GB1440216A - Derivatives of penam-3-carboxylic acid and cephem-4-carboxylic acid and processes for their manufacture - Google Patents
Derivatives of penam-3-carboxylic acid and cephem-4-carboxylic acid and processes for their manufactureInfo
- Publication number
- GB1440216A GB1440216A GB4434473A GB4434473A GB1440216A GB 1440216 A GB1440216 A GB 1440216A GB 4434473 A GB4434473 A GB 4434473A GB 4434473 A GB4434473 A GB 4434473A GB 1440216 A GB1440216 A GB 1440216A
- Authority
- GB
- United Kingdom
- Prior art keywords
- optionally substituted
- compound
- carboxylic acid
- tetrahydropyrimidyl
- thioxo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title abstract 2
- 238000004519 manufacturing process Methods 0.000 title 1
- -1 2- thioxo - 6 - oxo - 1,2,3,6 - tetrahydropyrimidyl Chemical group 0.000 abstract 3
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- 229930186147 Cephalosporin Natural products 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 239000003242 anti bacterial agent Substances 0.000 abstract 1
- 229940088710 antibiotic agent Drugs 0.000 abstract 1
- 229910052799 carbon Inorganic materials 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 1
- 229940124587 cephalosporin Drugs 0.000 abstract 1
- 150000001780 cephalosporins Chemical class 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 239000003085 diluting agent Substances 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 125000002541 furyl group Chemical group 0.000 abstract 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- 150000002960 penicillins Chemical class 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 125000005717 substituted cycloalkylene group Chemical group 0.000 abstract 1
- 125000001544 thienyl group Chemical group 0.000 abstract 1
- 125000000464 thioxo group Chemical group S=* 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Cephalosporin Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1425772A CH585227A5 (en) | 1972-09-29 | 1972-09-29 | Antibacterial penicillin and cephalosporin analogues - contg substd pyrimi-dine-carboxamido or-acetamido gp |
| CH369473 | 1973-03-14 | ||
| CH744473 | 1973-05-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1440216A true GB1440216A (en) | 1976-06-23 |
Family
ID=27174475
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB4434473A Expired GB1440216A (en) | 1972-09-29 | 1973-09-21 | Derivatives of penam-3-carboxylic acid and cephem-4-carboxylic acid and processes for their manufacture |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4015000A (enExample) |
| AR (1) | AR208171A1 (enExample) |
| AT (2) | ATA89875A (enExample) |
| CA (1) | CA1074295A (enExample) |
| DD (1) | DD107288A5 (enExample) |
| DE (1) | DE2347533A1 (enExample) |
| FR (1) | FR2201075B1 (enExample) |
| GB (1) | GB1440216A (enExample) |
| IE (1) | IE38222B1 (enExample) |
| IL (2) | IL42174A (enExample) |
| NL (1) | NL7313347A (enExample) |
| SE (1) | SE7611410L (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4231928A (en) * | 1979-04-24 | 1980-11-04 | Bristol-Myers Company | Antibacterial agents |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4115566A (en) * | 1972-03-29 | 1978-09-19 | Ciba-Geigy Corporation | 7α Ureido cephem-4-carboxylic acid derivatives |
| US4202900A (en) * | 1972-09-27 | 1980-05-13 | Ciba-Geigy Corporation | Derivatives of penam-3-carboxylic acid and a pharmaceutical composition containing the same |
| DE2559932C2 (de) * | 1974-05-09 | 1983-04-21 | Toyama Chemical Co. Ltd., Tokyo | Cephalosporine, Verfahren zur Herstellung derselben und Mittel mit einem Gehalt derselben |
| US4160087A (en) * | 1974-09-06 | 1979-07-03 | Sumitomo Chemical Company, Limited | N-acylamino-α-arylacetamido cephalosporins |
| CA1074784A (en) * | 1974-09-06 | 1980-04-01 | Sumitomo Chemical Company | N-ACYLAMINO-.alpha.-ARYLACETAMIDO CEPHALOSPORINS |
| CH634848A5 (de) * | 1976-08-17 | 1983-02-28 | Fujisawa Pharmaceutical Co | Verfahren zur herstellung neuer 7-(n-substituierter 2-phenylglycinamido)-3-substituierte-3-cephem-4-carbonsaeuren. |
| JPS5331690A (en) * | 1976-09-01 | 1978-03-25 | Shionogi & Co Ltd | Oxadithiacephalosporins |
| IT1192287B (it) * | 1977-11-14 | 1988-03-31 | Fujisawa Pharmaceutical Co | Derivati di acido cefalosporanico ad azione farmaceutica e relativo procedimento di preparazione |
| JPS5492991A (en) * | 1977-12-28 | 1979-07-23 | Dainippon Pharmaceut Co Ltd | N-acyl cephalosporin derivative and its salt |
| DE2817228A1 (de) * | 1978-04-20 | 1979-10-31 | Bayer Ag | Verfahren zur herstellung halbsynthetischer beta-lactamantibiotika |
| US4198504A (en) * | 1978-11-02 | 1980-04-15 | Bristol-Myers Company | [3-(Pyridinium)-7-(naphthyiridinyl carbonylamino)acetamido]cephalosporanic acid derivatives |
| JPS5572195A (en) * | 1978-11-28 | 1980-05-30 | Mitsui Toatsu Chem Inc | Novel cephalosporin and antibacterial comprising it as active constituent |
| JPS5673087A (en) * | 1979-11-19 | 1981-06-17 | Eisai Co Ltd | Cephalosporin derivative, its preparation and antimicrobial agent consisting of the same |
| JPS55136292A (en) * | 1979-04-09 | 1980-10-23 | Eisai Co Ltd | Cephalosporin derivative, its preparation, and antibacterial comprising it |
| DE2924948A1 (de) * | 1979-06-21 | 1981-01-22 | Thomae Gmbh Dr K | Neue cephalosporine, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| JPS565487A (en) * | 1979-06-26 | 1981-01-20 | Eisai Co Ltd | Cephalosporin compound, its preparation, and antimicrobial comprising it |
| EP0067610A1 (en) * | 1981-06-16 | 1982-12-22 | Beecham Group Plc | Penicillins, a process for their preparation and compositions containing them |
| US4546176A (en) * | 1982-12-14 | 1985-10-08 | Eisai Co., Ltd. | 7-Carboxymethoxyphenylacetamido-3-cephem derivatives and antibacterial preparations containing the same |
| FR2669221B1 (fr) * | 1990-11-15 | 1993-01-15 | Rhone Poulenc Sante | Procede de preparation par compression directe de comprimes de derives de l'acide cephalosporanique. |
| US6274588B1 (en) * | 1999-05-31 | 2001-08-14 | Hoffmann-La Roche Inc. | 4-phenyl-pyrimidine derivatives |
| JO2308B1 (en) | 1999-05-31 | 2005-09-12 | اف. هوفمان- لاروش أيه جي | Derivatives of phenylpyrmidine |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3322749A (en) * | 1965-07-21 | 1967-05-30 | Bristol Myers Co | Derivatives of penicillanic acid and cephalosporanic acid |
| US3499893A (en) * | 1968-12-06 | 1970-03-10 | Bristol Myers Co | Pyrimidinyl- or diazepinylthioacetamidocephalosporanic acids |
| US3833570A (en) * | 1970-08-12 | 1974-09-03 | Bristol Myers Co | 7-(3-substituted-1,2,4-oxadiazole-5-one-4-acetamido)cephalosporanic acids and derivatives thereof |
| JPS569511B2 (enExample) * | 1972-03-15 | 1981-03-02 | ||
| US3825536A (en) * | 1972-09-22 | 1974-07-23 | Squibb & Sons Inc | Bis-cephalosporins |
| US3873523A (en) * | 1972-12-15 | 1975-03-25 | Parke Davis & Co | Derivatives of ampicillin |
| CA1022544A (en) * | 1972-12-21 | 1977-12-13 | Yukiyasu Murakami | Process of preparing a heterocyclic acyl group-substituted cephalosporin derivative |
-
1973
- 1973-01-01 AR AR250301A patent/AR208171A1/es active
- 1973-05-02 IL IL42174A patent/IL42174A/xx unknown
- 1973-09-06 IL IL43174A patent/IL43174A0/xx unknown
- 1973-09-06 IE IE1588/73A patent/IE38222B1/xx unknown
- 1973-09-11 CA CA180,798A patent/CA1074295A/en not_active Expired
- 1973-09-18 US US05/398,512 patent/US4015000A/en not_active Expired - Lifetime
- 1973-09-21 GB GB4434473A patent/GB1440216A/en not_active Expired
- 1973-09-21 DE DE19732347533 patent/DE2347533A1/de active Pending
- 1973-09-27 NL NL7313347A patent/NL7313347A/xx not_active Application Discontinuation
- 1973-09-27 DD DD173731A patent/DD107288A5/xx unknown
- 1973-09-28 FR FR7334803A patent/FR2201075B1/fr not_active Expired
- 1973-09-28 AT AT89875*A patent/ATA89875A/de not_active IP Right Cessation
- 1973-09-28 AT AT834873A patent/AT328614B/de not_active IP Right Cessation
-
1976
- 1976-10-14 SE SE7611410A patent/SE7611410L/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4231928A (en) * | 1979-04-24 | 1980-11-04 | Bristol-Myers Company | Antibacterial agents |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7313347A (enExample) | 1974-04-02 |
| DD107288A5 (enExample) | 1974-07-20 |
| AR208171A1 (es) | 1976-12-09 |
| IE38222B1 (en) | 1978-01-18 |
| AT328614B (de) | 1976-03-25 |
| IE38222L (en) | 1974-03-29 |
| US4015000A (en) | 1977-03-29 |
| FR2201075A1 (enExample) | 1974-04-26 |
| ATA834873A (de) | 1975-06-15 |
| FR2201075B1 (enExample) | 1976-08-13 |
| IL42174A (en) | 1975-08-31 |
| SE7611410L (sv) | 1976-10-14 |
| CA1074295A (en) | 1980-03-25 |
| DE2347533A1 (de) | 1974-04-04 |
| IL43174A0 (en) | 1973-11-28 |
| AU6078073A (en) | 1975-03-27 |
| ATA89875A (de) | 1975-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1440216A (en) | Derivatives of penam-3-carboxylic acid and cephem-4-carboxylic acid and processes for their manufacture | |
| IE831527L (en) | Preparation of azetidinooxazole derivatives | |
| GB1221855A (en) | Penicillin and cephalosporin derivatives | |
| GB1495676A (en) | Cephalosporins having an alpha-acylamino-acetic acid side chain | |
| IE40220L (en) | 7ó-methoxycephalosporin derivatives | |
| IE39549B1 (en) | Ureido-aryl cephalosporin compounds | |
| GB1289358A (enExample) | ||
| GB1427139A (en) | Penicillins | |
| AU1866388A (en) | New process for the preparation of cephem compounds and new cephalosporin derivatives | |
| GB1460916A (en) | Preparation of 3-thiolated-7-acylamido-cephalosporanic acid derivatives | |
| GB1429539A (en) | Derivatives of penam-3-carboxylic acid and cephem-4-carboxylic acid and processes for their manufacture | |
| GB1277415A (en) | Improvements in or relating to cephalosporin derivatives | |
| GB1425571A (en) | Penicillins and cephaosporins | |
| GB1377661A (en) | Oxofuryl ester derivatives of penicillin and cephalosporin | |
| US3956287A (en) | 7-[(2-Oxo-1-pyridinyl)acylamino]cephalosporin derivatives | |
| GB1469448A (en) | Cephem derivatives and process for preparing them | |
| GB1426869A (en) | Penicillins | |
| GB1443738A (en) | Chemical intermediates | |
| GB1474738A (en) | Cephalosporanic acid derivatives the preparation thereof and pharmaceutical compositions containing them | |
| US3956288A (en) | 7-[(2,4-Dioxo-1-pyrimidinyl)acylamino]cephalosporin derivatives | |
| GB1360860A (en) | Cepham compounds process for their manufacture and compositions containing them | |
| GB1421280A (en) | 3-heterocyclicthiomethylcephalosporins | |
| GB1421526A (en) | Penicillins and cephalosporins | |
| IE771799L (en) | Cephalosporins. | |
| GB1435220A (en) | Process for the preparation of cephalosporanic acid derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |