CA976973A - Pyrrolidine derivative - Google Patents
Pyrrolidine derivativeInfo
- Publication number
- CA976973A CA976973A CA170,699A CA170699A CA976973A CA 976973 A CA976973 A CA 976973A CA 170699 A CA170699 A CA 170699A CA 976973 A CA976973 A CA 976973A
- Authority
- CA
- Canada
- Prior art keywords
- pyrrolidine derivative
- pyrrolidine
- derivative
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- FKCMADOPPWWGNZ-YUMQZZPRSA-N [(2r)-1-[(2s)-2-amino-3-methylbutanoyl]pyrrolidin-2-yl]boronic acid Chemical compound CC(C)[C@H](N)C(=O)N1CCC[C@H]1B(O)O FKCMADOPPWWGNZ-YUMQZZPRSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00280048A US3803170A (en) | 1972-08-11 | 1972-08-11 | 2-((1-benzylcyclopentyl)imino)pyrrolidine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA976973A true CA976973A (en) | 1975-10-28 |
Family
ID=23071419
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA170,699A Expired CA976973A (en) | 1972-08-11 | 1973-05-08 | Pyrrolidine derivative |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3803170A (index.php) |
| JP (1) | JPS4945064A (index.php) |
| BE (1) | BE803483A (index.php) |
| CA (1) | CA976973A (index.php) |
| CH (1) | CH588461A5 (index.php) |
| DE (1) | DE2324633A1 (index.php) |
| DK (1) | DK135502B (index.php) |
| FR (1) | FR2195445B1 (index.php) |
| GB (1) | GB1367597A (index.php) |
| IL (1) | IL42201A (index.php) |
| NL (1) | NL7308928A (index.php) |
| ZA (1) | ZA732922B (index.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ183570A (en) * | 1976-03-19 | 1979-06-08 | Mcneilab Inc | Heterocyclic guanidine derivatives, having anti-secretory and hypogliycaemic activity |
| US5010072A (en) * | 1988-06-28 | 1991-04-23 | Merrell Dow Pharmaceuticals Inc. | Lactamimides as calcium antagonists |
| US5082837A (en) * | 1988-06-28 | 1992-01-21 | Merrell Dow Pharmaceuticals | Lactamimides as calcium antagonists |
| US5198433A (en) * | 1988-06-28 | 1993-03-30 | Merrell Dow Pharmaceuticals Inc. | Lactamimides as calcium antagonists |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB913932A (en) * | 1958-03-03 | 1962-12-28 | Rohm & Haas | Iminopyrrolidines |
-
1972
- 1972-08-11 US US00280048A patent/US3803170A/en not_active Expired - Lifetime
-
1973
- 1973-04-30 ZA ZA732922A patent/ZA732922B/xx unknown
- 1973-04-30 GB GB2046073A patent/GB1367597A/en not_active Expired
- 1973-05-04 IL IL42201A patent/IL42201A/en unknown
- 1973-05-08 CA CA170,699A patent/CA976973A/en not_active Expired
- 1973-05-16 DE DE2324633A patent/DE2324633A1/de active Pending
- 1973-05-17 JP JP48054180A patent/JPS4945064A/ja active Pending
- 1973-06-27 NL NL7308928A patent/NL7308928A/xx not_active Application Discontinuation
- 1973-07-25 CH CH1086073A patent/CH588461A5/xx not_active IP Right Cessation
- 1973-08-09 FR FR7329216A patent/FR2195445B1/fr not_active Expired
- 1973-08-10 BE BE134467A patent/BE803483A/xx unknown
- 1973-08-10 DK DK442373AA patent/DK135502B/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1367597A (en) | 1974-09-18 |
| DE2324633A1 (de) | 1974-02-28 |
| AU5593373A (en) | 1974-11-21 |
| JPS4945064A (index.php) | 1974-04-27 |
| ZA732922B (en) | 1974-04-24 |
| BE803483A (fr) | 1973-12-03 |
| IL42201A0 (en) | 1973-07-30 |
| IL42201A (en) | 1976-02-29 |
| CH588461A5 (index.php) | 1977-06-15 |
| US3803170A (en) | 1974-04-09 |
| FR2195445B1 (index.php) | 1976-10-22 |
| NL7308928A (index.php) | 1974-02-13 |
| DK135502C (index.php) | 1977-10-17 |
| DK135502B (da) | 1977-05-09 |
| FR2195445A1 (index.php) | 1974-03-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1003417A (en) | Piperidine derivatives | |
| AU464154B2 (en) | 1-aroylalkyl-4-diphenylmethyl piperidines | |
| AU467361B2 (en) | Q-aryl-4-substituted piperidinoalkanol derivatives | |
| AU472196B2 (en) | Eee-hive frame | |
| CA1019738A (en) | Isothiocyanopyridine derivatives | |
| AU470719B2 (en) | Oxazinoindole-and thiazinoinindole derivatives | |
| AU467405B2 (en) | Diphenylalkyllactamimide derivatives | |
| CA1020946A (en) | 1-phenoxy-3-phenoxyethylamino-2-propanol derivatives | |
| CA976973A (en) | Pyrrolidine derivative | |
| AU470763B2 (en) | Pyrano-and thiopyranoindole derivatives | |
| CA1006514A (en) | Beta-aminoketone derivatives | |
| CA1018161A (en) | Indan-1-carboxamide derivatives | |
| CA978526A (en) | Pyrano- and thiopyranoindole derivatives | |
| CA996939A (en) | Cycloalkanoyl-substituted pyrroles | |
| CA981684A (en) | Cyclopenteno-quinolone derivatives | |
| CA993864A (en) | Angiotensin ii derivative | |
| CA891497A (en) | Piperidine derivatives | |
| CA899353A (en) | 1-hydroxyproline derivatives | |
| CA901015A (en) | Benzophenonimine derivatives | |
| CA898253A (en) | Styryl-naphthalene derivatives | |
| AU477427B2 (en) | 2-fluoro-substituted thiazanthene derivatives | |
| CA896560A (en) | 6-phenyl-dihydropyridazine-3-one derivatives | |
| CA891502A (en) | Benhydrylquinuclidinol derivatives | |
| CA899886A (en) | Oxotremarine derivatives | |
| CA892056A (en) | Sulphonamidopyrazolinone derivatives |