FI71335C - Luminiserad yta och med luminiserad yta foersedd laogtrycks-kvicksilvergasurladdningslampa - Google Patents
Luminiserad yta och med luminiserad yta foersedd laogtrycks-kvicksilvergasurladdningslampa Download PDFInfo
- Publication number
- FI71335C FI71335C FI831602A FI831602A FI71335C FI 71335 C FI71335 C FI 71335C FI 831602 A FI831602 A FI 831602A FI 831602 A FI831602 A FI 831602A FI 71335 C FI71335 C FI 71335C
- Authority
- FI
- Finland
- Prior art keywords
- aluminate
- europium
- alkaline earth
- earth metal
- strontium
- Prior art date
Links
- 150000004645 aluminates Chemical class 0.000 claims description 50
- 229910052693 Europium Inorganic materials 0.000 claims description 24
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 claims description 24
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 20
- 239000011575 calcium Substances 0.000 claims description 18
- 229910052791 calcium Inorganic materials 0.000 claims description 17
- 229910052712 strontium Inorganic materials 0.000 claims description 17
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 16
- -1 alkaline earth metal aluminate Chemical class 0.000 claims description 16
- 239000000126 substance Substances 0.000 claims description 16
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 15
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 12
- 239000013078 crystal Substances 0.000 claims description 12
- 238000010586 diagram Methods 0.000 claims description 12
- 229910052782 aluminium Inorganic materials 0.000 claims description 9
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 9
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 9
- 238000010438 heat treatment Methods 0.000 claims description 8
- 239000000843 powder Substances 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 5
- 229910052796 boron Inorganic materials 0.000 claims description 5
- 229910052810 boron oxide Inorganic materials 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 150000002739 metals Chemical class 0.000 claims description 4
- IATRAKWUXMZMIY-UHFFFAOYSA-N strontium oxide Chemical compound [O-2].[Sr+2] IATRAKWUXMZMIY-UHFFFAOYSA-N 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 3
- 230000008569 process Effects 0.000 claims description 3
- 229910052771 Terbium Inorganic materials 0.000 claims description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 2
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 claims description 2
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 claims description 2
- 239000000292 calcium oxide Substances 0.000 claims description 2
- 229910001940 europium oxide Inorganic materials 0.000 claims description 2
- AEBZCFFCDTZXHP-UHFFFAOYSA-N europium(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Eu+3].[Eu+3] AEBZCFFCDTZXHP-UHFFFAOYSA-N 0.000 claims description 2
- 229910000464 lead oxide Inorganic materials 0.000 claims description 2
- SIWVEOZUMHYXCS-UHFFFAOYSA-N oxo(oxoyttriooxy)yttrium Chemical group O=[Y]O[Y]=O SIWVEOZUMHYXCS-UHFFFAOYSA-N 0.000 claims description 2
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 claims description 2
- GZCRRIHWUXGPOV-UHFFFAOYSA-N terbium atom Chemical compound [Tb] GZCRRIHWUXGPOV-UHFFFAOYSA-N 0.000 claims description 2
- 230000004907 flux Effects 0.000 description 9
- 230000005855 radiation Effects 0.000 description 8
- 238000010521 absorption reaction Methods 0.000 description 7
- 230000005284 excitation Effects 0.000 description 7
- 239000005084 Strontium aluminate Substances 0.000 description 6
- FNWBQFMGIFLWII-UHFFFAOYSA-N strontium aluminate Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[Al+3].[Al+3].[Sr+2].[Sr+2] FNWBQFMGIFLWII-UHFFFAOYSA-N 0.000 description 6
- 229910052788 barium Inorganic materials 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 230000004913 activation Effects 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 230000003595 spectral effect Effects 0.000 description 4
- 229910000873 Beta-alumina solid electrolyte Inorganic materials 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 229910003668 SrAl Inorganic materials 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 2
- 238000002441 X-ray diffraction Methods 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000002452 interceptive effect Effects 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- QNRATNLHPGXHMA-XZHTYLCXSA-N (r)-(6-ethoxyquinolin-4-yl)-[(2s,4s,5r)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol;hydrochloride Chemical compound Cl.C([C@H]([C@H](C1)CC)C2)CN1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OCC)C=C21 QNRATNLHPGXHMA-XZHTYLCXSA-N 0.000 description 1
- 101100310920 Caenorhabditis elegans sra-2 gene Proteins 0.000 description 1
- 206010015150 Erythema Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 239000008896 Opium Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- QKYBEKAEVQPNIN-UHFFFAOYSA-N barium(2+);oxido(oxo)alumane Chemical compound [Ba+2].[O-][Al]=O.[O-][Al]=O QKYBEKAEVQPNIN-UHFFFAOYSA-N 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 229960001027 opium Drugs 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000003746 solid phase reaction Methods 0.000 description 1
- 238000010671 solid-state reaction Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- FVRNDBHWWSPNOM-UHFFFAOYSA-L strontium fluoride Chemical compound [F-].[F-].[Sr+2] FVRNDBHWWSPNOM-UHFFFAOYSA-L 0.000 description 1
- 229910001637 strontium fluoride Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 235000013616 tea Nutrition 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K11/00—Luminescent, e.g. electroluminescent, chemiluminescent materials
- C09K11/08—Luminescent, e.g. electroluminescent, chemiluminescent materials containing inorganic luminescent materials
- C09K11/77—Luminescent, e.g. electroluminescent, chemiluminescent materials containing inorganic luminescent materials containing rare earth metals
- C09K11/7728—Luminescent, e.g. electroluminescent, chemiluminescent materials containing inorganic luminescent materials containing rare earth metals containing europium
- C09K11/7734—Aluminates
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K11/00—Luminescent, e.g. electroluminescent, chemiluminescent materials
- C09K11/08—Luminescent, e.g. electroluminescent, chemiluminescent materials containing inorganic luminescent materials
- C09K11/66—Luminescent, e.g. electroluminescent, chemiluminescent materials containing inorganic luminescent materials containing germanium, tin or lead
- C09K11/666—Aluminates; Silicates
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/38—Devices for influencing the colour or wavelength of the light
- H01J61/42—Devices for influencing the colour or wavelength of the light by transforming the wavelength of the light by luminescence
- H01J61/44—Devices characterised by the luminescent material
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Luminescent Compositions (AREA)
- Vessels And Coating Films For Discharge Lamps (AREA)
- Compounds Of Alkaline-Earth Elements, Aluminum Or Rare-Earth Metals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL8201943 | 1982-05-12 | ||
| NL8201943A NL8201943A (nl) | 1982-05-12 | 1982-05-12 | Luminescerend scherm. |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI831602A0 FI831602A0 (fi) | 1983-05-09 |
| FI831602L FI831602L (fi) | 1983-11-13 |
| FI71335B FI71335B (fi) | 1986-09-09 |
| FI71335C true FI71335C (fi) | 1986-12-19 |
Family
ID=19839719
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI831602A FI71335C (fi) | 1982-05-12 | 1983-05-09 | Luminiserad yta och med luminiserad yta foersedd laogtrycks-kvicksilvergasurladdningslampa |
Country Status (10)
| Country | Link |
|---|---|
| EP (1) | EP0094132B1 (enExample) |
| JP (1) | JPS58213080A (enExample) |
| AU (1) | AU557504B2 (enExample) |
| BR (1) | BR8302418A (enExample) |
| CA (1) | CA1201580A (enExample) |
| DE (1) | DE3367250D1 (enExample) |
| ES (1) | ES8405997A1 (enExample) |
| FI (1) | FI71335C (enExample) |
| HU (1) | HU188889B (enExample) |
| NL (1) | NL8201943A (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1223030A (en) * | 1983-04-25 | 1987-06-16 | Johannes T.C. Van Kemenade | Low-pressure mercury vapour discharge lamp |
| JPS60185354A (ja) * | 1984-03-02 | 1985-09-20 | Matsushita Electronics Corp | 蛍光ランプ |
| JPS622444A (ja) * | 1985-06-27 | 1987-01-08 | Matsushita Electronics Corp | 螢光ランプ |
| NL8700808A (nl) * | 1987-04-07 | 1988-11-01 | Philips Nv | Werkwijze voor het bereiden van een luminescerend met eu2 geactiveerd strontium-aluminaat, op dergelijke wijze verkregen aluminaat en lagedrukkwikdampontladingslamp voorzien van een dergelijk aluminaat. |
| NL8900950A (nl) * | 1989-04-17 | 1990-11-16 | Philips Nv | Lagedrukkwikdampontladingslamp. |
| JP2543825B2 (ja) * | 1993-04-28 | 1996-10-16 | 根本特殊化学株式会社 | 蓄光性蛍光体 |
| JPH0899384A (ja) * | 1994-09-30 | 1996-04-16 | Ykk Kk | 蓄光体 |
| JP3456553B2 (ja) * | 1994-11-01 | 2003-10-14 | 根本特殊化学株式会社 | 蓄光性蛍光体 |
| CN1062887C (zh) * | 1995-08-29 | 2001-03-07 | 北京宏业亚阳荧光材料厂 | 长余辉磷光体及其制备方法 |
| DE19649662A1 (de) | 1996-11-29 | 1998-06-04 | Riedel De Haen Ag | Schichtkörper mit Nachleuchteigenschaften, Verfahren zu dessen Herstellung und dessen Verwendung |
| US6969475B2 (en) | 2002-11-22 | 2005-11-29 | Kb Alloys | Photoluminescent alkaline earth aluminate and method for making the same |
| US7077980B2 (en) * | 2004-05-03 | 2006-07-18 | General Electric Company | Phosphors containing oxides of alkaline-earth and group-13 metals, and light sources incorporating the same |
| KR100655894B1 (ko) | 2004-05-06 | 2006-12-08 | 서울옵토디바이스주식회사 | 색온도 및 연색성이 우수한 파장변환 발광장치 |
| KR100658700B1 (ko) | 2004-05-13 | 2006-12-15 | 서울옵토디바이스주식회사 | Rgb 발광소자와 형광체를 조합한 발광장치 |
| KR100665298B1 (ko) | 2004-06-10 | 2007-01-04 | 서울반도체 주식회사 | 발광장치 |
| KR100665299B1 (ko) | 2004-06-10 | 2007-01-04 | 서울반도체 주식회사 | 발광물질 |
| US8318044B2 (en) | 2004-06-10 | 2012-11-27 | Seoul Semiconductor Co., Ltd. | Light emitting device |
| KR101258397B1 (ko) | 2005-11-11 | 2013-04-30 | 서울반도체 주식회사 | 구리 알칼리토 실리케이트 혼성 결정 형광체 |
| KR101055772B1 (ko) | 2005-12-15 | 2011-08-11 | 서울반도체 주식회사 | 발광장치 |
| KR100875443B1 (ko) | 2006-03-31 | 2008-12-23 | 서울반도체 주식회사 | 발광 장치 |
| KR101258227B1 (ko) | 2006-08-29 | 2013-04-25 | 서울반도체 주식회사 | 발광 소자 |
| WO2009025469A2 (en) | 2007-08-22 | 2009-02-26 | Seoul Semiconductor Co., Ltd. | Non stoichiometric tetragonal copper alkaline earth silicate phosphors and method of preparing the same |
| KR101055769B1 (ko) | 2007-08-28 | 2011-08-11 | 서울반도체 주식회사 | 비화학양론적 정방정계 알칼리 토류 실리케이트 형광체를채택한 발광 장치 |
| DE102009030205A1 (de) | 2009-06-24 | 2010-12-30 | Litec-Lp Gmbh | Leuchtstoffe mit Eu(II)-dotierten silikatischen Luminophore |
| KR101055762B1 (ko) | 2009-09-01 | 2011-08-11 | 서울반도체 주식회사 | 옥시오소실리케이트 발광체를 갖는 발광 물질을 채택한 발광 장치 |
| WO2011109145A2 (en) * | 2010-03-01 | 2011-09-09 | University Of Georgia Research Foundation, Inc. | Eu2+-activated aluminates nanobelts, whiskers, and powders, methods of making the same, and uses thereof |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1284867A (fr) * | 1961-03-23 | 1962-02-16 | Ass Elect Ind | Aluminate de strontium luminescent |
| DE1154215B (de) * | 1962-02-08 | 1963-09-12 | Patra Patent Treuhand | Anorganischer Leuchtstoff und Verfahren zu seiner Herstellung |
| NL6715823A (enExample) * | 1967-11-22 | 1969-05-27 | ||
| NL6716848A (enExample) * | 1967-12-12 | 1969-06-16 | ||
| US4088923A (en) * | 1974-03-15 | 1978-05-09 | U.S. Philips Corporation | Fluorescent lamp with superimposed luminescent layers |
| NL179854C (nl) * | 1977-08-23 | 1986-11-17 | Philips Nv | Lagedrukkwikdampontladingslamp. |
| US4431941A (en) * | 1979-06-11 | 1984-02-14 | Gte Products Corporation | Fluorescent lamp having double phosphor layer |
-
1982
- 1982-05-12 NL NL8201943A patent/NL8201943A/nl not_active Application Discontinuation
-
1983
- 1983-05-04 DE DE8383200639T patent/DE3367250D1/de not_active Expired
- 1983-05-04 EP EP83200639A patent/EP0094132B1/en not_active Expired
- 1983-05-05 CA CA000427540A patent/CA1201580A/en not_active Expired
- 1983-05-09 HU HU831592A patent/HU188889B/hu not_active IP Right Cessation
- 1983-05-09 JP JP58079457A patent/JPS58213080A/ja active Granted
- 1983-05-09 AU AU14357/83A patent/AU557504B2/en not_active Ceased
- 1983-05-09 FI FI831602A patent/FI71335C/fi not_active IP Right Cessation
- 1983-05-09 BR BR8302418A patent/BR8302418A/pt not_active IP Right Cessation
- 1983-05-10 ES ES522239A patent/ES8405997A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FI831602L (fi) | 1983-11-13 |
| AU1435783A (en) | 1983-11-17 |
| EP0094132A1 (en) | 1983-11-16 |
| JPS6215115B2 (enExample) | 1987-04-06 |
| ES522239A0 (es) | 1984-06-16 |
| FI831602A0 (fi) | 1983-05-09 |
| DE3367250D1 (en) | 1986-12-04 |
| EP0094132B1 (en) | 1986-10-29 |
| HU188889B (en) | 1986-05-28 |
| JPS58213080A (ja) | 1983-12-10 |
| AU557504B2 (en) | 1986-12-24 |
| CA1201580A (en) | 1986-03-11 |
| ES8405997A1 (es) | 1984-06-16 |
| NL8201943A (nl) | 1983-12-01 |
| BR8302418A (pt) | 1984-01-10 |
| FI71335B (fi) | 1986-09-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI71335C (fi) | Luminiserad yta och med luminiserad yta foersedd laogtrycks-kvicksilvergasurladdningslampa | |
| US4215289A (en) | Luminescent material, luminescent screen provided with such a material and low-pressure mercury vapor discharge lamp provided with such a screen | |
| KR100232395B1 (ko) | 알루미네이트 형광물질 | |
| KR100248067B1 (ko) | 잔광성 램프 | |
| US4319161A (en) | Luminescent screen and low pressure mercury vapor discharge lamp containing the same | |
| EP0229428B1 (en) | Low-pressure mercury vapour discharge lamp | |
| FI74297B (fi) | Luminiserande bildyta. | |
| KR101323481B1 (ko) | 카비도니트리도실리케이트 발광 물질 | |
| US4590405A (en) | Bivalent europium-activated barium aluminate phosphor and low mercury vapor discharge lamp provided with a phosphor | |
| US4315191A (en) | Luminescent material with alkaline earth metal silicate aluminate host lattice and low-pressure mercury vapor discharge lamp containing the same | |
| US20170275532A1 (en) | Fluorescent material, a manufacturing method thereof, and a photo-luminescent composition containing the fluorescent material | |
| US4963787A (en) | Luminescent alkaline earth metal orthosilicate, luminescent screen provided with such a silicate and low-pressure mercury vapor discharge lamp provided with such a screen | |
| US4151443A (en) | Luminescent materials and discharge lamp containing the same | |
| FI92217C (fi) | Loisteainehiukkanen | |
| US4806825A (en) | Infra-red phosphors | |
| HU200033B (en) | Method for making luminous powder in yellow-green range and mercury vapour gas-discharge lamp containing the said powder | |
| JP2000034480A (ja) | 蓄光性蛍光体 | |
| JPS5944335B2 (ja) | 螢光体 | |
| GB2259095A (en) | Green light emitting aluminate phosphor | |
| JPS5944341B2 (ja) | 螢光体 | |
| KR100432664B1 (ko) | 청색형광체 | |
| JPS621778A (ja) | 螢光体 | |
| EP0251550A1 (en) | Improvements in or relating to inorganic phosphors | |
| KR950011233B1 (ko) | 녹색 발광형광체 | |
| SU996427A1 (ru) | Люминофор |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| TC | Name/ company changed in patent |
Owner name: PHILIPS ELECTRONICS N.V. |
|
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: PHILIPS ELECTRONICS N.V. |