ES2263568T3 - Cubierta de proteccion para fibras opticas. - Google Patents
Cubierta de proteccion para fibras opticas.Info
- Publication number
- ES2263568T3 ES2263568T3 ES01401340T ES01401340T ES2263568T3 ES 2263568 T3 ES2263568 T3 ES 2263568T3 ES 01401340 T ES01401340 T ES 01401340T ES 01401340 T ES01401340 T ES 01401340T ES 2263568 T3 ES2263568 T3 ES 2263568T3
- Authority
- ES
- Spain
- Prior art keywords
- module according
- thermoplastic elastomer
- cover
- less
- thermoplastic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000013307 optical fiber Substances 0.000 title claims description 15
- 230000004224 protection Effects 0.000 title description 13
- 229920002725 thermoplastic elastomer Polymers 0.000 claims abstract description 23
- 150000002009 diols Chemical class 0.000 claims abstract description 17
- 230000001681 protective effect Effects 0.000 claims abstract description 12
- 238000002844 melting Methods 0.000 claims abstract description 9
- 230000008018 melting Effects 0.000 claims abstract description 9
- 239000000835 fiber Substances 0.000 claims description 21
- 239000000463 material Substances 0.000 claims description 17
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 14
- -1 polybutylene Polymers 0.000 claims description 12
- 229920001169 thermoplastic Polymers 0.000 claims description 10
- 239000004416 thermosoftening plastic Substances 0.000 claims description 9
- 229920001971 elastomer Polymers 0.000 claims description 8
- 239000000806 elastomer Substances 0.000 claims description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 6
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 5
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 claims description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 4
- 238000001125 extrusion Methods 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 239000005995 Aluminium silicate Substances 0.000 claims description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 3
- 229910052782 aluminium Inorganic materials 0.000 claims description 3
- 235000012211 aluminium silicate Nutrition 0.000 claims description 3
- 239000006229 carbon black Substances 0.000 claims description 3
- 239000004927 clay Substances 0.000 claims description 3
- 229910052570 clay Inorganic materials 0.000 claims description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 claims description 3
- 229920001748 polybutylene Polymers 0.000 claims description 3
- 239000000377 silicon dioxide Substances 0.000 claims description 3
- 239000000454 talc Substances 0.000 claims description 3
- 229910052623 talc Inorganic materials 0.000 claims description 3
- 239000012757 flame retardant agent Substances 0.000 claims description 2
- 239000000395 magnesium oxide Substances 0.000 claims description 2
- 239000004408 titanium dioxide Substances 0.000 claims description 2
- 229920001400 block copolymer Polymers 0.000 claims 1
- 229920000570 polyether Polymers 0.000 description 14
- 239000004721 Polyphenylene oxide Substances 0.000 description 12
- 229920000728 polyester Polymers 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 8
- 229920001577 copolymer Polymers 0.000 description 6
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 6
- 239000012948 isocyanate Substances 0.000 description 6
- 229920006347 Elastollan Polymers 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 239000004952 Polyamide Substances 0.000 description 4
- 239000004698 Polyethylene Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000004014 plasticizer Substances 0.000 description 4
- 229920002647 polyamide Polymers 0.000 description 4
- 229920000573 polyethylene Polymers 0.000 description 4
- 229920002635 polyurethane Polymers 0.000 description 4
- 239000004814 polyurethane Substances 0.000 description 4
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 4
- 239000004970 Chain extender Substances 0.000 description 3
- 229920001634 Copolyester Polymers 0.000 description 3
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 3
- 229920001451 polypropylene glycol Polymers 0.000 description 3
- 230000002787 reinforcement Effects 0.000 description 3
- 229920002803 thermoplastic polyurethane Polymers 0.000 description 3
- 229920002614 Polyether block amide Polymers 0.000 description 2
- 239000004433 Thermoplastic polyurethane Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000007547 defect Effects 0.000 description 2
- 125000004427 diamine group Chemical group 0.000 description 2
- 229920001038 ethylene copolymer Polymers 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- 229920012485 Plasticized Polyvinyl chloride Polymers 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ORLQHILJRHBSAY-UHFFFAOYSA-N [1-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1(CO)CCCCC1 ORLQHILJRHBSAY-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000004026 adhesive bonding Methods 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 239000013536 elastomeric material Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 239000013305 flexible fiber Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 125000003827 glycol group Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920005606 polypropylene copolymer Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920000909 polytetrahydrofuran Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 150000004756 silanes Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920006346 thermoplastic polyester elastomer Polymers 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G02—OPTICS
- G02B—OPTICAL ELEMENTS, SYSTEMS OR APPARATUS
- G02B6/00—Light guides; Structural details of arrangements comprising light guides and other optical elements, e.g. couplings
- G02B6/44—Mechanical structures for providing tensile strength and external protection for fibres, e.g. optical transmission cables
- G02B6/4401—Optical cables
- G02B6/4429—Means specially adapted for strengthening or protecting the cables
- G02B6/443—Protective covering
-
- G—PHYSICS
- G02—OPTICS
- G02B—OPTICAL ELEMENTS, SYSTEMS OR APPARATUS
- G02B6/00—Light guides; Structural details of arrangements comprising light guides and other optical elements, e.g. couplings
- G02B6/44—Mechanical structures for providing tensile strength and external protection for fibres, e.g. optical transmission cables
- G02B6/4401—Optical cables
- G02B6/441—Optical cables built up from sub-bundles
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Surface Treatment Of Glass Fibres Or Filaments (AREA)
- Optical Fibers, Optical Fiber Cores, And Optical Fiber Bundles (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR0006838A FR2809499B1 (fr) | 2000-05-29 | 2000-05-29 | Peau de protection pour fibres optiques |
| FR0006838 | 2000-05-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ES2263568T3 true ES2263568T3 (es) | 2006-12-16 |
Family
ID=8850717
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES01401340T Expired - Lifetime ES2263568T3 (es) | 2000-05-29 | 2001-05-22 | Cubierta de proteccion para fibras opticas. |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US6658184B2 (enExample) |
| EP (1) | EP1160607B1 (enExample) |
| JP (1) | JP4782310B2 (enExample) |
| AT (1) | ATE326710T1 (enExample) |
| DE (1) | DE60119619T2 (enExample) |
| ES (1) | ES2263568T3 (enExample) |
| FR (1) | FR2809499B1 (enExample) |
Families Citing this family (107)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7008431B2 (en) * | 2001-10-30 | 2006-03-07 | Depuy Spine, Inc. | Configured and sized cannula |
| FR2842611B1 (fr) * | 2002-07-19 | 2004-11-26 | Acome Soc Coop Travailleurs | Unite optique comprenant une gaine particuliere |
| US7054531B2 (en) | 2002-12-23 | 2006-05-30 | Corning Cable Systems Llc | High density fiber optic premises cable with easy open units |
| US6915052B2 (en) * | 2003-03-06 | 2005-07-05 | E. I. Du Pont De Nemours And Company | Covered optical fiber |
| DE10311371B4 (de) * | 2003-03-14 | 2005-08-04 | CCS Technology, Inc., Wilmington | Verfahren zur Herstellung eines optischen Übertragungselements mit mehreren trockenen und kompressiblen Füllelementen |
| DE60335747D1 (de) * | 2003-08-28 | 2011-02-24 | Prysmian Spa | Optisches kabel und darin enthaltene optische einheit |
| DE102004035809A1 (de) * | 2004-07-23 | 2006-03-16 | CCS Technology, Inc., Wilmington | Optisches Kabel und Verfahren zur Herstellung eines optischen Kabels |
| JP4602135B2 (ja) * | 2005-03-28 | 2010-12-22 | 株式会社オーシーシー | 光ケーブル |
| NL1033101C2 (nl) | 2006-12-21 | 2008-06-24 | Draka Comteq Bv | Optische vezeleenheid, optische kabel en werkwijze ter vervaardiging daarvan. |
| BRPI0721873A2 (pt) * | 2007-07-30 | 2014-03-25 | Prysmian Spa | Cabo de telecomunicação, e, fibra óptica |
| US8081853B2 (en) * | 2007-11-09 | 2011-12-20 | Draka Comteq, B.V. | Single-fiber drop cables for MDU deployments |
| EP2206001B1 (en) | 2007-11-09 | 2014-04-16 | Draka Comteq B.V. | Microbend- resistant optical fiber |
| US8600206B2 (en) * | 2008-11-07 | 2013-12-03 | Draka Comteq, B.V. | Reduced-diameter optical fiber |
| US8041167B2 (en) | 2007-11-09 | 2011-10-18 | Draka Comteq, B.V. | Optical-fiber loose tube cables |
| US8145026B2 (en) * | 2007-11-09 | 2012-03-27 | Draka Comteq, B.V. | Reduced-size flat drop cable |
| US8031997B2 (en) * | 2007-11-09 | 2011-10-04 | Draka Comteq, B.V. | Reduced-diameter, easy-access loose tube cable |
| US8041168B2 (en) * | 2007-11-09 | 2011-10-18 | Draka Comteq, B.V. | Reduced-diameter ribbon cables with high-performance optical fiber |
| US8165439B2 (en) * | 2007-11-09 | 2012-04-24 | Draka Comteq, B.V. | ADSS cables with high-performance optical fiber |
| US8467650B2 (en) * | 2007-11-09 | 2013-06-18 | Draka Comteq, B.V. | High-fiber-density optical-fiber cable |
| FR2929716B1 (fr) * | 2008-04-04 | 2011-09-16 | Draka Comteq France Sa | Fibre optique a dispersion decalee. |
| FR2930997B1 (fr) * | 2008-05-06 | 2010-08-13 | Draka Comteq France Sa | Fibre optique monomode |
| FR2931253B1 (fr) * | 2008-05-16 | 2010-08-20 | Draka Comteq France Sa | Cable de telecommunication a fibres optiques |
| FR2932932B1 (fr) * | 2008-06-23 | 2010-08-13 | Draka Comteq France Sa | Systeme optique multiplexe en longueur d'ondes avec fibres optiques multimodes |
| FR2933779B1 (fr) | 2008-07-08 | 2010-08-27 | Draka Comteq France | Fibres optiques multimodes |
| US8273845B2 (en) * | 2008-09-02 | 2012-09-25 | Lubrizol Advanced Materials, Inc. | Soft thermoplastic elastomer composition |
| US7970247B2 (en) * | 2008-09-12 | 2011-06-28 | Draka Comteq B.V. | Buffer tubes for mid-span storage |
| US20100109174A1 (en) * | 2008-11-05 | 2010-05-06 | George Cornelius Abernathy | Method for drop cable having an oval cavity |
| FR2938389B1 (fr) * | 2008-11-07 | 2011-04-15 | Draka Comteq France | Systeme optique multimode |
| DK2187486T3 (da) * | 2008-11-12 | 2014-07-07 | Draka Comteq Bv | Forstærkende optisk fiber og fremgangsmåde til fremstilling |
| FR2939246B1 (fr) * | 2008-12-02 | 2010-12-24 | Draka Comteq France | Fibre optique amplificatrice et procede de fabrication |
| FR2939522B1 (fr) * | 2008-12-08 | 2011-02-11 | Draka Comteq France | Fibre optique amplificatrice resistante aux radiations ionisantes |
| FR2939911B1 (fr) * | 2008-12-12 | 2011-04-08 | Draka Comteq France | Fibre optique gainee, cable de telecommunication comportant plusieurs fibres optiques et procede de fabrication d'une telle fibre |
| NL1036343C2 (nl) * | 2008-12-19 | 2010-06-22 | Draka Comteq Bv | Werkwijze en inrichting voor het vervaardigen van een optische voorvorm. |
| PL2204681T3 (pl) | 2008-12-30 | 2016-08-31 | Draka Comteq Bv | Kabel światłowodowy zawierający perforowany element blokujący wodę |
| US8314408B2 (en) | 2008-12-31 | 2012-11-20 | Draka Comteq, B.V. | UVLED apparatus for curing glass-fiber coatings |
| FR2940839B1 (fr) * | 2009-01-08 | 2012-09-14 | Draka Comteq France | Fibre optique multimodale a gradient d'indice, procedes de caracterisation et de fabrication d'une telle fibre |
| FR2941539B1 (fr) * | 2009-01-23 | 2011-02-25 | Draka Comteq France | Fibre optique monomode |
| FR2941540B1 (fr) * | 2009-01-27 | 2011-05-06 | Draka Comteq France | Fibre optique monomode presentant une surface effective elargie |
| FR2941541B1 (fr) * | 2009-01-27 | 2011-02-25 | Draka Comteq France | Fibre optique monomode |
| US8489219B1 (en) | 2009-01-30 | 2013-07-16 | Draka Comteq B.V. | Process for making loose buffer tubes having controlled excess fiber length and reduced post-extrusion shrinkage |
| US9360647B2 (en) * | 2009-02-06 | 2016-06-07 | Draka Comteq, B.V. | Central-tube cable with high-conductivity conductors encapsulated with high-dielectric-strength insulation |
| FR2942571B1 (fr) * | 2009-02-20 | 2011-02-25 | Draka Comteq France | Fibre optique amplificatrice comprenant des nanostructures |
| FR2942551B1 (fr) * | 2009-02-23 | 2011-07-15 | Draka Comteq France | Cable comportant des elements a extraire, procede d'extraction desdits elements et procede de fabrication associe |
| US8625944B1 (en) | 2009-05-13 | 2014-01-07 | Draka Comteq, B.V. | Low-shrink reduced-diameter buffer tubes |
| US8625945B1 (en) | 2009-05-13 | 2014-01-07 | Draka Comteq, B.V. | Low-shrink reduced-diameter dry buffer tubes |
| FR2946436B1 (fr) * | 2009-06-05 | 2011-12-09 | Draka Comteq France | Fibre optique multimode a tres large bande passante avec une interface coeur-gaine optimisee |
| US20110026889A1 (en) * | 2009-07-31 | 2011-02-03 | Draka Comteq B.V. | Tight-Buffered Optical Fiber Unit Having Improved Accessibility |
| FR2949870B1 (fr) * | 2009-09-09 | 2011-12-16 | Draka Compteq France | Fibre optique multimode presentant des pertes en courbure ameliorees |
| FR2953605B1 (fr) * | 2009-12-03 | 2011-12-16 | Draka Comteq France | Fibre optique multimode a large bande passante et a faibles pertes par courbure |
| US9014525B2 (en) | 2009-09-09 | 2015-04-21 | Draka Comteq, B.V. | Trench-assisted multimode optical fiber |
| FR2953606B1 (fr) * | 2009-12-03 | 2012-04-27 | Draka Comteq France | Fibre optique multimode a large bande passante et a faibles pertes par courbure |
| FR2953030B1 (fr) * | 2009-11-25 | 2011-11-18 | Draka Comteq France | Fibre optique multimode a tres large bande passante avec une interface coeur-gaine optimisee |
| FR2957153B1 (fr) * | 2010-03-02 | 2012-08-10 | Draka Comteq France | Fibre optique multimode a large bande passante et a faibles pertes par courbure |
| FR2953029B1 (fr) | 2009-11-25 | 2011-11-18 | Draka Comteq France | Fibre optique multimode a tres large bande passante avec une interface coeur-gaine optimisee |
| US8306380B2 (en) * | 2009-09-14 | 2012-11-06 | Draka Comteq, B.V. | Methods and devices for cable insertion into latched-duct conduit |
| FR2950156B1 (fr) * | 2009-09-17 | 2011-11-18 | Draka Comteq France | Fibre optique multimode |
| FR2950443B1 (fr) * | 2009-09-22 | 2011-11-18 | Draka Comteq France | Fibre optique pour la generation de frequence somme et son procede de fabrication |
| BR112012006849A2 (pt) * | 2009-09-28 | 2017-09-19 | Prysmian Spa | cabo óptico para comunicações, micromódulo, uso de um material polimérico, e, processo para fabricar um micromódulo para um cabo óptico para comunicações. |
| US8805143B2 (en) * | 2009-10-19 | 2014-08-12 | Draka Comteq, B.V. | Optical-fiber cable having high fiber count and high fiber density |
| FR2952634B1 (fr) * | 2009-11-13 | 2011-12-16 | Draka Comteq France | Fibre en silice dopee en terre rare a faible ouverture numerique |
| US9042693B2 (en) * | 2010-01-20 | 2015-05-26 | Draka Comteq, B.V. | Water-soluble water-blocking element |
| EP3399357B1 (en) * | 2010-02-01 | 2024-12-11 | Draka Comteq B.V. | Non-zero dispersion shifted optical fiber having a short cutoff wavelength |
| DK2352047T3 (da) * | 2010-02-01 | 2019-11-11 | Draka Comteq Bv | Ikke-nul dispersionsskiftet optisk fiber med et stort effektivt areal |
| ES2539824T3 (es) * | 2010-03-17 | 2015-07-06 | Draka Comteq B.V. | Fibra óptica de modo único con reducidas pérdidas por curvatura |
| US8693830B2 (en) | 2010-04-28 | 2014-04-08 | Draka Comteq, B.V. | Data-center cable |
| ES2587432T3 (es) | 2010-05-03 | 2016-10-24 | Draka Comteq B.V | Cables de fibra óptica en haz |
| EP2388239B1 (en) | 2010-05-20 | 2017-02-15 | Draka Comteq B.V. | Curing apparatus employing angled UV-LEDs |
| US8625947B1 (en) | 2010-05-28 | 2014-01-07 | Draka Comteq, B.V. | Low-smoke and flame-retardant fiber optic cables |
| US8871311B2 (en) | 2010-06-03 | 2014-10-28 | Draka Comteq, B.V. | Curing method employing UV sources that emit differing ranges of UV radiation |
| FR2962230B1 (fr) | 2010-07-02 | 2012-07-27 | Draka Comteq France | Fibre optique monomode |
| US8682123B2 (en) | 2010-07-15 | 2014-03-25 | Draka Comteq, B.V. | Adhesively coupled optical fibers and enclosing tape |
| DK2418183T3 (en) | 2010-08-10 | 2018-11-12 | Draka Comteq Bv | Method of curing coated glass fibers which provides increased UVLED intensity |
| US8571369B2 (en) | 2010-09-03 | 2013-10-29 | Draka Comteq B.V. | Optical-fiber module having improved accessibility |
| FR2966256B1 (fr) | 2010-10-18 | 2012-11-16 | Draka Comteq France | Fibre optique multimode insensible aux pertes par |
| US8824845B1 (en) | 2010-12-03 | 2014-09-02 | Draka Comteq, B.V. | Buffer tubes having reduced stress whitening |
| FR2971061B1 (fr) | 2011-01-31 | 2013-02-08 | Draka Comteq France | Fibre optique a large bande passante et a faibles pertes par courbure |
| EP2482106B1 (en) | 2011-01-31 | 2014-06-04 | Draka Comteq B.V. | Multimode fiber |
| ES2674887T3 (es) | 2011-02-21 | 2018-07-04 | Draka Comteq B.V. | Cable de interconexión para fibras ópticas |
| EP2495589A1 (en) | 2011-03-04 | 2012-09-05 | Draka Comteq B.V. | Rare earth doped amplifying optical fiber for compact devices and method of manufacturing thereof |
| EP2503368A1 (en) | 2011-03-24 | 2012-09-26 | Draka Comteq B.V. | Multimode optical fiber with improved bend resistance |
| EP2506044A1 (en) | 2011-03-29 | 2012-10-03 | Draka Comteq B.V. | Multimode optical fiber |
| EP2518546B1 (en) | 2011-04-27 | 2018-06-20 | Draka Comteq B.V. | High-bandwidth, radiation-resistant multimode optical fiber |
| DK2527893T3 (da) | 2011-05-27 | 2013-12-16 | Draka Comteq Bv | Optisk singlemode fiber |
| DK2533082T3 (en) | 2011-06-09 | 2014-03-24 | Draka Comteq Bv | Optical single-mode fiber |
| EP2541292B1 (en) | 2011-07-01 | 2014-10-01 | Draka Comteq BV | Multimode optical fibre |
| EP2584340A1 (en) | 2011-10-20 | 2013-04-24 | Draka Comteq BV | Hydrogen sensing fiber and hydrogen sensor |
| NL2007831C2 (en) | 2011-11-21 | 2013-05-23 | Draka Comteq Bv | Apparatus and method for carrying out a pcvd deposition process. |
| RU2488184C1 (ru) * | 2011-11-28 | 2013-07-20 | Федеральное государственное образовательное бюджетное учреждение высшего профессионального образования Московский технический университет связи и информатики (ФГОБУ ВПО МТУСИ) | Оптический кабель связи с открытым модулем |
| US8929701B2 (en) | 2012-02-15 | 2015-01-06 | Draka Comteq, B.V. | Loose-tube optical-fiber cable |
| WO2013160714A1 (en) | 2012-04-27 | 2013-10-31 | Draka Comteq Bv | Hybrid single and multimode optical fiber for a home network |
| US9091830B2 (en) | 2012-09-26 | 2015-07-28 | Corning Cable Systems Llc | Binder film for a fiber optic cable |
| US11287589B2 (en) | 2012-09-26 | 2022-03-29 | Corning Optical Communications LLC | Binder film for a fiber optic cable |
| US8620124B1 (en) | 2012-09-26 | 2013-12-31 | Corning Cable Systems Llc | Binder film for a fiber optic cable |
| US9188754B1 (en) | 2013-03-15 | 2015-11-17 | Draka Comteq, B.V. | Method for manufacturing an optical-fiber buffer tube |
| US9482839B2 (en) | 2013-08-09 | 2016-11-01 | Corning Cable Systems Llc | Optical fiber cable with anti-split feature |
| US8805144B1 (en) | 2013-09-24 | 2014-08-12 | Corning Optical Communications LLC | Stretchable fiber optic cable |
| US9075212B2 (en) | 2013-09-24 | 2015-07-07 | Corning Optical Communications LLC | Stretchable fiber optic cable |
| US8913862B1 (en) | 2013-09-27 | 2014-12-16 | Corning Optical Communications LLC | Optical communication cable |
| CA2927060C (en) | 2013-10-18 | 2021-03-30 | Dow Global Technologies Llc | Optical fiber cable components |
| US9594226B2 (en) | 2013-10-18 | 2017-03-14 | Corning Optical Communications LLC | Optical fiber cable with reinforcement |
| EP3058407B1 (en) | 2013-10-18 | 2020-07-29 | Dow Global Technologies LLC | Optical fiber cable components |
| US9442263B1 (en) * | 2014-08-08 | 2016-09-13 | Superior Essex International LP | Cable components formed with a thermoplastic elastomer as a nucleating agent |
| RU2631945C2 (ru) * | 2016-02-05 | 2017-09-29 | Ордена трудового Красного Знамени федеральное государственное бюджетное образовательное учреждение высшего образования "Московский технический университет связи и информатики" (МТУСИ) | Речной оптический кабель связи |
| RU2673241C1 (ru) * | 2017-05-22 | 2018-11-23 | Ордена трудового Красного Знамени федеральное государственное бюджетное образовательное учреждение высшего образования "Московский технический университет связи и информатики" (МТУСИ) | Речной оптический кабель связи |
| KR20190022993A (ko) | 2017-08-25 | 2019-03-07 | 대한광통신 주식회사 | Tpee 소재의 루즈튜브를 구비한 광케이블 |
| RU2691625C1 (ru) * | 2018-06-13 | 2019-06-17 | Ордена трудового Красного Знамени федеральное государственное бюджетное образовательное учреждение высшего образования "Московский технический университет связи и информатики" (МТУСИ) | Самозаиливающаяся конструкция речного оптического кабеля связи |
| CN109385052A (zh) * | 2018-10-22 | 2019-02-26 | 江苏亨通光电股份有限公司 | 线缆微束管及微束管线缆 |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4396746A (en) * | 1981-04-16 | 1983-08-02 | Daicel Chemical Industries, Ltd. | Thermoplastic polyester copolymer |
| CA1269260A (en) * | 1984-01-25 | 1990-05-22 | Makoto Wagatsuma | Coated optical fiber, fabrication process thereof and fabrication apparatus thereof |
| US4582866A (en) * | 1984-04-30 | 1986-04-15 | E. I. Du Pont De Nemours And Company | Flame retardant thermoplastic multi-block copolyester elastomers |
| FI85779C (fi) * | 1984-09-18 | 1992-05-25 | Nkf Groep Bv | Signaltransmissionskabel. |
| US4806588A (en) * | 1986-04-15 | 1989-02-21 | Toyo Boseki Kabushiki Kaisha | Polyester resin composition |
| US5091478A (en) * | 1986-11-14 | 1992-02-25 | E. I. Du Pont De Nemours And Company | Partially grafted thermoplastic compositions |
| US4826899A (en) * | 1987-06-15 | 1989-05-02 | E. I. Du Pont De Nemours And Company | Low smoke generating, high char forming, flame resistant thermoplastic multi-block copolyesters |
| DE3887079T2 (de) * | 1987-09-30 | 1994-08-11 | Mitsubishi Rayon Co | Blockcopolymer aus aromatischem Polyester und Polyorganosiloxan. |
| KR0130822B1 (ko) * | 1988-05-13 | 1998-04-07 | 제임즈 제이 플린 | 그라프팅된, 다층-상의, 열가소성 에라스토머 조성물 및 그의 제조방법 |
| JP2850269B2 (ja) * | 1990-10-12 | 1999-01-27 | 住友化学工業株式会社 | 熱可塑性エラストマー組成物 |
| US5574816A (en) * | 1995-01-24 | 1996-11-12 | Alcatel Na Cable Sytems, Inc. | Polypropylene-polyethylene copolymer buffer tubes for optical fiber cables and method for making the same |
| US5928767A (en) * | 1995-06-07 | 1999-07-27 | Dexter Corporation | Conductive film composite |
| FR2740230B1 (fr) * | 1995-10-20 | 1997-11-21 | Alcatel Cable | Unite optique pour cable de telecommunications a fibres optiques, et cable a fibres optiques comprenant une telle unite |
| US5985961A (en) * | 1997-06-17 | 1999-11-16 | Johns Manville International, Inc. | Monofilament |
| US6215931B1 (en) * | 1999-01-26 | 2001-04-10 | Alcatel | Flexible thermoplastic polyolefin elastomers for buffering transmission elements in a telecommunications cable |
| JP2000336259A (ja) * | 1999-03-24 | 2000-12-05 | Polyplastics Co | 難燃性ポリエステル樹脂組成物 |
| FR2814245B1 (fr) * | 2000-09-21 | 2002-12-06 | Cit Alcatel | Cable a fibres optiques perfectionne et procede de fabrication de ce cable |
-
2000
- 2000-05-29 FR FR0006838A patent/FR2809499B1/fr not_active Expired - Fee Related
-
2001
- 2001-05-22 EP EP01401340A patent/EP1160607B1/fr not_active Expired - Lifetime
- 2001-05-22 DE DE60119619T patent/DE60119619T2/de not_active Expired - Lifetime
- 2001-05-22 ES ES01401340T patent/ES2263568T3/es not_active Expired - Lifetime
- 2001-05-22 AT AT01401340T patent/ATE326710T1/de not_active IP Right Cessation
- 2001-05-25 US US09/864,270 patent/US6658184B2/en not_active Expired - Fee Related
- 2001-05-28 JP JP2001158470A patent/JP4782310B2/ja not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| US6658184B2 (en) | 2003-12-02 |
| EP1160607A1 (fr) | 2001-12-05 |
| FR2809499A1 (fr) | 2001-11-30 |
| FR2809499B1 (fr) | 2003-10-03 |
| US20020001440A1 (en) | 2002-01-03 |
| EP1160607B1 (fr) | 2006-05-17 |
| JP4782310B2 (ja) | 2011-09-28 |
| JP2002023029A (ja) | 2002-01-23 |
| DE60119619D1 (de) | 2006-06-22 |
| ATE326710T1 (de) | 2006-06-15 |
| DE60119619T2 (de) | 2006-09-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES2263568T3 (es) | Cubierta de proteccion para fibras opticas. | |
| ES2292672T3 (es) | Tubo de proteccion para utilizar con cables opticos proporcionando facil acceso a las fibras opticas. | |
| ES2822160T3 (es) | Cables de fibra óptica con características de acceso extrudido y métodos para fabricar cables de fibra óptica | |
| ES2302514T3 (es) | Poliuretanos termoplasticos de alto peso molecular producidos a partir de polioles con un elevado contenido en hidroxilos secundarios. | |
| ES2397514T3 (es) | Poliuretano termoplástico con elevada transmisión humedad en forma de vapor resistente al calor | |
| ES2327447T3 (es) | Poliuretano termoplastico retardadores de llama sin halogeno. | |
| CN1206662C (zh) | 用于缓冲电信电缆中传输元的柔韧热塑性聚烯烃高弹性体 | |
| ES2870853T3 (es) | Telas elásticas no tejidas de alta resistencia | |
| ES2384202T3 (es) | Fibra monofilamento o cinta elástica de TPU hilado en estado fundido | |
| KR100638194B1 (ko) | 내충격성 폴리우레아우레탄 및 제조 방법 | |
| ES2300804T3 (es) | Fibras de tpu hiladas por fusion y procedimiento de fabricacion. | |
| ES2712853T3 (es) | Cable de fibras ópticas con tubo central suelto | |
| ES2507765T3 (es) | Piezas recubiertas y su uso | |
| KR20040053314A (ko) | 내충격성 폴리우레아우레탄 및 낮은 ｎｃｏ/ｏｈ 비를갖는 폴리우레아우레탄 예비중합체 | |
| ES2191940T3 (es) | Mezclas compatibles con un elastomero termoplastico y una poliolefina. | |
| ATE239045T1 (de) | Thermoplastische polyurethane | |
| ES2359062T3 (es) | Cable óptico y unidad óptica comprendida en el mismo. | |
| ES2272428T3 (es) | Cable mejorado de fibra optica conteniendo tubos de proteccion de fibra optica unidos termicamente y proceso de fabricacion. | |
| ES2402580T3 (es) | Unidad de fibra óptica, cable óptico y su procedimiento de fabricación | |
| ES2408598T3 (es) | Poli(ureauretano)s, artículos y revestimientos preparados a partir de los mismos, y procedimientos de fabricación de los mismos | |
| ES2969409T3 (es) | Poliuretano termoplástico con alta resistencia al calor | |
| KR102874252B1 (ko) | 도장 보호 필름용 조성물 및 이를 이용하여 제조된 도장 보호 필름 | |
| CN1390893A (zh) | 一种辐射固化涂料 | |
| ES2345037T3 (es) | Cable de fibra optica con componente polimerico de dimensiones estables. | |
| CN109312049A (zh) | 用于包覆模制覆盖光纤电缆的材料配方 |