DK256975A - Fremgangsmade til fremstilling af cephalosporiner og mellemliggende produkter - Google Patents
Fremgangsmade til fremstilling af cephalosporiner og mellemliggende produkterInfo
- Publication number
- DK256975A DK256975A DK256975A DK256975A DK256975A DK 256975 A DK256975 A DK 256975A DK 256975 A DK256975 A DK 256975A DK 256975 A DK256975 A DK 256975A DK 256975 A DK256975 A DK 256975A
- Authority
- DK
- Denmark
- Prior art keywords
- cephalosporins
- procedure
- preparation
- intermediate products
- products
- Prior art date
Links
- 229930186147 Cephalosporin Natural products 0.000 title 1
- 229940124587 cephalosporin Drugs 0.000 title 1
- HOKIDJSKDBPKTQ-GLXFQSAKSA-N cephalosporin C Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CCC[C@@H](N)C(O)=O)[C@@H]12 HOKIDJSKDBPKTQ-GLXFQSAKSA-N 0.000 title 1
- 239000013067 intermediate product Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
- C07D205/09—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4
- C07D205/095—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4 and with a nitrogen atom directly attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2388774 | 1974-06-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK256975A true DK256975A (da) | 1975-12-13 |
Family
ID=11210657
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK256975A DK256975A (da) | 1974-06-12 | 1975-06-09 | Fremgangsmade til fremstilling af cephalosporiner og mellemliggende produkter |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4012381A (enFirst) |
| JP (1) | JPS6135199B2 (enFirst) |
| AT (1) | AT341539B (enFirst) |
| AU (1) | AU501660B2 (enFirst) |
| BE (1) | BE830089A (enFirst) |
| CA (1) | CA1057284A (enFirst) |
| CH (1) | CH615189A5 (enFirst) |
| DE (2) | DE2525510A1 (enFirst) |
| DK (1) | DK256975A (enFirst) |
| ES (1) | ES438429A1 (enFirst) |
| FR (1) | FR2283140A1 (enFirst) |
| GB (1) | GB1472866A (enFirst) |
| HU (1) | HU172891B (enFirst) |
| NL (1) | NL170416C (enFirst) |
| NO (1) | NO752034L (enFirst) |
| SE (1) | SE7506588L (enFirst) |
| ZA (1) | ZA753723B (enFirst) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5048181U (enFirst) * | 1973-08-31 | 1975-05-13 | ||
| GB1472866A (en) | 1974-06-12 | 1977-05-11 | Farmaceutici Italia | Cephalosporins and intermediates therefor |
| GB1472864A (en) * | 1975-04-05 | 1977-05-11 | Farmaceutici Italia | Method of preparing cephalosporins |
| US4218564A (en) * | 1975-06-18 | 1980-08-19 | Smithkline Corporation | 7β-Hydroxy-3-heterocyclicthio-methyl cephalosporin intermediates |
| US4112087A (en) * | 1976-11-04 | 1978-09-05 | Syntex (U.S.A.) Inc. | Cephalosporin type antibacterials having a substituted propenyl group in the 3-position |
| GB1576219A (en) | 1976-12-31 | 1980-10-01 | Connlab Holdings Ltd | Thiazoleneazetidinone derivatives |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BR6915080D0 (pt) * | 1969-06-12 | 1973-03-08 | Lilly Co Eli | Processo para a preparacao de um produto rearranjado de penicilina |
| US3905965A (en) * | 1969-10-17 | 1975-09-16 | Roussel Uclaf | Process of total synthesis of cephalosporin derivatives and intermediates |
| BE787618A (fr) * | 1971-08-17 | 1973-02-16 | Gist Brocades Nv | Procede pour preparer des composes heterocycliques |
| DE2243242A1 (de) * | 1972-09-02 | 1974-03-28 | Hoechst Ag | Verfahren zur herstellung von 7-amino3-cephem-4-carbonsaeurederivaten |
| GB1451459A (en) * | 1972-10-20 | 1976-10-06 | Fujisawa Pharamceutical Co Ltd | Process for preparing 3-alkyl-3-cephem-4-carboxylic acids and intermediates thereof |
| IT1043958B (it) | 1974-05-22 | 1980-02-29 | Farmaceutici Italia | Procedimento per la preparazione di cefalosporine |
| GB1472866A (en) | 1974-06-12 | 1977-05-11 | Farmaceutici Italia | Cephalosporins and intermediates therefor |
-
1975
- 1975-05-23 GB GB2246575A patent/GB1472866A/en not_active Expired
- 1975-06-06 NL NLAANVRAGE7506741,A patent/NL170416C/xx not_active IP Right Cessation
- 1975-06-07 DE DE19752525510 patent/DE2525510A1/de not_active Ceased
- 1975-06-07 DE DE2559976A patent/DE2559976C2/de not_active Expired - Lifetime
- 1975-06-09 FR FR7517880A patent/FR2283140A1/fr active Granted
- 1975-06-09 DK DK256975A patent/DK256975A/da unknown
- 1975-06-09 NO NO752034A patent/NO752034L/no unknown
- 1975-06-09 SE SE7506588A patent/SE7506588L/xx unknown
- 1975-06-09 AT AT437275A patent/AT341539B/de not_active IP Right Cessation
- 1975-06-10 CA CA229,024A patent/CA1057284A/en not_active Expired
- 1975-06-10 JP JP50069249A patent/JPS6135199B2/ja not_active Expired
- 1975-06-10 AU AU81980/75A patent/AU501660B2/en not_active Ceased
- 1975-06-10 HU HU75SO00001150A patent/HU172891B/hu not_active IP Right Cessation
- 1975-06-10 ZA ZA00753723A patent/ZA753723B/xx unknown
- 1975-06-11 ES ES438429A patent/ES438429A1/es not_active Expired
- 1975-06-11 CH CH756475A patent/CH615189A5/de not_active IP Right Cessation
- 1975-06-11 BE BE157204A patent/BE830089A/xx not_active IP Right Cessation
- 1975-06-12 US US05/586,376 patent/US4012381A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NL170416C (nl) | 1982-11-01 |
| JPS5111787A (enFirst) | 1976-01-30 |
| FR2283140A1 (fr) | 1976-03-26 |
| HU172891B (hu) | 1978-12-28 |
| FR2283140B1 (enFirst) | 1978-12-08 |
| DE2525510A1 (de) | 1976-01-02 |
| NO752034L (enFirst) | 1975-12-15 |
| JPS6135199B2 (enFirst) | 1986-08-12 |
| ZA753723B (en) | 1976-05-26 |
| BE830089A (fr) | 1975-12-11 |
| CA1057284A (en) | 1979-06-26 |
| US4012381A (en) | 1977-03-15 |
| DE2559976C2 (enFirst) | 1991-12-19 |
| ES438429A1 (es) | 1977-02-16 |
| CH615189A5 (enFirst) | 1980-01-15 |
| AU501660B2 (en) | 1979-06-28 |
| AU8198075A (en) | 1976-12-16 |
| AT341539B (de) | 1978-02-10 |
| ATA437275A (de) | 1977-06-15 |
| NL170416B (nl) | 1982-06-01 |
| GB1472866A (en) | 1977-05-11 |
| SE7506588L (sv) | 1975-12-15 |
| NL7506741A (nl) | 1975-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK356075A (da) | Fremgangsmade til fremstilling af 1-oxacephemer samt mellemprodukter dertil | |
| DK201975A (da) | Fremgangsmade til fremstilling af pencilliner og cephalospoiner | |
| NO145075C (no) | Kontinuerlig fremgangsmaate til fremstilling av alkoksysilaner | |
| DK144298C (da) | Fremgangsmaade til fremstilling af alkyl-tert-butylethere | |
| DK269175A (da) | Fremgangsmade til fremstilling af d-phenylglycinamid og l-phenylglycin | |
| SE7513085L (sv) | Forfarande for framstellning av etrar | |
| DK385475A (da) | Fremgangsmade til fremstilling af secoprostaglandiner | |
| DK398375A (da) | N-acylamino-alfa-arylacetamidocephalosporiner og fremgangsmade til fremstilling heraf | |
| DK222975A (da) | Fremgangsmade til fremstilling af polysocyanater og disses anvendelse | |
| SE7506160L (sv) | Forfarande for framstellning av n-cykloalkylmetyldekahydroisokinoline | |
| NO141472C (no) | Fremgangsmaate for fremstilling av polysakkarider og derivater derav | |
| DK132372C (da) | Fremgangsmade til fremstilling af tamponer og anleg til udovelse af fremgangsmaden | |
| DK411275A (da) | Thiophensacchariner og fremgangsmade til fremstilling deraf | |
| DK141849C (da) | Fremgangsmaade til fremstilling af slagseje vinylaromat-podecopolymere | |
| DK574075A (da) | Fremgangsmade til fremstilling af 2-methoxybenzamider | |
| DK206375A (da) | Fremgangsmade til fremstilling af thiaprostaglandiner | |
| SE411453B (sv) | Forfarande for framstellning av 3-fluorcefalosporiner | |
| DK256975A (da) | Fremgangsmade til fremstilling af cephalosporiner og mellemliggende produkter | |
| DK528475A (da) | Fremgangsmade til fremstilling af tetramethylethylendiamin | |
| DK583775A (da) | Fremgangsmade til fremstilling af 3-fluorbenzodiazepiner | |
| DK499075A (da) | Fremgangsmade til fremstilling af cephalosporiner | |
| DK543875A (da) | Fremgangsmade til fremstilling af hydroxyphenylacetonitriler | |
| DK144752C (da) | Dentalpulver og anvendelse deraf til fremstilling af tandfyldninger | |
| DK559975A (da) | Fremgangsmade til fremstilling af 15-substituerede 11-desoxy-omega-pentanorprostaglandiner og mellemprodukter til anvendelse herved | |
| SE7511801L (sv) | Forfarande for framstellning av ympsampolymerisat |