DK135502B - Analogifremgangsmåde til fremstilling af 2-((1-benzylcyclopentyl)-imino)-pyrrolidin eller dens farmaceutisk acceptable syreadditionssalte - Google Patents
Analogifremgangsmåde til fremstilling af 2-((1-benzylcyclopentyl)-imino)-pyrrolidin eller dens farmaceutisk acceptable syreadditionssalteInfo
- Publication number
- DK135502B DK135502B DK442373AA DK442373A DK135502B DK 135502 B DK135502 B DK 135502B DK 442373A A DK442373A A DK 442373AA DK 442373 A DK442373 A DK 442373A DK 135502 B DK135502 B DK 135502B
- Authority
- DK
- Denmark
- Prior art keywords
- benzylcyclopentyl
- imino
- pyrrolidine
- preparation
- pharmaceutically acceptable
- Prior art date
Links
- 239000002253 acid Substances 0.000 title 1
- ZGGSCVUIKNQWHQ-UHFFFAOYSA-N n-(1-benzylcyclopentyl)-3,4-dihydro-2h-pyrrol-5-amine Chemical compound C1CCCC1(N=C1NCCC1)CC1=CC=CC=C1 ZGGSCVUIKNQWHQ-UHFFFAOYSA-N 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00280048A US3803170A (en) | 1972-08-11 | 1972-08-11 | 2-((1-benzylcyclopentyl)imino)pyrrolidine |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK135502B true DK135502B (da) | 1977-05-09 |
| DK135502C DK135502C (index.php) | 1977-10-17 |
Family
ID=23071419
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK442373AA DK135502B (da) | 1972-08-11 | 1973-08-10 | Analogifremgangsmåde til fremstilling af 2-((1-benzylcyclopentyl)-imino)-pyrrolidin eller dens farmaceutisk acceptable syreadditionssalte |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3803170A (index.php) |
| JP (1) | JPS4945064A (index.php) |
| BE (1) | BE803483A (index.php) |
| CA (1) | CA976973A (index.php) |
| CH (1) | CH588461A5 (index.php) |
| DE (1) | DE2324633A1 (index.php) |
| DK (1) | DK135502B (index.php) |
| FR (1) | FR2195445B1 (index.php) |
| GB (1) | GB1367597A (index.php) |
| IL (1) | IL42201A (index.php) |
| NL (1) | NL7308928A (index.php) |
| ZA (1) | ZA732922B (index.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ183570A (en) * | 1976-03-19 | 1979-06-08 | Mcneilab Inc | Heterocyclic guanidine derivatives, having anti-secretory and hypogliycaemic activity |
| US5010072A (en) * | 1988-06-28 | 1991-04-23 | Merrell Dow Pharmaceuticals Inc. | Lactamimides as calcium antagonists |
| US5082837A (en) * | 1988-06-28 | 1992-01-21 | Merrell Dow Pharmaceuticals | Lactamimides as calcium antagonists |
| US5198433A (en) * | 1988-06-28 | 1993-03-30 | Merrell Dow Pharmaceuticals Inc. | Lactamimides as calcium antagonists |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB913932A (en) * | 1958-03-03 | 1962-12-28 | Rohm & Haas | Iminopyrrolidines |
-
1972
- 1972-08-11 US US00280048A patent/US3803170A/en not_active Expired - Lifetime
-
1973
- 1973-04-30 ZA ZA732922A patent/ZA732922B/xx unknown
- 1973-04-30 GB GB2046073A patent/GB1367597A/en not_active Expired
- 1973-05-04 IL IL42201A patent/IL42201A/en unknown
- 1973-05-08 CA CA170,699A patent/CA976973A/en not_active Expired
- 1973-05-16 DE DE2324633A patent/DE2324633A1/de active Pending
- 1973-05-17 JP JP48054180A patent/JPS4945064A/ja active Pending
- 1973-06-27 NL NL7308928A patent/NL7308928A/xx not_active Application Discontinuation
- 1973-07-25 CH CH1086073A patent/CH588461A5/xx not_active IP Right Cessation
- 1973-08-09 FR FR7329216A patent/FR2195445B1/fr not_active Expired
- 1973-08-10 BE BE134467A patent/BE803483A/xx unknown
- 1973-08-10 DK DK442373AA patent/DK135502B/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1367597A (en) | 1974-09-18 |
| DE2324633A1 (de) | 1974-02-28 |
| AU5593373A (en) | 1974-11-21 |
| JPS4945064A (index.php) | 1974-04-27 |
| ZA732922B (en) | 1974-04-24 |
| BE803483A (fr) | 1973-12-03 |
| IL42201A0 (en) | 1973-07-30 |
| IL42201A (en) | 1976-02-29 |
| CH588461A5 (index.php) | 1977-06-15 |
| CA976973A (en) | 1975-10-28 |
| US3803170A (en) | 1974-04-09 |
| FR2195445B1 (index.php) | 1976-10-22 |
| NL7308928A (index.php) | 1974-02-13 |
| DK135502C (index.php) | 1977-10-17 |
| FR2195445A1 (index.php) | 1974-03-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK138076B (da) | Analogifremgangsmåde til fremstilling af indolderivater eller syreadditionssalte deraf. | |
| DK136714B (da) | Analogifremgangsmåde til fremstilling af substituerede piperidinderivater eller syreadditionssalte deraf. | |
| DK132119B (da) | Analogifremgangsmåde til fremstilling af cephalosporansyrederivater eller farmaceutisk acceptable salte deraf. | |
| DK138496B (da) | Analogifremgangsmåde til fremstilling af imidazolinderivater eller syreadditionssalte deraf. | |
| DK138324B (da) | Analogifremgangsmåde til fremstilling af piperazinsubstituerede isoindolinderivater eller syreadditionssalte deraf. | |
| DK133899B (da) | Analogifremgangsmåde til fremstilling af benzofuranderivater eller farmaceutisk acceptable syreadditionssalte deraf. | |
| DK125021B (da) | Analogifremgangsmåde til fremstilling af 1,2,3,4-tetrahydro-4-phenyl-isoquinolinderivater eller syreadditionssalte deraf eller de tilsvarende optisk aktive forbindelser. | |
| AR197345A1 (es) | Procedimiento de preparacion de acido <1-(p-clorobenzoil)-5-metoxi-2-metil-3-indol> acetoxiacetico | |
| DK136713B (da) | Analogifremgangsmåde til fremstilling af alfa-aryl-4-substituerede piperidinoalkanolderivater eller deres syreadditionssalte. | |
| DK139575B (da) | Analogifremgangsmåde til fremstilling af 2-aminomethylen-1-indanon-forbindelser eller syreadditionssalte deraf. | |
| DK135502B (da) | Analogifremgangsmåde til fremstilling af 2-((1-benzylcyclopentyl)-imino)-pyrrolidin eller dens farmaceutisk acceptable syreadditionssalte | |
| DK138491B (da) | Analogifremgangsmåde til fremstilling af N-(1-cyclohexyl-3-pyrrolidinyl)-benzamider eller syreadditionssalte deraf. | |
| DK140833B (da) | Analogifremgangsmåde til fremstilling af phenylethylaminderivater eller syreadditionssalte deraf. | |
| DK137085B (da) | Analogifremgangsmåde til fremstilling af cycloalkyl-alkyl-estere af vincaminsyrederivater eller syreadditionssalte deraf. | |
| DK139582B (da) | Analogifremgangsmåde til fremstilling af racemiske eller optisk aktive benzocycloheptaisoquinolin-forbindelser eller syreadditionssalte deraf. | |
| DK140479B (da) | Analogifremgangsmåde til fremstilling af lumilysergolestere eller farmaceutisk acceptable additionssalte deraf med organiske syrer. | |
| DK139098B (da) | Analogifremgangsmåde til fremstilling af imidazoliner eller ikke-toxiske, farmaceutisk anvendelige syreadditionssalte deraf. | |
| DK131857B (da) | Analogifremgangsmåde til fremstilling af 4-hydroxymethyl-1-phthalazonderivater eller syreadditionssalte deraf. | |
| DK130958B (da) | Analogifremgangsmåde til fremstilling af racemiske eller optisk aktive 1-phenoxy-2-hydroxy-3-hydroxyalkylaminopropaner eller fysiologisk tålelige syreadditionssalte heraf. | |
| DK130344B (da) | Analogifremgangsmåde til fremstilling af benzofuranderivater eller syreadditionssalte deraf. | |
| DK138850B (da) | Analogifremgangsmåde til fremstilling af benzoesyrederivater eller farmaceutisk acceptable salte eller estere deraf. | |
| DK136367B (da) | Analogifremgangsmåde til fremstilling af indolderivater eller farmaceutisk acceptable syreadditionssalte deraf. | |
| DK135574B (da) | Fremgangsmåde til fremstilling af benzylaminderivater eller fysiologisk anvendelige syreadditionssalte heraf. | |
| DK123102B (da) | Analogifremgangsmåde til fremstilling af racemiske eller optisk aktive benzo[b]thiopheneddikesyreforbindelser eller carboxylatsalte deraf. | |
| DK124023B (da) | Analogifremgangsmåde til fremstilling af allenpolyaminer eller farmaceutisk acceptable syreadditionssalte deraf. |