GB1479711A - Acylureido cephalosporins - Google Patents
Acylureido cephalosporinsInfo
- Publication number
- GB1479711A GB1479711A GB27970/73A GB2797073A GB1479711A GB 1479711 A GB1479711 A GB 1479711A GB 27970/73 A GB27970/73 A GB 27970/73A GB 2797073 A GB2797073 A GB 2797073A GB 1479711 A GB1479711 A GB 1479711A
- Authority
- GB
- United Kingdom
- Prior art keywords
- compound
- formula
- ester
- salt
- reacting
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229930186147 Cephalosporin Natural products 0.000 title abstract 3
- 229940124587 cephalosporin Drugs 0.000 title abstract 3
- 150000001780 cephalosporins Chemical class 0.000 title abstract 3
- 150000001875 compounds Chemical class 0.000 abstract 6
- 150000003839 salts Chemical class 0.000 abstract 5
- 150000002148 esters Chemical class 0.000 abstract 4
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 abstract 4
- -1 sulphoxide compound Chemical class 0.000 abstract 3
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 abstract 2
- 239000002253 acid Substances 0.000 abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 238000006243 chemical reaction Methods 0.000 abstract 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 2
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 abstract 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 abstract 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 abstract 1
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 238000006136 alcoholysis reaction Methods 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 230000000903 blocking effect Effects 0.000 abstract 1
- 229910052799 carbon Inorganic materials 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 abstract 1
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 abstract 1
- 125000000524 functional group Chemical group 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 230000007062 hydrolysis Effects 0.000 abstract 1
- 238000006460 hydrolysis reaction Methods 0.000 abstract 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical compound O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 abstract 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 abstract 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 1
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 1
- 239000012038 nucleophile Substances 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 229910052717 sulfur Inorganic materials 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Priority Applications (39)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB27970/73A GB1479711A (en) | 1973-06-12 | 1973-06-12 | Acylureido cephalosporins |
| IE1132/74A IE39294B1 (en) | 1973-06-12 | 1974-05-29 | Acylureido cephalosporins |
| IE2264/77A IE39295B1 (en) | 1973-06-12 | 1974-05-29 | 7-amino-3-thiomethyl cephem 4-carboxylic acid derivatives |
| IE2265/77A IE39296B1 (en) | 1973-06-12 | 1974-05-29 | Carboxymethyl thiols |
| IL44959A IL44959A (en) | 1973-06-12 | 1974-06-03 | -acylureido-cephalosporins and their preparation |
| ZM85/74A ZM8574A1 (en) | 1973-06-12 | 1974-06-05 | Cephalosporins |
| AU69843/74A AU475246B2 (en) | 1973-06-12 | 1974-06-06 | Cephalosporins |
| MW24/74*UA MW2474A1 (en) | 1973-06-12 | 1974-06-10 | Cephalosporins |
| JP49066446A JPS5047990A (enExample) | 1973-06-12 | 1974-06-11 | |
| FI1791/74A FI179174A7 (enExample) | 1973-06-12 | 1974-06-11 | |
| DD179086A DD111581A5 (enExample) | 1973-06-12 | 1974-06-11 | |
| SE7407713A SE7407713L (enExample) | 1973-06-12 | 1974-06-11 | |
| DK311874A DK311874A (enExample) | 1973-06-12 | 1974-06-11 | |
| NO742117A NO742117L (enExample) | 1973-06-12 | 1974-06-11 | |
| DE19742428139 DE2428139A1 (de) | 1973-06-12 | 1974-06-11 | Cephalosporine, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate |
| AT482074A AT335060B (de) | 1973-06-12 | 1974-06-11 | Verfahren zur herstellung von neuen cephalosporinen |
| PL18935374A PL94613B1 (pl) | 1973-06-12 | 1974-06-12 | Sposob wytwarzania cefalosporyn |
| PL17185574A PL89964B1 (enExample) | 1973-06-12 | 1974-06-12 | |
| ES427234A ES427234A1 (es) | 1973-06-12 | 1974-06-12 | Un procedimiento para la preparacion de una cefalosporina. |
| BE145344A BE816238A (fr) | 1973-06-12 | 1974-06-12 | Cephalosporines |
| NL7407815A NL7407815A (enExample) | 1973-06-12 | 1974-06-12 | |
| RO7913074A RO63098A (fr) | 1973-06-12 | 1974-06-12 | Procede pour la preparation des cephalosporimes |
| RO8634574A RO63740A (fr) | 1973-06-12 | 1974-06-12 | Procede de preparation des cephalosporines |
| CH361378A CH613456A5 (en) | 1973-06-12 | 1974-06-12 | Process for the preparation of cephalosporins |
| FR7420301A FR2233067A1 (en) | 1973-06-12 | 1974-06-12 | N-(thio)acyl carbamoyl-glycylamino-cephalosporin ic acids - as antibiotics esp. active against pseudomonas and gram neg. organisms producing cephalosporinase |
| CH361278A CH611303A5 (en) | 1973-06-12 | 1974-06-12 | Process for the preparation of cephalosporins |
| RO7486344A RO64674A (ro) | 1973-06-12 | 1974-06-12 | Procedeu pentru prepararea unor cefalosporine |
| CH806474A CH609350A5 (enExample) | 1973-06-12 | 1974-06-12 | |
| ZA00743748A ZA743748B (en) | 1973-06-12 | 1974-06-12 | Cephalosporins |
| SU752189959A SU688130A3 (ru) | 1973-06-12 | 1975-11-19 | Способ поучени цефалоспоринов или их солей |
| US05/683,792 US4312982A (en) | 1973-06-12 | 1976-05-06 | α-Acylureidocephalosporins and salts and esters thereof |
| NO770104A NO770104L (enExample) | 1973-06-12 | 1977-01-12 | |
| SE7706081A SE7706081L (sv) | 1973-06-12 | 1977-05-24 | Forfarande for framstellning av cefalosporiner |
| IL52704A IL52704A0 (en) | 1973-06-12 | 1977-08-11 | Novel derivatives of 7-amino-cephem-4-carboxylic acid |
| AR269874A AR219722A1 (es) | 1973-06-12 | 1977-11-07 | Acido 7-amino-3-(1-carboximetil-1h-tetrazol-5-iltio)-metilcef-3-em-4-carboxilico, compuesto intermedio util para la preparacion de cefalosporinas, sin aplicacaion como agente terapeutico |
| FI773446A FI773446A7 (enExample) | 1973-06-12 | 1977-11-15 | |
| FI773447A FI773447A7 (enExample) | 1973-06-12 | 1977-11-15 | |
| DK533177A DK533177A (da) | 1973-06-12 | 1977-12-01 | Lemiske forbindelser til anvendelse som mellemprodukt ved fremstilling af cephalosporiner |
| NL8104456A NL8104456A (nl) | 1973-06-12 | 1981-09-29 | Werkwijze voor het bereiden van een 7-animo-cefalo- sporanzuurderivaat. |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB27970/73A GB1479711A (en) | 1973-06-12 | 1973-06-12 | Acylureido cephalosporins |
| GB4896873 | 1973-10-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1479711A true GB1479711A (en) | 1977-07-13 |
Family
ID=26259100
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB27970/73A Expired GB1479711A (en) | 1973-06-12 | 1973-06-12 | Acylureido cephalosporins |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4312982A (enExample) |
| JP (1) | JPS5047990A (enExample) |
| AR (1) | AR219722A1 (enExample) |
| AU (1) | AU475246B2 (enExample) |
| BE (1) | BE816238A (enExample) |
| CH (1) | CH609350A5 (enExample) |
| DD (1) | DD111581A5 (enExample) |
| DE (1) | DE2428139A1 (enExample) |
| DK (1) | DK311874A (enExample) |
| GB (1) | GB1479711A (enExample) |
| IE (1) | IE39294B1 (enExample) |
| IL (2) | IL44959A (enExample) |
| MW (1) | MW2474A1 (enExample) |
| NL (1) | NL7407815A (enExample) |
| SE (2) | SE7407713L (enExample) |
| ZM (1) | ZM8574A1 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4298605A (en) | 1978-06-22 | 1981-11-03 | Chugai Seiyaku Kabushiki Kaisha | Cephalosporin derivatives |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4071683A (en) * | 1973-10-30 | 1978-01-31 | Bayer Aktiengesellschaft | Oxoimidazolidinylthiocarbonyl derivatives of ceph-3-em-4-carboxylic acids |
| US4086340A (en) * | 1974-02-18 | 1978-04-25 | Bayer Aktiengesellschaft | Cephalosporins and their production |
| US4107304A (en) | 1974-02-18 | 1978-08-15 | Bayer Aktiengesellschaft | Oxo-imidazolidine substituted cephalosporins and antibacterial compositions and methods of combatting bacteria employing them |
| US4224442A (en) * | 1975-03-03 | 1980-09-23 | Eli Lilly And Company | 7-Ureido acetamido substituted cephalosporin antibiotics |
| US4061630A (en) * | 1976-02-20 | 1977-12-06 | Eli Lilly And Company | 7-Substituted-ureido-3-carbamoyloxymethyl cephalosporin antibiotics |
| US4061861A (en) * | 1976-06-21 | 1977-12-06 | Eli Lilly And Company | 7-[α-(2,3-DIHYDRO-2-OXO-1H-benzimidazol-1-ylcarbonyl-amino)arylacetamido]cephalosporins |
| FR2362146A1 (fr) * | 1976-08-17 | 1978-03-17 | Fujisawa Pharmaceutical Co | Procede de preparation de composes d'acide 7-(n-substitue-2-phenylglycinamido)-3-substitue-3-cephem-4-carboxylique et nouveaux produits ainsi obtenus, a activite antibacterienne |
| JPS5346996A (en) * | 1976-10-13 | 1978-04-27 | Sangyo Kagaku Kenkyu Kyokai | Antifungal compound |
| US4217348A (en) | 1978-09-28 | 1980-08-12 | E. R. Squibb & Sons, Inc. | Cephalosporins having an oxazolidonyloxamido substituted acyl sidechain |
| US4436903A (en) * | 1980-12-22 | 1984-03-13 | Ciba-Geigy Corporation | Process for the production of 7 β-substituted-3-unsubstituted-3-cephem-4-carboxylic acid compounds |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3687949A (en) * | 1969-01-21 | 1972-08-29 | Bristol Myers Co | Synthetic cephalosporins |
| US3673183A (en) * | 1969-11-17 | 1972-06-27 | Squibb & Sons Inc | {60 -ureidocephalosporanic acid compounds |
| US3741962A (en) * | 1971-05-21 | 1973-06-26 | Squibb & Sons Inc | Alpha-thioureidocephalosporanic acid compounds |
| CH570407A5 (enExample) * | 1972-03-29 | 1975-12-15 | Ciba Geigy Ag | |
| US4086340A (en) * | 1974-02-18 | 1978-04-25 | Bayer Aktiengesellschaft | Cephalosporins and their production |
| US4107304A (en) * | 1974-02-18 | 1978-08-15 | Bayer Aktiengesellschaft | Oxo-imidazolidine substituted cephalosporins and antibacterial compositions and methods of combatting bacteria employing them |
| US3956292A (en) * | 1974-04-01 | 1976-05-11 | Eli Lilly And Company | 7-(α-FUROYLUREIDOARYL AND CYCLOHEXADIENYLACETAMIDO) CEPHALOSPORIN ANTIBIOTICS |
| US3925368A (en) * | 1974-04-01 | 1975-12-09 | Lilly Co Eli | Acylureido substituted cephalosporins |
| US4224442A (en) * | 1975-03-03 | 1980-09-23 | Eli Lilly And Company | 7-Ureido acetamido substituted cephalosporin antibiotics |
| US4061630A (en) * | 1976-02-20 | 1977-12-06 | Eli Lilly And Company | 7-Substituted-ureido-3-carbamoyloxymethyl cephalosporin antibiotics |
-
1973
- 1973-06-12 GB GB27970/73A patent/GB1479711A/en not_active Expired
-
1974
- 1974-05-29 IE IE1132/74A patent/IE39294B1/xx unknown
- 1974-06-03 IL IL44959A patent/IL44959A/xx unknown
- 1974-06-05 ZM ZM85/74A patent/ZM8574A1/xx unknown
- 1974-06-06 AU AU69843/74A patent/AU475246B2/en not_active Expired
- 1974-06-10 MW MW24/74*UA patent/MW2474A1/xx unknown
- 1974-06-11 DE DE19742428139 patent/DE2428139A1/de active Pending
- 1974-06-11 SE SE7407713A patent/SE7407713L/xx unknown
- 1974-06-11 DD DD179086A patent/DD111581A5/xx unknown
- 1974-06-11 DK DK311874A patent/DK311874A/da unknown
- 1974-06-11 JP JP49066446A patent/JPS5047990A/ja active Pending
- 1974-06-12 NL NL7407815A patent/NL7407815A/xx not_active Application Discontinuation
- 1974-06-12 CH CH806474A patent/CH609350A5/xx not_active IP Right Cessation
- 1974-06-12 BE BE145344A patent/BE816238A/xx unknown
-
1976
- 1976-05-06 US US05/683,792 patent/US4312982A/en not_active Expired - Lifetime
-
1977
- 1977-05-24 SE SE7706081A patent/SE7706081L/ not_active Application Discontinuation
- 1977-08-11 IL IL52704A patent/IL52704A0/xx unknown
- 1977-11-07 AR AR269874A patent/AR219722A1/es active
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4298605A (en) | 1978-06-22 | 1981-11-03 | Chugai Seiyaku Kabushiki Kaisha | Cephalosporin derivatives |
| US4301161A (en) | 1978-06-22 | 1981-11-17 | Chugai Seiyaku Kabushiki Kaisha | Cephalosporin derivatives |
| US4328224A (en) | 1978-06-22 | 1982-05-04 | Chugai Seiyaku Kabushiki Kaisha | Cephalosporin derivatives |
| US4341776A (en) | 1978-06-22 | 1982-07-27 | Chugai Seiyaku Kabushiki Kaisha | Cephalosporin derivatives |
Also Published As
| Publication number | Publication date |
|---|---|
| AR219722A1 (es) | 1980-09-15 |
| AU6984374A (en) | 1975-12-11 |
| CH609350A5 (enExample) | 1979-02-28 |
| DE2428139A1 (de) | 1975-01-09 |
| IL44959A (en) | 1978-07-31 |
| DK311874A (enExample) | 1975-02-17 |
| SE7706081L (sv) | 1977-05-24 |
| ZM8574A1 (en) | 1976-08-23 |
| IL52704A0 (en) | 1977-10-31 |
| US4312982A (en) | 1982-01-26 |
| BE816238A (fr) | 1974-12-12 |
| NL7407815A (enExample) | 1974-12-16 |
| IL44959A0 (en) | 1974-09-10 |
| IE39294L (en) | 1974-12-12 |
| MW2474A1 (en) | 1975-08-13 |
| AU475246B2 (en) | 1976-08-19 |
| DD111581A5 (enExample) | 1975-02-20 |
| JPS5047990A (enExample) | 1975-04-28 |
| IE39294B1 (en) | 1978-09-13 |
| SE7407713L (enExample) | 1974-12-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1432576A (en) | Substituted phenylacetic acids | |
| GB1479711A (en) | Acylureido cephalosporins | |
| GB1495676A (en) | Cephalosporins having an alpha-acylamino-acetic acid side chain | |
| GB1364672A (en) | Penicillins | |
| GB1456221A (en) | 3-hydroxy cephalosporins their ether derivatives and methods for their preparation | |
| GB1420573A (en) | Process for the preparation of 7-acylamino-desacetoxy cephalosporanic acid deri''tives | |
| IE33580L (en) | 2-acyloxy cephalosporins | |
| US4193918A (en) | Process for the preparation of hydroxy-alpha-amino-benzyl penicillin | |
| GB1425571A (en) | Penicillins and cephaosporins | |
| GB1291644A (en) | Substituted 1-indancarboxylic acids, their esters and salts | |
| GB1527109A (en) | Cephalosporin derivatives and process for preparing same | |
| GB1498025A (en) | 3-carbamoyloxymethyl-7-8-(substituted acetamido)-3-cephem-4-carboxylic acid derivatives and methods for their preparation | |
| GB1387656A (en) | Cephalosporin compounds | |
| GB1397647A (en) | Thiophene derivatives | |
| GB1433973A (en) | Prostaglandin intermediates | |
| GB1390754A (en) | Penicillin and cephalosporin esters | |
| GB1331505A (en) | Derivatives of thiophene acetic acid and processes for preparing them | |
| GB1459999A (en) | Penicillin and cephalosporin intermediates | |
| GB1390402A (en) | Substituted imidazolecarboxamides | |
| GB1476312A (en) | Penicillins and cephalosporins | |
| GB1430908A (en) | Derivatives of cephalosporin | |
| SU735169A3 (ru) | Способ получени производных цефалоспорина | |
| ES427234A1 (es) | Un procedimiento para la preparacion de una cefalosporina. | |
| GB1377817A (en) | Penicillins and cephalosporins | |
| ES434923A1 (es) | Un procedimiento para la preparacion de un ester de cefa- losporina. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| 48S | Specification amended (sect. 8/1949) | ||
| SPA | Amended specification published |