CA947762A - Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives - Google Patents
Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivativesInfo
- Publication number
- CA947762A CA947762A CA125,120A CA125120A CA947762A CA 947762 A CA947762 A CA 947762A CA 125120 A CA125120 A CA 125120A CA 947762 A CA947762 A CA 947762A
- Authority
- CA
- Canada
- Prior art keywords
- thion
- quinazoline
- derivatives
- basically substituted
- basically
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- PUPFOFVEHDNUJU-UHFFFAOYSA-N 2-sulfanylidene-1h-quinazolin-4-one Chemical class C1=CC=C2C(=O)NC(S)=NC2=C1 PUPFOFVEHDNUJU-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/95—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in positions 2 and 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702050640 DE2050640A1 (de) | 1970-10-15 | 1970-10-15 | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons |
| US18756271A | 1971-10-07 | 1971-10-07 | |
| US00351832A US3855225A (en) | 1970-10-15 | 1973-04-17 | Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives |
| US00351830A US3855223A (en) | 1970-10-15 | 1973-04-17 | Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives |
| US00351831A US3855224A (en) | 1970-10-15 | 1973-04-17 | Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA947762A true CA947762A (en) | 1974-05-21 |
Family
ID=27510128
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA125,120A Expired CA947762A (en) | 1970-10-15 | 1971-10-14 | Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives |
Country Status (8)
| Country | Link |
|---|---|
| US (4) | US3793320A (enExample) |
| AU (1) | AU3458571A (enExample) |
| BE (1) | BE773965R (enExample) |
| CA (1) | CA947762A (enExample) |
| DE (1) | DE2050640A1 (enExample) |
| FR (1) | FR2110444B2 (enExample) |
| GB (1) | GB1327640A (enExample) |
| NL (1) | NL7113449A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2050640A1 (de) * | 1970-10-15 | 1972-04-20 | Cassella Farbwerke Mainkur Ag, 6000 Frankfurt | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3296447A (en) * | 1965-10-19 | 1967-01-03 | Searle & Co | 7-ureido-2, 4-dioxo-1, 2, 3, 4, 5, 6-hexahydro-pyrido [2, 3-d]-pyrimidines |
| DE1934036A1 (de) * | 1969-07-04 | 1971-01-07 | Cassella Farbwerke Mainkur Ag | Basisch substituierte Derivate des 2,4-(1H,3H)-Chinazolindions |
| DE2037693C3 (de) * | 1969-08-02 | 1975-01-16 | Sumitomo Chemical Co., Ltd., Osaka (Japan) | 1-Cyclopropylmethyl-2(1 H)-chinazolinonderivate |
| DE2020233A1 (de) * | 1970-04-25 | 1971-11-18 | Cassella Farbwerke Mainkur Ag | Basisch substituierte Derivate des 4(3H)-Chinazolinons |
| US3764600A (en) * | 1970-10-06 | 1973-10-09 | Sandoz Ag | 1-substituted-quinazoline-2(1h)-thiones |
| DE2050640A1 (de) * | 1970-10-15 | 1972-04-20 | Cassella Farbwerke Mainkur Ag, 6000 Frankfurt | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons |
-
1970
- 1970-10-15 DE DE19702050640 patent/DE2050640A1/de active Pending
-
1971
- 1971-09-30 NL NL7113449A patent/NL7113449A/xx unknown
- 1971-10-07 US US00187562A patent/US3793320A/en not_active Expired - Lifetime
- 1971-10-14 CA CA125,120A patent/CA947762A/en not_active Expired
- 1971-10-14 GB GB4786271A patent/GB1327640A/en not_active Expired
- 1971-10-14 BE BE773965A patent/BE773965R/xx active
- 1971-10-14 AU AU34585/71A patent/AU3458571A/en not_active Expired
- 1971-10-14 FR FR7136929A patent/FR2110444B2/fr not_active Expired
-
1973
- 1973-04-17 US US00351830A patent/US3855223A/en not_active Expired - Lifetime
- 1973-04-17 US US00351832A patent/US3855225A/en not_active Expired - Lifetime
- 1973-04-17 US US00351831A patent/US3855224A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US3793320A (en) | 1974-02-19 |
| NL7113449A (enExample) | 1972-04-18 |
| BE773965R (fr) | 1972-04-14 |
| AU3458571A (en) | 1973-04-19 |
| GB1327640A (en) | 1973-08-22 |
| FR2110444B2 (enExample) | 1974-09-06 |
| DE2050640A1 (de) | 1972-04-20 |
| US3855225A (en) | 1974-12-17 |
| US3855224A (en) | 1974-12-17 |
| US3855223A (en) | 1974-12-17 |
| FR2110444A2 (enExample) | 1972-06-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU3419571A (en) | Pyridoquinoline derivatives | |
| CA1021352A (en) | Substituted 2-aminomethyl-4,6-dihalophenols | |
| AU3680271A (en) | Triazolobenzodiazepine derivatives | |
| AU3519871A (en) | Ergolene derivatives | |
| AU466979B2 (en) | Nitrofuran derivatives | |
| AU470485B2 (en) | Substituted 2-aminomethylphenol derivatives | |
| CA947762A (en) | Basically substituted (1h,3h)-quinazoline-2-thion-4-one derivatives | |
| AU448423B2 (en) | Triazolobenzodiazepine derivatives | |
| CA995235A (en) | Substituted carbamoyloxyphenylurea derivatives | |
| AU452257B2 (en) | New adenosine derivatives | |
| ZA716869B (en) | Basically substituted(1h,3h)-quinazoline-2-thion-4-one derivatives | |
| AU3306971A (en) | Leucauramine derivatives | |
| AU446117B2 (en) | Dihydropyrimidopyridazine derivatives | |
| AU2648271A (en) | 2-amino-imidazol-2-ine derivatives | |
| CA844623A (en) | Pyrimidine derivatives | |
| AU454945B2 (en) | Pyrimidine derivatives | |
| CA853211A (en) | Pyrimidine derivatives | |
| CA835990A (en) | 1,2-dihydro-1-hydroxy-2-carboxyacyl-imino-6-lower-alkyl pyrimidine derivatives | |
| AU452480B2 (en) | Substituted chromenol derivatives | |
| AU454746B2 (en) | Substituted carbamoyoxyphenuylurea derivatives | |
| CA838126A (en) | Certain n11-substituted pyridobenzodiazepine derivatives | |
| CA854712A (en) | Certain n11-substituted pyridobenzodiazepine derivatives | |
| CA843449A (en) | Indenopyridine derivatives | |
| AU448024B2 (en) | Phenylaklane derivatives | |
| AU448194B2 (en) | Dibenzothiopene derivatives |