DK123820B - Analogifremgangsmåde til fremstilling af 5,6-dimetoxyindazol-3-karboxamidderivater samt alkalimetalsalte eller N-acylerede derivater heraf. - Google Patents
Analogifremgangsmåde til fremstilling af 5,6-dimetoxyindazol-3-karboxamidderivater samt alkalimetalsalte eller N-acylerede derivater heraf.Info
- Publication number
- DK123820B DK123820B DK158670AA DK158670A DK123820B DK 123820 B DK123820 B DK 123820B DK 158670A A DK158670A A DK 158670AA DK 158670 A DK158670 A DK 158670A DK 123820 B DK123820 B DK 123820B
- Authority
- DK
- Denmark
- Prior art keywords
- derivatives
- dimethoxyindazole
- preparation
- alkali metal
- metal salts
- Prior art date
Links
- CGODQEMLWTXHAT-UHFFFAOYSA-N 5,6-dimethoxy-1h-indazole-3-carboxamide Chemical class C1=C(OC)C(OC)=CC2=C1C(C(N)=O)=NN2 CGODQEMLWTXHAT-UHFFFAOYSA-N 0.000 title 1
- 229910052783 alkali metal Inorganic materials 0.000 title 1
- -1 alkali metal salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/54—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings condensed with carbocyclic rings or ring systems
- C07D231/56—Benzopyrazoles; Hydrogenated benzopyrazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains three hetero rings
- C07D487/14—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUEE001639 | 1969-04-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK123820B true DK123820B (da) | 1972-08-07 |
Family
ID=10995298
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK158670AA DK123820B (da) | 1969-04-01 | 1970-03-31 | Analogifremgangsmåde til fremstilling af 5,6-dimetoxyindazol-3-karboxamidderivater samt alkalimetalsalte eller N-acylerede derivater heraf. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3705175A (Direct) |
| JP (1) | JPS4920590B1 (Direct) |
| AT (2) | AT295529B (Direct) |
| CA (1) | CA918664A (Direct) |
| CH (1) | CH550804A (Direct) |
| CS (1) | CS188303B1 (Direct) |
| DE (1) | DE2015568C3 (Direct) |
| DK (1) | DK123820B (Direct) |
| FR (1) | FR2038107B1 (Direct) |
| GB (1) | GB1301882A (Direct) |
| NL (1) | NL146161B (Direct) |
| PL (1) | PL80614B1 (Direct) |
| SE (2) | SE386440B (Direct) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH575397A5 (Direct) * | 1971-11-09 | 1976-05-14 | Basf Ag | |
| US3928596A (en) * | 1973-05-17 | 1975-12-23 | Upjohn Co | Pharmaceutical compositions of 5,6-dialkoxy-2-aminobenzimidazoles and method for treating hypertension |
| CH612674A5 (Direct) * | 1973-08-16 | 1979-08-15 | Egyt Gyogyszervegyeszeti Gyar | |
| US3966760A (en) * | 1974-05-23 | 1976-06-29 | Morton-Norwich Products, Inc. | 2-Substituted-5,6-dimethoxyindazoles |
| US4009177A (en) * | 1974-05-23 | 1977-02-22 | Morton-Norwich Products, Inc. | Compound 2-(2-thiazolyl)-5,6-dimethoxyindazoles |
| US4001269A (en) * | 1976-01-29 | 1977-01-04 | Morton-Norwich Products, Inc. | 3-amino-5,6-dimethoxyindazole hydrochloride |
| JPH08277287A (ja) * | 1995-02-09 | 1996-10-22 | Mitsubishi Chem Corp | インダゾール類およびその用途 |
| TW200406385A (en) * | 2002-05-31 | 2004-05-01 | Eisai Co Ltd | Pyrazole compound and pharmaceutical composition containing the same |
| ITMI20030287A1 (it) * | 2003-02-18 | 2004-08-19 | Acraf | Indazolammidi dotate di attivita' analgesica metodo, per |
| WO2009106980A2 (en) * | 2008-02-29 | 2009-09-03 | Pfizer Inc. | Indazole derivatives |
| PT2105164E (pt) * | 2008-03-25 | 2011-03-24 | Affectis Pharmaceuticals Ag | Novos antagonistas de p2x7r e a sua utilização |
| US8815892B2 (en) | 2008-03-25 | 2014-08-26 | Affectis Pharmaceuticals Ag | P2X7R antagonists and their use |
| PT2243772E (pt) * | 2009-04-14 | 2012-03-28 | Affectis Pharmaceuticals Ag | Novos antagonistas de p2x7r e sua utilização |
| GB201511382D0 (en) | 2015-06-29 | 2015-08-12 | Imp Innovations Ltd | Novel compounds and their use in therapy |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US457269A (en) * | 1891-08-04 | Neck-yoke |
-
1970
- 1970-03-26 US US23069A patent/US3705175A/en not_active Expired - Lifetime
- 1970-03-31 GB GB1521870A patent/GB1301882A/en not_active Expired
- 1970-03-31 CS CS702104A patent/CS188303B1/cs unknown
- 1970-03-31 SE SE7004399-7A patent/SE386440B/xx unknown
- 1970-03-31 DK DK158670AA patent/DK123820B/da not_active IP Right Cessation
- 1970-03-31 PL PL1970139722A patent/PL80614B1/pl unknown
- 1970-03-31 FR FR7011477A patent/FR2038107B1/fr not_active Expired
- 1970-04-01 JP JP45027770A patent/JPS4920590B1/ja active Pending
- 1970-04-01 AT AT295470A patent/AT295529B/de not_active IP Right Cessation
- 1970-04-01 AT AT214371A patent/AT304542B/de not_active IP Right Cessation
- 1970-04-01 CH CH481570A patent/CH550804A/xx not_active IP Right Cessation
- 1970-04-01 NL NL707004647A patent/NL146161B/xx not_active IP Right Cessation
- 1970-04-01 DE DE2015568A patent/DE2015568C3/de not_active Expired
- 1970-04-01 CA CA078818A patent/CA918664A/en not_active Expired
-
1973
- 1973-11-23 SE SE7315895A patent/SE402287B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PL80614B1 (Direct) | 1975-08-30 |
| NL7004647A (Direct) | 1970-10-05 |
| DE2015568A1 (de) | 1970-10-15 |
| GB1301882A (Direct) | 1973-01-04 |
| CS188303B1 (en) | 1979-03-30 |
| CA918664A (en) | 1973-01-09 |
| SE386440B (sv) | 1976-08-09 |
| DE2015568C3 (de) | 1975-02-20 |
| DE2015568B2 (de) | 1974-07-11 |
| AT304542B (de) | 1973-01-10 |
| AT295529B (de) | 1972-01-10 |
| CH550804A (de) | 1974-06-28 |
| NL146161B (nl) | 1975-06-16 |
| SE402287B (sv) | 1978-06-26 |
| FR2038107A1 (Direct) | 1971-01-08 |
| FR2038107B1 (Direct) | 1974-02-01 |
| US3705175A (en) | 1972-12-05 |
| JPS4920590B1 (Direct) | 1974-05-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK134113B (da) | Analogifremgangsmåde til fremstilling af 1,2,3,4-tetrahydro-7-halogen-eller 7-trifluormethyl-6-sulfamyl-4-quinazolinoner eller salte heraf. | |
| DK132172B (da) | Analogifremgangsmåde til fremstilling af 6,7-benzomorphaner eller salte deraf. | |
| DK123820B (da) | Analogifremgangsmåde til fremstilling af 5,6-dimetoxyindazol-3-karboxamidderivater samt alkalimetalsalte eller N-acylerede derivater heraf. | |
| DK126788B (da) | Analogifremgangsmåde til fremstilling af γ-morpholino-p-amino-butyrophenoner eller salte deraf. | |
| DK128078B (da) | Analogifremgangsmåde til fremstilling af 1,2,3,4-tetrahydroisoquinolinderivater eller salte deraf. | |
| DK131373B (da) | Analogifremgangsmåde til fremstilling af 3,4-dihydroisoquinoleinderivater eller syreadditionssalte eller kvaternære ammoniumsalte deraf. | |
| DK131721B (da) | Analogifremgangsmåde til fremstilling af adamantanylaminer eller 3,5,7-trimethylhomologe eller syreadditionssalte deraf. | |
| DK135043B (da) | Analogifremgangsmåde til fremstilling af i 5-stillingen substituerede 5,10-dihydro-11H-dibenzo(b,e) (1,4) diazepin-11-oner samt syreadditionssalte deraf. | |
| DK129994B (da) | Analogifremgangsmåde til fremstilling af 1-trimethoxybenzyl-6,7-dialkanoyl-1,2,3,4-tetrahydroisoquinoliner eller syreadditionssalte deraf. | |
| DK137758B (da) | Analogifremgangsmåde til fremstilling af 2-(5-nitro-2-imidazolyl)-benzimidazoler eller salte deraf. | |
| DK121367B (da) | Analogifremgangsmåde til fremstilling af 3,3-difenylallylaminderivater eller syreadditionssalte deraf. | |
| DK125472B (da) | Analogifremgangsmåde til fremstilling af pyrimidopyridazinderivater eller syreadditionssalte deraf. | |
| DK127424B (da) | Analogifremgangsmåde til fremstilling af 4-aryl-1-(4,4-diarylbutyl)-4-hydroxypiperidiner eller syreadditionssalte deraf. | |
| DK130114B (da) | Analogifremgangsmåde til fremstilling af 5,6-dihydrofenantridinderivater eller syreadditionssalte eller kvaternære ammoniumsalte deraf. | |
| DK116739B (da) | Analogifremgangsmåde til fremstilling af 3,6-disubstituerede flavanderivater eller metal- eller ammoniumsalte deraf. | |
| DK133778B (da) | Analogifremgangsmåde til fremstilling af substituerede isoquinoliner eller salte heraf. | |
| DK128926B (da) | Fremgangsmåde til fremstilling af 3-amino-Δ<2>-pyrazolin-derivater eller de tautomere 3-iminopyrazolidiner. | |
| DK115627B (da) | Fremgangsmåde til fremstilling af derivater af 2-anilino-1,3-diazacyclopenten-(2) eller syreadditionssalte heraf. | |
| DK120796B (da) | Analogifremgangsmåde til fremstilling af 1,2-oxazinderivater eller salte deraf. | |
| DK126201B (da) | Analogifremgangsmåde til fremstilling af 1,4-benzodiazepinderivater eller salte deraf. | |
| DK124885B (da) | Analogifremgangsmåde til fremstilling af 4-alkenyl-substituerede 1,2-difenyl-3,5-dioxopyrazolidiner eller salte heraf. | |
| DK124545B (da) | Analogifremgangsmåde til fremstilling af bisimidazolyl-bisphenylmethaner eller salte deraf. | |
| DK127878B (da) | Analogifremgangsmåde til fremstilling af 1-amino-3-phenoxy-2-propanolderivater eller salte deraf. | |
| DK128929B (da) | Analogifremgangsmåde til fremstilling af N-substituerede 3-carbamoyl-1-thia-isochroman-1,1-dioxid-derivater eller syreadditionssalte deraf. | |
| DK125648B (da) | Analogifremgangsmåde til fremstilling af quinolinderivater eller salte deraf. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |