GB1533668A - Crosslinkable bis-imidyl derivatives - Google Patents
Crosslinkable bis-imidyl derivativesInfo
- Publication number
- GB1533668A GB1533668A GB52829/76A GB5282976A GB1533668A GB 1533668 A GB1533668 A GB 1533668A GB 52829/76 A GB52829/76 A GB 52829/76A GB 5282976 A GB5282976 A GB 5282976A GB 1533668 A GB1533668 A GB 1533668A
- Authority
- GB
- United Kingdom
- Prior art keywords
- formula
- compounds
- grouping
- radical
- unsubstituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 abstract 5
- 125000003545 alkoxy group Chemical group 0.000 abstract 2
- 125000004432 carbon atom Chemical group C* 0.000 abstract 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 abstract 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 2
- OWYWGLHRNBIFJP-UHFFFAOYSA-N Ipazine Chemical compound CCN(CC)C1=NC(Cl)=NC(NC(C)C)=N1 OWYWGLHRNBIFJP-UHFFFAOYSA-N 0.000 abstract 1
- 239000004952 Polyamide Substances 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- -1 alkali metal cation Chemical class 0.000 abstract 1
- 238000004132 cross linking Methods 0.000 abstract 1
- 150000003949 imides Chemical class 0.000 abstract 1
- 229920002647 polyamide Polymers 0.000 abstract 1
- 229920000642 polymer Polymers 0.000 abstract 1
- 125000001453 quaternary ammonium group Chemical group 0.000 abstract 1
- 125000005208 trialkylammonium group Chemical group 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G73/00—Macromolecular compounds obtained by reactions forming a linkage containing nitrogen with or without oxygen or carbon in the main chain of the macromolecule, not provided for in groups C08G12/00 - C08G71/00
- C08G73/06—Polycondensates having nitrogen-containing heterocyclic rings in the main chain of the macromolecule
- C08G73/10—Polyimides; Polyester-imides; Polyamide-imides; Polyamide acids or similar polyimide precursors
- C08G73/12—Unsaturated polyimide precursors
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Indole Compounds (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Polymerisation Methods In General (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1651075A CH619694A5 (enExample) | 1975-12-19 | 1975-12-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1533668A true GB1533668A (en) | 1978-11-29 |
Family
ID=4417992
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB52829/76A Expired GB1533668A (en) | 1975-12-19 | 1976-12-17 | Crosslinkable bis-imidyl derivatives |
Country Status (9)
| Country | Link |
|---|---|
| US (4) | US4126619A (enExample) |
| JP (2) | JPS5277054A (enExample) |
| BE (1) | BE849510A (enExample) |
| CA (1) | CA1084512A (enExample) |
| CH (1) | CH619694A5 (enExample) |
| DE (1) | DE2657128A1 (enExample) |
| FR (1) | FR2335510A1 (enExample) |
| GB (1) | GB1533668A (enExample) |
| NL (1) | NL7613978A (enExample) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH615912A5 (enExample) * | 1975-06-18 | 1980-02-29 | Ciba Geigy Ag | |
| CH619694A5 (enExample) * | 1975-12-19 | 1980-10-15 | Ciba Geigy Ag | |
| US4286097A (en) * | 1978-07-28 | 1981-08-25 | Ciba-Geigy Corporation | Carboxylic acid dianhydrides based on trimellitic anhydride |
| US4418181A (en) * | 1981-05-26 | 1983-11-29 | Plastics Engineering Company | Polyimides having bis-maleimide terminal groups |
| US4661604A (en) * | 1981-06-16 | 1987-04-28 | Trw, Inc. | Monofunctional crosslinking imidophenols |
| US5705598A (en) | 1985-04-23 | 1998-01-06 | The Boeing Company | Polyester sulfone oligomers and blends |
| US5367083A (en) * | 1987-09-03 | 1994-11-22 | The Boeing Company | Extended acid halide capping monomers |
| US5216117A (en) * | 1987-09-03 | 1993-06-01 | The Boeing Company | Amideimide blends |
| US5210213A (en) | 1983-06-17 | 1993-05-11 | The Boeing Company | Dimensional, crosslinkable oligomers |
| US4536559A (en) * | 1983-06-17 | 1985-08-20 | The Boeing Company | Thermally stable polyimide polysulfone compositions for composite structures |
| US5512676A (en) | 1987-09-03 | 1996-04-30 | The Boeing Company | Extended amideimide hub for multidimensional oligomers |
| US5969079A (en) | 1985-09-05 | 1999-10-19 | The Boeing Company | Oligomers with multiple chemically functional end caps |
| US5506060A (en) * | 1981-11-13 | 1996-04-09 | The Boeing Company | Method for making multidimensional ether or ester oligomers |
| US4584364A (en) * | 1984-02-06 | 1986-04-22 | The Boeing Company | Phenolic-capped imide sulfone resins |
| US5693741A (en) | 1988-03-15 | 1997-12-02 | The Boeing Company | Liquid molding compounds |
| US5516876A (en) * | 1983-09-27 | 1996-05-14 | The Boeing Company | Polyimide oligomers and blends |
| US4871475A (en) * | 1985-10-07 | 1989-10-03 | The Boeing Company | Polysulfone and polyethersulfone oligomers |
| US5618907A (en) | 1985-04-23 | 1997-04-08 | The Boeing Company | Thallium catalyzed multidimensional ester oligomers |
| US5610317A (en) | 1985-09-05 | 1997-03-11 | The Boeing Company | Multiple chemically functional end cap monomers |
| US5109105A (en) * | 1987-06-12 | 1992-04-28 | The Boeing Company | Polyamide oligomers |
| US4886842A (en) * | 1988-03-04 | 1989-12-12 | Loctite Corporation | Epoxy-amine compositions employing unsaturated imides |
| US4837295A (en) * | 1988-03-04 | 1989-06-06 | Loctite Corporation | Epoxy-amine compositions employing unsaturated imides |
| US5817744A (en) | 1988-03-14 | 1998-10-06 | The Boeing Company | Phenylethynyl capped imides |
| US4861882A (en) * | 1988-07-14 | 1989-08-29 | The United States Of America As Represented By The Administrator Of The National Aeronautics And Space Administration | Ethynyl terminated imidothioethers and resins therefrom |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE316011B (enExample) * | 1964-11-13 | 1969-10-13 | Rhodiaceta | |
| NL66822C (enExample) * | 1967-07-03 | |||
| FR1537135A (fr) * | 1967-07-12 | 1968-08-23 | Rhone Poulenc Sa | Nouveaux polyimides réticulés |
| US3700617A (en) * | 1969-09-22 | 1972-10-24 | Ferro Corp | Epoxy-terminated polyimides |
| US3954710A (en) * | 1970-12-11 | 1976-05-04 | Westinghouse Electric Corporation | Polymers prepared from imide containing dianhydrides |
| US3962278A (en) * | 1970-12-11 | 1976-06-08 | Westinghouse Electric Corporation | N,n'bis(phthalic anhydride) diimides |
| US3689464A (en) * | 1970-12-18 | 1972-09-05 | Gen Electric | Imido-substituted polyamide compositions |
| US3763114A (en) * | 1971-07-22 | 1973-10-02 | American Cyanamid Co | Preparation of a thermosettable polyimide |
| US3862129A (en) * | 1973-01-12 | 1975-01-21 | Union Carbide Corp | Novel haloaromatic etheramines |
| FR2220552B1 (enExample) * | 1973-03-07 | 1976-06-11 | Rhone Poulenc Ind | |
| CA1031350A (en) * | 1973-04-03 | 1978-05-16 | Hughes Aircraft Company | Nitrile substituted polyimide oligomers |
| US3948941A (en) * | 1973-10-26 | 1976-04-06 | Exxon Research And Engineering Company | Preparation of imides using CN- catalysts |
| CH587272A5 (enExample) * | 1973-12-20 | 1977-04-29 | Ciba Geigy Ag | |
| FR2264834A1 (en) * | 1974-03-20 | 1975-10-17 | Rhone Poulenc Ind | Thermosetting di-maleimide-contg. compsns. - prepd. from piperazine and di-maleimides in organic solvents |
| FR2264835A1 (en) * | 1974-03-20 | 1975-10-17 | Rhone Poulenc Ind | Thermosetting compsns with high flexural resistance - from imide prepolymer and phenolic resins |
| CH619692A5 (enExample) * | 1975-12-19 | 1980-10-15 | Ciba Geigy Ag | |
| CH619694A5 (enExample) * | 1975-12-19 | 1980-10-15 | Ciba Geigy Ag |
-
1975
- 1975-12-19 CH CH1651075A patent/CH619694A5/de not_active IP Right Cessation
-
1976
- 1976-12-06 US US05/747,443 patent/US4126619A/en not_active Expired - Lifetime
- 1976-12-16 NL NL7613978A patent/NL7613978A/xx not_active Application Discontinuation
- 1976-12-16 DE DE19762657128 patent/DE2657128A1/de not_active Ceased
- 1976-12-17 FR FR7638050A patent/FR2335510A1/fr active Granted
- 1976-12-17 GB GB52829/76A patent/GB1533668A/en not_active Expired
- 1976-12-17 BE BE173352A patent/BE849510A/xx unknown
- 1976-12-17 CA CA268,204A patent/CA1084512A/en not_active Expired
- 1976-12-18 JP JP51152779A patent/JPS5277054A/ja active Granted
-
1978
- 1978-09-07 US US05/940,409 patent/US4219481A/en not_active Expired - Lifetime
-
1979
- 1979-12-03 US US06/099,952 patent/US4280946A/en not_active Expired - Lifetime
-
1980
- 1980-11-14 US US06/206,923 patent/US4365068A/en not_active Expired - Lifetime
-
1985
- 1985-06-12 JP JP60127906A patent/JPS6181413A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| CA1084512A (en) | 1980-08-26 |
| US4126619A (en) | 1978-11-21 |
| DE2657128A1 (de) | 1977-06-23 |
| JPS6252746B2 (enExample) | 1987-11-06 |
| US4280946A (en) | 1981-07-28 |
| BE849510A (fr) | 1977-06-17 |
| NL7613978A (nl) | 1977-06-21 |
| JPS5277054A (en) | 1977-06-29 |
| FR2335510B1 (enExample) | 1979-09-21 |
| US4365068A (en) | 1982-12-21 |
| FR2335510A1 (fr) | 1977-07-15 |
| JPS6181413A (ja) | 1986-04-25 |
| US4219481A (en) | 1980-08-26 |
| CH619694A5 (enExample) | 1980-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1533668A (en) | Crosslinkable bis-imidyl derivatives | |
| IE41102L (en) | Haloacetanlide fungicides | |
| AU549640B2 (en) | Tropyl benzoate derivatives | |
| IE36124B1 (en) | Amino pyridine compounds and compositions | |
| EP0034116A3 (en) | N-(3-phenoxy-2-hydroxypropyl)benzimidazole-1-alkanamines | |
| GB1533649A (en) | Crosslinkable tetra-imidyl derivatives | |
| ES8304916A1 (es) | Procedimiento para preparar esteres de 2-nitro-5(fenoxi sus-tituido-benzoato de alfa-hidroxialcanoatos) | |
| CA2046313A1 (en) | Platinum (ii) complex and agent for treating malignant tumor | |
| FR2471973B1 (enExample) | ||
| EP0147788A3 (en) | Phenylacetanilide derivatives | |
| JPS5283818A (en) | Novel cyclohexane derivatives | |
| EP0500952A4 (en) | Process for producing nitrogenous heterocycle | |
| EP0753514A4 (en) | ALKYLENEDIAMINE DERIVATIVES | |
| JPS52108938A (en) | Phenoxyphenoxyalkanenitrile derivative and herbicide containing the sa me | |
| IE810600L (en) | 2-haloacetamides | |
| IE832886L (en) | Treatment of migraine with n-alkyl-piperidinyl benzoate¹derivatives | |
| JPS5439029A (en) | Nitro compounds | |
| JPS5337645A (en) | Iron complexes of bis (5,6-diaminocalicenes) | |
| JPS56115383A (en) | Antioxidant | |
| DE3375575D1 (de) | Substituted tetrahydrotetrazolo(5,1-a)phthalazines | |
| IE36412B1 (en) | Herbicides | |
| JPS51123821A (en) | An algicide and protective agent | |
| JPS5229823A (en) | Preparation of quinophthalone compound | |
| JPS55147275A (en) | Ppacetamidophenollalphaamethyll4*2**thienyll carbonyl*phenylacetate and its use and manufacture | |
| JPS51143650A (en) | A process for preparing cyclohexanol derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |