DK137190B - Fremgangsmåde til fremstilling af 6beta-amino-2,2-dimetylpenam-3alfa-karboxylsyre. - Google Patents
Fremgangsmåde til fremstilling af 6beta-amino-2,2-dimetylpenam-3alfa-karboxylsyre.Info
- Publication number
- DK137190B DK137190B DK110972A DK110972A DK137190B DK 137190 B DK137190 B DK 137190B DK 110972 A DK110972 A DK 110972A DK 110972 A DK110972 A DK 110972A DK 137190 B DK137190 B DK 137190B
- Authority
- DK
- Denmark
- Prior art keywords
- dimethylpenam
- 6beta
- 3alpha
- amino
- preparation
- Prior art date
Links
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Cephalosporin Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB670871A GB1388265A (en) | 1971-03-12 | 1971-03-12 | Preparation of antibiotic compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK137190B true DK137190B (da) | 1978-01-30 |
| DK137190C DK137190C (enFirst) | 1978-07-03 |
Family
ID=9819332
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK110972A DK137190B (da) | 1971-03-12 | 1972-03-10 | Fremgangsmåde til fremstilling af 6beta-amino-2,2-dimetylpenam-3alfa-karboxylsyre. |
Country Status (15)
| Country | Link |
|---|---|
| JP (1) | JPS5421358B1 (enFirst) |
| AT (1) | AT332537B (enFirst) |
| AU (1) | AU470876B2 (enFirst) |
| BE (1) | BE780510A (enFirst) |
| CA (1) | CA1002036A (enFirst) |
| CH (1) | CH571006A5 (enFirst) |
| CS (1) | CS193013B2 (enFirst) |
| DE (1) | DE2211763C2 (enFirst) |
| DK (1) | DK137190B (enFirst) |
| ES (1) | ES400637A1 (enFirst) |
| FR (1) | FR2129579A5 (enFirst) |
| GB (1) | GB1388265A (enFirst) |
| HU (1) | HU163268B (enFirst) |
| NL (1) | NL7203191A (enFirst) |
| PL (1) | PL90110B1 (enFirst) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL8602767A (nl) * | 1986-10-31 | 1988-05-16 | Gantax Nv | Organisch zuuranhydride, alsmede farmaceutisch preparaat op basis van een prodrug. |
| CA2072360A1 (en) * | 1989-12-26 | 1991-06-27 | Abraham J. Domb | Prodrug anhydride compositions |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR95946E (fr) * | 1967-10-11 | 1972-03-10 | Koninklijke Gist Spiritus | Procédé de préparation de l'acide aminopénicillanique et ses dérivés. |
| DE2062925A1 (en) * | 1969-12-26 | 1971-07-01 | President Of Osaka University, Osaka (Japan) | 6-aminopenicillanic acid prepn |
| YU34425B (en) * | 1970-06-01 | 1979-07-10 | Galenka | Process for preparing 6-aminopenicillanic acid |
-
1971
- 1971-03-12 GB GB670871A patent/GB1388265A/en not_active Expired
-
1972
- 1972-03-10 DE DE19722211763 patent/DE2211763C2/de not_active Expired
- 1972-03-10 JP JP7224056A patent/JPS5421358B1/ja active Pending
- 1972-03-10 PL PL15399072A patent/PL90110B1/pl unknown
- 1972-03-10 BE BE780510A patent/BE780510A/xx unknown
- 1972-03-10 ES ES400637A patent/ES400637A1/es not_active Expired
- 1972-03-10 AU AU39848/72A patent/AU470876B2/en not_active Expired
- 1972-03-10 FR FR7208369A patent/FR2129579A5/fr not_active Expired
- 1972-03-10 CA CA136,780A patent/CA1002036A/en not_active Expired
- 1972-03-10 AT AT205272A patent/AT332537B/de not_active IP Right Cessation
- 1972-03-10 NL NL7203191A patent/NL7203191A/xx not_active Application Discontinuation
- 1972-03-10 DK DK110972A patent/DK137190B/da unknown
- 1972-03-10 CS CS162272A patent/CS193013B2/cs unknown
- 1972-03-10 HU HUGA001081 patent/HU163268B/hu unknown
- 1972-03-10 CH CH359172A patent/CH571006A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AU3984872A (en) | 1973-09-13 |
| BE780510A (enFirst) | 1972-09-11 |
| DE2211763A1 (de) | 1972-10-05 |
| HU163268B (enFirst) | 1973-07-28 |
| JPS5421358B1 (enFirst) | 1979-07-30 |
| CA1002036A (en) | 1976-12-21 |
| AU470876B2 (en) | 1973-09-13 |
| ES400637A1 (es) | 1975-01-16 |
| NL7203191A (enFirst) | 1972-09-14 |
| ATA205272A (de) | 1976-01-15 |
| AT332537B (de) | 1976-10-11 |
| GB1388265A (en) | 1975-03-26 |
| CH571006A5 (enFirst) | 1975-12-31 |
| PL90110B1 (enFirst) | 1977-01-31 |
| DE2211763C2 (de) | 1981-10-08 |
| FR2129579A5 (enFirst) | 1972-10-27 |
| DK137190C (enFirst) | 1978-07-03 |
| CS193013B2 (en) | 1979-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK138419B (da) | Fremgangsmåde til fremstilling af 1alfa-hydroxycholecalciferol. | |
| DK132496B (da) | Analogifremgangsmåde til fremstilling af usymmetriske 1,4-dihydropyridincarboxylsyreestere. | |
| DK134316B (da) | Fremgangsmåde til fremstilling af methylsubstituerede cuinoner. | |
| DK133828B (da) | Fremgangsmåde til fremstilling af zeaxanthin. | |
| DK129987B (da) | Analogifremgangsmåde til fremstilling af guanidiner. | |
| DK127119B (da) | Analogifremgangsmåde til fremstilling af 6-amino-9-benzylpurin-forbindelser. | |
| DK133470B (da) | Fremgangsmåde til fremstilling af 3alfa-hydroxy-5alfa-steroider. | |
| DK140842B (da) | Fremgangsmåde til fremstilling af 8,9-didebydro-10alfa-alkoxy-ergolener. | |
| DK130212B (da) | Analogifremgangsmåde til fremstilling af 7-aminoindazolderivater. | |
| DK138229B (da) | Fremgangsmåde til fremstilling af (+)(-)-eburnamonin. | |
| DK132221B (da) | Fremgangsmåde til fremstilling af 2,4-diamino-5-benzylpyrimider. | |
| DK129794B (da) | Analogifremgangsmåde til fremstilling af N-acyl-3-(piperazinoethyl)-pyrazoler. | |
| DK131296B (da) | Analogifremgangsmåde til fremstilling af 3alfa-hydroxy-19-nor-5alfa-pregnan-11,20-dion. | |
| DK133464B (da) | Analogifremgangsmåde til fremstilling af nitrosourinstofderivater. | |
| DK130987B (da) | Analogifremgangsmåde til fremstilling af 15alfa,16alfa-methylen-4-androsten-3-oner. | |
| DK126780B (da) | Fremgangsmåde til fremstilling af flavon-7-oxyacetater. | |
| DK140896B (da) | Fremgangsmåde til fremstilling af en 7-D-alfa-aminoacetamidocephalosporin-4-carboxylsyre. | |
| DK137190B (da) | Fremgangsmåde til fremstilling af 6beta-amino-2,2-dimetylpenam-3alfa-karboxylsyre. | |
| DK130308B (da) | Fremgangsmåde til fremstilling af 13β-alkylgona-4,9,11-triener. | |
| DK140942B (da) | Fremgangsmåde til fremstilling af 7-aminocephalosporansyre. | |
| DK139871B (da) | Analogifremgangsmåde til fremstilling af 3-isonicotinoyl-benzofuranderivater. | |
| DK137928B (da) | Fremgangsmåde til fremstilling af 5alfa-hydroxygona-9,11-diener. | |
| DK134012B (da) | Fremgangsmåde til fremstilling af thioformamid. | |
| DK125788B (da) | Fremgangsmåde til fremstilling af p-nitrophenoler. | |
| DK132223B (da) | Analogifremgangsmåde til fremstilling af benzesulfonamidopyrimidiner. |