FI49299C - Menetelmä verenpainetta alentavien 1,4-dihydro-4-(2-trifluorimetyylife nyyli)pyridiinien valmistamiseksi. - Google Patents
Menetelmä verenpainetta alentavien 1,4-dihydro-4-(2-trifluorimetyylife nyyli)pyridiinien valmistamiseksi.Info
- Publication number
- FI49299C FI49299C FI680251A FI25168A FI49299C FI 49299 C FI49299 C FI 49299C FI 680251 A FI680251 A FI 680251A FI 25168 A FI25168 A FI 25168A FI 49299 C FI49299 C FI 49299C
- Authority
- FI
- Finland
- Prior art keywords
- hypotensive
- pyridines
- trifluoromethylphenyl
- dihydro
- preparation
- Prior art date
Links
- LOPXZJSGDFACRF-UHFFFAOYSA-N 4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine Chemical class FC(F)(F)C1=CC=CC=C1C1C=CNC=C1 LOPXZJSGDFACRF-UHFFFAOYSA-N 0.000 title 1
- 208000001953 Hypotension Diseases 0.000 title 1
- 208000021822 hypotensive Diseases 0.000 title 1
- 230000001077 hypotensive effect Effects 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/02—Preparation by ring-closure or hydrogenation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US61439367A | 1967-02-07 | 1967-02-07 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI49299B FI49299B (oth) | 1975-01-31 |
| FI49299C true FI49299C (fi) | 1975-05-12 |
Family
ID=24461057
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI680251A FI49299C (fi) | 1967-02-07 | 1968-01-31 | Menetelmä verenpainetta alentavien 1,4-dihydro-4-(2-trifluorimetyylife nyyli)pyridiinien valmistamiseksi. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3441648A (oth) |
| BE (1) | BE710391A (oth) |
| CH (1) | CH498113A (oth) |
| DE (1) | DE1695826C3 (oth) |
| DK (1) | DK131819C (oth) |
| ES (1) | ES350204A1 (oth) |
| FI (1) | FI49299C (oth) |
| FR (2) | FR7046M (oth) |
| GB (1) | GB1167447A (oth) |
| IE (1) | IE31932B1 (oth) |
| IL (1) | IL29354A (oth) |
| NL (1) | NL156135B (oth) |
| SE (1) | SE337024B (oth) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1923990C3 (de) * | 1969-05-10 | 1978-11-23 | Bayer Ag | Verfahren zur Herstellung von N-substituierten M-Dihydropyridin-S.S-dicarbonsäureestern |
| DE1963188A1 (de) * | 1969-12-17 | 1971-06-24 | Bayer Ag | Neue Cyanphenyl-1,4-dihydropyridinderivate |
| DE1963186C3 (de) * | 1969-12-17 | 1979-02-15 | Bayer Ag, 5090 Leverkusen | Schwefelhaltige 1,4-Dihydropyridin-33-dicarbonsäureester |
| US3862161A (en) * | 1970-01-24 | 1975-01-21 | Bayer Ag | 4-pyridyl substituted 1,4-dihydropyridines |
| DE2005116C3 (de) * | 1970-02-05 | 1980-02-14 | Bayer Ag, 5090 Leverkusen | Symmetrische 1,4-Dihydropyridin-3,5-dicarbonsäureester |
| GB1430961A (en) * | 1972-01-22 | 1976-04-07 | Yamanouchi Pharma Co Ltd | 1-substituted-1,4-dihyddrypyridine derivatives |
| US3971791A (en) * | 1972-03-06 | 1976-07-27 | Bayer Aktiengesellschaft | 2-Amino-1,4-dihydropyridine derivatives |
| US3971790A (en) * | 1972-03-06 | 1976-07-27 | Bayer Aktiengesellschaft | 2-Amino-1,4-dihydropyridine derivatives |
| US3922278A (en) * | 1972-06-12 | 1975-11-25 | Sterling Drug Inc | 4-(3-Nitrophenyl)-3,5-pyridinedicarboxylic acid |
| US4136187A (en) * | 1972-08-12 | 1979-01-23 | Bayer Aktiengesellschaft | Antihypertensive 2-amino-4,5-dihydropyridine derivatives |
| DE2239815C2 (de) * | 1972-08-12 | 1983-02-10 | Bayer Ag, 5090 Leverkusen | 2-Alkylamino-dihydropyridine, Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel |
| SU706410A1 (ru) * | 1978-01-11 | 1979-12-30 | Ордена Трудового Красного Знамени Институт Органического Синтеза Ан Латвийской Сср | 2,6-Диметил-3,5-дикарбметокси-4(0-дифторметоксифенил)-1,4-дигидропиридин,обладающий выраженной гипотензивной активностью и оказывающий действие на функции вегетативной нервной системы |
| SE429652B (sv) * | 1978-06-30 | 1983-09-19 | Haessle Ab | 2.6-dimetyl-4-(2.3-diklorfenyl)-1.4-dihydropyridin-3.5-dikarboxylsyra-3-metylester-5-etylester |
| US4285955A (en) * | 1978-10-31 | 1981-08-25 | Bayer Aktiengesellschaft | 1,4-Dihydropyridinecarboxylic acids |
| US4365063A (en) * | 1981-08-31 | 1982-12-21 | American Home Products Corporation | Antihypertensive agents |
| US4321384A (en) * | 1981-02-27 | 1982-03-23 | American Home Products Corporation | Antihypertensive agents |
| US4435574A (en) * | 1981-07-20 | 1984-03-06 | Kastron Valeria V | 2,6-Dimethyl-3,5-dicarbomethoxy-4-(ortho-di-fluoromethylthiophenyl)-1,4-dihydropyridine |
| US4677101A (en) * | 1983-09-26 | 1987-06-30 | Merck & Co., Inc. | Substituted dihydroazepines useful as calcium channel blockers |
| IE57810B1 (en) * | 1984-03-27 | 1993-04-21 | Delagrange Lab | 1,4-dihydropyridine derivatives,their preparation and their use |
| US4652573A (en) * | 1985-03-14 | 1987-03-24 | Nelson Research & Development Co. | Calcium antagonist N-hetero ester 1,4-dihydropyridines |
| US4771057A (en) * | 1986-02-03 | 1988-09-13 | University Of Alberta | Reduced pyridyl derivatives with cardiovascular regulating properties |
| US4849436A (en) * | 1986-03-11 | 1989-07-18 | Nelson Research & Development Co. | 1,4-dihydropyridines |
| EP0302980B1 (fr) * | 1987-08-03 | 1991-03-13 | Laboratorios Delagrange S.A. | 1,4-Dihydropyridines, leur procédé de préparation et leur application comme médicaments |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3221017A (en) * | 1964-04-07 | 1965-11-30 | Aldrich Chem Co Inc | Aralkoxyamides of 4-phenyl-1,2,5,6-tetrahydropyridino alkanoic acids and intermediates thereof |
| US3325505A (en) * | 1965-02-24 | 1967-06-13 | Smith Kline French Lab | 4-cycloalkyl(or cycloalkenyl)-dihydropyridines |
-
1967
- 1967-02-07 US US614393A patent/US3441648A/en not_active Expired - Lifetime
-
1968
- 1968-01-17 DK DK16968*#A patent/DK131819C/da active
- 1968-01-21 IL IL29354A patent/IL29354A/en unknown
- 1968-01-25 GB GB4049/68A patent/GB1167447A/en not_active Expired
- 1968-01-31 IE IE121/68A patent/IE31932B1/xx unknown
- 1968-01-31 FI FI680251A patent/FI49299C/fi active
- 1968-02-01 DE DE1695826A patent/DE1695826C3/de not_active Expired
- 1968-02-02 SE SE01402/68A patent/SE337024B/xx unknown
- 1968-02-05 FR FR138648A patent/FR7046M/fr not_active Expired
- 1968-02-05 FR FR1574702D patent/FR1574702A/fr not_active Expired
- 1968-02-06 CH CH169368A patent/CH498113A/de not_active IP Right Cessation
- 1968-02-06 BE BE710391D patent/BE710391A/xx not_active IP Right Cessation
- 1968-02-06 ES ES350204A patent/ES350204A1/es not_active Expired
- 1968-02-07 NL NL6801710.A patent/NL156135B/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| BE710391A (oth) | 1968-08-06 |
| GB1167447A (en) | 1969-10-15 |
| DE1695826B2 (de) | 1977-07-14 |
| US3441648A (en) | 1969-04-29 |
| IL29354A (en) | 1971-11-29 |
| DE1695826A1 (de) | 1971-05-13 |
| SE337024B (oth) | 1971-07-26 |
| DK131819B (da) | 1975-09-08 |
| FR7046M (oth) | 1969-06-16 |
| IE31932B1 (en) | 1973-02-21 |
| IE31932L (en) | 1968-08-07 |
| ES350204A1 (es) | 1969-04-16 |
| DE1695826C3 (de) | 1978-03-23 |
| FR1574702A (oth) | 1969-07-18 |
| NL6801710A (oth) | 1968-08-08 |
| NL156135B (nl) | 1978-03-15 |
| DK131819C (da) | 1976-02-09 |
| CH498113A (de) | 1970-10-31 |
| FI49299B (oth) | 1975-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI49299C (fi) | Menetelmä verenpainetta alentavien 1,4-dihydro-4-(2-trifluorimetyylife nyyli)pyridiinien valmistamiseksi. | |
| DK122885B (da) | Analogifremgangsmåde til fremstilling af 1,4-dihydropyridinderivater. | |
| DK123484B (da) | Analogifremgangsmåde til fremstilling af 1H-imidazo[4,5-β]pyrazin-2-oner. | |
| FI49716C (fi) | Menetelmä 2,4-diamino-5-bentsyyli-pyrimidiinien valmistamiseksi. | |
| DK136421B (da) | Analogifremgangsmåde til fremstilling af 1,4-dihydropyridin-derivater. | |
| DK127113B (da) | Analogifremgangsmåde til fremstilling af 1,4-dihydropyridiner. | |
| DK112523B (da) | Fremgangsmåde til fremstilling af 2,3-pyridindiol. | |
| DK129234B (da) | Fremgangsmåde til fremstilling af levo-1-n-butyl-2',6'-pipecoloxylidid. | |
| DK112726B (da) | Fremgangsmåde til fremstilling af 1,6-dibrom-1,6-didesoxydulcitol. | |
| DK119559B (da) | Analogifremgangsmåde til fremstilling af 4-pyrimidyl-1,4-dihydropyridinderivater. | |
| DK119166B (da) | Fremgangsmåde til fremstilling af 1,4-bezodiazepinderivater. | |
| FI44621C (fi) | Menetelmä hypertensiivisten 3,4-dihydroksifenyylipropaani-johdannaiste n valmistamiseksi. | |
| DK115184B (da) | Fremgangsmåde til fremstilling af 6,7-benzomorphaner. | |
| DK126936B (da) | Fremgangsmåde til fremstilling af 3-oxo-13β-alkylgona-4,9,11-triener. | |
| DK118291B (da) | Analogifremgangsmåde til fremstilling af 10α-alkoxy-9,10-dihydroergolinderivater. | |
| DK116594B (da) | Fremgangsmåde til fremstilling af 4,1,5-benzoxadiazociner. | |
| DK119611B (da) | Fremgangsmåde til fremstilling af et N,N'-disubstitueret-4,4'-bipyridyliumsalt. | |
| DK127473B (da) | Fremgangsmåde til fremstilling af 2,5- eller 3,4-dihydroxyarylsulfoniumsalte. | |
| DK120191B (da) | Fremgangsmåde til fremstilling af et N,N'-disubstitueret tetrahydro-4,4'-bipyridyl. | |
| DK124409B (da) | Fremgangsmåde til fremstilling af 1,3,4-thiadiazol-5(4H)-on-derivater. | |
| DK128679B (da) | Analogifremgangsmåde til fremstilling af 3-carboxylsyreamidoquinoxalin-di-N-oxider-(1,4). | |
| FI45173C (fi) | Menetelmä 11beta-hydroksi-pregn-4-eeni-3,20-dioni-/17alfa,16alfa-d/-ok satsoliinien valmistamiseksi. | |
| FI48470C (fi) | Menetelmä 2-animo-2H-1,4-bentsodiatsepiinijohdannaisten valmistamiseks i. | |
| DK122175B (da) | Analogifremgangsmåde til fremstilling af 3-oxo-13β-alkyl-17α-allyl-17β-hydroxygona-4,9,11-triener. | |
| DK122324B (da) | Fremgangsmåde til fremstilling af 4,4'-dihydroxy-diphenyl-(2-pyridyl)-methan. |