FI49308C - Menetelmä 6-aminopenisillaanihapon valmistamiseksi. - Google Patents
Menetelmä 6-aminopenisillaanihapon valmistamiseksi.Info
- Publication number
- FI49308C FI49308C FI671412A FI141267A FI49308C FI 49308 C FI49308 C FI 49308C FI 671412 A FI671412 A FI 671412A FI 141267 A FI141267 A FI 141267A FI 49308 C FI49308 C FI 49308C
- Authority
- FI
- Finland
- Prior art keywords
- preparation
- aminopenicillanic acid
- aminopenicillanic
- acid
- Prior art date
Links
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 title 1
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D499/21—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring with a nitrogen atom directly attached in position 6 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
- C07D499/42—Compounds with a free primary amino radical attached in position 6
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL6606872A NL6606872A (enExample) | 1966-05-18 | 1966-05-18 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI49308B FI49308B (enExample) | 1975-01-31 |
| FI49308C true FI49308C (fi) | 1975-05-12 |
Family
ID=19796644
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI671412A FI49308C (fi) | 1966-05-18 | 1967-05-17 | Menetelmä 6-aminopenisillaanihapon valmistamiseksi. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3676429A (enExample) |
| AT (1) | AT279803B (enExample) |
| BE (1) | BE698596A (enExample) |
| CH (1) | CH513207A (enExample) |
| DE (1) | DE1695313C3 (enExample) |
| DK (1) | DK129938B (enExample) |
| ES (1) | ES340634A1 (enExample) |
| FI (1) | FI49308C (enExample) |
| FR (1) | FR1523029A (enExample) |
| GB (1) | GB1189022A (enExample) |
| IL (1) | IL27882A (enExample) |
| NL (2) | NL6606872A (enExample) |
| NO (1) | NO134801C (enExample) |
| SE (1) | SE356521B (enExample) |
| YU (1) | YU31324B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PL79157B1 (enExample) * | 1970-12-22 | 1975-06-30 | ||
| DE2222094A1 (de) * | 1972-05-05 | 1973-11-15 | Hoechst Ag | Verfahren zur herstellung von aminoazetidinonen |
| NL7908867A (nl) * | 1979-12-10 | 1981-07-01 | Gist Brocades Nv | Werkwijze voor het bereiden van 6-aminopenicillaanzuur- -1,1-dioxide en zijn zouten. |
| KR100815100B1 (ko) * | 2000-03-22 | 2008-03-20 | 소시에떼 데 프로듀이 네슬레 소시에떼아노님 | 애완동물용 식품 조성물 및 이의 제조방법 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1159449B (de) * | 1961-03-22 | 1963-12-19 | Gruenenthal Chemie | Verfahren zur Herstellung von 6-Acylaminopenicillansaeuren und deren Salzen |
| US3304301A (en) * | 1962-12-27 | 1967-02-14 | Rit Rech Ind Therapeut | Derivatives of 6-aminopenicillanic acid |
-
0
- NL NL130546D patent/NL130546C/xx active
-
1966
- 1966-05-18 NL NL6606872A patent/NL6606872A/xx unknown
-
1967
- 1967-04-21 DE DE1695313A patent/DE1695313C3/de not_active Expired
- 1967-04-28 IL IL27882A patent/IL27882A/en unknown
- 1967-05-05 NO NO168015A patent/NO134801C/no unknown
- 1967-05-12 GB GB22057/67A patent/GB1189022A/en not_active Expired
- 1967-05-16 YU YU0989/67A patent/YU31324B/xx unknown
- 1967-05-16 SE SE06804/67A patent/SE356521B/xx unknown
- 1967-05-17 AT AT462267A patent/AT279803B/de not_active IP Right Cessation
- 1967-05-17 FR FR106707A patent/FR1523029A/fr not_active Expired
- 1967-05-17 BE BE698596D patent/BE698596A/xx not_active IP Right Cessation
- 1967-05-17 DK DK258267AA patent/DK129938B/da not_active IP Right Cessation
- 1967-05-17 FI FI671412A patent/FI49308C/fi active
- 1967-05-17 ES ES340634A patent/ES340634A1/es not_active Expired
- 1967-05-18 CH CH696467A patent/CH513207A/de not_active IP Right Cessation
-
1969
- 1969-07-16 US US842344A patent/US3676429A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| SE356521B (enExample) | 1973-05-28 |
| DE1695313B2 (de) | 1974-08-01 |
| BE698596A (enExample) | 1967-11-17 |
| DK129938B (da) | 1974-12-02 |
| YU31324B (en) | 1973-04-30 |
| FR1523029A (fr) | 1968-04-02 |
| AT279803B (de) | 1970-03-25 |
| GB1189022A (en) | 1970-04-22 |
| DK129938C (enExample) | 1975-05-20 |
| NL130546C (enExample) | |
| US3676429A (en) | 1972-07-11 |
| NO134801B (enExample) | 1976-09-06 |
| DE1695313A1 (de) | 1972-07-27 |
| ES340634A1 (es) | 1968-06-01 |
| NO134801C (enExample) | 1976-12-15 |
| NL6606872A (enExample) | 1967-11-20 |
| CH513207A (de) | 1971-09-30 |
| IL27882A (en) | 1970-11-30 |
| DE1695313C3 (de) | 1975-04-10 |
| FI49308B (enExample) | 1975-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI48590C (fi) | Menetelmä terapeuttisesti käytettävien atsaspiroalkaanidioniyhdisteide n valmistamiseksi. | |
| DK120749B (da) | Analogifremgangsmåde til fremstilling af 6-aminopenicillansyrederivater. | |
| FI51046C (fi) | Menetelmä asetosalisyylihappotabletin valmistamiseksi. | |
| FI46840C (fi) | Menetelmä antidiureettisesti vaikuttavan polypeptidin valmistamiseksi. | |
| FI51805C (fi) | Menetelmä allyyliasetaatin valmistamiseksi | |
| FI48609C (fi) | Menetelmä bentsiinin valmistamiseksi. | |
| SE300618B (sv) | Förfarande för framställning av N-fenylpropyl- N1 -fenylpiperaziner | |
| DK118021B (da) | Fremgangsmåde til fremstilling af 6-aminopenicillansyrederivater. | |
| FI50334C (fi) | Menetelmä 1-hydroksi-2pyridonien valmistamiseksi. | |
| FI50409C (fi) | Menetelmä pyridiini-karboksyylihappojen valmistamiseksi | |
| FI47365C (fi) | Menetelmä valmistaa uusia terapeuttisesti vaikuttavia indolijohdannais ia. | |
| FI47575C (fi) | Analogiamenetelmä evomonosidi-johdannaisten valmistamiseksi. | |
| FI45551C (fi) | Menetelmä terapeuttisesti käytettävän dehydroepiandrosteroniönantaatin valmistamiseksi. | |
| FI50407C (fi) | Menetelmä trikloorimonosilaanien valmistamiseksi | |
| FI49308C (fi) | Menetelmä 6-aminopenisillaanihapon valmistamiseksi. | |
| FI50423C (fi) | Menetelmä 6-aminopenisillaanihapon valmistamiseksi | |
| FI47577C (fi) | Tapa valmistaa sepelvaltimoita laajentavan vaikutuksen omaavia 2,4,7-t riamino-6-fenyyli-pteridiinejä. | |
| FI51472C (fi) | Menetelmä hydroksihappoestereiden valmistamiseksi. | |
| FI50975C (fi) | Menetelmä pyratsiiniamidi-johdannaisten valmistamiseksi. | |
| FI48724C (fi) | Menetelmä N-karbamoyylioksifenyylikarbamaattien valmistamiseksi. | |
| FI47576C (fi) | Menetelmä 2-alkyyliamino-5-fenyyli-3H-1,4-bentsodiatsepiini-4-oksidien valmistamiseksi. | |
| FI47189C (fi) | Tapa valmistaa terapeuttisesti vaikuttavia d-lysergiinihappo-N-fenyyli piperatsideja. | |
| FI46727C (fi) | Menetelmä pyridatsolijohdannaisten valmistamiseksi. | |
| FI48586C (fi) | Menetelmä 3-indolyylietikkahappoyhdisteen valmistamiseksi. | |
| FI49162C (fi) | Menetelmä terapeuttisesti käytettävien 3-indolyyli-alifaattinen-happo- johdannaisten valmistamiseksi. |