DK133298B - Analogifremgangsmade til fremstilling af n-(3'-tiofenylpropyl)-3,3-difenylpropylamin eller syreadditionssalte deraf - Google Patents
Analogifremgangsmade til fremstilling af n-(3'-tiofenylpropyl)-3,3-difenylpropylamin eller syreadditionssalte derafInfo
- Publication number
- DK133298B DK133298B DK352272AA DK352272A DK133298B DK 133298 B DK133298 B DK 133298B DK 352272A A DK352272A A DK 352272AA DK 352272 A DK352272 A DK 352272A DK 133298 B DK133298 B DK 133298B
- Authority
- DK
- Denmark
- Prior art keywords
- thiophenylpropyl
- diphenylpropylamine
- preparation
- additional salts
- acid additional
- Prior art date
Links
- HMMGOBDMEYGYPW-UHFFFAOYSA-N 3,3-diphenyl-N-(3-thiophen-2-ylpropyl)propan-1-amine Chemical compound S1C(=CC=C1)CCCNCCC(C1=CC=CC=C1)C1=CC=CC=C1 HMMGOBDMEYGYPW-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/31—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
- C07C323/32—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton having at least one of the nitrogen atoms bound to an acyclic carbon atom of the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT347671 | 1971-07-15 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK133298B true DK133298B (da) | 1976-04-26 |
| DK133298C DK133298C (da) | 1976-09-20 |
Family
ID=11108082
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK352272A DK133298C (da) | 1971-07-15 | 1972-07-14 | Analogifremgangsmade til fremstilling af n-(3'-tiofenylpropyl)-3,3-difenylpropylamin eller syreadditionssalte deraf |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS5224012B1 (da) |
| AR (4) | AR197088A1 (da) |
| AT (2) | AT321272B (da) |
| BE (1) | BE786147A (da) |
| BR (1) | BR7204677D0 (da) |
| CA (1) | CA1003859A (da) |
| CH (2) | CH589618A5 (da) |
| DK (1) | DK133298C (da) |
| ES (4) | ES404743A1 (da) |
| FI (1) | FI57100C (da) |
| FR (1) | FR2145639B1 (da) |
| GB (1) | GB1345319A (da) |
| MX (1) | MX3738E (da) |
| NL (1) | NL153862B (da) |
| NO (1) | NO134800C (da) |
| SE (1) | SE388607B (da) |
| ZA (1) | ZA724511B (da) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1080455B (it) * | 1977-06-17 | 1985-05-16 | Alfa Farmaceutici Spa | N 3 feniltiopropil 3.3 difenil propilammine sostituite dotate di attivita farmacologia |
-
1972
- 1972-06-29 NO NO2334/72A patent/NO134800C/no unknown
- 1972-06-30 ZA ZA724511A patent/ZA724511B/xx unknown
- 1972-07-07 FI FI1946/72A patent/FI57100C/fi active
- 1972-07-10 CH CH1314575A patent/CH589618A5/xx not_active IP Right Cessation
- 1972-07-10 CH CH1031172A patent/CH582138A5/xx not_active IP Right Cessation
- 1972-07-11 ES ES404743A patent/ES404743A1/es not_active Expired
- 1972-07-12 BE BE786147A patent/BE786147A/xx unknown
- 1972-07-12 MX MX72570U patent/MX3738E/es unknown
- 1972-07-12 FR FR7225278A patent/FR2145639B1/fr not_active Expired
- 1972-07-14 NL NL727209820A patent/NL153862B/xx not_active IP Right Cessation
- 1972-07-14 AT AT979273A patent/AT321272B/de not_active Expired
- 1972-07-14 DK DK352272A patent/DK133298C/da active
- 1972-07-14 JP JP47070048A patent/JPS5224012B1/ja active Pending
- 1972-07-14 BR BR4677/72A patent/BR7204677D0/pt unknown
- 1972-07-14 AT AT607272A patent/AT318560B/de not_active IP Right Cessation
- 1972-07-14 CA CA147,175A patent/CA1003859A/en not_active Expired
- 1972-07-14 SE SE7209286A patent/SE388607B/xx unknown
- 1972-07-17 AR AR243108A patent/AR197088A1/es active
- 1972-07-17 GB GB3338072A patent/GB1345319A/en not_active Expired
-
1973
- 1973-08-03 AR AR249439A patent/AR197154A1/es active
- 1973-08-03 AR AR249438A patent/AR197153A1/es active
- 1973-08-03 AR AR249440A patent/AR197155A1/es active
-
1975
- 1975-01-28 ES ES434221A patent/ES434221A1/es not_active Expired
- 1975-01-28 ES ES434220A patent/ES434220A1/es not_active Expired
- 1975-01-28 ES ES434219A patent/ES434219A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE388607B (sv) | 1976-10-11 |
| NL153862B (nl) | 1977-07-15 |
| AR197155A1 (es) | 1974-03-15 |
| BE786147A (fr) | 1972-11-03 |
| AT318560B (de) | 1974-10-25 |
| NO134800B (da) | 1976-09-06 |
| JPS5224012B1 (da) | 1977-06-28 |
| NL7209820A (da) | 1973-01-17 |
| CA1003859A (en) | 1977-01-18 |
| ES404743A1 (es) | 1976-01-01 |
| NO134800C (da) | 1976-12-15 |
| BR7204677D0 (pt) | 1973-11-01 |
| DE2232939A1 (de) | 1973-01-18 |
| FI57100B (fi) | 1980-02-29 |
| ES434219A1 (es) | 1976-12-01 |
| AR197153A1 (es) | 1974-03-15 |
| ZA724511B (en) | 1973-03-28 |
| AR197088A1 (es) | 1974-03-15 |
| FR2145639B1 (da) | 1976-03-05 |
| CH582138A5 (da) | 1976-11-30 |
| GB1345319A (en) | 1974-01-30 |
| ES434221A1 (es) | 1976-12-01 |
| AR197154A1 (es) | 1974-03-15 |
| DK133298C (da) | 1976-09-20 |
| AT321272B (de) | 1975-03-25 |
| FR2145639A1 (da) | 1973-02-23 |
| ES434220A1 (es) | 1976-12-16 |
| DE2232939B2 (de) | 1975-10-02 |
| FI57100C (fi) | 1980-06-10 |
| CH589618A5 (da) | 1977-07-15 |
| MX3738E (es) | 1981-06-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK138992C (da) | Analogifremgangsmaade til fremstilling af 5,9beta-disubstituerede 2-tetrahydrofurfuryl-6,7-benzomorphaner eller syreadditionssalte heraf | |
| DK137188C (da) | Analogifremgangsmaade til fremstilling af 2-tetrahydrofurfuryl-6,7-benzomorphaner eller syreadditionssalte heraf | |
| DK131725C (da) | Analogifremgangsmade til fremstilling af 2,4-diaminoquinazoliner eller salte deraf | |
| DK138325C (da) | Analogifremgangsmaade til fremstilling af n-(methoxymethylfurylmethyl)-6,7-benzomorphaner eller -morphinaner eller syreadditionssalte deraf | |
| DK140481B (da) | Analogifremgangsmaade til fremstilling af hidtil ukendte penicillinestere eller salte heraf | |
| DK133106C (da) | Analogifremgangsmade til fremstilling af 1-oxa-3,8-diazaspiro-(4,5)-decanderivater eller additionssalte heraf | |
| DK137382B (da) | Analogifremgangsmåde til fremstilling af 2,2-diaryl-4-(4'-aryl-4'-hydroxy-piperidin)butyramider eller syreadditionssalte deraf. | |
| DK132944C (da) | Analogifremgangsmade til fremstilling af 4-(4-biphenylyl)-4-oxo-smorsyrer eller estere eller salte heraf | |
| DK136612C (da) | Analogifremgangsmaade til fremstilling af 3,20-dioxo-4-pregnen-21-syrederivater | |
| DK138491B (da) | Analogifremgangsmåde til fremstilling af N-(1-cyclohexyl-3-pyrrolidinyl)-benzamider eller syreadditionssalte deraf. | |
| DK137606B (da) | Analogifremgangsmaade til fremstilling af substituerede 2-phenylamino-imidazoliner-(2) eller syreadditionssalte deraf | |
| DK131857C (da) | Analogifremgangsmade til fremstilling af 4-hydroxymethyl-1-phthalazonderivater eller syreadditionssalte deraf | |
| DK139517C (da) | Analogifremgangsmaade til fremstilling af substituerede thiazol-2-carboxamider eller syreadditionssalte deraf | |
| DK136821C (da) | Analogifremgangsmaade til fremstilling af s-triazolo-(4,3-a)(1,5)-benzodiazepin-5-oner eller syreadditionssalte heraf | |
| DK128779B (da) | Analogifremgangsmåde til fremstilling af 2-arylamino-imidazolin-(2)'er eller syreadditionssalte deraf. | |
| DK133975B (da) | Analogifremgangsmåde til fremstilling af aminspirodibenzocykloheptenforbindelser eller syreadditionssalte deraf. | |
| DK133298C (da) | Analogifremgangsmade til fremstilling af n-(3'-tiofenylpropyl)-3,3-difenylpropylamin eller syreadditionssalte deraf | |
| DK140408B (da) | Analogifremgangsmaade til fremstilling af n-(heteroarylmethyl)-7alfa-acyl-6,14-endoetheno-eller-endoethano-tetrahydronororipaviner eller thebainer eller syreadditionssalte deraf | |
| DK130837B (da) | Fremgangsmåde til fremstilling af 21-desoxy-21-N-(N'-metylpiperazinyl)-prednisolon eller mono-syreadditionssalte heraf. | |
| DK134436C (da) | Analogifremgangsmade til fremstilling af s(iv)-benzo-1,2,4-thiadiaziner eller syreadditionssalte deraf | |
| DK135941C (da) | Analogifremgangsmaade til fremstilling af 1-cyclopropyl-1-phenyl-3-amino-1-propanoler eller syreaddittionssalte deraf | |
| DK132622C (da) | Analogifremgangsmade til fremstilling af n-substituerede eller n,n-disubstituerede 2-aminoisoquinolinderivater eller syreadditionssalte deraf | |
| DK138391C (da) | Analogifremgangsmaade til fremstilling af n-(1'-allylpyrrolidinyl-2'-methyl)-2-methoxy-4,5-azimido-benzamid eller syreadditionssalte eller kvaternaere ammoniumsalte eller optisk aktive isomere deraf | |
| DK138848B (da) | Analogifremgangsmaade til fremstilling af phenylpropanolaminderivater eller syreadditionssalte deraf | |
| DK135576B (da) | Analogifremgangsmåde til fremstilling af 1,4-methano- eller 1,4-ethano-tetrahydronaphthyloxyaminopropanoler eller syreadditionssalte deraf. |