DK123100B - Fremgangsmåde til fremstilling af N-tritylimidazoler. - Google Patents
Fremgangsmåde til fremstilling af N-tritylimidazoler.Info
- Publication number
- DK123100B DK123100B DK462468AA DK462468A DK123100B DK 123100 B DK123100 B DK 123100B DK 462468A A DK462468A A DK 462468AA DK 462468 A DK462468 A DK 462468A DK 123100 B DK123100 B DK 123100B
- Authority
- DK
- Denmark
- Prior art keywords
- tritylimidazoles
- preparation
- Prior art date
Links
- NPZDCTUDQYGYQD-UHFFFAOYSA-N 1-tritylimidazole Chemical class C1=NC=CN1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 NPZDCTUDQYGYQD-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0053587 | 1967-09-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK123100B true DK123100B (da) | 1972-05-15 |
Family
ID=7106446
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK462468AA DK123100B (da) | 1967-09-26 | 1968-09-25 | Fremgangsmåde til fremstilling af N-tritylimidazoler. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3711497A (enExample) |
| AT (1) | AT278001B (enExample) |
| BE (1) | BE721378A (enExample) |
| CA (1) | CA938611A (enExample) |
| CH (3) | CH554868A (enExample) |
| DE (1) | DE1670932C3 (enExample) |
| DK (1) | DK123100B (enExample) |
| ES (1) | ES358531A1 (enExample) |
| FR (1) | FR1581925A (enExample) |
| GB (1) | GB1173537A (enExample) |
| IL (1) | IL30637A (enExample) |
| NL (1) | NL6813715A (enExample) |
| SE (1) | SE341633B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3929820A (en) * | 1967-09-26 | 1975-12-30 | Bayer Ag | Process for the production of N-tritylimidazoles |
| DE2213863C3 (de) * | 1972-03-22 | 1982-05-13 | Bayer Ag, 5090 Leverkusen | Disubstituierte Triphenylmethylimidazole, Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel |
| US4117142A (en) * | 1972-03-22 | 1978-09-26 | Bayer Aktiengesellschaft | Disubstituted triphenylmethylmidazoles for treating mycotic infections |
| US4216333A (en) * | 1978-10-30 | 1980-08-05 | Sumitomo Chemical Company, Limited | Process for preparing N-tritylimidazole compounds |
| US6103733A (en) * | 1998-09-09 | 2000-08-15 | Bachmann; Kenneth A. | Method for increasing HDL cholesterol levels using heteroaromatic phenylmethanes |
| US20060211632A1 (en) * | 2005-03-17 | 2006-09-21 | Bachmann Kenneth A | PXR agonists for cardiovascular disease |
-
1967
- 1967-09-26 DE DE1670932A patent/DE1670932C3/de not_active Expired
-
1968
- 1968-08-23 CH CH65271A patent/CH554868A/xx not_active IP Right Cessation
- 1968-08-23 CH CH65171A patent/CH571503A5/xx not_active IP Right Cessation
- 1968-08-23 CH CH1267568A patent/CH517100A/de not_active IP Right Cessation
- 1968-08-27 IL IL30637A patent/IL30637A/en unknown
- 1968-09-20 SE SE12718/68A patent/SE341633B/xx unknown
- 1968-09-23 GB GB45013/68A patent/GB1173537A/en not_active Expired
- 1968-09-25 DK DK462468AA patent/DK123100B/da not_active IP Right Cessation
- 1968-09-25 BE BE721378D patent/BE721378A/xx unknown
- 1968-09-25 NL NL6813715A patent/NL6813715A/xx unknown
- 1968-09-26 AT AT940768A patent/AT278001B/de not_active IP Right Cessation
- 1968-09-26 ES ES358531A patent/ES358531A1/es not_active Expired
- 1968-09-26 FR FR1581925D patent/FR1581925A/fr not_active Expired
-
1970
- 1970-05-15 US US00037850A patent/US3711497A/en not_active Expired - Lifetime
-
1973
- 1973-01-05 CA CA160628A patent/CA938611A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE721378A (enExample) | 1969-03-25 |
| CH554868A (de) | 1974-10-15 |
| ES358531A1 (es) | 1970-04-16 |
| FR1581925A (enExample) | 1969-09-19 |
| US3711497A (en) | 1973-01-16 |
| AT278001B (de) | 1970-01-26 |
| CH571503A5 (enExample) | 1976-01-15 |
| DE1670932A1 (de) | 1971-04-08 |
| SE341633B (enExample) | 1972-01-10 |
| NL6813715A (enExample) | 1969-03-28 |
| CH517100A (de) | 1971-12-31 |
| GB1173537A (en) | 1969-12-10 |
| DE1670932B2 (de) | 1974-02-07 |
| IL30637A0 (en) | 1968-10-24 |
| IL30637A (en) | 1972-05-30 |
| CA938611A (en) | 1973-12-18 |
| DE1670932C3 (de) | 1974-09-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK137232B (da) | Analogifremgangsmåde til fremstilling af phenylethanolaminer. | |
| DK122222B (da) | Fremgangsmåde til fremstilling af alk-3-en-1-oler. | |
| DK133783B (da) | Fremgangsmåde til fremstilling af 7-halogen-7-desoxy-1-thio-alfa-D-galacto-octopyranosider. | |
| DK120698B (da) | Analogifremgangsmåde til fremstilling af acetylguanidiner. | |
| DK124080B (da) | Fremgangsmåde til fremstilling af D-6-metyl-8-cyanmetylergolin. | |
| DK127853B (da) | Analogifremgangsmåde til fremstilling af benzodipyroner. | |
| DK118820B (da) | Analogifremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoliner. | |
| DK119307B (da) | Fremgangsmåde til fremstilling af ketonitriler. | |
| DK123868B (da) | Analogifremgangsmåde til fremstilling af 3-hydroxycumarin-derivater. | |
| DK136033B (da) | Fremgangsmåde til fremstilling af indolyl-3-eddikesyrer. | |
| DK122758B (da) | Fremgangsmåde til fremstilling af α-methyl-multicyclo-methylaminer. | |
| DK122522B (da) | Fremgangsmåde til fremstilling af dichlorquinoliner. | |
| DK123100B (da) | Fremgangsmåde til fremstilling af N-tritylimidazoler. | |
| DK119663B (da) | Analogifremgangsmåde til fremstilling af 2-benzolsulfonamidopyrimidinforbindelser. | |
| DK118507B (da) | Fremgangsmåde til fremstilling af 3-dimethylsulfamoylphenthiazinderivater. | |
| DK135287B (da) | Analogifremgangsmåde til fremstilling af styrylthiazoliumsalte. | |
| DK119976B (da) | Analogifremgangsmåde til fremstilling af 18-methyl-19-nor-17α-hydroxyprogesteroner og -17-estere deraf. | |
| DK130307B (da) | Fremgangsmåde til fremstilling af 3-oxo-13β-alkyl-17β-hydroxy-17α-ethynylgona-4,9-diener. | |
| DK119879B (da) | Analogifremgangsmåde til fremstilling af calciumdiorotat. | |
| DK120948B (da) | Fremgangsmåde til fremstilling af (androst-17β-yl)-α-pyroner. | |
| DK122666B (da) | Analogifremgangsmåde til fremstilling af hydrocortison-17-cyclopentancorboxylat. | |
| DK117568B (da) | Analogifremgangsmåde til fremstilling af ftalazino-ftalazindioner. | |
| DK129842B (da) | Fremgangsmåde til fremstilling af 3-imino-1,2-benzisothiazoliner. | |
| DK123476B (da) | Fremgangsmåde til fremstilling af 3-oxo-A-nor-B-homo-estra-5(10)-ener. | |
| DK117898B (da) | Fremgangsmåde til fremstilling af cycloserin. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUP | Patent expired |