DK496176A - Fremgangsmade til fremstilling af 4,4'-dinitrodiphenylcarbonat - Google Patents
Fremgangsmade til fremstilling af 4,4'-dinitrodiphenylcarbonatInfo
- Publication number
- DK496176A DK496176A DK496176A DK496176A DK496176A DK 496176 A DK496176 A DK 496176A DK 496176 A DK496176 A DK 496176A DK 496176 A DK496176 A DK 496176A DK 496176 A DK496176 A DK 496176A
- Authority
- DK
- Denmark
- Prior art keywords
- preparation
- dinitrodiphenyl
- carbonate
- dinitrodiphenyl carbonate
- Prior art date
Links
- ACBQROXDOHKANW-UHFFFAOYSA-N bis(4-nitrophenyl) carbonate Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC(=O)OC1=CC=C([N+]([O-])=O)C=C1 ACBQROXDOHKANW-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/39—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups
- C07C205/42—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/43—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2549036A DE2549036C3 (de) | 1975-11-03 | 1975-11-03 | Verfahren zur Herstellung von 4,4'-Dinitro-diphenylcarbonat |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK496176A true DK496176A (da) | 1977-05-04 |
Family
ID=5960659
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK496176A DK496176A (da) | 1975-11-03 | 1976-11-02 | Fremgangsmade til fremstilling af 4,4'-dinitrodiphenylcarbonat |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4101569A (cs) |
| JP (1) | JPS5259132A (cs) |
| BE (1) | BE847881A (cs) |
| BR (1) | BR7607286A (cs) |
| CH (1) | CH605595A5 (cs) |
| DE (1) | DE2549036C3 (cs) |
| DK (1) | DK496176A (cs) |
| FR (1) | FR2329643A1 (cs) |
| GB (1) | GB1496108A (cs) |
| IN (1) | IN145558B (cs) |
| NL (1) | NL7612149A (cs) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5221798A (en) * | 1988-12-30 | 1993-06-22 | Amoco Corporation | Changing the regiopurity of mixtures containing 4,4'-disubstituted diphenyl carbonates |
| US5187294A (en) * | 1989-03-22 | 1993-02-16 | Amoco Corporation | Regioselective nitration of diphenyl compounds |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB360883A (en) * | 1930-01-17 | 1931-11-11 | Franz Hofwimmer | Improved nitrating process |
| GB390556A (en) * | 1931-11-03 | 1933-04-13 | Ig Farbenindustrie Ag | The manufacture of nitro compounds of the diphenyl series |
| US2985688A (en) * | 1953-09-09 | 1961-05-23 | Bayer Ag | Production of substituted nitrophenols |
| DE1290148B (de) * | 1967-05-13 | 1969-03-06 | Bayer Ag | Verfahren zur Herstellung von 4, 4'-Dinitrodiphenylaether |
| US3715323A (en) * | 1971-02-25 | 1973-02-06 | Gen Electric | Nitration of aromatic ring-containing compositions |
-
1975
- 1975-11-03 DE DE2549036A patent/DE2549036C3/de not_active Expired
-
1976
- 1976-10-05 IN IN1827/CAL/76A patent/IN145558B/en unknown
- 1976-10-26 US US05/735,715 patent/US4101569A/en not_active Expired - Lifetime
- 1976-10-28 CH CH1360476A patent/CH605595A5/xx not_active IP Right Cessation
- 1976-10-29 BR BR7607286A patent/BR7607286A/pt unknown
- 1976-11-01 JP JP51130579A patent/JPS5259132A/ja active Pending
- 1976-11-01 GB GB45284/76A patent/GB1496108A/en not_active Expired
- 1976-11-02 DK DK496176A patent/DK496176A/da unknown
- 1976-11-02 NL NL7612149A patent/NL7612149A/xx not_active Application Discontinuation
- 1976-11-03 FR FR7633148A patent/FR2329643A1/fr not_active Withdrawn
- 1976-11-03 BE BE2055415A patent/BE847881A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1496108A (en) | 1977-12-30 |
| FR2329643A1 (fr) | 1977-05-27 |
| JPS5259132A (en) | 1977-05-16 |
| CH605595A5 (cs) | 1978-09-29 |
| BE847881A (fr) | 1977-05-03 |
| NL7612149A (nl) | 1977-05-05 |
| IN145558B (cs) | 1985-01-05 |
| DE2549036C3 (de) | 1979-01-18 |
| DE2549036A1 (de) | 1977-05-05 |
| BR7607286A (pt) | 1977-09-13 |
| US4101569A (en) | 1978-07-18 |
| DE2549036B2 (de) | 1978-05-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK352176A (da) | Fremgangsmade til femstilling af acyl-3-oxo-1,2-benzisothiazoliner eller acylsacchariner | |
| DK282076A (da) | Fremgangsmade til fremstilling af 2,3-dihydro6,7-disubstitueret-5-acyl-benzofuran-2-carboxylsyrer | |
| DK260976A (da) | Fremgangsmade til fremstilling af delta9(11)-5alfa-20-ketosteroider | |
| DK113476A (da) | Fremgangsmade til fremstilling af amoxicillintrihydrat | |
| DK164376A (da) | Fremgangsmade til fremstilling af 3,4-dihydrospiro-2h-1,3-benzoxaziner | |
| DK554076A (da) | Fremgangsmade til fremstilling af 3,4i-dideoxykanamycin ] | |
| DK149088C (da) | Fremgangsmaade til fremstilling af 1,3-dihydroxy-2-aminopropan | |
| DK233377A (da) | Fremgangsmade til fremstilling af omega-noraromatiske-13,14-dehydro-prostaglandiner | |
| DK362676A (da) | Fremgangsmade til fremstilling af 1,4-dihydropyridiner | |
| DK144912C (da) | Fremgangsmaade til fremstilling af substituerede 2,6-methano-3,4,5,6-tetrahydro-2h-1-benzoxociner | |
| DK143757C (da) | Analogifremgangsmaade til fremstilling af 16,16-disubstituerede 3-oxoandrostener | |
| DK143346C (da) | Fremgangsmaade til fremstilling af 0,0-dialkylthionophosphorsyrechlorider | |
| DK219776A (da) | Fremgangsmade til fremstilling af 1,2-benzothiazin-oxadiazolforbindelse | |
| DK29276A (da) | Fremgangsmade til fremstilling af 8-bromothieno-triazolo-1,4-diazepiner | |
| DK496176A (da) | Fremgangsmade til fremstilling af 4,4'-dinitrodiphenylcarbonat | |
| DK566277A (da) | Fremgangsmaade til fremstilling af 1-aminoalkyl3,4-diphenyl-1h-pyrazoler | |
| DK301177A (da) | Fremgangsmade til fremstilling af 6a,10a-cishexahydrodibenzopyranoner | |
| DK544476A (da) | Fremgangsmade til fremstilling af difluormethyl-1,2,2-trifluorethylether | |
| DK336676A (da) | Fremgangsmade til fremstilling af 1,2,3,4-tetrahydroisoquinoliner | |
| DK280376A (da) | Fremgangsmade til fremstilling af 1-acyl-1,2,3,4-tetrahydro-6-quinoliner | |
| DK305076A (da) | Fremgangsmade til fremstilling af d,l-pantolacton | |
| DK149803C (da) | Fremgangsmaade til fremstilling af 1,2-dichlorethan | |
| DK144823C (da) | Fremgangsmaade til fremstilling af o,o-dialkyl-thiophosphorsyreesterchlorider | |
| DK580076A (da) | Fremgangsmade til fremstilling af 6,6,6-trihalogen-3,3-dimethyl-4-hexenoater | |
| DK554176A (da) | Fremgangsmade til fremstilling af 3,4-dideoxykanamycin b |