DK137045B - Analogifremgangsmåde til fremstilling af 6-(alfa-aminophenylacetamido)penicillansyre-oxofurylestere eller syreadditionssalte deraf. - Google Patents
Analogifremgangsmåde til fremstilling af 6-(alfa-aminophenylacetamido)penicillansyre-oxofurylestere eller syreadditionssalte deraf.Info
- Publication number
- DK137045B DK137045B DK275772AA DK275772A DK137045B DK 137045 B DK137045 B DK 137045B DK 275772A A DK275772A A DK 275772AA DK 275772 A DK275772 A DK 275772A DK 137045 B DK137045 B DK 137045B
- Authority
- DK
- Denmark
- Prior art keywords
- oxofuryl
- aminophenylacetamido
- alpha
- esters
- preparation
- Prior art date
Links
- 239000002253 acid Substances 0.000 title 1
- -1 alpha-aminophenylacetamido Chemical group 0.000 title 1
- 150000002148 esters Chemical class 0.000 title 1
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical compound OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3948371A JPS538715B1 (esLanguage) | 1971-06-05 | 1971-06-05 | |
| JP46042197A JPS5129157B1 (esLanguage) | 1971-06-15 | 1971-06-15 | |
| JP4651071A JPS5441597B1 (esLanguage) | 1971-06-25 | 1971-06-25 | |
| JP5996971A JPS4826793A (esLanguage) | 1971-08-10 | 1971-08-10 | |
| JP2512172A JPS5414115B2 (esLanguage) | 1972-03-11 | 1972-03-11 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK137045B true DK137045B (da) | 1978-01-09 |
| DK137045C DK137045C (esLanguage) | 1979-08-06 |
Family
ID=27520689
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK275772AA DK137045B (da) | 1971-06-05 | 1972-06-02 | Analogifremgangsmåde til fremstilling af 6-(alfa-aminophenylacetamido)penicillansyre-oxofurylestere eller syreadditionssalte deraf. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3951954A (esLanguage) |
| AT (1) | AT318141B (esLanguage) |
| BE (1) | BE784235A (esLanguage) |
| DE (1) | DE2225149C2 (esLanguage) |
| DK (1) | DK137045B (esLanguage) |
| FI (1) | FI55204C (esLanguage) |
| FR (1) | FR2140420A1 (esLanguage) |
| GB (1) | GB1377661A (esLanguage) |
| NO (1) | NO137999C (esLanguage) |
| SE (1) | SE417318B (esLanguage) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1364672A (en) * | 1971-06-09 | 1974-08-29 | Beecham Group Ltd | Penicillins |
| GB1459999A (en) * | 1972-12-27 | 1976-12-31 | Novo Industri As | Penicillin and cephalosporin intermediates |
| US4092476A (en) * | 1974-02-21 | 1978-05-30 | Beecham Group Limited | Phthalidyl esters of 7-[(α amino, 2 substituted acetamido)-3-(heterocyclic-thio methyl)]cephalosporins |
| GB1544404A (en) * | 1975-02-22 | 1979-04-19 | Beecham Group Ltd | Process for preparing esters of 7-amino-cephalosporanic acid derivatives |
| US4206218A (en) * | 1978-08-31 | 1980-06-03 | E. R. Squibb & Sons, Inc. | Phthalidyl esters of the acetone adduct of epicillin |
| US4340539A (en) * | 1980-01-21 | 1982-07-20 | Bristol-Myers Company | Derivatives of 6-bromo penicillanic acid |
| CA1212105A (en) * | 1980-04-30 | 1986-09-30 | Shoji Ikeda | Ampicillin esters and production thereof |
| US4675186A (en) | 1985-04-18 | 1987-06-23 | Pfizer Inc. | 6-(1-acyl-1-hydroxymethyl)penicillanic acid derivatives |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2985648A (en) * | 1958-10-06 | 1961-05-23 | Doyle Frank Peter | Alpha-aminobenzylpenicillins |
| US3697507A (en) * | 1968-09-26 | 1972-10-10 | Leo Pharm Prod Ltd | Esters of {60 -aminobenzylpenicillin |
| GB1234426A (esLanguage) * | 1968-10-23 | 1971-06-03 | ||
| AT303960B (de) * | 1969-06-16 | 1972-11-15 | Yamanouchi Pharma Co Ltd | Verfahren zur herstellung von alpha-aminobenzylpenicillin |
| BE754141A (fr) * | 1969-08-04 | 1971-02-01 | Pfizer | Esters d'alpha-carboxyarylmethyl penicillines |
| GB1364672A (en) * | 1971-06-09 | 1974-08-29 | Beecham Group Ltd | Penicillins |
-
1972
- 1972-05-17 GB GB2326372A patent/GB1377661A/en not_active Expired
- 1972-05-24 DE DE2225149A patent/DE2225149C2/de not_active Expired
- 1972-05-31 AT AT04712/72A patent/AT318141B/de not_active IP Right Cessation
- 1972-05-31 BE BE784235A patent/BE784235A/xx not_active IP Right Cessation
- 1972-06-02 FR FR7219846A patent/FR2140420A1/fr active Granted
- 1972-06-02 NO NO1970/72A patent/NO137999C/no unknown
- 1972-06-02 SE SE7207259A patent/SE417318B/xx unknown
- 1972-06-02 DK DK275772AA patent/DK137045B/da not_active IP Right Cessation
- 1972-06-02 FI FI1557/72A patent/FI55204C/fi active
-
1975
- 1975-02-18 US US05/550,457 patent/US3951954A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2140420A1 (en) | 1973-01-19 |
| FR2140420B1 (esLanguage) | 1976-04-16 |
| FI55204C (fi) | 1979-06-11 |
| AT318141B (de) | 1974-09-25 |
| GB1377661A (en) | 1974-12-18 |
| FI55204B (fi) | 1979-02-28 |
| DK137045C (esLanguage) | 1979-08-06 |
| DE2225149A1 (de) | 1972-12-14 |
| US3951954A (en) | 1976-04-20 |
| NO137999B (no) | 1978-02-27 |
| DE2225149C2 (de) | 1981-12-03 |
| BE784235A (fr) | 1972-09-18 |
| NO137999C (no) | 1978-06-07 |
| SE417318B (sv) | 1981-03-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK140597B (da) | Analogifremgangsmåde til fremstilling af phthalidester af 6-(D(-) alfa-aminophenylacetamido) penicillansyre eller syreadditionssalte deraf. | |
| DK134984B (da) | Analogifremgangsmåde til fremstilling af alfa-alkylaminopropiophenoner eller syreadditionssalte heraf. | |
| DK129446B (da) | Analogifremgangsmåde til fremstilling af fenoxyhydroxypropylaminer eller syreadditionssalte heraf. | |
| DK128731B (da) | Analogifremgangsmåde til fremstilling af α-phenoxysubstituerede aliphatiske carboxylsyrederivater eller salte deraf. | |
| DK138496B (da) | Analogifremgangsmåde til fremstilling af imidazolinderivater eller syreadditionssalte deraf. | |
| DK139717B (da) | Analogifremgangsmåde til fremstilling af beta-aryl-2-aminoalkoxystyroler eller syreadditionssalte heraf. | |
| DK131858B (da) | Analogifremgangsmåde til fremstilling af 4-amino-6-arylpyrimidin-forbindelser eller syreadditionssalte deraf. | |
| DK131287B (da) | Analogifremgangsmåde til fremstilling af 2-phenylimino-imidazolidiner eller syreadditionssalte deraf. | |
| DK136526B (da) | Analogifremgangsmåde til fremstilling af substituerede naphthylalkylaminer eller syreadditionssalte deraf. | |
| DK129577B (da) | Analogifremgangsmåde til fremstilling af phenacetylguanidiner eller syreadditionssalte deraf. | |
| DK140545B (da) | Analogifremgangsmåde til fremstilling af benzoylphenylsmørsyrederivater eller salte deraf. | |
| DK137045B (da) | Analogifremgangsmåde til fremstilling af 6-(alfa-aminophenylacetamido)penicillansyre-oxofurylestere eller syreadditionssalte deraf. | |
| DK128562B (da) | Fremgangsmåde til fremstilling af basiske estere af 3-methylflavon-8-carboxylsyre eller syreadditionssalte af disse estere. | |
| DK129513B (da) | Analogifremgangsmåde til fremstilling af basisk substituerede alkylidenaminooxyalkylcarboxylsyreestere eller syreadditionssalte deraf. | |
| DK131778B (da) | Fremgangsmåde til fremstilling af substituerede 3-hydroksymetylisokinolinderivater eller syreadditionssalte heraf. | |
| DK132434B (da) | Analogifremgangsmåde til fremstilling af derivater af 6-aminopenicillansyre. | |
| DK129240B (da) | Analogifremgangsmåde til fremstilling af 1-imidazolyl-methanphosphonsyreestere eller salte deraf. | |
| DK137757B (da) | Analogifremgangsmåde til fremstilling af pyridylpiperaziner eller syreadditionssalte deraf. | |
| DK131857B (da) | Analogifremgangsmåde til fremstilling af 4-hydroxymethyl-1-phthalazonderivater eller syreadditionssalte deraf. | |
| DK129454B (da) | Analogifremgangsmåde til fremstilling af ergonorcornin eller syreadditionssalte deraf. | |
| DK129164B (da) | Analogifremgangsmåde til fremstilling af 3-alkyl-5-aryloxymethylisoxazoler eller syreadditionssalte deraf. | |
| DK133871B (da) | Fremgangsmåde til fremstilling af trans-chrysanthemsyre eller alkylestere deraf. | |
| DK137863B (da) | Fremgangsmåde til fremstilling af antibiotikum A-4696 eller syreadditionssalte deraf. | |
| DK131727B (da) | Analogifremgangsmåde til fremstilling af oxazinobenzoxaziner eller syreadditionssalte deraf. | |
| DK134023B (da) | Analogifremgangsmåde til fremstilling af acyloxypiperazinylforbindelser eller syreadditionssalte deraf. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |