DK141367B - Herbicidt aktive dioxaner. - Google Patents
Herbicidt aktive dioxaner. Download PDFInfo
- Publication number
- DK141367B DK141367B DK463872AA DK463872A DK141367B DK 141367 B DK141367 B DK 141367B DK 463872A A DK463872A A DK 463872AA DK 463872 A DK463872 A DK 463872A DK 141367 B DK141367 B DK 141367B
- Authority
- DK
- Denmark
- Prior art keywords
- dioxane
- cis
- methyl
- mixture
- benzyloxy
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title description 28
- 239000004009 herbicide Substances 0.000 title description 13
- 150000002012 dioxanes Chemical class 0.000 title description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 101
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 75
- 239000000203 mixture Substances 0.000 description 70
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 50
- 239000000243 solution Substances 0.000 description 39
- -1 cyclic acetal Chemical class 0.000 description 38
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 32
- 150000001875 compounds Chemical class 0.000 description 31
- 239000011541 reaction mixture Substances 0.000 description 28
- 239000000047 product Substances 0.000 description 26
- 241000196324 Embryophyta Species 0.000 description 24
- 239000003921 oil Substances 0.000 description 24
- 235000019198 oils Nutrition 0.000 description 24
- 239000007788 liquid Substances 0.000 description 22
- 238000004458 analytical method Methods 0.000 description 21
- 239000002689 soil Substances 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- 238000002360 preparation method Methods 0.000 description 19
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 18
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 16
- 235000019341 magnesium sulphate Nutrition 0.000 description 16
- 239000003208 petroleum Substances 0.000 description 16
- 239000007787 solid Substances 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 238000001228 spectrum Methods 0.000 description 14
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 14
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 13
- 239000012312 sodium hydride Substances 0.000 description 13
- 229910000104 sodium hydride Inorganic materials 0.000 description 13
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 12
- 230000008033 biological extinction Effects 0.000 description 12
- 238000000034 method Methods 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- 238000004821 distillation Methods 0.000 description 11
- 229910052739 hydrogen Inorganic materials 0.000 description 11
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 10
- 239000004480 active ingredient Substances 0.000 description 10
- 125000000217 alkyl group Chemical group 0.000 description 10
- 238000001035 drying Methods 0.000 description 10
- 238000002474 experimental method Methods 0.000 description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 239000000843 powder Substances 0.000 description 10
- 238000001953 recrystallisation Methods 0.000 description 10
- 125000001424 substituent group Chemical group 0.000 description 10
- UAESGIBOJCAHQP-UHFFFAOYSA-N 5-phenylmethoxy-1,3-dioxane Chemical compound C=1C=CC=CC=1COC1COCOC1 UAESGIBOJCAHQP-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 9
- 239000000463 material Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000002270 dispersing agent Substances 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- UDIPIOHLDFSMLR-UHFFFAOYSA-N 2-phenylmethoxypropane-1,3-diol Chemical compound OCC(CO)OCC1=CC=CC=C1 UDIPIOHLDFSMLR-UHFFFAOYSA-N 0.000 description 7
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 239000002002 slurry Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- 239000008096 xylene Substances 0.000 description 7
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 6
- 244000237956 Amaranthus retroflexus Species 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 6
- 229940073608 benzyl chloride Drugs 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 239000005416 organic matter Substances 0.000 description 6
- WZKXQJURGRERJY-UHFFFAOYSA-N 2-[(2-fluorophenyl)methoxy]-2-methylpropane-1,3-diol Chemical compound OCC(C)(CO)OCC1=CC=CC=C1F WZKXQJURGRERJY-UHFFFAOYSA-N 0.000 description 5
- 229920000742 Cotton Polymers 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 5
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 5
- 239000006227 byproduct Substances 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- RPZCVZVTXRZDAZ-UHFFFAOYSA-N diethyl 2-[(2-fluorophenyl)methoxy]-2-methylpropanedioate Chemical compound CCOC(=O)C(C)(C(=O)OCC)OCC1=CC=CC=C1F RPZCVZVTXRZDAZ-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000004495 emulsifiable concentrate Substances 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 239000012259 ether extract Substances 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 235000011181 potassium carbonates Nutrition 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000012265 solid product Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 239000003053 toxin Substances 0.000 description 5
- 231100000765 toxin Toxicity 0.000 description 5
- 239000000080 wetting agent Substances 0.000 description 5
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 4
- VCKSNYNNVSOWEE-UHFFFAOYSA-N 1,3-dioxan-5-ol Chemical compound OC1COCOC1 VCKSNYNNVSOWEE-UHFFFAOYSA-N 0.000 description 4
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 4
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 4
- 244000036975 Ambrosia artemisiifolia Species 0.000 description 4
- 235000003133 Ambrosia artemisiifolia Nutrition 0.000 description 4
- 240000006122 Chenopodium album Species 0.000 description 4
- 235000009344 Chenopodium album Nutrition 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 240000008042 Zea mays Species 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 150000004862 dioxolanes Chemical class 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- 238000009736 wetting Methods 0.000 description 4
- RNQWXOKSUCPOFS-UHFFFAOYSA-N 1,4-dioxan-2-ol Chemical compound OC1COCCO1 RNQWXOKSUCPOFS-UHFFFAOYSA-N 0.000 description 3
- XCARXOGXWMRQIN-UHFFFAOYSA-N 2-(3-fluorophenyl)-1,3-dioxan-5-ol Chemical compound O1CC(O)COC1C1=CC=CC(F)=C1 XCARXOGXWMRQIN-UHFFFAOYSA-N 0.000 description 3
- GEASUTBFDRNQEF-UHFFFAOYSA-N 2-(chloromethyl)-5-phenylmethoxy-1,3-dioxane Chemical compound C1OC(CCl)OCC1OCC1=CC=CC=C1 GEASUTBFDRNQEF-UHFFFAOYSA-N 0.000 description 3
- UJBZRWXLUJWIEB-UHFFFAOYSA-N 2-(furan-2-yl)-5-phenylmethoxy-1,3-dioxane Chemical compound C=1C=CC=CC=1COC(CO1)COC1C1=CC=CO1 UJBZRWXLUJWIEB-UHFFFAOYSA-N 0.000 description 3
- JASINQNJRVUSBZ-UHFFFAOYSA-N 2-methyl-5-phenylmethoxy-1,3-dioxane Chemical compound C1OC(C)OCC1OCC1=CC=CC=C1 JASINQNJRVUSBZ-UHFFFAOYSA-N 0.000 description 3
- BWKDAAFSXYPQOS-UHFFFAOYSA-N Benzaldehyde glyceryl acetal Chemical compound O1CC(O)COC1C1=CC=CC=C1 BWKDAAFSXYPQOS-UHFFFAOYSA-N 0.000 description 3
- 244000152970 Digitaria sanguinalis Species 0.000 description 3
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 3
- 235000010469 Glycine max Nutrition 0.000 description 3
- 244000068988 Glycine max Species 0.000 description 3
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 3
- 244000046052 Phaseolus vulgaris Species 0.000 description 3
- 235000017016 Setaria faberi Nutrition 0.000 description 3
- 241001355178 Setaria faberi Species 0.000 description 3
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 3
- 238000006359 acetalization reaction Methods 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 3
- 235000005822 corn Nutrition 0.000 description 3
- 238000006266 etherification reaction Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 125000002541 furyl group Chemical group 0.000 description 3
- 125000001188 haloalkyl group Chemical group 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 238000012216 screening Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- QEHXDOJPVIHUDO-UHFFFAOYSA-N (2-fluorophenyl)methanol Chemical compound OCC1=CC=CC=C1F QEHXDOJPVIHUDO-UHFFFAOYSA-N 0.000 description 2
- IHWUPMSVNMUIJX-UHFFFAOYSA-N (2-methyl-1,3-dioxan-5-yl) benzoate Chemical compound C1OC(C)OCC1OC(=O)C1=CC=CC=C1 IHWUPMSVNMUIJX-UHFFFAOYSA-N 0.000 description 2
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 2
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical group C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- 229940035437 1,3-propanediol Drugs 0.000 description 2
- WGVYCXYGPNNUQA-UHFFFAOYSA-N 1-(bromomethyl)-2-methylbenzene Chemical compound CC1=CC=CC=C1CBr WGVYCXYGPNNUQA-UHFFFAOYSA-N 0.000 description 2
- MOBRMRJUKNQBMY-UHFFFAOYSA-N 1-(chloromethyl)-2-fluorobenzene Chemical compound FC1=CC=CC=C1CCl MOBRMRJUKNQBMY-UHFFFAOYSA-N 0.000 description 2
- GRCLCWDBGAEPIN-UHFFFAOYSA-N 2-(3-fluorophenyl)-5-phenylmethoxy-1,3-dioxane Chemical compound FC1=CC=CC(C2OCC(CO2)OCC=2C=CC=CC=2)=C1 GRCLCWDBGAEPIN-UHFFFAOYSA-N 0.000 description 2
- DHMAZTUTJDQFAG-UHFFFAOYSA-N 2-(chloromethyl)-1,3-dioxan-5-ol Chemical compound OC1COC(CCl)OC1 DHMAZTUTJDQFAG-UHFFFAOYSA-N 0.000 description 2
- YBRIUPLTKFBNNE-UHFFFAOYSA-N 2-(chloromethyl)-5-[(2-methylphenyl)methoxy]-1,3-dioxane Chemical compound CC1=CC=CC=C1COC1COC(CCl)OC1 YBRIUPLTKFBNNE-UHFFFAOYSA-N 0.000 description 2
- KIWWJRDYPRHMNL-UHFFFAOYSA-N 2-ethyl-5-methyl-1,3-dioxan-5-ol Chemical compound CCC1OCC(C)(O)CO1 KIWWJRDYPRHMNL-UHFFFAOYSA-N 0.000 description 2
- LYULANJSVNVULZ-UHFFFAOYSA-N 2-phenyl-5-phenylmethoxy-1,3-dioxane Chemical compound C=1C=CC=CC=1COC(CO1)COC1C1=CC=CC=C1 LYULANJSVNVULZ-UHFFFAOYSA-N 0.000 description 2
- GMCAGELUBLAWJK-UHFFFAOYSA-N 5-[(2-fluorophenyl)methoxy]-2-phenyl-1,3-dioxane Chemical compound FC1=CC=CC=C1COC1COC(C=2C=CC=CC=2)OC1 GMCAGELUBLAWJK-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- 244000105624 Arachis hypogaea Species 0.000 description 2
- 244000056139 Brassica cretica Species 0.000 description 2
- 235000003351 Brassica cretica Nutrition 0.000 description 2
- 235000003343 Brassica rupestris Nutrition 0.000 description 2
- 244000045232 Canavalia ensiformis Species 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- HSSBORCLYSCBJR-UHFFFAOYSA-N Chloramben Chemical compound NC1=CC(Cl)=CC(C(O)=O)=C1Cl HSSBORCLYSCBJR-UHFFFAOYSA-N 0.000 description 2
- 244000000626 Daucus carota Species 0.000 description 2
- 235000002767 Daucus carota Nutrition 0.000 description 2
- 244000058871 Echinochloa crus-galli Species 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 240000008415 Lactuca sativa Species 0.000 description 2
- 235000003228 Lactuca sativa Nutrition 0.000 description 2
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 2
- 235000011999 Panicum crusgalli Nutrition 0.000 description 2
- 235000010617 Phaseolus lunatus Nutrition 0.000 description 2
- 241000209504 Poaceae Species 0.000 description 2
- 241000219053 Rumex Species 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 240000003768 Solanum lycopersicum Species 0.000 description 2
- 101150052863 THY1 gene Proteins 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 125000004966 cyanoalkyl group Chemical group 0.000 description 2
- 239000002274 desiccant Substances 0.000 description 2
- CSLQAXTUGPUBCW-UHFFFAOYSA-N diethyl 2-bromo-2-methylpropanedioate Chemical compound CCOC(=O)C(C)(Br)C(=O)OCC CSLQAXTUGPUBCW-UHFFFAOYSA-N 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 150000002118 epoxides Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 235000010460 mustard Nutrition 0.000 description 2
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- 235000020232 peanut Nutrition 0.000 description 2
- 230000008635 plant growth Effects 0.000 description 2
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 239000004576 sand Substances 0.000 description 2
- 239000010802 sludge Substances 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 238000009331 sowing Methods 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000004611 spectroscopical analysis Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- RYVBINGWVJJDPU-UHFFFAOYSA-M tributyl(hexadecyl)phosphanium;bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[P+](CCCC)(CCCC)CCCC RYVBINGWVJJDPU-UHFFFAOYSA-M 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 1
- IWZSHWBGHQBIML-ZGGLMWTQSA-N (3S,8S,10R,13S,14S,17S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine Chemical compound CN(C)[C@H]1CC[C@]2(C)C3CC[C@@]4(C)[C@@H](CC[C@@H]4c4ccc5ccncc5c4)[C@@H]3CC=C2C1 IWZSHWBGHQBIML-ZGGLMWTQSA-N 0.000 description 1
- PCYADPMXIILFTP-UHFFFAOYSA-N 1,1-diethoxy-2-methoxyethane Chemical compound CCOC(COC)OCC PCYADPMXIILFTP-UHFFFAOYSA-N 0.000 description 1
- AMLMBWVCZUMIPW-UHFFFAOYSA-N 1,3-dioxan-2-yl benzoate Chemical compound C=1C=CC=CC=1C(=O)OC1OCCCO1 AMLMBWVCZUMIPW-UHFFFAOYSA-N 0.000 description 1
- 150000000093 1,3-dioxanes Chemical class 0.000 description 1
- BOHGAOWOIJMTPZ-UHFFFAOYSA-N 1,3-dioxolan-4-ylmethanol Chemical class OCC1COCO1 BOHGAOWOIJMTPZ-UHFFFAOYSA-N 0.000 description 1
- VQRBXYBBGHOGFT-UHFFFAOYSA-N 1-(chloromethyl)-2-methylbenzene Chemical compound CC1=CC=CC=C1CCl VQRBXYBBGHOGFT-UHFFFAOYSA-N 0.000 description 1
- DMHZDOTYAVHSEH-UHFFFAOYSA-N 1-(chloromethyl)-4-methylbenzene Chemical compound CC1=CC=C(CCl)C=C1 DMHZDOTYAVHSEH-UHFFFAOYSA-N 0.000 description 1
- OMTBMVJQYXLWAE-UHFFFAOYSA-N 2,5-diethyl-5-[(2-fluorophenyl)methoxy]-1,3-dioxane Chemical compound C1OC(CC)OCC1(CC)OCC1=CC=CC=C1F OMTBMVJQYXLWAE-UHFFFAOYSA-N 0.000 description 1
- WXKWKNVAWSDNLG-UHFFFAOYSA-N 2-(2-ethoxyphenyl)-5-phenylmethoxy-1,3-dioxane Chemical compound CCOC1=CC=CC=C1C1OCC(OCC=2C=CC=CC=2)CO1 WXKWKNVAWSDNLG-UHFFFAOYSA-N 0.000 description 1
- KLTWCFMCDLEURG-UHFFFAOYSA-N 2-(2-fluorophenyl)-5-phenylmethoxy-1,3-dioxane Chemical compound FC1=CC=CC=C1C1OCC(OCC=2C=CC=CC=2)CO1 KLTWCFMCDLEURG-UHFFFAOYSA-N 0.000 description 1
- CZUFFZBAOIPGKQ-UHFFFAOYSA-N 2-(2-methoxyphenyl)-5-phenylmethoxy-1,3-dioxane Chemical compound COC1=CC=CC=C1C1OCC(OCC=2C=CC=CC=2)CO1 CZUFFZBAOIPGKQ-UHFFFAOYSA-N 0.000 description 1
- ZVIKDNXISFOMPU-UHFFFAOYSA-N 2-(3-fluorophenyl)-5-[(2-fluorophenyl)methoxy]-1,3-dioxane Chemical compound FC1=CC=CC(C2OCC(CO2)OCC=2C(=CC=CC=2)F)=C1 ZVIKDNXISFOMPU-UHFFFAOYSA-N 0.000 description 1
- KSLZVZCFDYNZQK-UHFFFAOYSA-N 2-(3-methoxyphenyl)-5-phenylmethoxy-1,3-dioxane Chemical compound COC1=CC=CC(C2OCC(CO2)OCC=2C=CC=CC=2)=C1 KSLZVZCFDYNZQK-UHFFFAOYSA-N 0.000 description 1
- BWYHAHQMECAMAR-UHFFFAOYSA-N 2-(bromomethyl)-5-phenylmethoxy-1,3-dioxane Chemical compound C1OC(CBr)OCC1OCC1=CC=CC=C1 BWYHAHQMECAMAR-UHFFFAOYSA-N 0.000 description 1
- NUHDKJAUAXCWED-UHFFFAOYSA-N 2-(chloromethyl)-5-[(2-fluorophenyl)methoxy]-5-methyl-1,3-dioxane Chemical compound C=1C=CC=C(F)C=1COC1(C)COC(CCl)OC1 NUHDKJAUAXCWED-UHFFFAOYSA-N 0.000 description 1
- HDNRCMSNNPLGFO-UHFFFAOYSA-N 2-(furan-2-yl)-5-[(2-methylphenyl)methoxy]-1,3-dioxane Chemical compound CC1=CC=CC=C1COC1COC(C=2OC=CC=2)OC1 HDNRCMSNNPLGFO-UHFFFAOYSA-N 0.000 description 1
- YOZVYJSSXPBWRF-UHFFFAOYSA-N 2-[(3-chlorophenoxy)methyl]-5-phenylmethoxy-1,3-dioxane Chemical compound ClC1=CC=CC(OCC2OCC(CO2)OCC=2C=CC=CC=2)=C1 YOZVYJSSXPBWRF-UHFFFAOYSA-N 0.000 description 1
- YSUIQYOGTINQIN-UZFYAQMZSA-N 2-amino-9-[(1S,6R,8R,9S,10R,15R,17R,18R)-8-(6-aminopurin-9-yl)-9,18-difluoro-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3lambda5,12lambda5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one Chemical compound NC1=NC2=C(N=CN2[C@@H]2O[C@@H]3COP(S)(=O)O[C@@H]4[C@@H](COP(S)(=O)O[C@@H]2[C@@H]3F)O[C@H]([C@H]4F)N2C=NC3=C2N=CN=C3N)C(=O)N1 YSUIQYOGTINQIN-UZFYAQMZSA-N 0.000 description 1
- OVXJWSYBABKZMD-UHFFFAOYSA-N 2-chloro-1,1-diethoxyethane Chemical compound CCOC(CCl)OCC OVXJWSYBABKZMD-UHFFFAOYSA-N 0.000 description 1
- CRZJPEIBPQWDGJ-UHFFFAOYSA-N 2-chloro-1,1-dimethoxyethane Chemical compound COC(CCl)OC CRZJPEIBPQWDGJ-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- GLEDFKMOWGWMGL-UHFFFAOYSA-N 2-ethyl-2-[(2-fluorophenyl)methoxy]propane-1,3-diol Chemical compound CCC(CO)(CO)OCC1=CC=CC=C1F GLEDFKMOWGWMGL-UHFFFAOYSA-N 0.000 description 1
- WLSBXUTYJZHJDW-UHFFFAOYSA-N 2-ethyl-5-[(2-fluorophenyl)methoxy]-5-methyl-1,3-dioxane Chemical compound C1OC(CC)OCC1(C)OCC1=CC=CC=C1F WLSBXUTYJZHJDW-UHFFFAOYSA-N 0.000 description 1
- MROZEXUYEGHFEP-UHFFFAOYSA-N 2-ethyl-5-methyl-5-[(2-methylphenyl)methoxy]-1,3-dioxane Chemical compound C1OC(CC)OCC1(C)OCC1=CC=CC=C1C MROZEXUYEGHFEP-UHFFFAOYSA-N 0.000 description 1
- QDCBEAGPHBHTKW-UHFFFAOYSA-N 2-ethyl-5-methylidene-1,3-dioxane Chemical compound CCC1OCC(=C)CO1 QDCBEAGPHBHTKW-UHFFFAOYSA-N 0.000 description 1
- RLVMGTURHNLOJX-UHFFFAOYSA-N 2-methyl-1,3-dioxan-5-ol Chemical compound CC1OCC(O)CO1 RLVMGTURHNLOJX-UHFFFAOYSA-N 0.000 description 1
- JFFYKITVXPZLQS-UHFFFAOYSA-N 2-methylidenepropane-1,3-diol Chemical compound OCC(=C)CO JFFYKITVXPZLQS-UHFFFAOYSA-N 0.000 description 1
- PFJQPZMTKVAIGA-UHFFFAOYSA-N 2-phenyl-5-[(2,3,6-trichlorophenyl)methoxy]-1,3-dioxane Chemical compound ClC1=CC=C(Cl)C(COC2COC(OC2)C=2C=CC=CC=2)=C1Cl PFJQPZMTKVAIGA-UHFFFAOYSA-N 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- PIKNVEVCWAAOMJ-UHFFFAOYSA-N 3-fluorobenzaldehyde Chemical compound FC1=CC=CC(C=O)=C1 PIKNVEVCWAAOMJ-UHFFFAOYSA-N 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- MPSCZEFPEBUTHJ-UHFFFAOYSA-N 4-[(2-phenyl-1,3-dioxan-5-yl)oxymethyl]benzonitrile Chemical compound C1=CC(C#N)=CC=C1COC1COC(C=2C=CC=CC=2)OC1 MPSCZEFPEBUTHJ-UHFFFAOYSA-N 0.000 description 1
- ZNTXHVJPXKUFOK-UHFFFAOYSA-N 5-[(2-fluorophenyl)methoxy]-2-(furan-2-yl)-1,3-dioxane Chemical compound FC1=CC=CC=C1COC1COC(C=2OC=CC=2)OC1 ZNTXHVJPXKUFOK-UHFFFAOYSA-N 0.000 description 1
- KQFIJZCTDRSHMX-UHFFFAOYSA-N 5-[(3-methylphenyl)methoxy]-2-phenyl-1,3-dioxane Chemical compound CC1=CC=CC(COC2COC(OC2)C=2C=CC=CC=2)=C1 KQFIJZCTDRSHMX-UHFFFAOYSA-N 0.000 description 1
- MYZZCFNNGCBOAS-UHFFFAOYSA-N 5-[(4-methylphenyl)methoxy]-2-phenyl-1,3-dioxane Chemical compound C1=CC(C)=CC=C1COC1COC(C=2C=CC=CC=2)OC1 MYZZCFNNGCBOAS-UHFFFAOYSA-N 0.000 description 1
- RLSCVQIAWTXAQS-UHFFFAOYSA-N 5-phenylmethoxy-2-(3-phenylmethoxyphenyl)-1,3-dioxane Chemical compound C=1C=CC=CC=1COC(CO1)COC1C(C=1)=CC=CC=1OCC1=CC=CC=C1 RLSCVQIAWTXAQS-UHFFFAOYSA-N 0.000 description 1
- KIYFILZSGCWDGD-UHFFFAOYSA-N 5-phenylmethoxy-2-(phenylmethoxymethyl)-1,3-dioxane Chemical compound O1CC(OCC=2C=CC=CC=2)COC1COCC1=CC=CC=C1 KIYFILZSGCWDGD-UHFFFAOYSA-N 0.000 description 1
- 241000219144 Abutilon Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 235000017060 Arachis glabrata Nutrition 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000018262 Arachis monticola Nutrition 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 235000014750 Brassica kaber Nutrition 0.000 description 1
- 244000024671 Brassica kaber Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 235000000509 Chenopodium ambrosioides Nutrition 0.000 description 1
- 244000098897 Chenopodium botrys Species 0.000 description 1
- 235000005490 Chenopodium botrys Nutrition 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 241001057636 Dracaena deremensis Species 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 241001148659 Panicum dichotomiflorum Species 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 241000205407 Polygonum Species 0.000 description 1
- 241000219295 Portulaca Species 0.000 description 1
- 235000001855 Portulaca oleracea Nutrition 0.000 description 1
- 244000234609 Portulaca oleracea Species 0.000 description 1
- 235000008515 Setaria glauca Nutrition 0.000 description 1
- 244000010062 Setaria pumila Species 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 241000219793 Trifolium Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 241000482268 Zea mays subsp. mays Species 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229920003232 aliphatic polyester Polymers 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- NEHMKBQYUWJMIP-UHFFFAOYSA-N anhydrous methyl chloride Natural products ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000005002 aryl methyl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- KGNDCEVUMONOKF-UGPLYTSKSA-N benzyl n-[(2r)-1-[(2s,4r)-2-[[(2s)-6-amino-1-(1,3-benzoxazol-2-yl)-1,1-dihydroxyhexan-2-yl]carbamoyl]-4-[(4-methylphenyl)methoxy]pyrrolidin-1-yl]-1-oxo-4-phenylbutan-2-yl]carbamate Chemical compound C1=CC(C)=CC=C1CO[C@H]1CN(C(=O)[C@@H](CCC=2C=CC=CC=2)NC(=O)OCC=2C=CC=CC=2)[C@H](C(=O)N[C@@H](CCCCN)C(O)(O)C=2OC3=CC=CC=C3N=2)C1 KGNDCEVUMONOKF-UGPLYTSKSA-N 0.000 description 1
- 125000006515 benzyloxy alkyl group Chemical class 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000004965 chloroalkyl group Chemical group 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000011362 coarse particle Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229940126208 compound 22 Drugs 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000012156 elution solvent Substances 0.000 description 1
- 230000008029 eradication Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 229920000847 nonoxynol Polymers 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical class CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 239000010451 perlite Substances 0.000 description 1
- 235000019362 perlite Nutrition 0.000 description 1
- 125000005359 phenoxyalkyl group Chemical class 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000003822 preparative gas chromatography Methods 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- JBYXPOFIGCOSSB-UQGDGPGGSA-N rumenic acid Chemical compound CCCCCC\C=C/C=C/CCCCCCCC(O)=O JBYXPOFIGCOSSB-UQGDGPGGSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229920005552 sodium lignosulfonate Polymers 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- ZSDSQXJSNMTJDA-UHFFFAOYSA-N trifluralin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O ZSDSQXJSNMTJDA-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000010455 vermiculite Substances 0.000 description 1
- 229910052902 vermiculite Inorganic materials 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/04—1,3-Dioxanes; Hydrogenated 1,3-dioxanes
- C07D319/08—1,3-Dioxanes; Hydrogenated 1,3-dioxanes condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/03—Ethers having all ether-oxygen atoms bound to acyclic carbon atoms
- C07C43/14—Unsaturated ethers
- C07C43/178—Unsaturated ethers containing hydroxy or O-metal groups
- C07C43/1782—Unsaturated ethers containing hydroxy or O-metal groups containing six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK214176A DK214176A (da) | 1971-09-21 | 1976-05-13 | Fremgangsmade til bekempelse af uonsket plantevekst samt herbicid til anvendelse ved fremgangsmaden |
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US18240071A | 1971-09-21 | 1971-09-21 | |
| US18240071 | 1971-09-21 | ||
| US22490972A | 1972-02-09 | 1972-02-09 | |
| US22490972 | 1972-02-09 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK141367B true DK141367B (da) | 1980-03-03 |
| DK141367C DK141367C (online.php) | 1980-09-22 |
Family
ID=26878066
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK463872AA DK141367B (da) | 1971-09-21 | 1972-09-20 | Herbicidt aktive dioxaner. |
Country Status (23)
| Country | Link |
|---|---|
| JP (1) | JPS4839623A (online.php) |
| AR (1) | AR193292A1 (online.php) |
| AT (1) | AT327604B (online.php) |
| BE (1) | BE789105A (online.php) |
| BG (1) | BG23894A3 (online.php) |
| CA (1) | CA995679A (online.php) |
| CH (1) | CH578302A5 (online.php) |
| DE (1) | DE2243685A1 (online.php) |
| DK (1) | DK141367B (online.php) |
| ES (1) | ES406847A1 (online.php) |
| FR (1) | FR2153344B1 (online.php) |
| GB (1) | GB1406849A (online.php) |
| IE (1) | IE36654B1 (online.php) |
| IL (2) | IL40277A (online.php) |
| IT (1) | IT967673B (online.php) |
| NL (1) | NL7212762A (online.php) |
| NO (1) | NO137996C (online.php) |
| OA (1) | OA04175A (online.php) |
| PH (1) | PH10389A (online.php) |
| RO (1) | RO62794A (online.php) |
| SE (1) | SE398881B (online.php) |
| SU (1) | SU584740A3 (online.php) |
| TR (1) | TR17323A (online.php) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1470509A (en) * | 1973-06-18 | 1977-04-14 | Shell Int Research | Dihalobenzyl ethers |
| US4035178A (en) * | 1976-08-31 | 1977-07-12 | Fmc Corporation | Herbicidal 1,3-dioxanes |
| IN146343B (online.php) * | 1976-08-31 | 1979-05-05 | Fmc Corp | |
| DE3176532D1 (de) * | 1981-12-01 | 1987-12-23 | Dow Chemical Co | 2-cyano-substituted 1,3-dioxane and dioxolane derivatives |
| DE3405914A1 (de) * | 1984-02-18 | 1985-08-22 | Merck Patent Gmbh, 6100 Darmstadt | Fluessigkristalline verbindungen |
| US4554011A (en) * | 1984-08-24 | 1985-11-19 | Chevron Research Company | Herbicidal 2S-(2β,4β,5β)-5-Arylmethoxy-4-substituted 2-alkyl-1,3-dioxane derivatives |
| DE10301110A1 (de) * | 2003-01-09 | 2004-07-22 | Bayer Cropscience Gmbh | Substituierte Benzoylderivate als Herbizide |
-
0
- BE BE789105D patent/BE789105A/xx unknown
-
1972
- 1972-08-22 CA CA149,950A patent/CA995679A/en not_active Expired
- 1972-08-24 IE IE1161/72A patent/IE36654B1/xx unknown
- 1972-08-29 IL IL40277A patent/IL40277A/xx unknown
- 1972-08-29 IL IL40227A patent/IL40227A0/xx unknown
- 1972-09-04 PH PH13863A patent/PH10389A/en unknown
- 1972-09-06 DE DE2243685A patent/DE2243685A1/de not_active Withdrawn
- 1972-09-14 AT AT1083573*7A patent/AT327604B/de not_active IP Right Cessation
- 1972-09-15 AR AR244107A patent/AR193292A1/es active
- 1972-09-19 ES ES406847A patent/ES406847A1/es not_active Expired
- 1972-09-19 JP JP47093298A patent/JPS4839623A/ja active Pending
- 1972-09-19 SU SU7201829041A patent/SU584740A3/ru active
- 1972-09-19 OA OA54690A patent/OA04175A/xx unknown
- 1972-09-20 SE SE7212156A patent/SE398881B/xx unknown
- 1972-09-20 NO NO3360/72A patent/NO137996C/no unknown
- 1972-09-20 CH CH1376172A patent/CH578302A5/xx not_active IP Right Cessation
- 1972-09-20 DK DK463872AA patent/DK141367B/da unknown
- 1972-09-20 GB GB4345272A patent/GB1406849A/en not_active Expired
- 1972-09-20 TR TR17323A patent/TR17323A/xx unknown
- 1972-09-20 IT IT29452/72A patent/IT967673B/it active
- 1972-09-20 FR FR7233329A patent/FR2153344B1/fr not_active Expired
- 1972-09-20 BG BG7200021424A patent/BG23894A3/xx unknown
- 1972-09-21 NL NL7212762A patent/NL7212762A/xx not_active Application Discontinuation
- 1972-09-21 RO RO7200072293A patent/RO62794A/ro unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK141367C (online.php) | 1980-09-22 |
| AT327604B (de) | 1976-02-10 |
| IE36654B1 (en) | 1977-01-19 |
| ATA1083573A (de) | 1975-04-15 |
| AU4613272A (en) | 1974-03-07 |
| PH10389A (en) | 1977-03-04 |
| FR2153344A1 (online.php) | 1973-05-04 |
| ES406847A1 (es) | 1976-01-16 |
| JPS4839623A (online.php) | 1973-06-11 |
| DE2243685A1 (de) | 1973-03-29 |
| BG23894A3 (en) | 1977-11-10 |
| NO137996B (no) | 1978-02-27 |
| IL40277A (en) | 1977-10-31 |
| IE36654L (en) | 1973-03-21 |
| CH578302A5 (online.php) | 1976-08-13 |
| FR2153344B1 (online.php) | 1977-07-29 |
| AR193292A1 (es) | 1973-04-11 |
| SE398881B (sv) | 1978-01-23 |
| NO137996C (no) | 1978-06-07 |
| SU584740A3 (ru) | 1977-12-15 |
| TR17323A (tr) | 1975-03-24 |
| GB1406849A (en) | 1975-09-17 |
| IT967673B (it) | 1974-03-11 |
| CA995679A (en) | 1976-08-24 |
| OA04175A (fr) | 1979-12-15 |
| RO62794A (fr) | 1977-11-15 |
| IL40227A0 (en) | 1972-11-28 |
| BE789105A (fr) | 1973-03-21 |
| NL7212762A (online.php) | 1973-03-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BG61516B2 (bg) | Пропинилов естер на 2-/4-(5-хлоро-3-флуоропиридин-2-илокси) фенокси/-пропионовата киселина и приложението й | |
| US4175947A (en) | Phenoxy-phenoxypropionic acid esters | |
| US5567670A (en) | Herbicides for citrus oil palm rubber and other plantation crops | |
| EP0288275B1 (en) | Phenoxypropionic acid derivatives for use as herbicides | |
| DK141367B (da) | Herbicidt aktive dioxaner. | |
| CA2043376A1 (en) | Sulfonylureas | |
| HU188576B (en) | Herbicides containing cyclohexane-1,3-dione-derivatives and process for the production of cyclohexane-1,3-dione-derivatives | |
| CN1129936A (zh) | 具有除草活性的取代1-氨基-3-苯基尿嘧啶 | |
| JPH0124140B2 (online.php) | ||
| AU616983B2 (en) | Herbicidal compounds and compositions containing them | |
| US4302238A (en) | Herbicidal isoxazolidine-3,5-diones | |
| US4077982A (en) | 5-Benzyloxy-1,3-dioxanes | |
| JPS5925789B2 (ja) | チアゾリリデン−オキソ−プロピオニトリル、その製造法並びに該化合物を含有する殺虫剤 | |
| HU207063B (en) | Process for producing substituted dioxolane and dioxane derivatives, plant protectant compositions comprising such compounds, their application for exterminating insects and acari, as well as process for producing agents against ticks, comprising such compounds | |
| US4410354A (en) | Spiro ether herbicides | |
| CA1080236A (en) | Dioxolane derivatives | |
| US4629492A (en) | Substituted oxirane compounds | |
| US4035178A (en) | Herbicidal 1,3-dioxanes | |
| US5207818A (en) | Herbicidally active benzoxazines | |
| US4537623A (en) | Herbicidal 2-(oxa or thia heterocycle)5-amino-3-oxo-4-(substituted-phenyl)-2,3-dihydrofurans | |
| CH656133A5 (de) | Herbizid wirksame derivate von 5-desoxy-3-0-arylmethyl- oder substituierten arylmethyl-1,2,0-alkyl-idene-alpha-d-xylofuranosen. | |
| IE45464B1 (en) | Herbicidal 1,3-dioxanes | |
| US4439225A (en) | Herbicidal cyano-tetrahydrofuranylmethyl ether and cyano-tetrahydropyranylmethyl ether derivatives | |
| US4978386A (en) | Herbicidal 2-(substituted-phenyl)-3-amino-2-cyclopentenone derivatives | |
| US4561876A (en) | Haloalkylcarbonylamino-1,3-dioxane herbicide antidotes |