FI66162C - Foerfarande foer rening av fosforsyra med avseende pao tungmetaller - Google Patents
Foerfarande foer rening av fosforsyra med avseende pao tungmetaller Download PDFInfo
- Publication number
- FI66162C FI66162C FI801521A FI801521A FI66162C FI 66162 C FI66162 C FI 66162C FI 801521 A FI801521 A FI 801521A FI 801521 A FI801521 A FI 801521A FI 66162 C FI66162 C FI 66162C
- Authority
- FI
- Finland
- Prior art keywords
- phosphoric acid
- heavy metals
- alkali
- cadmium
- sulfuric acid
- Prior art date
Links
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims abstract description 138
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims abstract description 69
- 229910001385 heavy metal Inorganic materials 0.000 claims abstract description 41
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims abstract description 39
- 238000000034 method Methods 0.000 claims abstract description 38
- 229910052793 cadmium Inorganic materials 0.000 claims abstract description 27
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims abstract description 24
- 239000003513 alkali Substances 0.000 claims abstract description 15
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims abstract description 7
- 239000002244 precipitate Substances 0.000 claims abstract description 7
- -1 sulphide compound Chemical class 0.000 claims abstract description 5
- 238000006386 neutralization reaction Methods 0.000 claims abstract description 3
- 125000004437 phosphorous atom Chemical group 0.000 claims abstract description 3
- 150000003568 thioethers Chemical group 0.000 claims abstract 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 11
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 9
- 229910019142 PO4 Inorganic materials 0.000 claims description 7
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 7
- 239000010452 phosphate Substances 0.000 claims description 7
- 238000001556 precipitation Methods 0.000 claims description 6
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 4
- 229910052602 gypsum Inorganic materials 0.000 claims description 4
- 239000010440 gypsum Substances 0.000 claims description 4
- 229940043430 calcium compound Drugs 0.000 claims description 3
- 150000001674 calcium compounds Chemical class 0.000 claims description 3
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 claims description 3
- 239000000920 calcium hydroxide Substances 0.000 claims description 3
- 229910001861 calcium hydroxide Inorganic materials 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 3
- 238000000746 purification Methods 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 239000000908 ammonium hydroxide Substances 0.000 claims description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims 1
- 230000029087 digestion Effects 0.000 claims 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 abstract description 7
- 229910021653 sulphate ion Inorganic materials 0.000 abstract description 5
- 230000001376 precipitating effect Effects 0.000 abstract description 3
- 239000001117 sulphuric acid Substances 0.000 abstract 2
- 235000011149 sulphuric acid Nutrition 0.000 abstract 2
- 239000000463 material Substances 0.000 abstract 1
- 235000011007 phosphoric acid Nutrition 0.000 description 63
- 239000010949 copper Substances 0.000 description 18
- 239000000203 mixture Substances 0.000 description 12
- 239000011734 sodium Substances 0.000 description 12
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 11
- 239000002994 raw material Substances 0.000 description 10
- 150000004763 sulfides Chemical class 0.000 description 10
- 239000002253 acid Substances 0.000 description 8
- 229910052979 sodium sulfide Inorganic materials 0.000 description 8
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 229910052785 arsenic Inorganic materials 0.000 description 7
- 239000011575 calcium Substances 0.000 description 7
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 6
- 235000011941 Tilia x europaea Nutrition 0.000 description 6
- 229910052980 cadmium sulfide Inorganic materials 0.000 description 6
- 239000000292 calcium oxide Substances 0.000 description 6
- 229910052802 copper Inorganic materials 0.000 description 6
- 239000004571 lime Substances 0.000 description 6
- 235000021317 phosphate Nutrition 0.000 description 6
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 description 5
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 5
- 239000008267 milk Substances 0.000 description 5
- 210000004080 milk Anatomy 0.000 description 5
- 235000013336 milk Nutrition 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 235000013305 food Nutrition 0.000 description 3
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- UYJXRRSPUVSSMN-UHFFFAOYSA-P ammonium sulfide Chemical compound [NH4+].[NH4+].[S-2] UYJXRRSPUVSSMN-UHFFFAOYSA-P 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 210000003734 kidney Anatomy 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004135 Bone phosphate Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- DEMJYWYZJFNNNB-UHFFFAOYSA-N OP(O)(O)=O.OP(O)(O)=O.OP(O)(O)=O Chemical compound OP(O)(O)=O.OP(O)(O)=O.OP(O)(O)=O DEMJYWYZJFNNNB-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 229910052586 apatite Inorganic materials 0.000 description 1
- 150000001553 barium compounds Chemical class 0.000 description 1
- CJDPJFRMHVXWPT-UHFFFAOYSA-N barium sulfide Chemical compound [S-2].[Ba+2] CJDPJFRMHVXWPT-UHFFFAOYSA-N 0.000 description 1
- 235000019347 bone phosphate Nutrition 0.000 description 1
- FRLJSGOEGLARCA-UHFFFAOYSA-N cadmium sulfide Chemical class [S-2].[Cd+2] FRLJSGOEGLARCA-UHFFFAOYSA-N 0.000 description 1
- CJOBVZJTOIVNNF-UHFFFAOYSA-N cadmium sulfide Chemical compound [Cd]=S CJOBVZJTOIVNNF-UHFFFAOYSA-N 0.000 description 1
- WLZRMCYVCSSEQC-UHFFFAOYSA-N cadmium(2+) Chemical compound [Cd+2] WLZRMCYVCSSEQC-UHFFFAOYSA-N 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- JGIATAMCQXIDNZ-UHFFFAOYSA-N calcium sulfide Chemical compound [Ca]=S JGIATAMCQXIDNZ-UHFFFAOYSA-N 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- OMZSGWSJDCOLKM-UHFFFAOYSA-N copper(II) sulfide Chemical compound [S-2].[Cu+2] OMZSGWSJDCOLKM-UHFFFAOYSA-N 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 231100001261 hazardous Toxicity 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910052976 metal sulfide Inorganic materials 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- DPLVEEXVKBWGHE-UHFFFAOYSA-N potassium sulfide Chemical compound [S-2].[K+].[K+] DPLVEEXVKBWGHE-UHFFFAOYSA-N 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B25/00—Phosphorus; Compounds thereof
- C01B25/16—Oxyacids of phosphorus; Salts thereof
- C01B25/18—Phosphoric acid
- C01B25/234—Purification; Stabilisation; Concentration
- C01B25/237—Selective elimination of impurities
- C01B25/238—Cationic impurities, e.g. arsenic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Removal Of Specific Substances (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
- Processing Of Solid Wastes (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE7904135 | 1979-05-10 | ||
| SE7904135A SE418845B (sv) | 1979-05-10 | 1979-05-10 | Forfarande for rening av vatprocessfosforsyra |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI801521A7 FI801521A7 (fi) | 1980-11-11 |
| FI66162B FI66162B (fi) | 1984-05-31 |
| FI66162C true FI66162C (fi) | 1984-09-10 |
Family
ID=20338025
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI801521A FI66162C (fi) | 1979-05-10 | 1980-05-09 | Foerfarande foer rening av fosforsyra med avseende pao tungmetaller |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4378340A (Direct) |
| EP (1) | EP0023195B2 (Direct) |
| JP (1) | JPH021086B2 (Direct) |
| AT (1) | ATE6050T1 (Direct) |
| DE (1) | DE3066353D1 (Direct) |
| DK (1) | DK151216C (Direct) |
| FI (1) | FI66162C (Direct) |
| NO (1) | NO152505C (Direct) |
| SE (1) | SE418845B (Direct) |
| WO (1) | WO1980002418A1 (Direct) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3134847A1 (de) * | 1981-09-03 | 1983-03-17 | Hoechst Ag, 6000 Frankfurt | "verfahren zur gewinnung cadmium-freier rohphosphorsaeure" |
| FR2520342A1 (fr) * | 1982-01-25 | 1983-07-29 | Rhone Poulenc Chim Base | Procede de purification d'acide phosphorique de voie humide |
| DE3202658A1 (de) * | 1982-01-28 | 1983-08-04 | Hoechst Ag, 6230 Frankfurt | Verfahren zur entfernung von schwermetallionen aus nassverfahrensphosphorsaeure |
| EP0087065B1 (de) * | 1982-02-12 | 1985-09-25 | Hoechst Aktiengesellschaft | Verfahren zur Verminderung des Schwermetallgehaltes im Rohphosphat |
| DE3218599A1 (de) * | 1982-05-18 | 1983-12-01 | Chemische Fabrik Budenheim Rudolf A. Oetker, 6501 Budenheim | Verfahren zum entfernen von cadmium aus sauren, insbesondere p(pfeil abwaerts)2(pfeil abwaerts)0(pfeil abwaerts)5(pfeil abwaerts)-haltigen loesungen |
| DE3604483A1 (de) * | 1986-02-13 | 1987-08-20 | Hoechst Ag | Verfahren zum entfernen von schwermetallen aus mineralsaeuren |
| DE3604920A1 (de) * | 1986-02-17 | 1987-08-20 | Hoechst Ag | Verfahren zur herstellung von rohphosphorsaeure |
| DE3622597A1 (de) * | 1986-07-04 | 1988-01-07 | Budenheim Rud A Oetker Chemie | Verfahren zur faellung und abtrennung von cadmiumsulfid aus den raffinaten der phosphorsaeurereinigung |
| NL8601846A (nl) * | 1986-07-15 | 1988-02-01 | Stamicarbon | Werkwijze voor het verwijderen van zware metalen uit zure fosfaathoudende waterige media. |
| DE3631290A1 (de) * | 1986-09-13 | 1988-03-24 | Budenheim Rud A Oetker Chemie | Verfahren zur behandlung von nassverfahrensphosphorsaeure |
| NO164768C (no) * | 1988-03-04 | 1990-11-14 | Norsk Hydro As | Fremgangsmaate for fjerning av tungmetaller, spesielt kadmium, fra fosforsyreholdige loesninger. |
| DE4327401A1 (de) * | 1993-08-14 | 1995-02-16 | Hoechst Ag | Verfahren zur Entfernung von Blei und Cadmium aus Phosphorsäure |
| US20040179984A1 (en) * | 2003-03-13 | 2004-09-16 | Nagaraj D. R. | Process for removing metal impurities from wet process phosphoric acid and compositions thereof |
| TW200944535A (en) * | 2008-03-20 | 2009-11-01 | Sigma Aldrich Co | Purification and preparation of phosphorus-containing compounds |
| WO2013190116A1 (en) * | 2012-06-21 | 2013-12-27 | Outotec Oyj | Process and plant for separating heavy metals from phosphoric starting material |
| DE102014006278B3 (de) * | 2014-05-02 | 2015-02-26 | Remondis Aqua Gmbh & Co. Kg | Verfahren zur Reinigung von Roh-Phosphorsäure (z.B. MGA-Säure) durch Zugabe von Aschen aus Abfall-Verbrennungsanlagen umfassend die Gewinnung von reiner Phosphorsäure, Kalziumsulfat, wasserlöslichen Kalziumhydrogenphosphaten und Metallsalz-Lösung |
| FR3039830B1 (fr) | 2015-08-03 | 2018-09-07 | Ocp Sa | Procede de fabrication d'un engrais a base de phosphate d'ammonium presentant une teneur reduite en cadmium |
| EP3691992B1 (en) | 2017-10-08 | 2022-07-06 | Cytec Industries Inc. | Processes for removing heavy metals from phosphoric acid solutions |
| EP3925710A1 (en) | 2020-06-16 | 2021-12-22 | Yara International ASA | Method for treating solid hazardous heavy metal-containing compositions |
| EP3964478A1 (en) | 2020-09-08 | 2022-03-09 | Yara International ASA | Process for the removal of heavy metals from a phosphoric acid containing composition |
| EP3964477A1 (en) | 2020-09-08 | 2022-03-09 | Yara International ASA | Process for the removal of heavy metals from a phosphoric acid containing composition using an ionic polymeric surfactant |
| EP4164815A1 (en) | 2020-06-16 | 2023-04-19 | Yara International ASA | Process for the removal of heavy metals from a phosphoric acid containing composition |
| EP3964476A1 (en) | 2020-09-08 | 2022-03-09 | Yara International ASA | Process for the removal of heavy metals from a phosphoric acid containing composition using a flocculating agent |
| BR112022020189A2 (pt) | 2020-06-16 | 2022-11-22 | Yara Int Asa | Processo para a remoção de metais pesados de uma composição contendo ácido fosfórico usando um agente de floculação |
| CA3180517A1 (en) | 2020-06-16 | 2021-12-23 | Yara International Asa | Process for the removal of heavy metals from a phosphoric acid containing composition using an ionic polymeric surfactant and use of said surfactant in the precipitation of heavy metals in a phosphoric acid containing composition |
| EP4015452A1 (en) | 2020-12-21 | 2022-06-22 | Técnicas Reunidas, S.A. | Process for producing technical grade phosphoric acid from sewage sludge ash |
| WO2024047228A1 (en) | 2022-09-02 | 2024-03-07 | Cytec Industries Inc. | Reagents and processes for removing heavy metals from phosphoric acid solutions |
| PL442462A1 (pl) * | 2022-10-07 | 2024-04-08 | Politechnika Wrocławska | Sposób oczyszczania surowców fosforowych przez kalcynację z dodatkiem soli nieorganicznych |
| CN120322408A (zh) | 2022-11-17 | 2025-07-15 | 塞特工业公司 | 用于从含磷酸的流中去除重金属的组合物和方法 |
| WO2024256668A1 (en) | 2023-06-15 | 2024-12-19 | Cytec Industries Inc. | Heavy metals removal from phosphoric acid containing streams |
| WO2025219513A1 (en) | 2024-04-19 | 2025-10-23 | Cytec Industries Inc. | Compositions and processes for removing heavy metals from acid-containing streams |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE190035C1 (Direct) | 1964-01-01 | |||
| SE37857C1 (Direct) | 1914-11-18 | |||
| US935337A (en) * | 1908-07-08 | 1909-09-28 | John Herbert Thwaites | Wet method of separating metallic compounds. |
| US1473641A (en) * | 1921-08-24 | 1923-11-13 | Pohl Otto | Process of dry distilling and carbonizing crude peat |
| US1783757A (en) * | 1927-12-14 | 1930-12-02 | Ig Farbenindustrie Ag | Dehydration of moist fuels |
| US1787192A (en) * | 1928-08-11 | 1930-12-30 | Rumford Chemical Works | Method of purifying phosphoric acid and the like |
| US2183924A (en) * | 1938-04-13 | 1939-12-19 | Eugene P Schoch | Lignite and process of producing the same |
| DE817590C (de) | 1948-10-02 | 1951-10-18 | Paul Hoppe | Verfahren zum Herstellen von hochwertigem Brennstoff |
| US3124419A (en) * | 1961-04-20 | 1964-03-10 | Purification of phosphoric acid | |
| US3205589A (en) * | 1961-09-27 | 1965-09-14 | West Wood Proc Corp | Process of drying wood by oil immersion and vacuum treatment to selected moisture content with oil recovery |
| US3685964A (en) * | 1970-12-09 | 1972-08-22 | Fmc Corp | Purification of alkali phosphate solution |
| SE393676B (sv) | 1972-02-22 | 1977-05-16 | B O Heger | Forfarande for torkning av tre och andra liknande fiberprodukter |
| JPS5018388A (Direct) * | 1973-06-21 | 1975-02-26 | ||
| JPS5651123B2 (Direct) * | 1973-11-07 | 1981-12-03 | ||
| DE2447390C3 (de) * | 1974-10-04 | 1983-11-17 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Reinigung von Naßphosphorsäure |
| DE2608029C2 (de) * | 1976-02-27 | 1984-02-23 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Herstellung einer Alkaliphosphatlösung aus Naßverfahrensphosphorsäuren |
| JPS5375196A (en) * | 1976-12-15 | 1978-07-04 | Central Glass Co Ltd | Removing method for heavy metals from phosphoric acid solution |
-
1979
- 1979-05-10 SE SE7904135A patent/SE418845B/sv not_active IP Right Cessation
-
1980
- 1980-05-08 WO PCT/SE1980/000134 patent/WO1980002418A1/en not_active Ceased
- 1980-05-08 JP JP55501082A patent/JPH021086B2/ja not_active Expired - Lifetime
- 1980-05-08 DE DE8080850070T patent/DE3066353D1/de not_active Expired
- 1980-05-08 US US06/220,060 patent/US4378340A/en not_active Expired - Fee Related
- 1980-05-08 EP EP80850070A patent/EP0023195B2/en not_active Expired
- 1980-05-08 AT AT80850070T patent/ATE6050T1/de not_active IP Right Cessation
- 1980-05-09 FI FI801521A patent/FI66162C/fi not_active IP Right Cessation
- 1980-12-22 DK DK547780A patent/DK151216C/da not_active IP Right Cessation
-
1981
- 1981-01-07 NO NO810039A patent/NO152505C/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI801521A7 (fi) | 1980-11-11 |
| EP0023195B1 (en) | 1984-02-01 |
| DK547780A (da) | 1980-12-22 |
| FI66162B (fi) | 1984-05-31 |
| EP0023195A2 (en) | 1981-01-28 |
| US4378340A (en) | 1983-03-29 |
| SE418845B (sv) | 1981-06-29 |
| JPH021086B2 (Direct) | 1990-01-10 |
| EP0023195A3 (en) | 1981-09-09 |
| DE3066353D1 (en) | 1984-03-08 |
| DK151216B (da) | 1987-11-16 |
| NO152505B (no) | 1985-07-01 |
| NO152505C (no) | 1985-10-09 |
| EP0023195B2 (en) | 1988-09-21 |
| WO1980002418A1 (en) | 1980-11-13 |
| NO810039L (no) | 1981-01-07 |
| ATE6050T1 (de) | 1984-02-15 |
| JPS56500492A (Direct) | 1981-04-16 |
| SE7904135L (sv) | 1980-11-11 |
| DK151216C (da) | 1988-07-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI66162C (fi) | Foerfarande foer rening av fosforsyra med avseende pao tungmetaller | |
| US4986970A (en) | Method for removal of heavy metals, especially cadmium, from phosphoric acid containing solutions | |
| US10464853B2 (en) | Source of phosphate for agriculture and the food industry | |
| IL281830B1 (en) | Process for purifying and concentrating rare earths from phosphogypsum | |
| JP2680285B2 (ja) | 肥料の製造方法 | |
| FI80251C (fi) | Foerfarande foer behandling av tungmetallhaltigt avfall fraon rening av raofosforsyror. | |
| US4053562A (en) | Production of alkali metal phosphate solutions of low vanadium content | |
| AU2024303923A1 (en) | Heavy metals removal from phosphoric acid containing streams | |
| CA1045339A (en) | Process and apparatus for purifying wet-processed phosphoric acid | |
| US20250042742A1 (en) | Process for producing a phosphate containing product from a phosphate source | |
| AU2023332203A1 (en) | Reagents and processes for removing heavy metals from phosphoric acid solutions | |
| CA1261115A (en) | Process for dearsenifying phosphoric acid solutions | |
| US4299803A (en) | Production of alkali metal phosphate solutions free from zinc | |
| CA1156427A (en) | Method of purifying phosphoric acid of heavy metals | |
| CA1141939A (en) | Production of alkali metal phosphate solutions free from zinc | |
| RU2145571C1 (ru) | Способ получения фосфорной кислоты | |
| KR970009647B1 (ko) | 비소(As)가 함유된 폐수의 처리방법 | |
| RU1781303C (ru) | Способ нейтрализации гидролизата растительного сырь | |
| DE4040474A1 (de) | Neue dithiophosphorsaeureester und deren verwendung zur faellung und flotation von schwermetallen aus mineralsaeuren | |
| US5124048A (en) | Treatment of waste and residue containing sodium and potassium ions | |
| SU833571A1 (ru) | Способ очистки сточных вод от мышь ка | |
| SU856985A1 (ru) | Способ очистки фосфатсодержащих сточных вод | |
| SU880972A1 (ru) | Раствор дл отмывки сульфата кальци | |
| EP0233523A2 (de) | Verfahren zur Herstellung von Rohphosphorsäure | |
| JPH0117753B2 (Direct) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: BOLIDEN AKTIEBOLAG |