FI57260C - Foerfarande foer framstaellning av terapeutiskt verksamma 2-amino-3,4-dihydro-5-metyl-imidazo-/5,1-f/-as-triaziner - Google Patents
Foerfarande foer framstaellning av terapeutiskt verksamma 2-amino-3,4-dihydro-5-metyl-imidazo-/5,1-f/-as-triaziner Download PDFInfo
- Publication number
- FI57260C FI57260C FI3900/73A FI390073A FI57260C FI 57260 C FI57260 C FI 57260C FI 3900/73 A FI3900/73 A FI 3900/73A FI 390073 A FI390073 A FI 390073A FI 57260 C FI57260 C FI 57260C
- Authority
- FI
- Finland
- Prior art keywords
- group
- carbon atoms
- dihydro
- amino
- substituted
- Prior art date
Links
- 230000001225 therapeutic effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 37
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- 125000000217 alkyl group Chemical group 0.000 claims description 22
- 125000003545 alkoxy group Chemical group 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 13
- 125000005843 halogen group Chemical group 0.000 claims description 12
- 125000002252 acyl group Chemical group 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 229910052987 metal hydride Inorganic materials 0.000 claims description 5
- 150000004681 metal hydrides Chemical class 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- IJYHVZICHKCLMQ-UHFFFAOYSA-N imidazo[4,5-d]triazin-4-one Chemical compound O=C1N=NN=C2N=CN=C12 IJYHVZICHKCLMQ-UHFFFAOYSA-N 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 63
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 54
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 41
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 31
- -1 lithium aluminum hydride Chemical compound 0.000 description 29
- 239000000203 mixture Substances 0.000 description 28
- 239000007787 solid Substances 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 16
- 238000002844 melting Methods 0.000 description 14
- 230000008018 melting Effects 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 11
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 7
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- 239000012280 lithium aluminium hydride Substances 0.000 description 7
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 5
- 229940124630 bronchodilator Drugs 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- WFKAJVHLWXSISD-UHFFFAOYSA-N isobutyramide Chemical compound CC(C)C(N)=O WFKAJVHLWXSISD-UHFFFAOYSA-N 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 4
- FWWOWPGPERBCNJ-UHFFFAOYSA-N 2-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid Chemical compound OCCOC(=O)CC(O)C(O)=O FWWOWPGPERBCNJ-UHFFFAOYSA-N 0.000 description 4
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 4
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- GMXWDFNZUIWGRJ-UHFFFAOYSA-N NC=1NN(C(C(N1)=O)C(C)N)CC1=CC=CC=C1 Chemical compound NC=1NN(C(C(N1)=O)C(C)N)CC1=CC=CC=C1 GMXWDFNZUIWGRJ-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000001589 carboacyl group Chemical group 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- QMNWYGTWTXOQTP-UHFFFAOYSA-N 1h-triazin-6-one Chemical compound O=C1C=CN=NN1 QMNWYGTWTXOQTP-UHFFFAOYSA-N 0.000 description 3
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 125000003435 aroyl group Chemical group 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- 230000001813 broncholytic effect Effects 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229940047889 isobutyramide Drugs 0.000 description 3
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- XYHKNCXZYYTLRG-UHFFFAOYSA-N 1h-imidazole-2-carbaldehyde Chemical compound O=CC1=NC=CN1 XYHKNCXZYYTLRG-UHFFFAOYSA-N 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 2
- LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical compound NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 description 2
- GWYFCOCPABKNJV-UHFFFAOYSA-M 3-Methylbutanoic acid Natural products CC(C)CC([O-])=O GWYFCOCPABKNJV-UHFFFAOYSA-M 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 201000005569 Gout Diseases 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N benzene carboxamide Natural products NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- GWYFCOCPABKNJV-UHFFFAOYSA-N beta-methyl-butyric acid Natural products CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 2
- 239000000168 bronchodilator agent Substances 0.000 description 2
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- FGKJLKRYENPLQH-UHFFFAOYSA-N isocaproic acid Chemical compound CC(C)CCC(O)=O FGKJLKRYENPLQH-UHFFFAOYSA-N 0.000 description 2
- SANOUVWGPVYVAV-UHFFFAOYSA-N isovaleramide Chemical compound CC(C)CC(N)=O SANOUVWGPVYVAV-UHFFFAOYSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- AMLUTWHRKQGOTC-UHFFFAOYSA-N (2-cyclohexylacetyl) 2-cyclohexylacetate Chemical compound C1CCCCC1CC(=O)OC(=O)CC1CCCCC1 AMLUTWHRKQGOTC-UHFFFAOYSA-N 0.000 description 1
- XCYJPXQACVEIOS-UHFFFAOYSA-N 1-isopropyl-3-methylbenzene Chemical compound CC(C)C1=CC=CC(C)=C1 XCYJPXQACVEIOS-UHFFFAOYSA-N 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- DKLQJNUJPSHYQG-UHFFFAOYSA-N 2-cyclohexylacetamide Chemical compound NC(=O)CC1CCCCC1 DKLQJNUJPSHYQG-UHFFFAOYSA-N 0.000 description 1
- PLMQGZMOKKJNHI-UHFFFAOYSA-N 3-(1-aminoethyl)-4H-1,2,4-triazin-5-one Chemical compound NC(C)C1=NN=CC(N1)=O PLMQGZMOKKJNHI-UHFFFAOYSA-N 0.000 description 1
- FREZLSIGWNCSOQ-UHFFFAOYSA-N 3-methylbutanoyl 3-methylbutanoate Chemical compound CC(C)CC(=O)OC(=O)CC(C)C FREZLSIGWNCSOQ-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- XRHGYUZYPHTUJZ-UHFFFAOYSA-N 4-chlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1 XRHGYUZYPHTUJZ-UHFFFAOYSA-N 0.000 description 1
- POFJHQACUQZQDA-UHFFFAOYSA-N 5-methyl-7-(2-methylbutyl)-1,4-dihydroimidazo[5,1-f][1,2,4]triazin-2-amine Chemical compound C1NC(N)=NN2C(CC(C)CC)=NC(C)=C21 POFJHQACUQZQDA-UHFFFAOYSA-N 0.000 description 1
- PZASAAIJIFDWSB-CKPDSHCKSA-N 8-[(1S)-1-[8-(trifluoromethyl)-7-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]ethyl]-8-azabicyclo[3.2.1]octane-3-carboxylic acid Chemical compound FC(F)(F)C=1C2=CC([C@@H](N3C4CCC3CC(C4)C(O)=O)C)=CC=C2C=CC=1OC1CCC(C(F)(F)F)CC1 PZASAAIJIFDWSB-CKPDSHCKSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 206010005746 Blood pressure fluctuation Diseases 0.000 description 1
- 208000009079 Bronchial Spasm Diseases 0.000 description 1
- 206010006482 Bronchospasm Diseases 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 206010007559 Cardiac failure congestive Diseases 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- GXESFRURCHJCJF-UHFFFAOYSA-N N-[1-(3-amino-2-benzyl-5-oxo-1,2,4-triazin-6-yl)ethyl]-2-cyclohexylacetamide Chemical compound NC=1N(N=C(C(N=1)=O)C(C)NC(CC1CCCCC1)=O)CC1=CC=CC=C1 GXESFRURCHJCJF-UHFFFAOYSA-N 0.000 description 1
- XZMNDICNJXYIDO-UHFFFAOYSA-N N-[1-(3-amino-2-benzyl-5-oxo-1,2,4-triazin-6-yl)ethyl]-2-cyclopentylacetamide Chemical compound N=1N(CC=2C=CC=CC=2)C(N)=NC(=O)C=1C(C)NC(=O)CC1CCCC1 XZMNDICNJXYIDO-UHFFFAOYSA-N 0.000 description 1
- CDIRNJUIJOTUEE-UHFFFAOYSA-N N-[1-(3-amino-2-benzyl-5-oxo-1,2,4-triazin-6-yl)ethyl]-2-methylbutanamide Chemical compound NC1=NC(=O)C(C(C)NC(=O)C(C)CC)=NN1CC1=CC=CC=C1 CDIRNJUIJOTUEE-UHFFFAOYSA-N 0.000 description 1
- LFKLAMZWARMJHM-UHFFFAOYSA-N N-[1-(3-amino-2-benzyl-5-oxo-1,2,4-triazin-6-yl)ethyl]-3-methylpentanamide Chemical compound NC1=NC(=O)C(C(C)NC(=O)CC(C)CC)=NN1CC1=CC=CC=C1 LFKLAMZWARMJHM-UHFFFAOYSA-N 0.000 description 1
- LYEXBRXSBSCTMI-UHFFFAOYSA-N N-[1-(3-amino-5-oxo-4H-1,2,4-triazin-6-yl)ethyl]-2-cyclopentylacetamide Chemical compound N=1N=C(N)NC(=O)C=1C(C)NC(=O)CC1CCCC1 LYEXBRXSBSCTMI-UHFFFAOYSA-N 0.000 description 1
- NFILHASEQZANTI-UHFFFAOYSA-N N-[1-(3-amino-5-oxo-4H-1,2,4-triazin-6-yl)ethyl]-2-methylbutanamide Chemical compound CCC(C)C(=O)NC(C)C1=NN=C(N)NC1=O NFILHASEQZANTI-UHFFFAOYSA-N 0.000 description 1
- CAKWATXPWICLQP-UHFFFAOYSA-N N-[1-(3-amino-5-oxo-4H-1,2,4-triazin-6-yl)ethyl]-4-methylpentanamide Chemical compound NC1=NN=C(C(N1)=O)C(C)NC(CCC(C)C)=O CAKWATXPWICLQP-UHFFFAOYSA-N 0.000 description 1
- JWHPZIBLGLBDEV-UHFFFAOYSA-N N1=C(N)NC(=O)C=2N1C(C(C)C)=NC=2C Chemical compound N1=C(N)NC(=O)C=2N1C(C(C)C)=NC=2C JWHPZIBLGLBDEV-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 102000004861 Phosphoric Diester Hydrolases Human genes 0.000 description 1
- 108090001050 Phosphoric Diester Hydrolases Proteins 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- 206010037423 Pulmonary oedema Diseases 0.000 description 1
- 208000005392 Spasm Diseases 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004373 acetylcholine Drugs 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 210000001367 artery Anatomy 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 206010006451 bronchitis Diseases 0.000 description 1
- 230000007885 bronchoconstriction Effects 0.000 description 1
- 230000003182 bronchodilatating effect Effects 0.000 description 1
- 230000007883 bronchodilation Effects 0.000 description 1
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000003177 cardiotonic effect Effects 0.000 description 1
- OJYGBLRPYBAHRT-IPQSZEQASA-N chloralose Chemical compound O1[C@H](C(Cl)(Cl)Cl)O[C@@H]2[C@@H](O)[C@@H]([C@H](O)CO)O[C@@H]21 OJYGBLRPYBAHRT-IPQSZEQASA-N 0.000 description 1
- 229950009941 chloralose Drugs 0.000 description 1
- SOIODWSIJIUYHX-UHFFFAOYSA-N chlorobenzene;methane Chemical compound C.ClC1=CC=CC=C1 SOIODWSIJIUYHX-UHFFFAOYSA-N 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 229960003821 choline theophyllinate Drugs 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000003413 degradative effect Effects 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000002532 enzyme inhibitor Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- AZTMMFCJOROKMO-UHFFFAOYSA-N imidazo[5,1-f][1,2,4]triazine Chemical class N1=CN=CC2=CN=CN21 AZTMMFCJOROKMO-UHFFFAOYSA-N 0.000 description 1
- LSACYLWPPQLVSM-UHFFFAOYSA-N isobutyric acid anhydride Chemical compound CC(C)C(=O)OC(=O)C(C)C LSACYLWPPQLVSM-UHFFFAOYSA-N 0.000 description 1
- 210000004731 jugular vein Anatomy 0.000 description 1
- QDLAGTHXVHQKRE-UHFFFAOYSA-N lichenxanthone Natural products COC1=CC(O)=C2C(=O)C3=C(C)C=C(OC)C=C3OC2=C1 QDLAGTHXVHQKRE-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- IZDROVVXIHRYMH-UHFFFAOYSA-N methanesulfonic anhydride Chemical compound CS(=O)(=O)OS(C)(=O)=O IZDROVVXIHRYMH-UHFFFAOYSA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- 210000005036 nerve Anatomy 0.000 description 1
- 230000001129 nonadrenergic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- RLANKEDHRWMNRO-UHFFFAOYSA-M oxtriphylline Chemical compound C[N+](C)(C)CCO.O=C1N(C)C(=O)N(C)C2=C1[N-]C=N2 RLANKEDHRWMNRO-UHFFFAOYSA-M 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- JQPTYAILLJKUCY-UHFFFAOYSA-N palladium(ii) oxide Chemical compound [O-2].[Pd+2] JQPTYAILLJKUCY-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000003395 phenylethylamino group Chemical group [H]N(*)C([H])([H])C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- VHWJSJBTUWUEAL-UHFFFAOYSA-N propanamide;hydrochloride Chemical compound Cl.CCC(N)=O VHWJSJBTUWUEAL-UHFFFAOYSA-N 0.000 description 1
- 208000005333 pulmonary edema Diseases 0.000 description 1
- 230000035485 pulse pressure Effects 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000003506 spasmogen Substances 0.000 description 1
- 230000002048 spasmolytic effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- FDRPZJWMPZUHBN-UHFFFAOYSA-N triazin-2-ium;chloride Chemical compound Cl.C1=CN=NN=C1 FDRPZJWMPZUHBN-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/02—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 not condensed with other rings
- C07D253/06—1,2,4-Triazines
- C07D253/065—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members
- C07D253/07—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members with hetero atoms, or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D253/075—Two hetero atoms, in positions 3 and 5
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/53—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with three nitrogens as the only ring hetero atoms, e.g. chlorazanil, melamine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB55373 | 1973-01-04 | ||
| GB55373*[A GB1457873A (en) | 1973-01-04 | 1973-01-04 | Imidazotriazines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI57260B FI57260B (fi) | 1980-03-31 |
| FI57260C true FI57260C (fi) | 1980-07-10 |
Family
ID=9706420
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI3900/73A FI57260C (fi) | 1973-01-04 | 1973-12-18 | Foerfarande foer framstaellning av terapeutiskt verksamma 2-amino-3,4-dihydro-5-metyl-imidazo-/5,1-f/-as-triaziner |
| FI793137A FI793137A7 (fi) | 1973-01-04 | 1979-10-10 | Menetelmä terapeuttisesti vaikuttavien 2-amino-3-hydro-imidatsotriatsiinien valmistamiseksi. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI793137A FI793137A7 (fi) | 1973-01-04 | 1979-10-10 | Menetelmä terapeuttisesti vaikuttavien 2-amino-3-hydro-imidatsotriatsiinien valmistamiseksi. |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3941785A (cs) |
| JP (1) | JPS4995994A (cs) |
| AT (1) | AT336029B (cs) |
| AU (1) | AU474078B2 (cs) |
| BE (1) | BE809369A (cs) |
| CA (1) | CA1005057A (cs) |
| CH (1) | CH618170A5 (cs) |
| DE (1) | DE2364076A1 (cs) |
| ES (1) | ES422001A1 (cs) |
| FI (2) | FI57260C (cs) |
| FR (1) | FR2213058B1 (cs) |
| GB (1) | GB1457873A (cs) |
| IE (1) | IE38681B1 (cs) |
| IL (1) | IL43872A (cs) |
| LU (1) | LU69099A1 (cs) |
| NL (1) | NL7400095A (cs) |
| NO (1) | NO140301C (cs) |
| SE (1) | SE408179B (cs) |
| ZA (1) | ZA739534B (cs) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK109578A (da) * | 1977-03-25 | 1978-09-26 | Allen & Hanburys Ltd | Fremgangsmaade til fremstilling af heterocycliske forbindelser |
| US4096257A (en) * | 1977-05-23 | 1978-06-20 | American Cyanamid Company | Substituted imidazo [1,2-d]-as-triazines |
| US4107309A (en) * | 1977-05-23 | 1978-08-15 | American Cyanamid Company | Substituted imidazo[1,2-d]-as-triazines |
| US4126444A (en) * | 1977-11-22 | 1978-11-21 | American Cynamid Company | Substituted imidazo (1,5-D)-as-triazin-4-ols, and herbicidal use thereof |
| US4308384A (en) * | 1978-09-18 | 1981-12-29 | Glaxo Group Limited | Production of triazinones |
| DD244681A3 (de) * | 1985-12-02 | 1987-04-15 | Zeiss Jena Veb Carl | Vorrichtung zur positionierung von enden flexibler lichtleitelemente |
| US6624181B1 (en) * | 1997-02-28 | 2003-09-23 | Altana Pharma Ag | Synergistic combination |
| HU230154B1 (hu) * | 1997-11-12 | 2015-09-28 | Bayer Intellectual Property Gmbh | Eljárás 2-es helyzetben fenil-szubszituenst hordozó imidazo-triazinon-származékok előállítására |
| DE19827640A1 (de) * | 1998-06-20 | 1999-12-23 | Bayer Ag | 7-Alkyl- und Cycloalkyl-substituierte Imidazotriazinone |
| WO2000012078A1 (en) | 1998-08-26 | 2000-03-09 | Smithkline Beecham Corporation | Therapies for treating pulmonary diseases |
| CA2381802C (en) * | 1999-08-21 | 2010-12-07 | Byk Gulden Lomberg Chemische Fabrik Gmbh | Synergistic combination of roflumilast and salmeterol |
| WO2002089808A1 (de) * | 2001-05-09 | 2002-11-14 | Bayer Healthcare Ag | Neue verwendung von 2-phenyl-substituierten imidazotriazinonen |
| GB0113344D0 (en) | 2001-06-01 | 2001-07-25 | Bayer Ag | Novel heterocycles 3 |
| GB0113343D0 (en) * | 2001-06-01 | 2001-07-25 | Bayer Ag | Novel Heterocycles 2 |
| DE10130167A1 (de) * | 2001-06-22 | 2003-01-02 | Bayer Ag | Imidazotriazine |
| DE10135815A1 (de) | 2001-07-23 | 2003-02-06 | Bayer Ag | Verwendung von 2-Alkoxyphenyl-substituierten Imidazotriazinonen |
| DE10230605A1 (de) * | 2002-07-08 | 2004-01-29 | Bayer Ag | Substituierte Imidazotriazine |
| DE10230604A1 (de) * | 2002-07-08 | 2004-01-29 | Bayer Ag | Heterocyclisch substituierte Imidazotriazine |
| DE10232113A1 (de) | 2002-07-16 | 2004-01-29 | Bayer Ag | Vardenafil Hydrochlorid Trihydrat enthaltende Arzneimittel |
| EP1608656B1 (en) * | 2003-04-01 | 2009-06-03 | SmithKline Beecham Corporation | Imidazotriazine compounds for the treatment of cancer diseases |
| DE102005001989A1 (de) * | 2005-01-15 | 2006-07-20 | Bayer Healthcare Ag | Intravenöse Formulierungen von PDE-Inhibitoren |
| DE102005009240A1 (de) * | 2005-03-01 | 2006-09-07 | Bayer Healthcare Ag | Arzneiformen mit verbesserten pharmakokinetischen Eigenschaften |
| DE102005009241A1 (de) * | 2005-03-01 | 2006-09-07 | Bayer Healthcare Ag | Arzneiformen mit kontrollierter Bioverfügbarkeit |
| EP2258357A3 (en) | 2005-08-26 | 2011-04-06 | Braincells, Inc. | Neurogenesis with acetylcholinesterase inhibitor |
| EP2275096A3 (en) | 2005-08-26 | 2011-07-13 | Braincells, Inc. | Neurogenesis via modulation of the muscarinic receptors |
| SG166106A1 (en) * | 2005-09-29 | 2010-11-29 | Bayer Schering Pharma Ag | Pde inhibitors and combinations thereof for the treatment of urological disorders |
| EP1940389A2 (en) | 2005-10-21 | 2008-07-09 | Braincells, Inc. | Modulation of neurogenesis by pde inhibition |
| US20070112017A1 (en) | 2005-10-31 | 2007-05-17 | Braincells, Inc. | Gaba receptor mediated modulation of neurogenesis |
| US20100216734A1 (en) * | 2006-03-08 | 2010-08-26 | Braincells, Inc. | Modulation of neurogenesis by nootropic agents |
| CA2643199A1 (en) * | 2006-03-08 | 2007-09-13 | Braincells, Inc. | Modulation of neurogenesis by nootropic agents |
| CA2651862A1 (en) * | 2006-05-09 | 2007-11-22 | Braincells, Inc. | 5 ht receptor mediated neurogenesis |
| AU2007249399A1 (en) | 2006-05-09 | 2007-11-22 | Braincells, Inc. | Neurogenesis by modulating angiotensin |
| US20100009983A1 (en) * | 2006-05-09 | 2010-01-14 | Braincells, Inc. | 5 ht receptor mediated neurogenesis |
| WO2008030651A1 (en) * | 2006-09-08 | 2008-03-13 | Braincells, Inc. | Combinations containing a 4-acylaminopyridine derivative |
| CA2663347A1 (en) * | 2006-09-19 | 2008-03-27 | Braincells, Inc. | Ppar mediated modulation of neurogenesis |
| US20100184806A1 (en) | 2006-09-19 | 2010-07-22 | Braincells, Inc. | Modulation of neurogenesis by ppar agents |
| KR20100029762A (ko) * | 2007-06-13 | 2010-03-17 | 바이엘 쉐링 파마 악티엔게젤샤프트 | 청력 장애 치료용 pde 억제제 |
| WO2010099217A1 (en) | 2009-02-25 | 2010-09-02 | Braincells, Inc. | Modulation of neurogenesis using d-cycloserine combinations |
| US20150119399A1 (en) | 2012-01-10 | 2015-04-30 | President And Fellows Of Harvard College | Beta-cell replication promoting compounds and methods of their use |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE791025A (fr) * | 1971-11-19 | 1973-05-07 | Allen & Hanburys Ltd | Composes heterocycliques |
-
1973
- 1973-01-04 GB GB55373*[A patent/GB1457873A/en not_active Expired
- 1973-12-18 ZA ZA739534A patent/ZA739534B/xx unknown
- 1973-12-18 FI FI3900/73A patent/FI57260C/fi active
- 1973-12-18 NO NO4843/73A patent/NO140301C/no unknown
- 1973-12-19 AU AU63774/73A patent/AU474078B2/en not_active Expired
- 1973-12-20 IL IL43872A patent/IL43872A/xx unknown
- 1973-12-21 DE DE2364076A patent/DE2364076A1/de not_active Withdrawn
- 1973-12-26 US US05/427,558 patent/US3941785A/en not_active Expired - Lifetime
- 1973-12-28 CA CA189,199A patent/CA1005057A/en not_active Expired
- 1973-12-28 FR FR7346979A patent/FR2213058B1/fr not_active Expired
- 1973-12-31 JP JP49004782A patent/JPS4995994A/ja active Pending
- 1973-12-31 IE IE2345/73A patent/IE38681B1/xx unknown
-
1974
- 1974-01-02 LU LU69099A patent/LU69099A1/xx unknown
- 1974-01-02 AT AT2374A patent/AT336029B/de not_active IP Right Cessation
- 1974-01-02 CH CH9274A patent/CH618170A5/de not_active IP Right Cessation
- 1974-01-03 BE BE139496A patent/BE809369A/xx unknown
- 1974-01-03 SE SE7400062A patent/SE408179B/xx unknown
- 1974-01-03 ES ES422001A patent/ES422001A1/es not_active Expired
- 1974-01-04 NL NL7400095A patent/NL7400095A/xx not_active Application Discontinuation
-
1979
- 1979-10-10 FI FI793137A patent/FI793137A7/fi not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| SE408179B (sv) | 1979-05-21 |
| AU6377473A (en) | 1975-06-19 |
| AU474078B2 (en) | 1976-07-15 |
| CA1005057A (en) | 1977-02-08 |
| ATA2374A (de) | 1976-08-15 |
| DE2364076A1 (de) | 1974-07-18 |
| FI57260B (fi) | 1980-03-31 |
| NO140301B (no) | 1979-04-30 |
| US3941785A (en) | 1976-03-02 |
| LU69099A1 (cs) | 1974-04-02 |
| FR2213058A1 (cs) | 1974-08-02 |
| NL7400095A (cs) | 1974-07-08 |
| BE809369A (fr) | 1974-07-03 |
| CH618170A5 (cs) | 1980-07-15 |
| IE38681L (en) | 1974-07-04 |
| IL43872A (en) | 1979-01-31 |
| FR2213058B1 (cs) | 1977-07-01 |
| FI793137A7 (fi) | 1981-01-01 |
| AT336029B (de) | 1977-04-12 |
| IL43872A0 (en) | 1974-03-14 |
| JPS4995994A (cs) | 1974-09-11 |
| NO140301C (no) | 1979-08-08 |
| GB1457873A (en) | 1976-12-08 |
| IE38681B1 (en) | 1978-05-10 |
| ZA739534B (en) | 1974-11-27 |
| ES422001A1 (es) | 1976-08-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI57260C (fi) | Foerfarande foer framstaellning av terapeutiskt verksamma 2-amino-3,4-dihydro-5-metyl-imidazo-/5,1-f/-as-triaziner | |
| US3812127A (en) | 4-(quinolin-4-yl)piperazine-1-carboxylic acid esters | |
| FI78097B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara (2-oxo-1,2,3,5-tatrahydroimidazo/2,1-b/ kinazolinyl)oxialkylamider. | |
| Daly et al. | Analogs of caffeine and theophylline: Effect of structural alterations on affinity at adenosine receptors | |
| US3702849A (en) | 4-(isoquinolin-1-yl) piperazine-1-carboxylic acid esters | |
| US4289776A (en) | Xanthine derivatives | |
| US5866580A (en) | Quinazoline derivatives and methods of using the same | |
| CZ342595A3 (en) | Purine derivatives, process of their preparation and pharmaceutical compositions containing thereof | |
| US3950343A (en) | Pyrroloisoquinoline derivatives | |
| PL212407B1 (pl) | Zwiazek pochodny 8-chinolinoksantyny i 8-izochinolinoksantyny, jego zastosowanie, kompozycja farmaceutyczna zawierajaca zwiazek oraz sposób wytwarzania zwiazku | |
| US4783530A (en) | 8-arylxanthines | |
| NO134212B (cs) | ||
| US4276295A (en) | 3-Aromatic moiety substituted-4(3H)-quinazolinones, process for production thereof, and use thereof | |
| Novinson et al. | Adenosine cyclic 3', 5'-monophosphate phosphodiesterase inhibitors. 2. 3-Substituted 5, 7-dialkylpyrazolo [1, 5-a] pyrimidines | |
| Sakai et al. | Effects of alkyl substitutions of xanthine skeleton on bronchodilation | |
| US4822800A (en) | Isoquinolinol compounds having cardiotonic and phosphodiesterase fraction III inhibiting properties and/or renal vasodilating properties | |
| US5314890A (en) | 1-7 disubstituted xanthine derivatives having antiasthmatic activity, their physiologically acceptable salts, pharmaceutical compositions containing them and process for their preparation | |
| EP0180352A2 (en) | Benzene-fused heterocyclic compound | |
| US5342841A (en) | Xanthine derivatives | |
| US5278186A (en) | Chromene derivatives, their production and use | |
| US3944581A (en) | 5-Substituted-2,4-diphenylpyrimidines | |
| US5378844A (en) | 8-(1-aminocycloalkyl)-1,3-dialkylxanthine derivatives, preparation process and antidepressant, nootropic and psychostimulant composition thereoff | |
| HU196758B (en) | Process for production of 3-hidroxi-methil-quinolines and medical compositions containing them | |
| US4176183A (en) | Novel naphthyridines | |
| US4372956A (en) | 5, 10-Dihydroimidazo[2,1-b]quinazolines and pharmaceutical compositions containing them |