GB1171670A - Derivatives of 4-Aryl-3-Hydroxybutyric Acid - Google Patents
Derivatives of 4-Aryl-3-Hydroxybutyric AcidInfo
- Publication number
- GB1171670A GB1171670A GB51987/67A GB5198767A GB1171670A GB 1171670 A GB1171670 A GB 1171670A GB 51987/67 A GB51987/67 A GB 51987/67A GB 5198767 A GB5198767 A GB 5198767A GB 1171670 A GB1171670 A GB 1171670A
- Authority
- GB
- United Kingdom
- Prior art keywords
- aryl
- alkyl
- hydroxybutyric acid
- formula
- acid derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000000217 alkyl group Chemical group 0.000 abstract 4
- 150000001875 compounds Chemical class 0.000 abstract 2
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 abstract 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 150000001412 amines Chemical class 0.000 abstract 1
- 230000003110 anti-inflammatory effect Effects 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 239000003937 drug carrier Substances 0.000 abstract 1
- 239000007788 liquid Substances 0.000 abstract 1
- 230000020477 pH reduction Effects 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 abstract 1
- 229910052708 sodium Inorganic materials 0.000 abstract 1
- 239000011734 sodium Substances 0.000 abstract 1
- 239000007787 solid Substances 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/32—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings
- C07C235/34—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/04—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups without replacement of the other oxygen atom of the carboxyl group, e.g. hydroxamic acids
- C07C259/06—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups without replacement of the other oxygen atom of the carboxyl group, e.g. hydroxamic acids having carbon atoms of hydroxamic groups bound to hydrogen atoms or to acyclic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB51987/67A GB1171670A (en) | 1967-11-15 | 1967-11-15 | Derivatives of 4-Aryl-3-Hydroxybutyric Acid |
| IE1309/68A IE32535B1 (en) | 1967-11-15 | 1968-10-31 | Derivatives of 4-aryl-3-hydroxybutyric acid |
| AT1099568A AT283330B (de) | 1967-11-15 | 1968-11-12 | Verfahren zur Herstellung neuer, substituierter γ-Phenyl-β-hydroxybuttersäureamide |
| NL6816143A NL6816143A (enExample) | 1967-11-15 | 1968-11-13 | |
| BR204068/68A BR6804068D0 (pt) | 1967-11-15 | 1968-11-14 | Processo para a preparacao de amidas substituidas |
| BE723917D BE723917A (enExample) | 1967-11-15 | 1968-11-14 | |
| NO4515/68A NO125272B (enExample) | 1967-11-15 | 1968-11-14 | |
| FR1591547D FR1591547A (enExample) | 1967-11-15 | 1968-11-14 | |
| DK557868AA DK124536B (da) | 1967-11-15 | 1968-11-15 | Analogifremgangsmåde til fremstilling af 4-aryl-3-hydroxybutyrohydroxamsyre. |
| SE15526/68A SE363503B (enExample) | 1967-11-15 | 1968-11-15 | |
| US776264A US3641123A (en) | 1967-11-15 | 1968-11-15 | Substituted amides of 4-aryl-3-hydroxy butyric acids |
| CH1708268A CH507206A (de) | 1967-11-15 | 1968-11-15 | Verfahren zur Herstellung substituierter 4-Aryl-3-hydroxybutyramide |
| DE19681809256 DE1809256C3 (de) | 1967-11-15 | 1968-11-15 | 4- (p- Diphenylyl) -3-hydroxy butyrohydroxamsäure, Verfahren zu ihrer Herstellung und dieses enthaltende pharmazeutische Präparate |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB51987/67A GB1171670A (en) | 1967-11-15 | 1967-11-15 | Derivatives of 4-Aryl-3-Hydroxybutyric Acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1171670A true GB1171670A (en) | 1969-11-26 |
Family
ID=10462202
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB51987/67A Expired GB1171670A (en) | 1967-11-15 | 1967-11-15 | Derivatives of 4-Aryl-3-Hydroxybutyric Acid |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3641123A (enExample) |
| AT (1) | AT283330B (enExample) |
| BE (1) | BE723917A (enExample) |
| BR (1) | BR6804068D0 (enExample) |
| CH (1) | CH507206A (enExample) |
| DK (1) | DK124536B (enExample) |
| FR (1) | FR1591547A (enExample) |
| GB (1) | GB1171670A (enExample) |
| IE (1) | IE32535B1 (enExample) |
| NL (1) | NL6816143A (enExample) |
| NO (1) | NO125272B (enExample) |
| SE (1) | SE363503B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4826873A (en) * | 1986-01-20 | 1989-05-02 | Chinese Academy Of Medical Sciences | 2,3-dihydroxy-3-phenyl-N-(2-phenyl-ethyl)-propionic acid amides derivatives thereof |
| EP2388247A3 (en) * | 2010-05-18 | 2012-01-04 | Taipei Medical University | Histone deacetylase inhibitors |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2128277B2 (enExample) * | 1970-05-05 | 1979-06-22 | Rorer Inc William H | |
| US4061668A (en) * | 1974-12-06 | 1977-12-06 | Societa Italo-Britannica L. Manetti - H. Roberts & C. | Process for the preparation of 2-(4-isobutylphenyl)-propiohydroxamic acid |
| US4109013A (en) * | 1974-12-20 | 1978-08-22 | Klinge Pharma Gmbh & Co. | Substituted propanol-(2) derivatives of hydroxamic acids and the use thereof as hypolipemic drugs |
| US4173652A (en) * | 1976-12-18 | 1979-11-06 | Akzona Incorporated | Pharmaceutical hydroxamic acid compositions and uses thereof |
| NL7614113A (nl) * | 1976-12-18 | 1978-06-20 | Akzo Nv | Hydroxamzuren. |
| FR2433505A1 (fr) * | 1978-08-18 | 1980-03-14 | Soissonnais Sucrerie | Procede de fabrication des acides phenoxylactiques, de leurs derives et produits obtenus |
| CN102267923B (zh) * | 2010-06-04 | 2015-07-15 | 台北医学大学 | 组蛋白去乙酰化酶抑制剂 |
-
1967
- 1967-11-15 GB GB51987/67A patent/GB1171670A/en not_active Expired
-
1968
- 1968-10-31 IE IE1309/68A patent/IE32535B1/xx unknown
- 1968-11-12 AT AT1099568A patent/AT283330B/de not_active IP Right Cessation
- 1968-11-13 NL NL6816143A patent/NL6816143A/xx unknown
- 1968-11-14 FR FR1591547D patent/FR1591547A/fr not_active Expired
- 1968-11-14 BE BE723917D patent/BE723917A/xx unknown
- 1968-11-14 NO NO4515/68A patent/NO125272B/no unknown
- 1968-11-14 BR BR204068/68A patent/BR6804068D0/pt unknown
- 1968-11-15 SE SE15526/68A patent/SE363503B/xx unknown
- 1968-11-15 CH CH1708268A patent/CH507206A/de not_active IP Right Cessation
- 1968-11-15 DK DK557868AA patent/DK124536B/da unknown
- 1968-11-15 US US776264A patent/US3641123A/en not_active Expired - Lifetime
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4826873A (en) * | 1986-01-20 | 1989-05-02 | Chinese Academy Of Medical Sciences | 2,3-dihydroxy-3-phenyl-N-(2-phenyl-ethyl)-propionic acid amides derivatives thereof |
| EP2388247A3 (en) * | 2010-05-18 | 2012-01-04 | Taipei Medical University | Histone deacetylase inhibitors |
| US8242282B2 (en) | 2010-05-18 | 2012-08-14 | Taipei Medical University | Histone deacetylase inhibitors |
Also Published As
| Publication number | Publication date |
|---|---|
| CH507206A (de) | 1971-05-15 |
| NL6816143A (enExample) | 1969-05-19 |
| IE32535B1 (en) | 1973-09-05 |
| BR6804068D0 (pt) | 1973-01-11 |
| BE723917A (enExample) | 1969-04-16 |
| NO125272B (enExample) | 1972-08-14 |
| SE363503B (enExample) | 1974-01-21 |
| IE32535L (en) | 1969-05-15 |
| US3641123A (en) | 1972-02-08 |
| DK124536B (da) | 1972-10-30 |
| AT283330B (de) | 1970-08-10 |
| FR1591547A (enExample) | 1970-04-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1159449A (en) | New Piperidinoalkanol Derivatives | |
| GB1171670A (en) | Derivatives of 4-Aryl-3-Hydroxybutyric Acid | |
| GB1322512A (en) | Substituted azetidinones and process for their manufacture | |
| GB1271466A (en) | Thiocarbamic acid derivatives | |
| GB1496491A (en) | Dihydroergopeptine derivatives | |
| GB1409648A (en) | Substituted pyrrolidinemethanol compounds and pharmaceutical compositions thereof | |
| GB1262292A (en) | Novel thiazoline derivatives, the preparation thereof and compositions containing the same | |
| GB1421589A (en) | Salicylanilide derivatives | |
| GB1255751A (en) | Herbicidal agents | |
| GB1195319A (en) | Alkyl Sulfate Salts of 1-(p-Chlorobenzhydryl)-4-Methylhomopiperazines | |
| GB1136918A (en) | Propanolamine derivatives | |
| GB1468079A (en) | Ethanolamine derivatives | |
| SE7408868L (enExample) | ||
| GB1203430A (en) | Heterocyclic spiro compounds | |
| GB1384523A (en) | Oxime derivatives and their preparation | |
| GB1245155A (en) | NOVEL 5-SUBSTITUTED-gamma-CARBOLINE DERIVATIVES AND THE SALTS THEREOF | |
| GB1305725A (enExample) | ||
| GB1388041A (en) | Benzimidazolyl sulphides and sulphones | |
| GB1339010A (en) | Tetrazolyl-anthraquinone derivatives | |
| GB1289658A (enExample) | ||
| GB1284423A (en) | Cyclohexa-1,4-diene-1-acetic acids | |
| GB1306396A (enExample) | ||
| GB1232780A (enExample) | ||
| GB1164496A (en) | 0-Oxaphenanthridine Derivatives and Method for the Preparation | |
| GB1171208A (en) | (N-Nitrosoamino)-Guanidines |