DK134076A - Fremgangsmade til fremstilling af chrysantheminsyreestere - Google Patents
Fremgangsmade til fremstilling af chrysantheminsyreestereInfo
- Publication number
- DK134076A DK134076A DK134076A DK134076A DK134076A DK 134076 A DK134076 A DK 134076A DK 134076 A DK134076 A DK 134076A DK 134076 A DK134076 A DK 134076A DK 134076 A DK134076 A DK 134076A
- Authority
- DK
- Denmark
- Prior art keywords
- residers
- procedure
- preparation
- chrysanthemic acid
- chrysanthemic
- Prior art date
Links
- XLOPRKKSAJMMEW-SFYZADRCSA-N Chrysanthemic acid Natural products CC(C)=C[C@@H]1[C@@H](C(O)=O)C1(C)C XLOPRKKSAJMMEW-SFYZADRCSA-N 0.000 title 1
- XLOPRKKSAJMMEW-UHFFFAOYSA-N chrysanthemic acid Chemical compound CC(C)=CC1C(C(O)=O)C1(C)C XLOPRKKSAJMMEW-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/74—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring
- C07C69/743—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring of acids with a three-membered ring and with unsaturation outside the ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE155168A BE827651A (fr) | 1975-04-07 | 1975-04-07 | Nouveau procede de preparation d'esters d'acide chrysanthemique |
| BE155168 | 1975-04-07 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK134076A true DK134076A (da) | 1976-10-08 |
| DK157749B DK157749B (da) | 1990-02-12 |
| DK157749C DK157749C (da) | 1990-07-16 |
Family
ID=3842756
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK134076A DK157749C (da) | 1975-04-07 | 1976-03-26 | Fremgangsmaade til fremstilling af chrysantheminsyreestere |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4048215A (da) |
| BE (1) | BE827651A (da) |
| CA (1) | CA1038880A (da) |
| CH (1) | CH609026A5 (da) |
| DE (1) | DE2615159C2 (da) |
| DK (1) | DK157749C (da) |
| FR (1) | FR2306969A1 (da) |
| GB (1) | GB1502569A (da) |
| IE (1) | IE43461B1 (da) |
| IT (1) | IT1065990B (da) |
| NL (1) | NL187627C (da) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE827651A (fr) * | 1975-04-07 | 1975-10-07 | Nouveau procede de preparation d'esters d'acide chrysanthemique | |
| DE2800922A1 (de) | 1978-01-10 | 1979-07-19 | Bayer Ag | Verfahren zur trennung stereoisomerer vinylcyclopropancarbonsaeuren |
| FR2428023A1 (fr) * | 1978-06-06 | 1980-01-04 | Roussel Uclaf | Procede de preparation d'esters d'acides cyclopropane carboxyliques racemiques de structure trans |
| US4252739A (en) * | 1979-08-20 | 1981-02-24 | Emery Industries, Inc. | Process for the preparation of vinylcyclopropane derivatives |
| US4898968A (en) * | 1984-03-26 | 1990-02-06 | Imperial Chemical Industries Plc | Cyclopropane derivatives |
| JP4770213B2 (ja) * | 2004-03-22 | 2011-09-14 | 住友化学株式会社 | (2−ホルミル−1−アルケニル)シクロプロパン化合物の製造方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL32569A (en) * | 1968-07-12 | 1976-06-30 | Roussel Uclaf | Process for the preparation of dimethyl cyclopropane carboxylic acid derivatives and some products resulting therefrom |
| FR2067854A5 (en) * | 1969-11-19 | 1971-08-20 | Roussel Uclaf | Subst vinyl cyclo-propane-1-carboxylic acids insecticidal prepn |
| BE827651A (fr) * | 1975-04-07 | 1975-10-07 | Nouveau procede de preparation d'esters d'acide chrysanthemique |
-
1975
- 1975-04-07 BE BE155168A patent/BE827651A/xx not_active IP Right Cessation
-
1976
- 1976-03-26 DK DK134076A patent/DK157749C/da not_active IP Right Cessation
- 1976-03-31 FR FR7609335A patent/FR2306969A1/fr active Granted
- 1976-04-05 US US05/673,458 patent/US4048215A/en not_active Expired - Lifetime
- 1976-04-05 CA CA249,574A patent/CA1038880A/fr not_active Expired
- 1976-04-06 IT IT48883/76A patent/IT1065990B/it active
- 1976-04-06 GB GB13930/76A patent/GB1502569A/en not_active Expired
- 1976-04-06 IE IE718/76A patent/IE43461B1/en unknown
- 1976-04-07 DE DE2615159A patent/DE2615159C2/de not_active Expired
- 1976-04-07 NL NLAANVRAGE7603674,A patent/NL187627C/xx not_active IP Right Cessation
- 1976-04-07 CH CH438176A patent/CH609026A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IE43461B1 (en) | 1981-03-11 |
| DE2615159C2 (de) | 1985-03-28 |
| DK157749B (da) | 1990-02-12 |
| NL7603674A (nl) | 1976-10-11 |
| IE43461L (en) | 1976-10-07 |
| IT1065990B (it) | 1985-03-04 |
| NL187627B (nl) | 1991-07-01 |
| GB1502569A (en) | 1978-03-01 |
| NL187627C (nl) | 1991-12-02 |
| FR2306969B1 (da) | 1978-11-17 |
| DE2615159A1 (de) | 1976-10-28 |
| BE827651A (fr) | 1975-10-07 |
| US4048215A (en) | 1977-09-13 |
| CA1038880A (fr) | 1978-09-19 |
| CH609026A5 (da) | 1979-02-15 |
| DK157749C (da) | 1990-07-16 |
| FR2306969A1 (fr) | 1976-11-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK424476A (da) | Fremgangsmade til fremstilling af svovlholdige organosiliciumforbindelser | |
| DK593975A (da) | Fremgangsmade til fremstilling af substituerede perhalogenalkylamidiner | |
| DK107876A (da) | Fremgangsmade til fremstilling af thiocarbamider | |
| DK470376A (da) | Fremgangsmade til fremstilling af phenoxyalcarboxylsyrer | |
| DK535476A (da) | Fremgangsmade til fremstilling af 7-methoxycephalosporiner | |
| DK150676A (da) | Fremgangsmade til fremstilling af krystallinsk natrium-o-formyl-cefamandol | |
| DK416975A (da) | Fremgangsmade til fremstilling af 5-fluor-2-methyl-1-(paramethylsulfinylbenzyliden)-indenyl-3-eddikesyre | |
| DK153176A (da) | Fremgangsmade til fremstilling af fenylpropionsyrer | |
| DK99376A (da) | Fremgangsmade til fremstilling af lavalkylimidazolcarboxylater | |
| DK55376A (da) | Fremgangsmade til fremstilling af beta-dihalogenethenylcyclopropanderivater | |
| DK134076A (da) | Fremgangsmade til fremstilling af chrysantheminsyreestere | |
| DK247976A (da) | Fremgangsmade til fremstilling af quinolin-3-carboxylsyrer | |
| DK399976A (da) | Fremgangsmade til fremstilling af aralkylamider | |
| DK415576A (da) | Fremgangsmade til fremstilling af krystallinsk dipilocarpiniumpamoat | |
| DK146277A (da) | Fremgangsmade til fremstilling af 2-chlornicotinsyre | |
| DK524977A (da) | Fremgangsmaade til fremstilling af 6-aminopencillansyre | |
| DK390976A (da) | Fremgangsmade til fremstilling af o,o-dialkylthinophosphorsyrechlorider | |
| DK143905C (da) | Analogifremgangsmaade til fremstilling af fusidinsyrederivater | |
| DK56976A (da) | Fremgangsmade til fremstilling af diacetone-2-ketogulonsyre | |
| DK251276A (da) | Fremgangsmade til fremstilling af alfa-klor-karboxylsyre | |
| DK587976A (da) | Fremgangsmade til fremstilling af syrechlorider | |
| DK141584C (da) | Fremgangsmaade til fremstilling af slagseje vinylaromat-podecopolymere | |
| DK526676A (da) | Fremgangsmade til fremstilling af 4-chlor-2-butynyl-m-chlorcarbanilat | |
| DK424676A (da) | Fremgangsmade til fremstilling af 2-alkylindan | |
| DK480676A (da) | Fremgangsmade til fremstilling af s-alkylphosphordihalogeniddithioater |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |