GB1327640A - Basically substituted - Google Patents
Basically substitutedInfo
- Publication number
- GB1327640A GB1327640A GB4786271A GB4786271A GB1327640A GB 1327640 A GB1327640 A GB 1327640A GB 4786271 A GB4786271 A GB 4786271A GB 4786271 A GB4786271 A GB 4786271A GB 1327640 A GB1327640 A GB 1327640A
- Authority
- GB
- United Kingdom
- Prior art keywords
- formula
- carbon atoms
- compound
- nitrogen atom
- integers
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910052757 nitrogen Inorganic materials 0.000 abstract 4
- 125000004432 carbon atom Chemical group C* 0.000 abstract 3
- 150000001875 compounds Chemical class 0.000 abstract 3
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 abstract 2
- 125000003545 alkoxy group Chemical group 0.000 abstract 2
- PKORYTIUMAOPED-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinazoline Chemical compound C1=CC=C2NCNCC2=C1 PKORYTIUMAOPED-UHFFFAOYSA-N 0.000 abstract 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 abstract 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 abstract 1
- 125000003341 7 membered heterocyclic group Chemical group 0.000 abstract 1
- 125000001931 aliphatic group Chemical group 0.000 abstract 1
- 150000001412 amines Chemical class 0.000 abstract 1
- 230000000916 dilatatory effect Effects 0.000 abstract 1
- 239000003085 diluting agent Substances 0.000 abstract 1
- 239000000543 intermediate Substances 0.000 abstract 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 abstract 1
- 238000007911 parenteral administration Methods 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 125000004434 sulfur atom Chemical group 0.000 abstract 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/95—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in positions 2 and 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702050640 DE2050640A1 (de) | 1970-10-15 | 1970-10-15 | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons |
| US18756271A | 1971-10-07 | 1971-10-07 | |
| US00351832A US3855225A (en) | 1970-10-15 | 1973-04-17 | Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives |
| US00351830A US3855223A (en) | 1970-10-15 | 1973-04-17 | Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives |
| US00351831A US3855224A (en) | 1970-10-15 | 1973-04-17 | Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1327640A true GB1327640A (en) | 1973-08-22 |
Family
ID=27510128
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB4786271A Expired GB1327640A (en) | 1970-10-15 | 1971-10-14 | Basically substituted |
Country Status (8)
| Country | Link |
|---|---|
| US (4) | US3793320A (enExample) |
| AU (1) | AU3458571A (enExample) |
| BE (1) | BE773965R (enExample) |
| CA (1) | CA947762A (enExample) |
| DE (1) | DE2050640A1 (enExample) |
| FR (1) | FR2110444B2 (enExample) |
| GB (1) | GB1327640A (enExample) |
| NL (1) | NL7113449A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2050640A1 (de) * | 1970-10-15 | 1972-04-20 | Cassella Farbwerke Mainkur Ag, 6000 Frankfurt | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3296447A (en) * | 1965-10-19 | 1967-01-03 | Searle & Co | 7-ureido-2, 4-dioxo-1, 2, 3, 4, 5, 6-hexahydro-pyrido [2, 3-d]-pyrimidines |
| DE1934036A1 (de) * | 1969-07-04 | 1971-01-07 | Cassella Farbwerke Mainkur Ag | Basisch substituierte Derivate des 2,4-(1H,3H)-Chinazolindions |
| DE2037693C3 (de) * | 1969-08-02 | 1975-01-16 | Sumitomo Chemical Co., Ltd., Osaka (Japan) | 1-Cyclopropylmethyl-2(1 H)-chinazolinonderivate |
| DE2020233A1 (de) * | 1970-04-25 | 1971-11-18 | Cassella Farbwerke Mainkur Ag | Basisch substituierte Derivate des 4(3H)-Chinazolinons |
| US3764600A (en) * | 1970-10-06 | 1973-10-09 | Sandoz Ag | 1-substituted-quinazoline-2(1h)-thiones |
| DE2050640A1 (de) * | 1970-10-15 | 1972-04-20 | Cassella Farbwerke Mainkur Ag, 6000 Frankfurt | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons |
-
1970
- 1970-10-15 DE DE19702050640 patent/DE2050640A1/de active Pending
-
1971
- 1971-09-30 NL NL7113449A patent/NL7113449A/xx unknown
- 1971-10-07 US US00187562A patent/US3793320A/en not_active Expired - Lifetime
- 1971-10-14 CA CA125,120A patent/CA947762A/en not_active Expired
- 1971-10-14 GB GB4786271A patent/GB1327640A/en not_active Expired
- 1971-10-14 BE BE773965A patent/BE773965R/xx active
- 1971-10-14 AU AU34585/71A patent/AU3458571A/en not_active Expired
- 1971-10-14 FR FR7136929A patent/FR2110444B2/fr not_active Expired
-
1973
- 1973-04-17 US US00351830A patent/US3855223A/en not_active Expired - Lifetime
- 1973-04-17 US US00351832A patent/US3855225A/en not_active Expired - Lifetime
- 1973-04-17 US US00351831A patent/US3855224A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US3793320A (en) | 1974-02-19 |
| CA947762A (en) | 1974-05-21 |
| NL7113449A (enExample) | 1972-04-18 |
| BE773965R (fr) | 1972-04-14 |
| AU3458571A (en) | 1973-04-19 |
| FR2110444B2 (enExample) | 1974-09-06 |
| DE2050640A1 (de) | 1972-04-20 |
| US3855225A (en) | 1974-12-17 |
| US3855224A (en) | 1974-12-17 |
| US3855223A (en) | 1974-12-17 |
| FR2110444A2 (enExample) | 1972-06-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU591390B2 (en) | Arylcyclobutylalkyl amines and their use as antidepressive medicines | |
| GB1507957A (en) | Nitrofuryl-pyrazole derivatives methods for producing them and medicaments comprising them | |
| GB1369247A (en) | Amines the preparation thereof and their use in pharmaceutical compositions | |
| GB1301243A (enExample) | ||
| GB1294678A (en) | New cyclic ketal derivatives and a process for the preparation thereof | |
| GB1184762A (en) | Process for the production of Coumarin Derivatives | |
| GB1327640A (en) | Basically substituted | |
| GB1315566A (en) | Penicillanic acid derivatives | |
| GB1206572A (en) | New basically substituted coumarin derivatives and process for the production thereof | |
| GB1383888A (en) | Amino ether derivatives of orthothymatic esters | |
| GB1365770A (en) | Basically substituted 1/2h/-phtalazinone derivatives and proce sses for the production thereof | |
| GB1394791A (en) | Diphenylalkyllactamimide derivatives | |
| GB1207930A (en) | Azacycloaliphatic compounds, process for their manufacture and compositions containing them | |
| GB1361863A (en) | Piperazine derivatives their preparation and pharmaceutical compositions containing them | |
| GB1156781A (en) | New Heterocyclic Compounds | |
| GB1460811A (en) | Bis-benzamido-benzoic acid derivatives | |
| GB1469430A (en) | Daunomycin derivatives | |
| GB1385639A (en) | Basically substituted coumarin derivatives | |
| GB1262052A (en) | Dibenzofuran derivatives | |
| GB1292417A (en) | 4-amino-2-(5-nitro-2-thienyl) quinazolines, their preparation, and compositions containing them | |
| GB1441873A (en) | Diamino-benzophenones | |
| GB1380009A (en) | Cyclic derivatives of 1,4-benzene disulphonamide | |
| GB1320548A (en) | Nitrofurylaminoalkoxy-pyrimidines | |
| GB1418831A (en) | Reserpine derivatives | |
| GB1393979A (en) | Piperidine derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PLNP | Patent lapsed through nonpayment of renewal fees |