DK123650B - Analogifremgangsmåde til fremstilling af D-threo-1-phenyl-2-amino-1,3-propandiolderivater. - Google Patents
Analogifremgangsmåde til fremstilling af D-threo-1-phenyl-2-amino-1,3-propandiolderivater.Info
- Publication number
- DK123650B DK123650B DK105665AA DK105665A DK123650B DK 123650 B DK123650 B DK 123650B DK 105665A A DK105665A A DK 105665AA DK 105665 A DK105665 A DK 105665A DK 123650 B DK123650 B DK 123650B
- Authority
- DK
- Denmark
- Prior art keywords
- threo
- phenyl
- amino
- preparation
- analogous process
- Prior art date
Links
- JUCGVCVPNPBJIG-RKDXNWHRSA-N (1r,2r)-2-amino-1-phenylpropane-1,3-diol Chemical class OC[C@@H](N)[C@H](O)C1=CC=CC=C1 JUCGVCVPNPBJIG-RKDXNWHRSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C247/00—Compounds containing azido groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT181064A AT249031B (de) | 1964-03-02 | 1964-03-02 | Verfahren zur Herstellung von neuen Derivaten des Chloramphenicols |
| AT99865A AT256074B (de) | 1965-02-04 | 1965-02-04 | Verfahren zur Herstellung neuer Chloramphenicolanaloga-Derivative |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK123650B true DK123650B (da) | 1972-07-17 |
Family
ID=25594558
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK105665AA DK123650B (da) | 1964-03-02 | 1965-03-01 | Analogifremgangsmåde til fremstilling af D-threo-1-phenyl-2-amino-1,3-propandiolderivater. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3367948A (enFirst) |
| BE (1) | BE660366A (enFirst) |
| BR (1) | BR6567486D0 (enFirst) |
| CH (1) | CH466316A (enFirst) |
| DE (1) | DE1298981B (enFirst) |
| DK (1) | DK123650B (enFirst) |
| ES (1) | ES309820A1 (enFirst) |
| FI (1) | FI44625C (enFirst) |
| FR (2) | FR4247M (enFirst) |
| GB (1) | GB1091448A (enFirst) |
| IL (1) | IL23054A (enFirst) |
| MY (1) | MY7100089A (enFirst) |
| NL (2) | NL6502607A (enFirst) |
| OA (1) | OA02635A (enFirst) |
| SE (1) | SE346309B (enFirst) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL128579C (enFirst) * | 1965-03-29 | |||
| YU34120B (en) * | 1968-05-11 | 1978-12-31 | Zambon Spa | Process for preparing novel thiamphenicol derivatives |
| US4254110A (en) * | 1979-02-02 | 1981-03-03 | Farmitalia Carlo Erba S.P.A. | Pentofuranosyl anthracyclines, intermediates in and method for their preparation and compositions and use thereof |
| US4235892A (en) * | 1979-02-05 | 1980-11-25 | Schering Corporation, Patent Dept. | 1-Aryl-2-acylamido-3-fluoro-1-propanols, methods for their use as antibacterial agents and compositions useful therefor |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2988481A (en) * | 1958-05-02 | 1961-06-13 | Du Pont | Compositions of aliphatic dibasic acid half esters of dichloracetyl-phenylpropanediols |
-
0
- NL NL130756D patent/NL130756C/xx active
-
1965
- 1965-02-24 IL IL23054A patent/IL23054A/xx unknown
- 1965-02-24 DE DEB80689A patent/DE1298981B/de active Pending
- 1965-02-25 ES ES0309820A patent/ES309820A1/es not_active Expired
- 1965-02-25 BR BR167486/65A patent/BR6567486D0/pt unknown
- 1965-02-26 US US435729A patent/US3367948A/en not_active Expired - Lifetime
- 1965-02-26 BE BE660366D patent/BE660366A/xx unknown
- 1965-02-26 GB GB8459/65A patent/GB1091448A/en not_active Expired
- 1965-03-01 DK DK105665AA patent/DK123650B/da unknown
- 1965-03-01 OA OA51484A patent/OA02635A/xx unknown
- 1965-03-01 FI FI650494A patent/FI44625C/fi active
- 1965-03-01 SE SE2621/65A patent/SE346309B/xx unknown
- 1965-03-01 FR FR7460A patent/FR4247M/fr not_active Expired
- 1965-03-01 FR FR1583703D patent/FR1583703A/fr not_active Expired
- 1965-03-01 CH CH276965A patent/CH466316A/de unknown
- 1965-03-02 NL NL6502607A patent/NL6502607A/xx unknown
-
1971
- 1971-12-31 MY MY197189A patent/MY7100089A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH466316A (de) | 1968-12-15 |
| OA02635A (fr) | 1970-12-15 |
| BR6567486D0 (pt) | 1973-08-02 |
| FI44625C (fi) | 1971-12-10 |
| FR4247M (enFirst) | 1966-06-27 |
| GB1091448A (en) | 1967-11-15 |
| FR1583703A (enFirst) | 1969-12-05 |
| NL6502607A (enFirst) | 1965-09-03 |
| SE346309B (enFirst) | 1972-07-03 |
| US3367948A (en) | 1968-02-06 |
| MY7100089A (en) | 1971-12-31 |
| ES309820A1 (es) | 1966-01-16 |
| FI44625B (enFirst) | 1971-08-31 |
| DE1298981B (de) | 1969-07-10 |
| IL23054A (en) | 1969-04-30 |
| NL130756C (enFirst) | |
| BE660366A (enFirst) | 1965-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK125553B (da) | Fremgangsmåde til fremstilling af substituerede 2,4-diamino-5-benzylpyrimidiner. | |
| DK127415B (da) | Fremgangsmåde til fremstilling af α-benzyl-β,β-dialkoxypropionitriler. | |
| DK116441B (da) | Fremgangsmåde til fremstilling af 10,11-dihydro-dibenzo-(b,f)-thiepinderivater. | |
| DK120194B (da) | Fremgangsmåde til fremstilling af azirindinderivater. | |
| DK114699B (da) | Fremgangsmåde til fremstilling af furylbenzofuranderivater. | |
| DK120752B (da) | Fremgangsmåde til fremstilling af 5-aryl-3H-1,4-benzodiazepin-4-oxider. | |
| DK123650B (da) | Analogifremgangsmåde til fremstilling af D-threo-1-phenyl-2-amino-1,3-propandiolderivater. | |
| DK121759B (da) | Analogifremgangsmåde til fremstilling af 3-oxo-7α-methylgona-4,9-diener. | |
| DK106328C (da) | Fremgangsmåde til fremstilling af 17α-alkoxy-16-methylen-3,20-diketopregnanderivater. | |
| DK114273B (da) | Fremgangsmåde til fremstilling af α-methyl-α-amino-β-(3,4-disubstituerede-phenyl)-propionitriler. | |
| DK118945B (da) | Fremgangsmåde til fremstilling af 3-phenylpyrrol-derivater. | |
| DK112031B (da) | Fremgangsmåde til fremstilling af 3,20-dioxo-17α-methyl-19-nor-pregna-4,9,11-trien. | |
| DK122071B (da) | Analogifremgangsmåde til fremstilling af methylenbutyrylphenoler. | |
| DK112318B (da) | Fremgangsmåde til fremstilling af 2-benzensulfonylamidopyrimidiner. | |
| DK109140C (da) | Fremgangsmåde til fremstilling af 1-hydroksy-3-aminopyrrolidon-2-derivater. | |
| DK113917B (da) | Fremgangsmåde til fremstilling af 2,2,6,6-tetrachlorcyclohexanon. | |
| DK117956B (da) | Fremgangsmåde til fremstilling af 3-oxogona-4,9-diener. | |
| DK114204B (da) | Fremgangsmåde til fremstilling af carboxamidoalkyl-1,3-benzoxaziner. | |
| DK116869B (da) | Fremgangsmåde til fremstilling af 6-methyl-16-fluormethylen-4-pregnen-3,20-dionderivater. | |
| DK109639C (da) | Fremgangsmåde til fremstilling af 3-oxo-17β-hydroxy-17α-methylestra-4,9,11-trien. | |
| DK109871C (da) | Fremgangsmåde til fremstilling af 2-aminometyl-3,4-dihydro-2H-pyraner eller derivater deraf. | |
| DK118602B (da) | Analogifremgangsmåde til fremstilling af 3-chlorethoxy-6-cyan-3,5-pregnadiener. | |
| DK114902B (da) | Fremgangsmåde til fremstilling af O,S-disubstituerede thiol-thiaminderivater. | |
| DK107421C (da) | Fremgangsmåde til fremstilling af 17α-ethoxy-6-chlor-6-dehydroprogesteron. | |
| DK106860C (da) | Fremgangsmåde til fremstilling af N-alkanoylamino-5-nitro-2-furamidiner. |