DK136366C - Analogifremgangsmade til fremstilling af 2-(2-tienyltio)-alkanohydroksamsyrer - Google Patents
Analogifremgangsmade til fremstilling af 2-(2-tienyltio)-alkanohydroksamsyrerInfo
- Publication number
- DK136366C DK136366C DK224175A DK224175A DK136366C DK 136366 C DK136366 C DK 136366C DK 224175 A DK224175 A DK 224175A DK 224175 A DK224175 A DK 224175A DK 136366 C DK136366 C DK 136366C
- Authority
- DK
- Denmark
- Prior art keywords
- tienyltio
- alkanoh
- preparation
- hydroxamic acids
- analogical procedure
- Prior art date
Links
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical class C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/34—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK255876A DK255876A (da) | 1974-05-21 | 1976-06-09 | Analogifremgangsmade til fremstilling af tiofenderivater |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2424742A DE2424742C3 (de) | 1974-05-21 | 1974-05-21 | Thiophenderivate Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK224175A DK224175A (da) | 1975-11-22 |
| DK136366B DK136366B (da) | 1977-10-03 |
| DK136366C true DK136366C (da) | 1978-02-27 |
Family
ID=5916183
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK224175A DK136366C (da) | 1974-05-21 | 1975-05-21 | Analogifremgangsmade til fremstilling af 2-(2-tienyltio)-alkanohydroksamsyrer |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4031236A (enExample) |
| JP (1) | JPS50160267A (enExample) |
| AT (1) | ATA385775A (enExample) |
| AU (1) | AU8138475A (enExample) |
| BE (1) | BE829307A (enExample) |
| DD (1) | DD121111A5 (enExample) |
| DE (1) | DE2424742C3 (enExample) |
| DK (1) | DK136366C (enExample) |
| ES (1) | ES437803A1 (enExample) |
| FI (1) | FI751474A7 (enExample) |
| FR (1) | FR2271816A1 (enExample) |
| GB (1) | GB1512236A (enExample) |
| IL (1) | IL47291A0 (enExample) |
| NL (1) | NL7505571A (enExample) |
| NO (1) | NO751779L (enExample) |
| SE (1) | SE7505711L (enExample) |
| ZA (1) | ZA753296B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2464953A1 (fr) * | 1979-09-06 | 1981-03-20 | Sanofi Sa | Derives d'a-(thienyl-2 thio) phenylacetamides, leur procede de preparation et leur application therapeutique |
| GR78697B (enExample) * | 1982-10-21 | 1984-09-27 | Lilly Industries Ltd | |
| US4885355A (en) * | 1982-12-09 | 1989-12-05 | The Dow Chemical Company | Water-insoluble polymers from cyclic sulfonium compounds |
| GB8725260D0 (en) * | 1987-10-28 | 1987-12-02 | Lilly Industries Ltd | Organic compounds |
| EE04295B1 (et) * | 1997-02-27 | 2004-06-15 | American Cyanamid Company | N-hüdroksü-2-(alküül-, arüül- või heteroarüülsulfanüül-, -sulfinüül- või-sulfonüül-)-3-asendatud-alküülamiidid, -arüülamiidid või -heteroarüülamiididkui maatriksmetalloproteinaasi inhibiitorid |
| US6172057B1 (en) | 1997-02-27 | 2001-01-09 | American Cyanamid Company | N-Hydroxy-2-(alkyl, aryl, or heteroaryl sulfanyl, sulfinyl or sulfonyl)-3-substituted alkyl, aryl or heteroarylamides as matrix metalloproteinase inhibitors |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2581626A (en) * | 1948-10-06 | 1952-01-08 | Socony Vacuum Oil Co Inc | Thienylthio carboxylic acids and thienylthio carboxylic acid esters in lubricating compositions |
| US3560525A (en) * | 1967-10-13 | 1971-02-02 | Parke Davis & Co | 5-phenyl-2-furanacetic acids,5-phenyl-2-thiopheneacetic acids,and their derivatives |
-
1974
- 1974-05-21 DE DE2424742A patent/DE2424742C3/de not_active Expired
-
1975
- 1975-05-13 NL NL7505571A patent/NL7505571A/xx unknown
- 1975-05-14 IL IL47291A patent/IL47291A0/xx unknown
- 1975-05-20 FI FI751474A patent/FI751474A7/fi not_active Application Discontinuation
- 1975-05-20 US US05/579,258 patent/US4031236A/en not_active Expired - Lifetime
- 1975-05-20 NO NO751779A patent/NO751779L/no unknown
- 1975-05-20 DD DD186142A patent/DD121111A5/xx unknown
- 1975-05-20 ES ES437803A patent/ES437803A1/es not_active Expired
- 1975-05-20 SE SE7505711A patent/SE7505711L/xx unknown
- 1975-05-21 JP JP50060837A patent/JPS50160267A/ja active Pending
- 1975-05-21 FR FR7515772A patent/FR2271816A1/fr not_active Withdrawn
- 1975-05-21 BE BE156549A patent/BE829307A/xx unknown
- 1975-05-21 AU AU81384/75A patent/AU8138475A/en not_active Expired
- 1975-05-21 AT AT753857A patent/ATA385775A/de not_active IP Right Cessation
- 1975-05-21 DK DK224175A patent/DK136366C/da active
- 1975-05-21 ZA ZA00753296A patent/ZA753296B/xx unknown
- 1975-05-21 GB GB21972/75A patent/GB1512236A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES437803A1 (es) | 1977-01-01 |
| NO751779L (enExample) | 1975-11-24 |
| FI751474A7 (enExample) | 1975-11-22 |
| DD121111A5 (enExample) | 1976-07-12 |
| ZA753296B (en) | 1976-04-28 |
| DK136366B (da) | 1977-10-03 |
| JPS50160267A (enExample) | 1975-12-25 |
| FR2271816A1 (enExample) | 1975-12-19 |
| AU8138475A (en) | 1976-11-25 |
| DE2424742A1 (de) | 1975-12-04 |
| ATA385775A (de) | 1978-03-15 |
| US4031236A (en) | 1977-06-21 |
| DK224175A (da) | 1975-11-22 |
| DE2424742C3 (de) | 1982-04-22 |
| SE7505711L (sv) | 1975-11-24 |
| BE829307A (fr) | 1975-11-21 |
| IL47291A0 (en) | 1975-07-28 |
| DE2424742B2 (de) | 1981-02-19 |
| NL7505571A (nl) | 1975-11-25 |
| GB1512236A (en) | 1978-05-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK139965B (da) | Analogifremgangsmaade til fremstilling af 4-(j-metoksy-fenyl)-2-pyrrolidoner | |
| DK137082B (da) | Analogifremgangsmade til fremstilling af 3-aminoidazolcarboxylsyrederivater | |
| DK134282C (da) | Analogifremgangsmade til fremstilling af substituerede phenylguanidiner | |
| DK136369C (da) | Analogifremgangsmade til fremstilling af 18-methyl-19-nor-20-ketopregnaner | |
| DK573475A (da) | Fremgangsmade til fremstilling af substituerede phenyleddikesyrer | |
| DK163075A (da) | Fremgangsmade til fremstilling af aryloxoheptansyrer | |
| DK139724C (da) | Analogifremgangsmaade til fremstilling af pyridobenzodiazepinoner eller salte heraf | |
| DK132892C (da) | Analogifremgangsmade til fremstilling af 4-aminoquinazoliner | |
| DK135424C (da) | Analogifremgangsmade til fremstilling af arylpiperazinderivater af adenin | |
| DK135378C (da) | Analogifremgangsmade til fremstilling af 7alfa-hydroxylerede 17alfa-ethinylostradioler | |
| DK147854C (da) | Analogifremgangsmaade til fremstilling af n-(1-benzylpiperid-4-yl)-benzamider | |
| DK136155C (da) | Analogifremgangsmade til fremstilling af pyrazoloner-(5) | |
| DK136366C (da) | Analogifremgangsmade til fremstilling af 2-(2-tienyltio)-alkanohydroksamsyrer | |
| DK137533C (da) | Analogifremgangsmaade til fremstilling af 2-carbalkoxyaminobenzimidazolyl-5(6)-sulfonsyrephenylestere | |
| DK136188C (da) | Analogifremgangsmade til fremstilling af 2-carbalkoxyamino-5(6)-phenylsulfonyloxy-benzimidazoler | |
| DK140011C (da) | Fremgangsmaade til fremstilling af 5-sulfamoylantranilsyrer | |
| DK137185C (da) | Analogifremgangsmaade til fremstilling af tiofenderivater | |
| DK519975A (da) | Fremgangsmade til fremstilling af 6', 2-(2'-arylkromonyl)-propionsyrer | |
| DK139138C (da) | Analogifremgangsmaade til fremstilling af 1-aryluraciler | |
| DK557175A (da) | Fremgangsmade til fremstilling af salte af n-substituerede carbamidsyrer | |
| DK142578A (da) | Analogifremgangsmaade til fremstilling af 4-benzazininderivater | |
| DK138500C (da) | Analogifremgangsmaade til fremstilling af 6alfa-fluor-21-hydroxy-16alfa-methyl-1,4,8-pregnatrien-3,20-dioner | |
| DK133303C (da) | Analogifremgangsmade til fremstilling af digitoxinorthoformiater | |
| DK136954C (da) | Analogifremgangsmaade til fremstilling af 3-alkoxycarbonylhydrazino-6-halogen-indazoler | |
| DK390875A (da) | Fremgangsmade til fremstilling af alfa-(2-(p-chlorphenoxy)-isobutyryl)-beta-nicotinoylglycolester |