FR949546A - Tube à rayons chi à anode tournante discoïde - Google Patents
Tube à rayons chi à anode tournante discoïdeInfo
- Publication number
- FR949546A FR949546A FR949546DA FR949546A FR 949546 A FR949546 A FR 949546A FR 949546D A FR949546D A FR 949546DA FR 949546 A FR949546 A FR 949546A
- Authority
- FR
- France
- Prior art keywords
- ray tube
- rotating anode
- discoid rotating
- chi
- chi ray
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J35/00—X-ray tubes
- H01J35/02—Details
- H01J35/04—Electrodes ; Mutual position thereof; Constructional adaptations therefor
- H01J35/08—Anodes; Anti cathodes
- H01J35/10—Rotary anodes; Arrangements for rotating anodes; Cooling rotary anodes
- H01J35/105—Cooling of rotating anodes, e.g. heat emitting layers or structures
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL265039X | 1946-07-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| FR949546A true FR949546A (fr) | 1949-09-01 |
Family
ID=19781672
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR949546D Expired FR949546A (fr) | 1946-07-17 | 1947-07-15 | Tube à rayons chi à anode tournante discoïde |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2489080A (enExample) |
| BE (1) | BE474657A (enExample) |
| CH (1) | CH265039A (enExample) |
| DE (1) | DE807973C (enExample) |
| FR (1) | FR949546A (enExample) |
| GB (1) | GB641096A (enExample) |
| NL (1) | NL70856C (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2536584A1 (fr) * | 1982-11-19 | 1984-05-25 | Thomson Csf | Disque en graphite pour anode tournante de tubes a rayons x |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH293278A (de) * | 1950-08-28 | 1953-09-15 | Siemens Reiniger Werke Ag | Elektrische Entladungsröhre. |
| DE3226858A1 (de) * | 1982-07-17 | 1984-01-19 | Philips Patentverwaltung Gmbh, 2000 Hamburg | Drehanoden-roentgenroehre |
| US6002745A (en) * | 1998-06-04 | 1999-12-14 | Varian Medical Systems, Inc. | X-ray tube target assembly with integral heat shields |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1002390A (en) * | 1908-03-28 | 1911-09-05 | Henry Green | Anode for x-ray tubes. |
| US1579779A (en) * | 1921-04-13 | 1926-04-06 | Westinghouse Lamp Co | X-ray target |
| GB400022A (en) * | 1932-01-07 | 1933-10-19 | Mueller C H F Ag | Improvements in or relating to x-ray tubes having a rotatable anode |
| NL37019C (enExample) * | 1932-05-30 | |||
| US2141924A (en) * | 1937-11-13 | 1938-12-27 | Gen Electric | Electrical discharge device |
| DE687378C (de) * | 1938-10-23 | 1940-01-27 | Siemens Reiniger Werke Akt Ges | Drehbare tellerfoermige Roentgenroehrenanode aus hochbelastbarem Werkstoff |
| US2298335A (en) * | 1940-09-10 | 1942-10-13 | Gen Electric X Ray Corp | Multiple target anode |
| BE477898A (enExample) * | 1941-04-25 | |||
| US2336271A (en) * | 1941-12-23 | 1943-12-07 | Machlett Lab Inc | Rotary anode x-ray tube |
| US2430800A (en) * | 1943-10-02 | 1947-11-11 | Gen Electric X Ray Corp | Rotating anode construction |
-
0
- BE BE474657D patent/BE474657A/xx unknown
- NL NL70856D patent/NL70856C/xx active
-
1947
- 1947-07-14 GB GB18657/47A patent/GB641096A/en not_active Expired
- 1947-07-15 FR FR949546D patent/FR949546A/fr not_active Expired
- 1947-07-15 CH CH265039D patent/CH265039A/de unknown
- 1947-07-18 US US761965A patent/US2489080A/en not_active Expired - Lifetime
-
1948
- 1948-12-21 DE DEP25640A patent/DE807973C/de not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2536584A1 (fr) * | 1982-11-19 | 1984-05-25 | Thomson Csf | Disque en graphite pour anode tournante de tubes a rayons x |
Also Published As
| Publication number | Publication date |
|---|---|
| BE474657A (enExample) | |
| NL70856C (enExample) | |
| GB641096A (en) | 1950-08-02 |
| DE807973C (de) | 1951-07-09 |
| US2489080A (en) | 1949-11-22 |
| CH265039A (de) | 1949-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FR944127A (fr) | Tubes à rayons cathodiques | |
| FR1042812A (fr) | Tube à rayons cathodiques | |
| CH261242A (de) | Kathodenstrahlröhre für Fernsehzwecke. | |
| FR979860A (fr) | Tube à rayon cathodique | |
| FR1028305A (fr) | Tube à rayons électroniques | |
| FR949546A (fr) | Tube à rayons chi à anode tournante discoïde | |
| CH283215A (de) | Drehanoden-Röntgenröhre. | |
| FR942329A (fr) | Perfectionnements aux dispositifs à rayons cathodiques | |
| FR951817A (fr) | Appareil à rayons chi | |
| FR973056A (fr) | Perfectionnements aux tubes à rayons cathodiques | |
| FR947275A (fr) | Appareils à tube électronique | |
| FR941063A (fr) | Tubes à faisceau électronique | |
| FR1024398A (fr) | Tube à rayon cathodique | |
| CH264737A (de) | Kathodenstrahlröhre. | |
| CH259237A (de) | Elektronenröhre. | |
| FR938656A (fr) | Perfectionnements aux tubes à faisceau cathodique | |
| FR933631A (fr) | Tube indicateur à rayons cathodiques | |
| FR947841A (fr) | Tube à rayons chi pour la radiothérapie | |
| FR951257A (fr) | Indicateurs à tube à faisceau cathodique | |
| GB1442592A (en) | Cathode ray tube apparatus | |
| FR954134A (fr) | Tube à décharge | |
| FR924885A (fr) | Tubes à vide | |
| FR1024263A (fr) | Tube à rayons cathodiques | |
| FR919727A (fr) | Perfectionnements aux tubes à rayons cathodiques | |
| FR1033384A (fr) | Tube à rayons cathodiques |