FR3684M - Nouvelle pénicilline. - Google Patents
Nouvelle pénicilline.Info
- Publication number
- FR3684M FR3684M FR971849A FR971849A FR3684M FR 3684 M FR3684 M FR 3684M FR 971849 A FR971849 A FR 971849A FR 971849 A FR971849 A FR 971849A FR 3684 M FR3684 M FR 3684M
- Authority
- FR
- France
- Prior art keywords
- new penicillin
- penicillin
- new
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229930182555 Penicillin Natural products 0.000 title 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 title 1
- 229940049954 penicillin Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB15889/63A GB1004670A (en) | 1963-04-23 | 1963-04-23 | Penicillins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| FR3684M true FR3684M (fr) | 1965-11-15 |
Family
ID=10067366
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR971849A Active FR3684M (fr) | 1963-04-23 | 1964-04-22 | Nouvelle pénicilline. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3282926A (en:Method) |
| AT (1) | AT259759B (en:Method) |
| BE (1) | BE646991A (en:Method) |
| BR (1) | BR6458467D0 (en:Method) |
| CH (1) | CH447173A (en:Method) |
| CY (1) | CY428A (en:Method) |
| DE (1) | DE1295558B (en:Method) |
| DK (1) | DK118133B (en:Method) |
| ES (1) | ES299038A1 (en:Method) |
| FI (1) | FI44912C (en:Method) |
| FR (1) | FR3684M (en:Method) |
| GB (1) | GB1004670A (en:Method) |
| NL (1) | NL142590B (en:Method) |
| NO (1) | NO129633B (en:Method) |
| SE (1) | SE337376B (en:Method) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1125557A (en) * | 1966-05-13 | 1968-08-28 | Beecham Group Ltd | Penicillins |
| US3881013A (en) * | 1966-11-05 | 1975-04-29 | Beecham Group Ltd | Penicillin compositions and their administration |
| US3853849A (en) * | 1969-05-29 | 1974-12-10 | Beecham Group Ltd | Alpha(aryloxycarbonyl)-and alpha(alkoxy-carbonyl)-aralkyl penicillins |
| US3669980A (en) * | 1968-09-17 | 1972-06-13 | American Home Prod | 2-amido-6-amino penicillanic acids and related compounds |
| AT290728B (de) * | 1968-09-28 | 1971-05-15 | Takeda Chemical Industries Ltd | Verfahren zur herstellung neuer penicilline |
| GB1250970A (en:Method) * | 1969-09-24 | 1971-10-27 | ||
| BE758350A (fr) * | 1969-12-30 | 1971-05-03 | Pfizer | Procede de fabrication des sels mono- et bi-metalliques alcalins de l'alpha-carboxybenzylpenicilline |
| US3697506A (en) * | 1970-08-07 | 1972-10-10 | Pfizer | Crystalline alkali metal salts of {60 -carboxybenzylpenicillin and process therefor |
| US3905960A (en) * | 1970-10-22 | 1975-09-16 | Beecham Inc | Crystalline anhydrous penicillins and preparation thereof |
| US3681342A (en) * | 1970-11-12 | 1972-08-01 | Pfizer | Esters of -carboxybenzylpenicillin |
| US3676427A (en) * | 1971-01-26 | 1972-07-11 | Pfizer | Process for the manufacture of the disodium salt of alpha-carboxybenzylpenicillin |
| DD98684A1 (en:Method) * | 1971-05-18 | 1973-07-12 | ||
| GB1424186A (en) * | 1971-10-08 | 1976-02-11 | Beecham Group Ltd | Penicillins |
| JPS4891218A (en:Method) * | 1972-03-06 | 1973-11-28 | ||
| US3862933A (en) * | 1972-07-12 | 1975-01-28 | Pfizer | Process for making esters of 6-(alpha-(carboxy)aryla-cetamido)penicillanic acids |
| US4171303A (en) * | 1974-07-30 | 1979-10-16 | Chinoin Gyogyszer Es Vegyeszeti Termekek Gyara Rt. | Process for the preparation of reactive penicillanic acid and cephalosporanic acid derivatives |
| HU168914B (en:Method) * | 1974-07-30 | 1976-08-28 | ||
| DE2652675A1 (de) * | 1975-11-21 | 1977-06-02 | Merck & Co Inc | N-acylderivate von thienamycin, verfahren zu deren herstellung und diese enthaltende arzneimittel |
| CH632508A5 (de) * | 1975-11-21 | 1982-10-15 | Merck & Co Inc | Verfahren zur herstellung von neuen estern des n-acylierten thienamycins. |
| NZ182630A (en) * | 1975-11-21 | 1979-07-11 | Merck & Co Inc | Substituted n-methylene dervatives of thienamycin and pharmaceutical compositions |
| US4236002A (en) | 1977-12-23 | 1980-11-25 | Yeda Research & Development Co., Ltd. | Cephalosporin derivatives |
| US4598074A (en) * | 1982-10-15 | 1986-07-01 | Beecham Group P.L.C. | β-lactam antibiotics |
| CN106117159B (zh) * | 2016-07-08 | 2018-10-16 | 上海上药新亚药业有限公司 | 一种羧苄西林钠杂质d的合成方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR617E (fr) * | 1901-09-16 | 1903-02-16 | Henriot Edouard | Une traverse en fer ou en acier avec cases pour rendre invariable l'écartement de la voie ferrée dans les courbes |
| US2528174A (en) * | 1948-07-01 | 1950-10-31 | Lilly Co Eli | Procaine salts of biosynthetic penicillins |
| GB874415A (en) * | 1959-05-25 | 1961-08-10 | Beecham Res Lab | Antibacterial agents |
| US3142673A (en) * | 1961-03-31 | 1964-07-28 | Pfizer & Co C | Derivatives of 6-aminopenicillanic acid |
-
1963
- 1963-04-23 GB GB15889/63A patent/GB1004670A/en not_active Expired
-
1964
- 1964-04-15 SE SE04665/64A patent/SE337376B/xx unknown
- 1964-04-16 BR BR158467/64A patent/BR6458467D0/pt unknown
- 1964-04-17 US US360760A patent/US3282926A/en not_active Expired - Lifetime
- 1964-04-21 NO NO00152913A patent/NO129633B/no unknown
- 1964-04-22 FR FR971849A patent/FR3684M/fr active Active
- 1964-04-22 NL NL646404384A patent/NL142590B/xx not_active IP Right Cessation
- 1964-04-22 ES ES0299038A patent/ES299038A1/es not_active Expired
- 1964-04-23 AT AT357964A patent/AT259759B/de active
- 1964-04-23 FI FI640858A patent/FI44912C/fi active
- 1964-04-23 CH CH526164A patent/CH447173A/de unknown
- 1964-04-23 BE BE646991A patent/BE646991A/xx unknown
- 1964-04-23 DE DEB76480A patent/DE1295558B/de active Pending
- 1964-04-23 DK DK202964AA patent/DK118133B/da unknown
-
1968
- 1968-01-08 CY CY42868A patent/CY428A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI44912C (fi) | 1972-02-10 |
| NL6404384A (en:Method) | 1964-10-26 |
| NO129633B (en:Method) | 1974-05-06 |
| SE337376B (en:Method) | 1971-08-09 |
| AT259759B (de) | 1968-02-12 |
| FI44912B (en:Method) | 1971-11-01 |
| DE1295558B (de) | 1969-05-22 |
| GB1004670A (en) | 1965-09-15 |
| CY428A (en) | 1968-01-08 |
| DK118133B (da) | 1970-07-13 |
| NL142590B (nl) | 1974-07-15 |
| BE646991A (en:Method) | 1964-08-17 |
| ES299038A1 (es) | 1964-08-16 |
| BR6458467D0 (pt) | 1973-09-20 |
| CH447173A (de) | 1967-11-30 |
| US3282926A (en) | 1966-11-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FR3684M (fr) | Nouvelle pénicilline. | |
| DK101572C (da) | Byggesæt. | |
| FR1350593A (fr) | Marchepied | |
| DK115947B (da) | Vagitorium. | |
| FR3846M (fr) | Nouvelles 4-amino-pipéridines. | |
| DK105902C (da) | Metalbor. | |
| DK116790B (da) | Centrifuge. | |
| DK119550B (da) | Diskontinuerligt arbejdende centrifuge. | |
| FR3840M (fr) | Chlorothioxanthenes substitués. | |
| DK107717C (da) | Pattegummi. | |
| FR3288M (fr) | Anti-cholinergique. | |
| NL148116B (nl) | Weeflis. | |
| DK106511C (da) | Smørefedt. | |
| FR3817M (fr) | Nouvel anthelmintique. | |
| DK123789B (da) | Smøreapparat. | |
| NL144671B (nl) | Spindop. | |
| DK113039B (da) | Stald. | |
| FR1396089A (fr) | Ejecto-convecteur double | |
| FR3552M (fr) | Nouvelle association anticoagulante. | |
| FR3325M (fr) | Nouvelles 2-alcoyl-4-pyridine-aldéhyde-thiosemicarbazones. | |
| BE642025A (fr) | Nouvelles indolylalcoylguanidines. | |
| FR1370764A (fr) | Gyromètre perfectionné | |
| FR1409225A (fr) | Marchepied | |
| FR1440622A (fr) | Nouvelles furamidines substituées | |
| DK109417C (da) | Høvender. |