.000 claims description 2
- 239000001828 Gelatine Substances 0.000 claims description 2
- NPPQSCRMBWNHMW-UHFFFAOYSA-N Meprobamate Chemical compound NC(=O)OCC(C)(CCC)COC(N)=O NPPQSCRMBWNHMW-UHFFFAOYSA-N 0.000 claims description 2
- HOZOZZFCZRXYEK-GSWUYBTGSA-M butylscopolamine bromide Chemical compound [Br-].C1([C@@H](CO)C(=O)O[C@H]2C[C@@H]3[N+]([C@H](C2)[C@@H]2[C@H]3O2)(C)CCCC)=CC=CC=C1 HOZOZZFCZRXYEK-GSWUYBTGSA-M 0.000 claims description 2
- 239000008273 gelatin Substances 0.000 claims description 2
- 235000011852 gelatine desserts Nutrition 0.000 claims description 2
- 239000008187 granular material Substances 0.000 claims description 2
- 229960003861 mephenesin Drugs 0.000 claims description 2
- 229960004815 meprobamate Drugs 0.000 claims description 2
- 239000003814 drug Substances 0.000 abstract 2
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 150000002431 hydrogen Chemical group 0.000 abstract 1
- 230000002757 inflammatory effect Effects 0.000 abstract 1
- 208000011580 syndromic disease Diseases 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000243 solution Substances 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- 241000700159 Rattus Species 0.000 description 7
- 238000001914 filtration Methods 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 229960001138 acetylsalicylic acid Drugs 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 206010018691 Granuloma Diseases 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- 206010030113 Oedema Diseases 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 208000025865 Ulcer Diseases 0.000 description 2
- 206010000269 abscess Diseases 0.000 description 2
- JLDSOYXADOWAKB-UHFFFAOYSA-N aluminium nitrate Chemical compound [Al+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O JLDSOYXADOWAKB-UHFFFAOYSA-N 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 206010003246 arthritis Diseases 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 210000003734 kidney Anatomy 0.000 description 2
- 229920000136 polysorbate Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 210000001541 thymus gland Anatomy 0.000 description 2
- 230000036269 ulceration Effects 0.000 description 2
- MDLKWDQMIZRIBY-UHFFFAOYSA-N 1-(dimethylamino)ethanol Chemical class CC(O)N(C)C MDLKWDQMIZRIBY-UHFFFAOYSA-N 0.000 description 1
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- TYEYBOSBBBHJIV-UHFFFAOYSA-N 2-oxobutanoic acid Chemical compound CCC(=O)C(O)=O TYEYBOSBBBHJIV-UHFFFAOYSA-N 0.000 description 1
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 1
- OFNISBHGPNMTMS-UHFFFAOYSA-N 3-methylideneoxolane-2,5-dione Chemical compound C=C1CC(=O)OC1=O OFNISBHGPNMTMS-UHFFFAOYSA-N 0.000 description 1
- 208000030090 Acute Disease Diseases 0.000 description 1
- 102000002260 Alkaline Phosphatase Human genes 0.000 description 1
- 108020004774 Alkaline Phosphatase Proteins 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 206010015150 Erythema Diseases 0.000 description 1
- 102000008946 Fibrinogen Human genes 0.000 description 1
- 108010049003 Fibrinogen Proteins 0.000 description 1
- 241000282414 Homo sapiens Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 206010036030 Polyarthritis Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 238000001838 alkalimetric titration Methods 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 231100000517 death Toxicity 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 231100000321 erythema Toxicity 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 229940012952 fibrinogen Drugs 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 235000012631 food intake Nutrition 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 210000004907 gland Anatomy 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 230000003137 locomotive effect Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 201000008482 osteoarthritis Diseases 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 208000030428 polyarticular arthritis Diseases 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 201000003068 rheumatic fever Diseases 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 210000000952 spleen Anatomy 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 231100000456 subacute toxicity Toxicity 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 230000001562 ulcerogenic effect Effects 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/88—Unsaturated compounds containing keto groups containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/84—Unsaturated compounds containing keto groups containing six membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7702959A FR2378741A1 (fr) | 1977-02-01 | 1977-02-01 | Acides garyl goxo isovaleriques doues de proprietes antiphlogistiques et antalgiques |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1565616A true GB1565616A (en) | 1980-04-23 |
Family
ID=9186227
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB404378A Expired GB1565616A (en) | 1977-02-01 | 1978-02-01 | 4-phenylbutyric acid dervatives process for their preparation and pharmaceutical compostions containing them |
Country Status (8)
| Country | Link |
|---|---|
| BE (1) | BE863196A (enrdf_load_stackoverflow) |
| CA (1) | CA1097684A (enrdf_load_stackoverflow) |
| CH (1) | CH628014A5 (enrdf_load_stackoverflow) |
| DE (1) | DE2804293A1 (enrdf_load_stackoverflow) |
| ES (1) | ES466493A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2378741A1 (enrdf_load_stackoverflow) |
| GB (1) | GB1565616A (enrdf_load_stackoverflow) |
| NL (1) | NL7801057A (enrdf_load_stackoverflow) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1996015096A1 (en) * | 1994-11-15 | 1996-05-23 | Bayer Corporation | Substituted 4-biarylbutyric or 5-biarylpentanoic acids and derivatives as matrix metalloprotease inhibitiors |
| WO1997017317A1 (en) * | 1995-11-03 | 1997-05-15 | Pharmacia & Upjohn S.P.A. | 4-phenyl-4-oxo-butanoic acid derivatives with kynurenine-3-hydroxylase inhibiting activity |
| WO1997043237A1 (en) * | 1996-05-15 | 1997-11-20 | Bayer Corporation | Subsitute 4-arylbutyric acid derivatives as matrix metalloprotease inhibitors |
| US5863915A (en) * | 1996-05-15 | 1999-01-26 | Bayer Corporation | Substituted 4-arylbutyric acid derivatives as matrix metalloprotease |
| US5886022A (en) * | 1995-06-05 | 1999-03-23 | Bayer Corporation | Substituted cycloalkanecarboxylic acid derivatives as matrix metalloprotease inhibitors |
| US6166082A (en) * | 1994-11-15 | 2000-12-26 | Bayer Corporation | Substituted 5-biarylpentanoic acids and derivatives as matrix metalloprotease inhibitors |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CS243570B1 (en) * | 1984-08-31 | 1986-06-12 | Miroslav Kuchar | Omega-aryloxoalkane acids |
| HRP970245B1 (en) | 1996-05-15 | 2002-06-30 | Bayer Ag | Biaryl acetilenes as matrix metalloprotease inhibitors |
-
1977
- 1977-02-01 FR FR7702959A patent/FR2378741A1/fr active Granted
-
1978
- 1978-01-23 BE BE184536A patent/BE863196A/xx not_active IP Right Cessation
- 1978-01-30 CA CA295,903A patent/CA1097684A/fr not_active Expired
- 1978-01-30 NL NL7801057A patent/NL7801057A/xx not_active Application Discontinuation
- 1978-01-31 ES ES466493A patent/ES466493A1/es not_active Expired
- 1978-02-01 DE DE19782804293 patent/DE2804293A1/de active Granted
- 1978-02-01 CH CH110878A patent/CH628014A5/fr not_active IP Right Cessation
- 1978-02-01 GB GB404378A patent/GB1565616A/en not_active Expired
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5861427A (en) * | 1994-11-15 | 1999-01-19 | Kluender; Harold Clinton Eugene | Substituted 4-biarylbutyric acid derivatives as matrix metalloprotease inhibitors |
| RU2159761C2 (ru) * | 1994-11-15 | 2000-11-27 | Байер Корпорейшн | Замещенные 4-биарилмасляные или 5-биарилпентановые кислоты или их производные, способы их получения, фармацевтическая композиция и способ лечения |
| US6166082A (en) * | 1994-11-15 | 2000-12-26 | Bayer Corporation | Substituted 5-biarylpentanoic acids and derivatives as matrix metalloprotease inhibitors |
| US5854277A (en) * | 1994-11-15 | 1998-12-29 | Bayer Corporation | Thiophenebutanoic acid derivatives as matrix metalloprotease inhibitors |
| US5859047A (en) * | 1994-11-15 | 1999-01-12 | Bayer Corporation | Substituted 4-biarylbutyric acid derivatives as matrix metalloprotease inhibitors |
| US5861428A (en) * | 1994-11-15 | 1999-01-19 | Bayer Corporation | Substituted 4-biarylbutyric acid derivatives as matrix metalloprotease inhibitors |
| US5874473A (en) * | 1994-11-15 | 1999-02-23 | Bayer Corporation | Substituted cycloalkanecarboxylic acid derivatives as matrix metalloprotease inhibitors |
| WO1996015096A1 (en) * | 1994-11-15 | 1996-05-23 | Bayer Corporation | Substituted 4-biarylbutyric or 5-biarylpentanoic acids and derivatives as matrix metalloprotease inhibitiors |
| US5886043A (en) * | 1994-11-15 | 1999-03-23 | Bayer Corporation | Substituted 4-biarylbutyric acid derivatives as matrix metalloprotease inhibitors |
| US5886024A (en) * | 1994-11-15 | 1999-03-23 | Bayer Corporation | Thiophene-containing butonic acid derivatives as matrix metalloprotease inhibitors |
| US5886022A (en) * | 1995-06-05 | 1999-03-23 | Bayer Corporation | Substituted cycloalkanecarboxylic acid derivatives as matrix metalloprotease inhibitors |
| WO1997017317A1 (en) * | 1995-11-03 | 1997-05-15 | Pharmacia & Upjohn S.P.A. | 4-phenyl-4-oxo-butanoic acid derivatives with kynurenine-3-hydroxylase inhibiting activity |
| US5863915A (en) * | 1996-05-15 | 1999-01-26 | Bayer Corporation | Substituted 4-arylbutyric acid derivatives as matrix metalloprotease |
| WO1997043237A1 (en) * | 1996-05-15 | 1997-11-20 | Bayer Corporation | Subsitute 4-arylbutyric acid derivatives as matrix metalloprotease inhibitors |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2804293C2 (enrdf_load_stackoverflow) | 1989-08-03 |
| BE863196A (fr) | 1978-05-16 |
| ES466493A1 (es) | 1979-05-01 |
| DE2804293A1 (de) | 1978-08-10 |
| FR2378741B1 (enrdf_load_stackoverflow) | 1980-02-22 |
| FR2378741A1 (fr) | 1978-08-25 |
| CA1097684A (fr) | 1981-03-17 |
| CH628014A5 (en) | 1982-02-15 |
| NL7801057A (nl) | 1978-08-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4126635A (en) | 2-amino-3-(5- and 6-)benzoylphenylacetic acids, esters and metal salts thereof | |
| EP0028833B1 (en) | Imidazole derivatives, their production and use | |
| US4058558A (en) | Aromatic keto acids and derivatives having analgetic, antiinflammatory, and hypocholesterolemizing action | |
| US4008323A (en) | Method of reducing cholesterol using certain aromatic keto acids | |
| GB1565616A (en) | 4-phenylbutyric acid dervatives process for their preparation and pharmaceutical compostions containing them | |
| US3766263A (en) | Substituted 2-phenoxyphenylacetic acids | |
| IE47960B1 (en) | Tetrazole derivatives | |
| US3929872A (en) | Indanacetic acid compounds | |
| CA1167767A (en) | Anti-inflammatory, analgesic, and antipyretic pharmaceutical composition | |
| FR2550192A1 (fr) | Nouveaux derives de la benzamidine a activite antimicrobienne, leur procede de preparation, leur utilisation en tant que medicaments desinfectants ou conservateurs | |
| US4096250A (en) | Tri-substituted phosphinegold(I) 1-thio-β-D-glucopyranosides | |
| US4123544A (en) | Acetylsalicylic acid derivatives | |
| US3536758A (en) | Substituted phenylacetamides | |
| US3658989A (en) | Antibacterial composition containing tetracycline sulfamate and derivatives thereof | |
| CA1054609A (en) | S-heterocyclic derivatives of phosphine or phosphite gold mercaptides | |
| US4420482A (en) | 1,4-Bis(acetylsalicyloyloxy)piperizine derivatives | |
| US4272529A (en) | O-Alcoxycarbonylphenyl esters of anthranilic acid with therapeutical activity, method for their preparation and related pharmaceutical composition | |
| US4310521A (en) | Aspirin-isopropylantipyrine | |
| US3845215A (en) | Phenylalkane derivatives in the treatment of inflammation | |
| JPS6056142B2 (ja) | チアゾリンの新規誘導体およびその医薬としての適用 | |
| US4329340A (en) | Pharmaceutical composition having antiphlogistic, antipyretic and analgesic activity | |
| US3458563A (en) | ((3 - (hydrocarbylpolythio)alkanoyl)phenoxy)alkanoic acids and ((3-(hydrocarbylpolythio)alkanoyl)phenylthio)alkanoic acids | |
| US4539331A (en) | Imidazole carboxamide derivatives and pharmaceutical compositions thereof | |
| EP0058009A1 (en) | Novel benzanilide derivatives and pharmaceutical compositions containing them | |
| US3324173A (en) | (2-methylenealkanoyl)benzoic acids |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed | ||
| PCNP | Patent ceased through non-payment of renewal fee |
Effective date: 19930201 |