DK48276A - Fremgangsmade til fremstilling af isoxazolylbenzamidderivater - Google Patents
Fremgangsmade til fremstilling af isoxazolylbenzamidderivaterInfo
- Publication number
- DK48276A DK48276A DK48276*#A DK48276A DK48276A DK 48276 A DK48276 A DK 48276A DK 48276 A DK48276 A DK 48276A DK 48276 A DK48276 A DK 48276A
- Authority
- DK
- Denmark
- Prior art keywords
- isoxazolyl
- procedure
- preparation
- benzamide derivatives
- benzamide
- Prior art date
Links
- WRWNOAXKVPQYBV-UHFFFAOYSA-N n-(1,2-oxazol-3-yl)benzamide Chemical class C=1C=CC=CC=1C(=O)NC=1C=CON=1 WRWNOAXKVPQYBV-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/08—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/549,934 US3987179A (en) | 1975-02-14 | 1975-02-14 | Isoxazolyl benzamides as pharmacological agents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK48276A true DK48276A (da) | 1976-08-15 |
Family
ID=24194993
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK48276*#A DK48276A (da) | 1975-02-14 | 1976-02-05 | Fremgangsmade til fremstilling af isoxazolylbenzamidderivater |
Country Status (16)
| Country | Link |
|---|---|
| US (2) | US3987179A (OSRAM) |
| JP (1) | JPS51105055A (OSRAM) |
| AU (1) | AU1106076A (OSRAM) |
| BE (1) | BE838509A (OSRAM) |
| DE (1) | DE2604119A1 (OSRAM) |
| DK (1) | DK48276A (OSRAM) |
| ES (1) | ES445177A1 (OSRAM) |
| FI (1) | FI760275A7 (OSRAM) |
| FR (2) | FR2300560A1 (OSRAM) |
| IL (1) | IL49022A0 (OSRAM) |
| NL (1) | NL7601318A (OSRAM) |
| NO (1) | NO760401L (OSRAM) |
| PT (1) | PT64789B (OSRAM) |
| SE (1) | SE7601274L (OSRAM) |
| YU (1) | YU33476A (OSRAM) |
| ZA (1) | ZA76859B (OSRAM) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4112108A (en) * | 1976-12-06 | 1978-09-05 | Sandoz, Inc. | Isoxazolyl benzamides |
| US4135910A (en) * | 1977-05-12 | 1979-01-23 | Monsanto Company | Oxadiazol-3-yl-benzoates as plant growth regulants |
| US4140515A (en) * | 1977-05-12 | 1979-02-20 | Monsanto Company | Aryl-3-isoxazole benzoates as plant growth regulants and herbicides |
| US4268299A (en) * | 1978-08-17 | 1981-05-19 | Monsanto Company | Method and composition for plant growth regulation containing trifluoromethyl 1,3,4 oxadiazol benzoates |
| US4210762A (en) * | 1978-08-17 | 1980-07-01 | Monsanto Company | 2[5-(3-Trifluoromethylphenyl)-1,3,4-oxadiazol-2-yl] benzoates |
| US4229204A (en) * | 1978-12-04 | 1980-10-21 | Monsanto Company | Trifluoromethylphenyl isoxazolyl benzoates |
| US4767868A (en) * | 1987-04-10 | 1988-08-30 | Pennwalt Corporation | 3-Phenyl-3-(1H-imidazol-1-ylmethyl)-2-methyl-5-[(phenylamino)methyl]isoxazolidines |
| US4831154A (en) * | 1987-04-10 | 1989-05-16 | Pennwalt Corporation | 5-alkyl(or alkenyl)-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4767867A (en) * | 1987-04-10 | 1988-08-30 | Pennwalt Corporation | 5-(alkoxyalkyl)-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4769468A (en) * | 1987-04-10 | 1988-09-06 | Penwalt Corporation | 5-(acyloxyalkyl)-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4727156A (en) * | 1986-08-27 | 1988-02-23 | Pennwalt Corporation | 3-(Substituted phenyl)-3-(1H-imidazol-1-ylmethyl)-2-methyl-5-{[(substituted phenyl)thio]me}isoxazolidine derivatives |
| US4719306A (en) * | 1986-08-27 | 1988-01-12 | Pennwalt Corporation | Substituted 3,5-diphenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4727157A (en) * | 1986-08-27 | 1988-02-23 | Pennwalt Corporation | 3-(Substituted phenyl)-3-(1H-1,2,4-triazol-1-yl)methyl-2-methyl-5-[(substituted phenoxy)methyl]isoxazolidine derivatives |
| US4769471A (en) * | 1987-04-10 | 1988-09-06 | Pennwalt Corporation | Substituted 3,5-diphenyl-3-(1H-1,2,4-triazol-1-yl-methyl)-2-methylisoxazolidines |
| US4723021A (en) * | 1986-08-27 | 1988-02-02 | Pennwalt Corporation | Substituted 5-(phenoxyalkyl)-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4767866A (en) * | 1987-04-10 | 1988-08-30 | Pennwalt Corporation | 3-Phenyl-3-(1H-1,2,4-triazol-1-ylmethyl)-2-methyl-5-alkylisoxazolidines |
| US4769469A (en) * | 1987-04-10 | 1988-09-06 | Pennwalt Corporation | 5-(phenyl or phenoxyalkyl)-3-(2-furanyl)-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4769470A (en) * | 1987-10-02 | 1988-09-06 | Pennwalt Corporation | 5-(phenyl or phenoxyalkyl)-3-(2-thienyl)-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4777264A (en) * | 1987-10-02 | 1988-10-11 | Pennwalt Corporation | 5-carbonyl derivatives of 3-phenyl-3-(1H-imadazol-1-ylmethyl)-2-methylisoxazolidines and related compounds thereof |
| US4785117A (en) * | 1987-10-02 | 1988-11-15 | Pennwalt Corporation | 5,5-disubstituted-3-phenyl-3-phenyl-3-[(1H-imidazol-1-ylmethyl) or (1H-1,2,4-triazol-1-ylmethyl)]-2-methylisoxazolidine derivatives (IR 3012) |
| US4777263A (en) * | 1987-10-02 | 1988-10-11 | Pennwalt Corporation | 5-substituted-3-(2-naphthalenyl)-3-((1H-imidazol-1-ylmethyl) or (1H-1,2,4-triazol-1-ylmethyl))-2-methylisoxazolidines |
| US4777262A (en) * | 1987-10-02 | 1988-10-11 | Pennwalt Corporation | 5-(substituted thiomethyl)-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidine derivatives |
| US4749793A (en) * | 1987-10-02 | 1988-06-07 | Pennwalt Corporation | 5-substituted-3-phenyl-3-[1H-imidazol-1-ylmethyl) or (1H-1,2,4-triazol-1-ylmethyl]-2-benzylisoxazolidines (ir 3011) |
| US4754042A (en) * | 1987-10-02 | 1988-06-28 | Pennwalt Corporation | 5-{[naphthyl(or 2-oxo-1,3-benzoxathiol-6-yl)oxy]methyl}-3-phenyl-3-(1H-imidazol-1-ylmethyl)-2-methylisoxazolidines |
| US4835283A (en) * | 1988-03-07 | 1989-05-30 | Pennwalt Corporation | 3,5-diphenyl-3-[(1H-imidazol-1-ylmethyl) or (1H-1,2,4-triazol-1-ylmethyl)]-2 |
| JP2019526617A (ja) | 2016-06-20 | 2019-09-19 | ラトガース ザ ステイト ユニバーシティー オブ ニュージャージー | 治療用化合物 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB974894A (en) * | 1961-04-06 | 1964-11-11 | Parke Davis & Co | Process for the production of amine compounds |
| US3772284A (en) * | 1966-12-20 | 1973-11-13 | American Cyanamid Co | Azirine compounds |
-
1975
- 1975-02-14 US US05/549,934 patent/US3987179A/en not_active Expired - Lifetime
-
1976
- 1976-02-04 DE DE2604119A patent/DE2604119A1/de active Pending
- 1976-02-05 FI FI760275A patent/FI760275A7/fi not_active Application Discontinuation
- 1976-02-05 DK DK48276*#A patent/DK48276A/da unknown
- 1976-02-05 SE SE7601274A patent/SE7601274L/xx unknown
- 1976-02-06 NO NO760401A patent/NO760401L/no unknown
- 1976-02-10 NL NL7601318A patent/NL7601318A/xx unknown
- 1976-02-11 FR FR7603746A patent/FR2300560A1/fr not_active Withdrawn
- 1976-02-12 AU AU11060/76A patent/AU1106076A/en not_active Expired
- 1976-02-12 IL IL49022A patent/IL49022A0/xx unknown
- 1976-02-12 YU YU00334/76A patent/YU33476A/xx unknown
- 1976-02-12 BE BE164283A patent/BE838509A/xx unknown
- 1976-02-12 PT PT64789A patent/PT64789B/pt unknown
- 1976-02-12 JP JP51013340A patent/JPS51105055A/ja active Pending
- 1976-02-13 ZA ZA760859A patent/ZA76859B/xx unknown
- 1976-02-13 ES ES445177A patent/ES445177A1/es not_active Expired
- 1976-07-22 US US05/707,681 patent/US4086243A/en not_active Expired - Lifetime
- 1976-07-23 FR FR7622493A patent/FR2326420A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| BE838509A (fr) | 1976-08-12 |
| DE2604119A1 (de) | 1976-08-26 |
| US3987179A (en) | 1976-10-19 |
| FI760275A7 (OSRAM) | 1976-08-15 |
| JPS51105055A (OSRAM) | 1976-09-17 |
| SE7601274L (sv) | 1976-08-16 |
| ZA76859B (en) | 1977-09-28 |
| PT64789A (fr) | 1976-03-01 |
| NL7601318A (nl) | 1976-08-17 |
| FR2300560A1 (fr) | 1976-09-10 |
| FR2326420A1 (fr) | 1977-04-29 |
| ES445177A1 (es) | 1977-08-16 |
| IL49022A0 (en) | 1976-04-30 |
| YU33476A (en) | 1982-05-31 |
| NO760401L (OSRAM) | 1976-08-17 |
| PT64789B (fr) | 1977-09-06 |
| AU1106076A (en) | 1977-08-18 |
| US4086243A (en) | 1978-04-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK48276A (da) | Fremgangsmade til fremstilling af isoxazolylbenzamidderivater | |
| DK567376A (da) | Fremgangsmade til fremstilling af quinazolonderivater | |
| DK593975A (da) | Fremgangsmade til fremstilling af substituerede perhalogenalkylamidiner | |
| DK107876A (da) | Fremgangsmade til fremstilling af thiocarbamider | |
| DK528976A (da) | Fremgangsmade til fremstilling af indazolderivater | |
| DK298476A (da) | Fremgangsmade til fremstilling af 5-benzyl-2-oxazolidonderivater | |
| DK324176A (da) | Fremgangsmade til fremstilling af orthoaminobutyrophenonderivater | |
| DK535476A (da) | Fremgangsmade til fremstilling af 7-methoxycephalosporiner | |
| DK387876A (da) | Fremgangsmade til fremstilling af oxazolidinoner | |
| DK150676A (da) | Fremgangsmade til fremstilling af krystallinsk natrium-o-formyl-cefamandol | |
| DK137275C (da) | Fremgangsmaade til fremstilling af 4-oxo-hexahydropyrazinoisoquinolinderivater | |
| DK565676A (da) | Fremgangsmade til fremstilling af klavamderivater | |
| DK538777A (da) | Fremgangsmaade til fremstilling af isoxazolderivater | |
| DK415576A (da) | Fremgangsmade til fremstilling af krystallinsk dipilocarpiniumpamoat | |
| DK399976A (da) | Fremgangsmade til fremstilling af aralkylamider | |
| DK551076A (da) | Fremgangsmade til fremstilling af trifluormethylthio-derivater af cyproheptadin | |
| DK343976A (da) | Fremgangsmade til fremstilling af 5-androsten-17-on-derivater | |
| DK251176A (da) | Fremgangsmade til fremstilling af cyklopropanolderivater | |
| DK253676A (da) | Fremgangsmade til fremstilling af cycloheptathiopenderivater | |
| DK141532C (da) | Fremgangsmaade til fremstilling af 21-hydroxy-16-pregnen-20-onderivater | |
| DK141584C (da) | Fremgangsmaade til fremstilling af slagseje vinylaromat-podecopolymere | |
| DK480676A (da) | Fremgangsmade til fremstilling af s-alkylphosphordihalogeniddithioater | |
| DK526676A (da) | Fremgangsmade til fremstilling af 4-chlor-2-butynyl-m-chlorcarbanilat | |
| DK424676A (da) | Fremgangsmade til fremstilling af 2-alkylindan | |
| DK62876A (da) | Fremgangsmade til fremstilling af benzo-cyclohepta-thiophenderivater |