DK137277B - Analogifremgangsmåde til fremstilling af ferrocenforbindelser. - Google Patents
Analogifremgangsmåde til fremstilling af ferrocenforbindelser.Info
- Publication number
- DK137277B DK137277B DK603474AA DK603474A DK137277B DK 137277 B DK137277 B DK 137277B DK 603474A A DK603474A A DK 603474AA DK 603474 A DK603474 A DK 603474A DK 137277 B DK137277 B DK 137277B
- Authority
- DK
- Denmark
- Prior art keywords
- preparation
- analogous process
- ferrocene compounds
- ferrocene
- compounds
- Prior art date
Links
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical class [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F17/00—Metallocenes
- C07F17/02—Metallocenes of metals of Groups 8, 9 or 10 of the Periodic Table
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5400273A GB1476300A (en) | 1973-11-21 | 1973-11-21 | Substituted ferrocene compounds and processes for their production |
| GB3160974 | 1974-07-17 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK603474A DK603474A (member.php) | 1975-08-11 |
| DK137277B true DK137277B (da) | 1978-02-13 |
| DK137277C DK137277C (member.php) | 1978-07-17 |
Family
ID=26260996
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK603474AA DK137277B (da) | 1973-11-21 | 1974-11-20 | Analogifremgangsmåde til fremstilling af ferrocenforbindelser. |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3960911A (member.php) |
| JP (1) | JPS5093951A (member.php) |
| AT (1) | AT331260B (member.php) |
| CA (1) | CA1032549A (member.php) |
| DD (1) | DD116837A5 (member.php) |
| DE (1) | DE2453977A1 (member.php) |
| DK (1) | DK137277B (member.php) |
| ES (1) | ES432100A1 (member.php) |
| FI (1) | FI330774A7 (member.php) |
| FR (1) | FR2251317B1 (member.php) |
| IE (1) | IE40260B1 (member.php) |
| IL (1) | IL46027A (member.php) |
| NL (1) | NL7415174A (member.php) |
| NO (1) | NO744183L (member.php) |
| SE (1) | SE7414596L (member.php) |
| ZM (1) | ZM16774A1 (member.php) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2702628A1 (de) * | 1977-01-22 | 1978-07-27 | Bayer Ag | Duengemittel zur versorgung von pflanzen mit eisen |
| DE2543999B2 (de) * | 1975-10-02 | 1980-02-07 | Bayer Ag, 5090 Leverkusen | Düngemittel zur Versorgung von Pflanzen mit Eisen |
| DE2623487A1 (de) * | 1976-05-26 | 1977-12-15 | Hoechst Ag | Ferrocenderivate und verfahren zu ihrer herstellung |
| DE2623486C2 (de) * | 1976-05-26 | 1982-12-30 | Hoechst Ag, 6000 Frankfurt | 3.5.5-Trimethylhexanoyl-ferrocen, Verfahren zu seiner Herstellung und pharmazeutische Präparate |
| DE2711546A1 (de) | 1977-03-17 | 1978-09-21 | Bayer Ag | Insektizide und akarizide mittel |
| DE2815930A1 (de) * | 1978-04-13 | 1979-10-18 | Bayer Ag | Duengemittel zur versorgung von pflanzen mit eisen |
| DE3404443A1 (de) * | 1984-02-08 | 1985-08-08 | Hartmut Prof. Dr. 1000 Berlin Köpf | Metallicenium-salze und deren verwendung als cytostatica bei der krebsbekaempfung |
| DE3765524D1 (de) * | 1986-11-10 | 1990-11-15 | Ciba Geigy Ag | Verbessertes verfahren zur herstellung von metallorganischen verbindungen. |
| US5015748A (en) * | 1988-10-01 | 1991-05-14 | Idemitsu Kosan Co., Ltd. | Novel ferrocene derivatives, surfactants containing same and a process for producing organic thin films |
| US5135619A (en) * | 1988-10-01 | 1992-08-04 | Idemitsu Kosan Co., Inc. | Process for producing organic thin films |
| JPH02250892A (ja) * | 1989-03-24 | 1990-10-08 | Idemitsu Kosan Co Ltd | 新規フェロセン誘導体,それを含有する界面活性剤及び有機薄膜の製造方法 |
| US5135637A (en) * | 1989-03-24 | 1992-08-04 | Idemitsu Kosan Co., Ltd. | Eerrocene derivatives, surfactants containing same and process for producing organic thin films |
| KR960004634B1 (ko) * | 1989-05-12 | 1996-04-11 | 이데미쓰 고산 가부시끼가이샤 | 페로세노일 유도체의 제조방법 |
| US5075471A (en) * | 1990-10-09 | 1991-12-24 | Rohm And Haas Company | Insecticidal ferrocenoyl acylhydrazines |
| FR2721028B1 (fr) * | 1994-06-14 | 1996-07-12 | Poudres & Explosifs Ste Nale | Procédé de synthèse d'halogénoalkylferrocènes. |
| US5863911A (en) * | 1994-10-12 | 1999-01-26 | Modelisation Et Mise Au Point De Molecules Medicinales | Diarylethylene metallocene derivatives, their processes of preparation and pharmaceutical compositions containing said derivatives |
| US6667050B1 (en) | 1999-04-06 | 2003-12-23 | Galen (Chemicals) Limited | Chewable oral contraceptive |
| WO2003032895A2 (en) * | 2001-10-17 | 2003-04-24 | Notox Ltd. | Methods and pharmaceutical compositions for stimulating the immune system and/or treating cancer |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2831879A (en) * | 1953-10-27 | 1958-04-22 | Du Pont | Chemical product and process |
| US3711280A (en) * | 1971-02-17 | 1973-01-16 | Eastman Kodak Co | Metallocene photoconductors used in electrophotography |
-
1974
- 1974-11-11 IL IL46027A patent/IL46027A/en unknown
- 1974-11-11 US US05/522,591 patent/US3960911A/en not_active Expired - Lifetime
- 1974-11-14 DE DE19742453977 patent/DE2453977A1/de active Pending
- 1974-11-14 FI FI3307/74A patent/FI330774A7/fi unknown
- 1974-11-18 AT AT922274A patent/AT331260B/de not_active IP Right Cessation
- 1974-11-19 IE IE2380/74A patent/IE40260B1/en unknown
- 1974-11-19 DD DD182456A patent/DD116837A5/xx unknown
- 1974-11-20 ES ES432100A patent/ES432100A1/es not_active Expired
- 1974-11-20 ZM ZM167/74A patent/ZM16774A1/xx unknown
- 1974-11-20 FR FR7438083A patent/FR2251317B1/fr not_active Expired
- 1974-11-20 NO NO744183A patent/NO744183L/no unknown
- 1974-11-20 SE SE7414596A patent/SE7414596L/xx unknown
- 1974-11-20 DK DK603474AA patent/DK137277B/da unknown
- 1974-11-21 CA CA214,322A patent/CA1032549A/en not_active Expired
- 1974-11-21 JP JP49133225A patent/JPS5093951A/ja active Pending
- 1974-11-21 NL NL7415174A patent/NL7415174A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| SE7414596L (member.php) | 1975-05-22 |
| DK137277C (member.php) | 1978-07-17 |
| ES432100A1 (es) | 1977-06-16 |
| DK603474A (member.php) | 1975-08-11 |
| US3960911A (en) | 1976-06-01 |
| ATA922274A (de) | 1975-11-15 |
| NL7415174A (nl) | 1975-05-23 |
| IL46027A (en) | 1977-06-30 |
| FI330774A7 (member.php) | 1975-05-22 |
| DD116837A5 (member.php) | 1975-12-12 |
| CA1032549A (en) | 1978-06-06 |
| DE2453977A1 (de) | 1975-05-28 |
| IE40260B1 (en) | 1979-04-25 |
| FR2251317A1 (member.php) | 1975-06-13 |
| FR2251317B1 (member.php) | 1978-07-21 |
| ZM16774A1 (en) | 1975-07-21 |
| IL46027A0 (en) | 1975-02-10 |
| NO744183L (member.php) | 1975-06-16 |
| AU7553074A (en) | 1976-05-20 |
| JPS5093951A (member.php) | 1975-07-26 |
| AT331260B (de) | 1976-08-10 |
| IE40260L (en) | 1975-05-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK134345B (da) | Analogifremgangsmåde til fremstilling af 4-hydroxymethyl-1-phthalazonderivater. | |
| DK136718B (da) | Analogifremgangsmåde til fremstilling af substituerede hexahydro-dibenzo(b,d)-pyran-9-oner. | |
| DK136719B (da) | Analogifremgangsmåde til fremstilling af substituerede hexahydro-dibenzo(b,d)-pyraner. | |
| DK135376B (da) | Fremgangsmåde til fremstilling af piperazinylquinazolin-forbindelser. | |
| DK137277B (da) | Analogifremgangsmåde til fremstilling af ferrocenforbindelser. | |
| DK138791B (da) | Analogifremgangsmåde til fremstilling af 2,6-disubstituerede fenylaminoguanidinforbindelser. | |
| DK140484B (da) | Fremgangsmåde til fremstilling af zeaxanthin. | |
| DK135766B (da) | Analogifremgangsmåde til fremstilling af isoquinoliner. | |
| DK139678B (da) | Fremgangsmåde til fremstilling af 2,2,6,6-tetramethyl-4-oxopiperidin. | |
| DK134031B (da) | Fremgangsmåde til fremstilling af et endo-beta-glucanase-præparat. | |
| DK140406B (da) | Fremgangsmåde til fremstilling af 2,2,6,6-tetramethyl-4-oxopiperidin. | |
| DK138759B (da) | Fremgangsmåde til fremstilling af D-ribose. | |
| DK137389B (da) | Analogifremgangsmåde til fremstilling af 11beta-substituerede delta4-østrener. | |
| DK134279B (da) | Analogifremgangsmåde til fremstilling af cycloalkylphenoxycarboxylsyrederivater. | |
| DK133977B (da) | Fremgangsmåde til fremstilling af 2-chlor-5-sulfamoylbenzoesyrer. | |
| DK137577B (da) | Fremgangsmåde til fremstilling af zeaxanthin. | |
| DK140411B (da) | Fremgangsmåde til fremstilling af deacetoxycephalosporin C. | |
| DK135723B (da) | Analogifremgangsmåde til fremstilling af 7alfa-acylthio-3-oxo-D-homo-21,24-dinor-17aalfa-chlo-4-en-23,17a-lactoner. | |
| DK137043B (da) | Analogifremgangsmåde til fremstilling af nitrocarbostyrilforbindelser. | |
| DK131633B (da) | Fremgangsmåde til fremstilling af 3-(17beta-4-androsten-3-on-17beta-yl)-propiolacton. | |
| DK139716B (da) | Analogifremgangsmåde til fremstilling af 4-aminoamfetaminderivater. | |
| DK132328B (da) | Analogifremgangsmåde til fremstilling af 17beta-hydroxy-16,16-dimethylestr-4-en-3-on. | |
| DK136619B (da) | Fremgangsmåde til fremstilling af dihydrokanadensolid. | |
| DK139910B (da) | Analogifremgangsmåde til fremstilling af substituerede triazoler. | |
| NO740486L (no) | Analogifremgangsmåte til fremstilling av beta-reseptor-aktive forbindelser. |