GB1424437A - Amidoxime deriatives - Google Patents
Amidoxime deriativesInfo
- Publication number
- GB1424437A GB1424437A GB1797073A GB1797073A GB1424437A GB 1424437 A GB1424437 A GB 1424437A GB 1797073 A GB1797073 A GB 1797073A GB 1797073 A GB1797073 A GB 1797073A GB 1424437 A GB1424437 A GB 1424437A
- Authority
- GB
- United Kingdom
- Prior art keywords
- reacting
- prepared
- alkyl
- amidoxime
- methylvaleramidoxime
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- SFZULDYEOVSIKM-UHFFFAOYSA-N chembl321317 Chemical compound C1=CC(C(=N)NO)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=N)NO)O1 SFZULDYEOVSIKM-UHFFFAOYSA-N 0.000 title abstract 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 abstract 3
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 229910052739 hydrogen Inorganic materials 0.000 abstract 3
- -1 polymethylene chain Polymers 0.000 abstract 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 abstract 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract 2
- 150000001805 chlorine compounds Chemical class 0.000 abstract 2
- ZNVDYFDUFZPVBB-UHFFFAOYSA-N n-hydroxy-n'-methylpentanimidamide Chemical compound CCCCC(NO)=NC ZNVDYFDUFZPVBB-UHFFFAOYSA-N 0.000 abstract 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 abstract 1
- JLYWPJHSOIEDFY-UHFFFAOYSA-N 1-(3-butyl-2H-oxadiazol-4-yl)ethanone Chemical compound C(CCC)N1NOC=C1C(C)=O JLYWPJHSOIEDFY-UHFFFAOYSA-N 0.000 abstract 1
- JPKUAJXQADXHCK-UHFFFAOYSA-N 3-butyl-2H-oxadiazole Chemical compound C(CCC)N1NOC=C1 JPKUAJXQADXHCK-UHFFFAOYSA-N 0.000 abstract 1
- GSNPVPVGAZJXEJ-UHFFFAOYSA-N 3-butyl-4-methyl-2H-oxadiazole Chemical compound C(CCC)N1NOC=C1C GSNPVPVGAZJXEJ-UHFFFAOYSA-N 0.000 abstract 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 abstract 1
- 206010020772 Hypertension Diseases 0.000 abstract 1
- 229910010082 LiAlH Inorganic materials 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- 229910052799 carbon Inorganic materials 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 239000000460 chlorine Substances 0.000 abstract 1
- 229910052801 chlorine Inorganic materials 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 239000003937 drug carrier Substances 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 abstract 1
- 239000012948 isocyanate Substances 0.000 abstract 1
- 150000002513 isocyanates Chemical class 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 150000003141 primary amines Chemical class 0.000 abstract 1
- 150000003335 secondary amines Chemical class 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
- C07D271/07—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/12—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. N-hydroxyamidines
- C07C259/14—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. N-hydroxyamidines having carbon atoms of hydroxamidine groups bound to hydrogen atoms or to acyclic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US24527072A | 1972-04-18 | 1972-04-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1424437A true GB1424437A (en) | 1976-02-11 |
Family
ID=22925997
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB1797073A Expired GB1424437A (en) | 1972-04-18 | 1973-04-13 | Amidoxime deriatives |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS4914426A (enExample) |
| AU (1) | AU5426873A (enExample) |
| BE (1) | BE798218A (enExample) |
| DE (1) | DE2318960A1 (enExample) |
| FR (1) | FR2182974B1 (enExample) |
| GB (1) | GB1424437A (enExample) |
| HU (1) | HU164731B (enExample) |
| IL (1) | IL41692A0 (enExample) |
| LU (1) | LU67441A1 (enExample) |
| NL (1) | NL7305377A (enExample) |
| ZA (1) | ZA731406B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS569480A (en) * | 1979-07-03 | 1981-01-30 | Nippon Hardboard | Production of fibrous deep drawn molded product |
| JPS60167958A (ja) * | 1984-02-06 | 1985-08-31 | 旭化成株式会社 | 改良された不織布及びその製造方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL33612A (en) * | 1969-01-08 | 1973-06-29 | Du Pont | Amidoxime o-carbamates,their preparation and their use as antihypertensive agents |
-
1973
- 1973-02-28 ZA ZA731406A patent/ZA731406B/xx unknown
- 1973-03-05 IL IL41692A patent/IL41692A0/xx unknown
- 1973-04-09 AU AU54268/73A patent/AU5426873A/en not_active Expired
- 1973-04-13 GB GB1797073A patent/GB1424437A/en not_active Expired
- 1973-04-13 BE BE130017A patent/BE798218A/xx unknown
- 1973-04-14 DE DE2318960A patent/DE2318960A1/de active Pending
- 1973-04-16 LU LU67441A patent/LU67441A1/xx unknown
- 1973-04-17 HU HU73DU201A patent/HU164731B/hu unknown
- 1973-04-17 NL NL7305377A patent/NL7305377A/xx unknown
- 1973-04-17 FR FR7313883A patent/FR2182974B1/fr not_active Expired
- 1973-04-18 JP JP48043271A patent/JPS4914426A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| ZA731406B (en) | 1974-10-30 |
| DE2318960A1 (de) | 1973-11-08 |
| JPS4914426A (enExample) | 1974-02-07 |
| HU164731B (en) | 1974-04-27 |
| IL41692A0 (en) | 1973-05-31 |
| BE798218A (fr) | 1973-07-31 |
| FR2182974A1 (enExample) | 1973-12-14 |
| LU67441A1 (enExample) | 1973-07-05 |
| FR2182974B1 (enExample) | 1976-07-02 |
| NL7305377A (enExample) | 1973-10-22 |
| AU5426873A (en) | 1974-10-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1463575A (en) | Vinca alkaloid derivatives | |
| ES357247A1 (es) | Procedimiento para la preparacion de un nuevo derivado de tetrahidroacepina. | |
| GB1377231A (en) | Basically substituted benzyl-phthalazinone derivatives acid addition salts thereof and process for the production thereof | |
| GB1424437A (en) | Amidoxime deriatives | |
| GB1295228A (enExample) | ||
| GB1413455A (en) | Alpha-cycloalkylbenzyl lactamimides | |
| GB1355718A (en) | 2-amino-5-chloro-thiazole derivatives | |
| GB1420067A (en) | Aryldiamides | |
| GB1379940A (en) | Carbazole derivatives | |
| GB1382769A (en) | 3-substituted phenothiazine derivatives | |
| IE35023B1 (en) | Bis-basic ketones of fluorene and fluorenone | |
| AU5899296A (en) | (2-morpholinylmethyl)benzamide derivatives | |
| GB1374820A (en) | Substituted dioxypiperidines and a process for the preparation thereof | |
| GB1429571A (en) | 4-aryl-5-aminoalkyl-4-oxazolin-2ones | |
| GB1269404A (en) | 0-substituted-2,5-diphenylpyrroles | |
| ES453664A1 (es) | Un procedimiento para la produccion de derivados de 2,3-di- hidro-1 h-, 4-diazepina. | |
| GB1448966A (en) | Amine derivatives of azidophenols | |
| GB1281433A (en) | Allene polymines and manufacture thereof | |
| GB1340637A (en) | Dibenzocycloheptadioxolan derivatives | |
| GB1419666A (en) | Carbazole derivatives | |
| GB1315355A (en) | Benzotriazole derivatives | |
| GB1203430A (en) | Heterocyclic spiro compounds | |
| GB1245155A (en) | NOVEL 5-SUBSTITUTED-gamma-CARBOLINE DERIVATIVES AND THE SALTS THEREOF | |
| GB1244592A (en) | Amidoxime-o-carbamates | |
| GB1453910A (en) | Benzazepine derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PLNP | Patent lapsed through nonpayment of renewal fees |