FR2022598A1 - Sedative chloro-phenyl-triazolobenzodiazepines - Google Patents
Sedative chloro-phenyl-triazolobenzodiazepinesInfo
- Publication number
- FR2022598A1 FR2022598A1 FR6937824A FR6937824A FR2022598A1 FR 2022598 A1 FR2022598 A1 FR 2022598A1 FR 6937824 A FR6937824 A FR 6937824A FR 6937824 A FR6937824 A FR 6937824A FR 2022598 A1 FR2022598 A1 FR 2022598A1
- Authority
- FR
- France
- Prior art keywords
- alkyl
- reaction
- triazolobenzodiazepines
- sedative
- chloro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000932 sedative agent Substances 0.000 title abstract 3
- UJLYTTDRMMUJLW-UHFFFAOYSA-N ClC1=C(C=2C(=C3C1=CC=CN=N3)N=NN=2)C1=CC=CC=C1 Chemical class ClC1=C(C=2C(=C3C1=CC=CN=N3)N=NN=2)C1=CC=CC=C1 UJLYTTDRMMUJLW-UHFFFAOYSA-N 0.000 title abstract 2
- 230000001624 sedative effect Effects 0.000 title abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 238000006243 chemical reaction Methods 0.000 abstract 3
- 239000003377 acid catalyst Substances 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- 150000001412 amines Chemical class 0.000 abstract 1
- 229940125681 anticonvulsant agent Drugs 0.000 abstract 1
- 239000001961 anticonvulsive agent Substances 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 125000004659 aryl alkyl thio group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 229940049706 benzodiazepine Drugs 0.000 abstract 1
- 150000001557 benzodiazepines Chemical class 0.000 abstract 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 abstract 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 abstract 1
- 125000001183 hydrocarbyl group Chemical group 0.000 abstract 1
- 229940035363 muscle relaxants Drugs 0.000 abstract 1
- 239000003158 myorelaxant agent Substances 0.000 abstract 1
- 238000006798 ring closing metathesis reaction Methods 0.000 abstract 1
- 229940125723 sedative agent Drugs 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
- C07D243/16—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals
- C07D243/18—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals substituted in position 2 by nitrogen, oxygen or sulfur atoms
- C07D243/20—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR6937824A FR2022598A1 (en) | 1969-11-04 | 1969-11-04 | Sedative chloro-phenyl-triazolobenzodiazepines |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR6937824A FR2022598A1 (en) | 1969-11-04 | 1969-11-04 | Sedative chloro-phenyl-triazolobenzodiazepines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FR2022598A1 true FR2022598A1 (en) | 1970-07-31 |
| FR2022598B1 FR2022598B1 (enExample) | 1973-12-21 |
Family
ID=9042556
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR6937824A Granted FR2022598A1 (en) | 1969-11-04 | 1969-11-04 | Sedative chloro-phenyl-triazolobenzodiazepines |
Country Status (1)
| Country | Link |
|---|---|
| FR (1) | FR2022598A1 (enExample) |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2085748A1 (enExample) * | 1970-03-27 | 1971-12-31 | Takeda Chemical Industries Ltd | |
| DE2156472A1 (de) * | 1970-11-23 | 1972-05-31 | Ciba-Geigy Ag, Basel (Schweiz) | Verfahren zur Herstellung von neuen Diazepinderivaten |
| FR2118028A1 (enExample) * | 1970-12-11 | 1972-07-28 | Takeda Chemical Industries Ltd | |
| FR2118010A1 (enExample) * | 1970-12-11 | 1972-07-28 | Ciba Geigy Ag | |
| FR2128551A2 (fr) * | 1969-03-17 | 1972-10-20 | Upjohn Co | Nouvelles 6-(2,6-difluorophenyl)-triazolobenzodiazepines et leur procede de preparation |
| FR2128550A2 (en) * | 1971-03-03 | 1972-10-20 | Upjohn Co | S-triazolo (4,3-a) (1,4) benzodiazepines - as hypnotics, sedatives, tranquillisers, muscle-relaxants |
| FR2134586A1 (enExample) * | 1971-04-28 | 1972-12-08 | Upjohn Co | |
| FR2157780A1 (enExample) * | 1971-06-18 | 1973-06-08 | Yoshitomi Pharmaceutical | |
| FR2288524A1 (fr) * | 1974-10-21 | 1976-05-21 | Hoffmann La Roche | Nouveaux derives de triazolobenzodiazepine utiles comme medicaments et leur procede de preparation |
-
1969
- 1969-11-04 FR FR6937824A patent/FR2022598A1/fr active Granted
Non-Patent Citations (1)
| Title |
|---|
| Y 706803 * |
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2128551A2 (fr) * | 1969-03-17 | 1972-10-20 | Upjohn Co | Nouvelles 6-(2,6-difluorophenyl)-triazolobenzodiazepines et leur procede de preparation |
| FR2085748A1 (enExample) * | 1970-03-27 | 1971-12-31 | Takeda Chemical Industries Ltd | |
| DE2156472A1 (de) * | 1970-11-23 | 1972-05-31 | Ciba-Geigy Ag, Basel (Schweiz) | Verfahren zur Herstellung von neuen Diazepinderivaten |
| FR2118028A1 (enExample) * | 1970-12-11 | 1972-07-28 | Takeda Chemical Industries Ltd | |
| FR2118010A1 (enExample) * | 1970-12-11 | 1972-07-28 | Ciba Geigy Ag | |
| DE2159242A1 (de) * | 1970-12-11 | 1972-12-07 | Takeda Chemical Industries, Ltd., Osaka (Japan) | Neue Triazolbenzodiazepinderivate und Verfahren zu ihrer Herstellung |
| DE2166657A1 (de) * | 1970-12-11 | 1975-01-23 | Takeda Chemical Industries Ltd | Neue triazolbenzodiazepinderivate und verfahren zu ihrer herstellung |
| FR2128550A2 (en) * | 1971-03-03 | 1972-10-20 | Upjohn Co | S-triazolo (4,3-a) (1,4) benzodiazepines - as hypnotics, sedatives, tranquillisers, muscle-relaxants |
| FR2134586A1 (enExample) * | 1971-04-28 | 1972-12-08 | Upjohn Co | |
| FR2157780A1 (enExample) * | 1971-06-18 | 1973-06-08 | Yoshitomi Pharmaceutical | |
| FR2288524A1 (fr) * | 1974-10-21 | 1976-05-21 | Hoffmann La Roche | Nouveaux derives de triazolobenzodiazepine utiles comme medicaments et leur procede de preparation |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2022598B1 (enExample) | 1973-12-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5272754A (en) | Curable organopolysiloxane compositions | |
| FR2022598A1 (en) | Sedative chloro-phenyl-triazolobenzodiazepines | |
| ZA755079B (en) | Tuyere for the injection of reaction gas | |
| GB1384239A (en) | Aromatic ester | |
| TR199802044T2 (xx) | Yeni karbon asidi t�revleri, �retilmeleri ve kullan�mlar�. | |
| IT1209375B (it) | Composizioni a base di mercaptoorganosilossani, vulcanizzabili in presenza di ossigeno, a rapida reazione superficiale e metodo per formare dalle medesime prodotti a peso molecolare superiore. | |
| GB1340646A (en) | Treatment of polyamides | |
| IT1264945B1 (it) | Composti piperidinici atti all'impiego come stabilizzanti per materiali organici | |
| GB1328333A (en) | Preparation of hexamethylenediamine | |
| GB1188248A (en) | 2-Isothiouronium-Methyl-Quinoxaline-1,4,di-N-Oxide-3-Carboxylic Acid Amide Halides | |
| IE40208L (en) | Production of 1,1,3,3-substituted hydroxy indanes | |
| GB1279207A (en) | Curing agents for epoxy resins | |
| FR2092787A1 (en) | Pyrazolopyridine derivs as tranquilisers | |
| JPS51134737A (en) | Resin composition | |
| GB1496709A (en) | Furotriazines | |
| USD207344S (en) | Metal clip or similar article | |
| JPS52139080A (en) | Preparation of 1-carbamoyluracils | |
| JPS5231072A (en) | Synthesis of molecular compounds of allantoin and alginine | |
| JPS526500A (en) | Plastering unit | |
| JPS5340746A (en) | Organophosphorous compound and chlorine-containing resin composition | |
| JPS5283737A (en) | Novel carboxylic acid amide derivatives and preparation thereof | |
| JPS51139832A (en) | Heat-resistant nonsolventvarnish composition | |
| GB965925A (en) | Improvements in or relating to 1,2,4-oxadiazole derivatives | |
| FR2079314A1 (en) | 2, 4-dioxo-1, 2, 3, 4, 5, 6, 7, 8-octahydrobenzothieno - (2, 3-d) pyrimidines - with antiinflammatory, analgesic, antitussive | |
| JPS52132091A (en) | Polymerizable solid resin compositions |