GB1139985A - Basically substituted 2-imidazolidone derivatives and their production - Google Patents
Basically substituted 2-imidazolidone derivatives and their productionInfo
- Publication number
- GB1139985A GB1139985A GB32226/67A GB3222667A GB1139985A GB 1139985 A GB1139985 A GB 1139985A GB 32226/67 A GB32226/67 A GB 32226/67A GB 3222667 A GB3222667 A GB 3222667A GB 1139985 A GB1139985 A GB 1139985A
- Authority
- GB
- United Kingdom
- Prior art keywords
- formula
- compound
- reacted
- alkyl
- imidazolidone
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical class O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 title abstract 3
- 150000001875 compounds Chemical class 0.000 abstract 5
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 150000001412 amines Chemical class 0.000 abstract 2
- 125000004185 ester group Chemical group 0.000 abstract 2
- 229910052757 nitrogen Inorganic materials 0.000 abstract 2
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 2
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 abstract 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 239000005864 Sulphur Substances 0.000 abstract 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000002947 alkylene group Chemical group 0.000 abstract 1
- 230000003474 anti-emetic effect Effects 0.000 abstract 1
- 239000002111 antiemetic agent Substances 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 239000004202 carbamide Substances 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 abstract 1
- 230000003197 catalytic effect Effects 0.000 abstract 1
- 125000004093 cyano group Chemical group *C#N 0.000 abstract 1
- 239000003085 diluting agent Substances 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 230000002936 tranquilizing effect Effects 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/30—Oxygen or sulfur atoms
- C07D233/32—One oxygen atom
- C07D233/36—One oxygen atom with hydrocarbon radicals, substituted by nitrogen atoms, attached to ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/30—Oxygen or sulfur atoms
- C07D233/32—One oxygen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0049713 | 1966-07-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1139985A true GB1139985A (en) | 1969-01-15 |
Family
ID=7103223
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB32226/67A Expired GB1139985A (en) | 1966-07-16 | 1967-07-13 | Basically substituted 2-imidazolidone derivatives and their production |
Country Status (5)
| Country | Link |
|---|---|
| BE (1) | BE701422A (es) |
| ES (2) | ES343093A1 (es) |
| FR (1) | FR6589M (es) |
| GB (1) | GB1139985A (es) |
| NL (1) | NL6709697A (es) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0587134A2 (de) * | 1992-09-11 | 1994-03-16 | Dr. Karl Thomae GmbH | Cyclische Harnstoffderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung |
-
1967
- 1967-07-12 NL NL6709697A patent/NL6709697A/xx unknown
- 1967-07-13 GB GB32226/67A patent/GB1139985A/en not_active Expired
- 1967-07-14 BE BE701422D patent/BE701422A/xx unknown
- 1967-07-15 ES ES343093A patent/ES343093A1/es not_active Expired
- 1967-08-12 ES ES344072A patent/ES344072A1/es not_active Expired
- 1967-10-12 FR FR124290A patent/FR6589M/fr not_active Expired
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0587134A2 (de) * | 1992-09-11 | 1994-03-16 | Dr. Karl Thomae GmbH | Cyclische Harnstoffderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung |
| EP0587134A3 (en) * | 1992-09-11 | 1994-07-06 | Thomae Gmbh Dr K | Cyclic urea derivatives, medicaments containing them and process for their preparation |
| US5681841A (en) * | 1992-09-11 | 1997-10-28 | Karl Thomae Gmbh | Cyclic urea derivatives, pharmaceutical compositions containing these compounds and processes for preparing them |
| US5880284A (en) * | 1992-09-11 | 1999-03-09 | Dr. Karl Thomae Gmbh | Cyclic urea derivatives, pharmaceutical compositions containing these compounds and processes for preparing them |
Also Published As
| Publication number | Publication date |
|---|---|
| BE701422A (es) | 1968-01-15 |
| ES343093A1 (es) | 1968-08-16 |
| NL6709697A (es) | 1968-01-17 |
| FR6589M (es) | 1968-12-30 |
| ES344072A1 (es) | 1968-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1164503A (en) | Azaspiroalkanediones, process for preparing the same and Pharmaceutical Compositions comprising the same | |
| GB1345880A (en) | Pyridazine derivatives | |
| GB1325192A (en) | Phloroglucinol derivatives | |
| GB1466646A (en) | Substituted benzamides | |
| GB1385543A (en) | Alpha-thioureidocehalosporanic acid compounds | |
| GB1450010A (en) | Preparation of triamino pyrimidine n-oxides | |
| GB1197479A (en) | 3,1-Benzoxazine Derivatives and Process for their Manufacture | |
| GB1422266A (en) | Diazepine derivatives and processes for their production | |
| GB1436307A (en) | Diaromatic o-aminoalkyl-oximes | |
| GB1477302A (en) | Triazolo-isoindole and triazolo-isoquinoline derivatives and their manufacture and uses | |
| GB1342321A (en) | Nitrofuran derivatives | |
| GB1139985A (en) | Basically substituted 2-imidazolidone derivatives and their production | |
| GB1475513A (en) | Benzylamine derivatives process for science union et cie benzylamine derivatives process for their production and pharmaceutical compositions containing them | |
| GB1446833A (en) | Hydroxamic acid derivatives of substituted a-aminooxycarboxylic acids and a process for the preparation thereof | |
| GB1447329A (en) | Preparation of sulphonyl-benzamide derivatives | |
| GB1466822A (en) | Substituted benzamides | |
| GB1254270A (en) | Benzoxazepine derivatives | |
| GB1428883A (en) | 1,3-benzoxazine and phenyl-alkylamine derivatives | |
| GB1479854A (en) | Thieno(3,2-f)-s-triazolo(1,5-alpha)(1,4)-diazepine-2-carboxamides | |
| GB1445257A (en) | Preparation | |
| GB1324687A (en) | 3-amino-delta2-pyrazoline derivatives and process for the preparation thereof | |
| GB1474039A (en) | Preparation of 2-alkoxy-5-sulphamoylbenzoic acids | |
| GB1126672A (en) | Sulphamylanthranilic acid amides and process for their manufacture | |
| GB1199857A (en) | o-Substituted 2-Phenylimino-1-Azacycloheptanes and their production | |
| GB1496072A (en) | Triazolo-benzodiazepine derivatives |