DK139575B - Analogifremgangsmåde til fremstilling af 2-aminomethylen-1-indanon-forbindelser eller syreadditionssalte deraf. - Google Patents
Analogifremgangsmåde til fremstilling af 2-aminomethylen-1-indanon-forbindelser eller syreadditionssalte deraf.Info
- Publication number
- DK139575B DK139575B DK657173AA DK657173A DK139575B DK 139575 B DK139575 B DK 139575B DK 657173A A DK657173A A DK 657173AA DK 657173 A DK657173 A DK 657173A DK 139575 B DK139575 B DK 139575B
- Authority
- DK
- Denmark
- Prior art keywords
- aminomethylene
- preparation
- acid addition
- addition salts
- analogous process
- Prior art date
Links
- HJOUSWJOPKLCGA-UHFFFAOYSA-N 2-(aminomethylidene)-3h-inden-1-one Chemical class C1=CC=C2C(=O)C(=CN)CC2=C1 HJOUSWJOPKLCGA-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/02—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton
- C07C225/14—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated
- C07C225/16—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings
- C07C225/18—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings the carbon skeleton containing also rings other than six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/312,693 US4022836A (en) | 1972-12-06 | 1972-12-06 | 2-Aminomethyleneindanone analgesic agents |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK139575B true DK139575B (da) | 1979-03-12 |
| DK139575C DK139575C (OSRAM) | 1979-08-27 |
Family
ID=23212586
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK657173AA DK139575B (da) | 1972-12-06 | 1973-12-05 | Analogifremgangsmåde til fremstilling af 2-aminomethylen-1-indanon-forbindelser eller syreadditionssalte deraf. |
Country Status (20)
| Country | Link |
|---|---|
| US (2) | US4022836A (OSRAM) |
| JP (1) | JPS5542066B2 (OSRAM) |
| AR (1) | AR207946A1 (OSRAM) |
| AT (1) | AT326646B (OSRAM) |
| BE (1) | BE808275A (OSRAM) |
| CA (1) | CA1002068A (OSRAM) |
| CH (1) | CH584677A5 (OSRAM) |
| DE (1) | DE2360096C2 (OSRAM) |
| DK (1) | DK139575B (OSRAM) |
| ES (1) | ES421167A1 (OSRAM) |
| FR (1) | FR2209565B1 (OSRAM) |
| GB (1) | GB1448026A (OSRAM) |
| IE (1) | IE38553B1 (OSRAM) |
| IL (1) | IL43722A (OSRAM) |
| LU (1) | LU68950A1 (OSRAM) |
| NL (1) | NL172057C (OSRAM) |
| NO (1) | NO137858C (OSRAM) |
| PH (1) | PH10690A (OSRAM) |
| SE (1) | SE405851B (OSRAM) |
| ZA (1) | ZA739052B (OSRAM) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4117012A (en) * | 1972-12-06 | 1978-09-26 | Pfizer Inc. | 2-aminomethyleneindanone analgesic agents |
| US4164514A (en) * | 1972-12-06 | 1979-08-14 | Pfizer Inc. | 2-Aminomethyleneindanone analgesic agents |
| US4334085A (en) * | 1978-09-14 | 1982-06-08 | Standard Oil Company (Indiana) | Transamination process for Mannich products |
| NZ209534A (en) * | 1983-09-30 | 1987-01-23 | Surgikos Inc | Antimicrobial fabric for surgical drape |
| US6369289B1 (en) | 2000-07-07 | 2002-04-09 | Tyco Healthcare Group Lp | Method and manufacture of a wound dressing for covering an open wound |
| EP1554572B1 (en) | 2001-07-25 | 2009-10-14 | Raptor Pharmaceutical Inc. | Compositions and methods for modulating blood-brain barrier transport |
| CN101287411B (zh) | 2005-04-28 | 2013-03-06 | 普罗秋斯生物医学公司 | 药物信息系统及其用途 |
| EP2063905B1 (en) | 2006-09-18 | 2014-07-30 | Raptor Pharmaceutical Inc | Treatment of liver disorders by administration of receptor-associated protein (rap)-conjugates |
| HUE059078T2 (hu) | 2009-02-20 | 2022-10-28 | Enhanx Biopharm Inc | Glutation-alapú hatóanyagszállító rendszer |
| KR101909711B1 (ko) | 2009-05-06 | 2018-12-19 | 라보라토리 스킨 케어, 인크. | 활성제-칼슘 포스페이트 입자 복합체를 포함하는 피부 전달 조성물 및 이들을 이용하는 방법 |
| US20120077778A1 (en) | 2010-09-29 | 2012-03-29 | Andrea Bourdelais | Ladder-Frame Polyether Conjugates |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3454565A (en) * | 1966-10-05 | 1969-07-08 | American Cyanamid Co | Novel indanones |
-
1972
- 1972-12-06 US US05/312,693 patent/US4022836A/en not_active Expired - Lifetime
-
1973
- 1973-01-01 AR AR251362A patent/AR207946A1/es active
- 1973-11-26 GB GB5483073A patent/GB1448026A/en not_active Expired
- 1973-11-28 ZA ZA739052A patent/ZA739052B/xx unknown
- 1973-11-29 IE IE2160/73A patent/IE38553B1/xx unknown
- 1973-11-29 IL IL43722A patent/IL43722A/en unknown
- 1973-12-03 CA CA187,227A patent/CA1002068A/en not_active Expired
- 1973-12-03 DE DE2360096A patent/DE2360096C2/de not_active Expired
- 1973-12-04 FR FR7343232A patent/FR2209565B1/fr not_active Expired
- 1973-12-04 AT AT1013873A patent/AT326646B/de not_active IP Right Cessation
- 1973-12-05 NO NO4652/73A patent/NO137858C/no unknown
- 1973-12-05 CH CH1704473A patent/CH584677A5/xx not_active IP Right Cessation
- 1973-12-05 SE SE7316447A patent/SE405851B/xx unknown
- 1973-12-05 NL NLAANVRAGE7316663,A patent/NL172057C/xx not_active IP Right Cessation
- 1973-12-05 PH PH15292A patent/PH10690A/en unknown
- 1973-12-05 ES ES421167A patent/ES421167A1/es not_active Expired
- 1973-12-05 DK DK657173AA patent/DK139575B/da unknown
- 1973-12-06 BE BE1005561A patent/BE808275A/xx unknown
- 1973-12-06 LU LU68950A patent/LU68950A1/xx unknown
- 1973-12-06 JP JP13575773A patent/JPS5542066B2/ja not_active Expired
-
1977
- 1977-01-27 US US05/763,241 patent/US4064272A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BE808275A (fr) | 1974-06-06 |
| IL43722A (en) | 1976-03-31 |
| IE38553L (en) | 1974-06-06 |
| NO137858B (no) | 1978-01-30 |
| FR2209565B1 (OSRAM) | 1977-04-08 |
| JPS5542066B2 (OSRAM) | 1980-10-28 |
| NL7316663A (OSRAM) | 1974-06-10 |
| NL172057B (nl) | 1983-02-01 |
| ATA1013873A (de) | 1975-03-15 |
| CA1002068A (en) | 1976-12-21 |
| FR2209565A1 (OSRAM) | 1974-07-05 |
| AU6302373A (en) | 1975-05-29 |
| GB1448026A (en) | 1976-09-02 |
| IE38553B1 (en) | 1978-04-12 |
| NL172057C (nl) | 1983-07-01 |
| DK139575C (OSRAM) | 1979-08-27 |
| SE7316447L (OSRAM) | 1974-06-07 |
| AR207946A1 (es) | 1976-11-22 |
| US4022836A (en) | 1977-05-10 |
| NO137858C (no) | 1978-05-10 |
| LU68950A1 (OSRAM) | 1974-07-05 |
| ZA739052B (en) | 1974-10-30 |
| CH584677A5 (OSRAM) | 1977-02-15 |
| DE2360096A1 (de) | 1974-07-04 |
| PH10690A (en) | 1977-08-10 |
| ES421167A1 (es) | 1976-04-01 |
| IL43722A0 (en) | 1974-03-14 |
| JPS4986352A (OSRAM) | 1974-08-19 |
| US4064272A (en) | 1977-12-20 |
| DE2360096C2 (de) | 1982-07-01 |
| SE405851B (sv) | 1979-01-08 |
| AT326646B (de) | 1975-12-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK129446B (da) | Analogifremgangsmåde til fremstilling af fenoxyhydroxypropylaminer eller syreadditionssalte heraf. | |
| DK136714B (da) | Analogifremgangsmåde til fremstilling af substituerede piperidinderivater eller syreadditionssalte deraf. | |
| DK124547B (da) | Analogifremgangsmåde til fremstilling af (3-amino-2-hydroxy-propyloxy)-thiochromanderivater eller syreadditionssalte deraf. | |
| DK131858B (da) | Analogifremgangsmåde til fremstilling af 4-amino-6-arylpyrimidin-forbindelser eller syreadditionssalte deraf. | |
| DK131287B (da) | Analogifremgangsmåde til fremstilling af 2-phenylimino-imidazolidiner eller syreadditionssalte deraf. | |
| DK136713B (da) | Analogifremgangsmåde til fremstilling af alfa-aryl-4-substituerede piperidinoalkanolderivater eller deres syreadditionssalte. | |
| DK139575B (da) | Analogifremgangsmåde til fremstilling af 2-aminomethylen-1-indanon-forbindelser eller syreadditionssalte deraf. | |
| DK138020B (da) | Analogifremgangsmåde til fremstilling af pyrazolodiazepinforbindelser eller salte deraf. | |
| DK145574C (da) | Analogifremgangsmaade til fremstilling af substituerede cyclopropylalkylaminer eller syreadditionssalte deraf | |
| DK140833B (da) | Analogifremgangsmåde til fremstilling af phenylethylaminderivater eller syreadditionssalte deraf. | |
| DK138491B (da) | Analogifremgangsmåde til fremstilling af N-(1-cyclohexyl-3-pyrrolidinyl)-benzamider eller syreadditionssalte deraf. | |
| DK131778B (da) | Fremgangsmåde til fremstilling af substituerede 3-hydroksymetylisokinolinderivater eller syreadditionssalte heraf. | |
| DK138943B (da) | Analogifremgangsmåde til fremstilling af substituerede dibenzocyclohepten-carboxamider eller syreadditionssalte deraf. | |
| DK131857B (da) | Analogifremgangsmåde til fremstilling af 4-hydroxymethyl-1-phthalazonderivater eller syreadditionssalte deraf. | |
| DK137757B (da) | Analogifremgangsmåde til fremstilling af pyridylpiperaziner eller syreadditionssalte deraf. | |
| DK138117B (da) | Analogifremgangsmåde til fremstilling af isoindolinderivater eller syreadditionssalte deraf. | |
| DK134014B (da) | Analogifremgangsmåde til fremstilling af cycloalkyllactamimider eller syreadditionssalte deraf. | |
| DK133975B (da) | Analogifremgangsmåde til fremstilling af aminspirodibenzocykloheptenforbindelser eller syreadditionssalte deraf. | |
| DK129164B (da) | Analogifremgangsmåde til fremstilling af 3-alkyl-5-aryloxymethylisoxazoler eller syreadditionssalte deraf. | |
| DK140259B (da) | Analogifremgangsmåde til fremstilling af 1-(L-(-)-omega-amino-alfa-hydroxyalkanoyl)-kanamyciner eller syreadditionssalte deraf. | |
| DK133677B (da) | Analogifremgangsmåde til fremstilling af 2-alkyl-4-(1-alkyl-4-piperidyliden)-benzocycloheptathiophenderivater eller syreadditionssalte deraf. | |
| DK130830B (da) | Analogifremgangsmåde til fremstilling af diphenylmethoxyethylaminer eller syreadditionssalte deraf. | |
| DK137863B (da) | Fremgangsmåde til fremstilling af antibiotikum A-4696 eller syreadditionssalte deraf. | |
| DK134023B (da) | Analogifremgangsmåde til fremstilling af acyloxypiperazinylforbindelser eller syreadditionssalte deraf. | |
| DK134717B (da) | Analogifremgangsmåde til fremstilling af substituerede m-dioxan-5-methylaminer eller syreadditionssalte deraf. |