EG11355A - Compound of cyanobenzyl cyclopropane carboxylates uses as insecticides - Google Patents
Compound of cyanobenzyl cyclopropane carboxylates uses as insecticidesInfo
- Publication number
- EG11355A EG11355A EG170/74A EG17074A EG11355A EG 11355 A EG11355 A EG 11355A EG 170/74 A EG170/74 A EG 170/74A EG 17074 A EG17074 A EG 17074A EG 11355 A EG11355 A EG 11355A
- Authority
- EG
- Egypt
- Prior art keywords
- insecticides
- compound
- cyanobenzyl
- cyclopropane carboxylates
- carboxylates
- Prior art date
Links
- POGISOCYCQEQTF-UHFFFAOYSA-N [cyano(phenyl)methyl] cyclopropanecarboxylate Chemical class C1CC1C(=O)OC(C#N)C1=CC=CC=C1 POGISOCYCQEQTF-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 title 1
- 239000002917 insecticide Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2297073A GB1437815A (cs) | 1973-05-15 | 1973-05-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| EG11355A true EG11355A (en) | 1977-03-31 |
Family
ID=10187998
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| EG170/74A EG11355A (en) | 1973-05-15 | 1974-05-13 | Compound of cyanobenzyl cyclopropane carboxylates uses as insecticides |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US3914274A (cs) |
| JP (1) | JPS5821602B2 (cs) |
| AR (1) | AR215114A1 (cs) |
| AT (1) | AT334136B (cs) |
| BE (1) | BE814819A (cs) |
| BR (1) | BR7403875D0 (cs) |
| CA (1) | CA1048530A (cs) |
| CH (1) | CH592409A5 (cs) |
| CS (1) | CS185652B2 (cs) |
| DD (1) | DD113429A5 (cs) |
| DE (1) | DE2422977C2 (cs) |
| DK (1) | DK136600B (cs) |
| EG (1) | EG11355A (cs) |
| ES (1) | ES426266A1 (cs) |
| FR (1) | FR2229689B1 (cs) |
| GB (1) | GB1437815A (cs) |
| HU (1) | HU168107B (cs) |
| IL (1) | IL44807A (cs) |
| IT (1) | IT1053763B (cs) |
| NL (1) | NL189040C (cs) |
| OA (1) | OA04662A (cs) |
| PH (1) | PH11747A (cs) |
| TR (1) | TR17825A (cs) |
| YU (1) | YU36370B (cs) |
| ZA (1) | ZA743030B (cs) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1562908A (en) * | 1976-12-09 | 1980-03-19 | Ici Ltd | Insecticidal compostions |
| GB1595081A (en) * | 1977-02-08 | 1981-08-05 | Shell Int Research | Pesticidal composition |
| GB1594462A (en) * | 1977-02-09 | 1981-07-30 | Shell Int Research | Pesticidal composition |
| US4299843A (en) * | 1977-09-26 | 1981-11-10 | Shell Oil Company | Stabilized cyandhydrin ester |
| US4259349A (en) | 1978-10-13 | 1981-03-31 | Shell Oil Company | Halobenzyl ester pesticides |
| DE2918023A1 (de) * | 1979-05-04 | 1980-11-13 | Bayer Ag | Verfahren zur herstellung von n-alkylierten aromatischen aminen |
| JPH02123516U (cs) * | 1989-03-20 | 1990-10-11 | ||
| JPH07217540A (ja) * | 1994-01-28 | 1995-08-15 | Fumio Morigami | 防水剤吹き付け用ポンプのポンピングチューブ |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1331706A (en) * | 1971-04-23 | 1973-09-26 | Shell Int Research | Cyclopropane derivatives and biologicall active compositions thereof |
| BE794926A (fr) * | 1971-04-23 | 1973-08-02 | Shell Int Research | Compositions biologiquement actives |
| JPS515450B1 (cs) * | 1971-06-29 | 1976-02-20 |
-
1973
- 1973-05-15 GB GB2297073A patent/GB1437815A/en not_active Expired
-
1974
- 1974-05-10 IT IT7422568A patent/IT1053763B/it active
- 1974-05-10 BE BE1005941A patent/BE814819A/xx not_active IP Right Cessation
- 1974-05-10 CA CA74199487A patent/CA1048530A/en not_active Expired
- 1974-05-13 DE DE2422977A patent/DE2422977C2/de not_active Expired
- 1974-05-13 FR FR7416417A patent/FR2229689B1/fr not_active Expired
- 1974-05-13 TR TR17825A patent/TR17825A/xx unknown
- 1974-05-13 DK DK261074AA patent/DK136600B/da not_active IP Right Cessation
- 1974-05-13 AT AT394274A patent/AT334136B/de not_active IP Right Cessation
- 1974-05-13 CH CH651274A patent/CH592409A5/xx not_active IP Right Cessation
- 1974-05-13 JP JP49052366A patent/JPS5821602B2/ja not_active Expired
- 1974-05-13 ES ES426266A patent/ES426266A1/es not_active Expired
- 1974-05-13 PH PH15830A patent/PH11747A/en unknown
- 1974-05-13 EG EG170/74A patent/EG11355A/xx active
- 1974-05-13 HU HUSE1727A patent/HU168107B/hu not_active IP Right Cessation
- 1974-05-13 ZA ZA00743030A patent/ZA743030B/xx unknown
- 1974-05-13 CS CS7400003398A patent/CS185652B2/cs unknown
- 1974-05-13 YU YU01318/74A patent/YU36370B/xx unknown
- 1974-05-13 DD DD178468A patent/DD113429A5/xx unknown
- 1974-05-13 AR AR253713A patent/AR215114A1/es active
- 1974-05-13 BR BR3875/74A patent/BR7403875D0/pt unknown
- 1974-05-13 OA OA55201A patent/OA04662A/xx unknown
- 1974-05-13 IL IL44807A patent/IL44807A/en unknown
- 1974-05-13 NL NLAANVRAGE7406384,A patent/NL189040C/xx not_active IP Right Cessation
- 1974-05-13 US US469134A patent/US3914274A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2229689A1 (cs) | 1974-12-13 |
| JPS5030849A (cs) | 1975-03-27 |
| PH11747A (en) | 1978-06-05 |
| US3914274A (en) | 1975-10-21 |
| CH592409A5 (cs) | 1977-10-31 |
| BR7403875D0 (pt) | 1974-12-24 |
| ES426266A1 (es) | 1976-11-01 |
| FR2229689B1 (cs) | 1977-10-21 |
| AR215114A1 (es) | 1979-09-14 |
| IT1053763B (it) | 1981-10-10 |
| IL44807A0 (en) | 1974-07-31 |
| AT334136B (de) | 1976-12-27 |
| OA04662A (fr) | 1980-07-31 |
| CS185652B2 (en) | 1978-10-31 |
| BE814819A (nl) | 1974-11-12 |
| YU131874A (en) | 1981-11-13 |
| NL189040B (nl) | 1992-07-16 |
| DK136600B (da) | 1977-10-31 |
| TR17825A (tr) | 1976-04-13 |
| DD113429A5 (cs) | 1975-06-12 |
| AU6886874A (en) | 1975-11-13 |
| YU36370B (en) | 1983-06-30 |
| DK136600C (cs) | 1978-05-16 |
| NL189040C (nl) | 1992-12-16 |
| ZA743030B (en) | 1975-05-28 |
| DE2422977C2 (de) | 1984-01-12 |
| DE2422977A1 (de) | 1974-12-05 |
| NL7406384A (cs) | 1974-11-19 |
| JPS5821602B2 (ja) | 1983-05-02 |
| IL44807A (en) | 1977-08-31 |
| CA1048530A (en) | 1979-02-13 |
| HU168107B (cs) | 1976-02-28 |
| ATA394274A (de) | 1976-04-15 |
| GB1437815A (cs) | 1976-06-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO145746C (no) | Fungicid preparat inneholdende nye uretanforbindelser | |
| EG11276A (en) | Novel cyclopropane derivatives use as pesticidal | |
| ZA744680B (en) | Polyene compounds | |
| EG10746A (en) | Fungicidal compositions to contain novel cyclopropane derivatives | |
| ZA742575B (en) | Prostaglandin analogs | |
| ZA744964B (en) | Polyene compounds | |
| ZA741580B (en) | Polyene compounds | |
| EG11355A (en) | Compound of cyanobenzyl cyclopropane carboxylates uses as insecticides | |
| ZA741234B (en) | Process for the preparation of paraxylene | |
| ZA744884B (en) | Polyene compounds | |
| ZA745383B (en) | Esters of trisubstituted hydroxyphenylalkonoic acids | |
| JPS5695159A (en) | Manufacture of amidinourea compound | |
| IL45417A (en) | Process for the preparation of phenoxybenzyl cyclopropane carboxylates and phenyl acetates | |
| EG10848A (en) | New esters of triazolylphosphorus,their use as insecticides | |
| EG11527A (en) | A novel cyclopropane derivatives used as insecticide | |
| AU6639274A (en) | Piston structure | |
| EG11374A (en) | New meta-diurethanes compounds used as herbicides | |
| PH12417A (en) | The substituted indanacetic acid compound | |
| IL44911A0 (en) | Process for the preparation ofprostaglandin intermediates | |
| YU42027B (en) | Process for preparing new pyrolyl compounds | |
| IT1025350B (it) | Preparazione di ciclopropano carbossilati | |
| AU7608074A (en) | To organic compounds | |
| IT1012884B (it) | Preparazione di acetofenone | |
| AU7040074A (en) | Compounds | |
| CA1019773A (en) | Process for the dimerization of cyclopentenes |