DK123031B - Analogifremgangsmåde til fremstilling af derivater af 1-benzyl-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinolin eller syreadditionssalte deraf. - Google Patents
Analogifremgangsmåde til fremstilling af derivater af 1-benzyl-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinolin eller syreadditionssalte deraf.Info
- Publication number
- DK123031B DK123031B DK632566AA DK632566A DK123031B DK 123031 B DK123031 B DK 123031B DK 632566A A DK632566A A DK 632566AA DK 632566 A DK632566 A DK 632566A DK 123031 B DK123031 B DK 123031B
- Authority
- DK
- Denmark
- Prior art keywords
- tetrahydroisoquinoline
- dihydroxy
- benzyl
- derivatives
- preparation
- Prior art date
Links
- GGGSEBXTKMTNBW-UHFFFAOYSA-N 1-benzyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol Chemical class C1=2C=C(O)C(O)=CC=2CCNC1CC1=CC=CC=C1 GGGSEBXTKMTNBW-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/12—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring
- C07D217/18—Aralkyl radicals
- C07D217/20—Aralkyl radicals with oxygen atoms directly attached to the aromatic ring of said aralkyl radical, e.g. papaverine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7582065 | 1965-12-08 | ||
| JP3752466 | 1966-06-09 | ||
| JP4828266 | 1966-07-22 | ||
| JP4828366 | 1966-07-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK123031B true DK123031B (da) | 1972-05-08 |
Family
ID=27460434
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK632566AA DK123031B (da) | 1965-12-08 | 1966-12-07 | Analogifremgangsmåde til fremstilling af derivater af 1-benzyl-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinolin eller syreadditionssalte deraf. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3497516A (enExample) |
| AT (1) | AT269882B (enExample) |
| BE (1) | BE689865A (enExample) |
| CH (1) | CH468384A (enExample) |
| DE (1) | DE1620567A1 (enExample) |
| DK (1) | DK123031B (enExample) |
| ES (1) | ES343003A1 (enExample) |
| FI (1) | FI48079C (enExample) |
| FR (1) | FR5747M (enExample) |
| GB (1) | GB1114660A (enExample) |
| IL (1) | IL28215A (enExample) |
| MY (1) | MY6900335A (enExample) |
| NL (1) | NL6617017A (enExample) |
| NO (1) | NO121340B (enExample) |
| SE (1) | SE323963B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3818015A (en) * | 1970-12-17 | 1974-06-18 | Tanabe Seiyaku Co | 1(polymethoxybenzyl) 6 hydroxyl 1,2,3,4 tetrahydro isoquinolines |
| FR2119989B1 (enExample) * | 1970-12-29 | 1975-10-10 | Fujisawa Pharmaceutical Co | |
| US3963725A (en) * | 1973-07-20 | 1976-06-15 | Fujisawa Pharmaceutical Co., Ltd. | 1,2,3,4-Tetrahydroisoquinoline derivatives and the preparation thereof |
| BG38182A1 (en) * | 1983-06-21 | 1985-11-15 | Ivanova | Tocolytic means |
| WO1999016752A1 (en) * | 1997-09-30 | 1999-04-08 | Molecular Designs International, Inc. | β3-ADRENORECEPTOR AGONISTS, AGONIST COMPOSITIONS AND METHODS OF USING |
| US6593341B2 (en) | 2001-03-29 | 2003-07-15 | Molecular Design International, Inc. | β3-adrenoreceptor agonists, agonist compositions and methods of making and using the same |
| US6596734B1 (en) | 2002-10-11 | 2003-07-22 | Molecular Design International, Inc. | Tetrahydroisoquinoline compounds for use as β3-adrenoreceptor agonists |
| CN119751351B (zh) * | 2024-11-28 | 2025-10-31 | 广东省农业科学院蚕业与农产品加工研究所 | 一种具有乙酰胆碱酯酶抑制活性的生物碱及其制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL286505A (enExample) * | 1961-12-15 |
-
1966
- 1966-09-15 US US579504A patent/US3497516A/en not_active Expired - Lifetime
- 1966-09-22 FR FR77345A patent/FR5747M/fr not_active Expired
- 1966-09-30 DE DE19661620567 patent/DE1620567A1/de active Pending
- 1966-11-17 BE BE689865D patent/BE689865A/xx not_active IP Right Cessation
- 1966-11-22 NO NO165684A patent/NO121340B/no unknown
- 1966-11-24 SE SE16115/66A patent/SE323963B/xx unknown
- 1966-12-02 NL NL6617017A patent/NL6617017A/xx unknown
- 1966-12-05 GB GB54413/66A patent/GB1114660A/en not_active Expired
- 1966-12-07 DK DK632566AA patent/DK123031B/da not_active IP Right Cessation
- 1966-12-08 CH CH1747666A patent/CH468384A/de unknown
-
1967
- 1967-06-28 IL IL28215A patent/IL28215A/xx unknown
- 1967-07-11 AT AT648267A patent/AT269882B/de active
- 1967-07-13 ES ES343003A patent/ES343003A1/es not_active Expired
- 1967-07-21 FI FI672013A patent/FI48079C/fi active
-
1969
- 1969-12-31 MY MY1969335A patent/MY6900335A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1620567A1 (de) | 1970-04-30 |
| CH468384A (de) | 1969-02-15 |
| SE323963B (enExample) | 1970-05-19 |
| GB1114660A (en) | 1968-05-22 |
| BE689865A (enExample) | 1967-05-02 |
| IL28215A (en) | 1971-02-25 |
| US3497516A (en) | 1970-02-24 |
| FI48079B (enExample) | 1974-02-28 |
| ES343003A1 (es) | 1968-08-16 |
| FR5747M (enExample) | 1968-01-29 |
| AT269882B (de) | 1969-04-10 |
| FI48079C (fi) | 1974-06-10 |
| NO121340B (enExample) | 1971-02-15 |
| NL6617017A (enExample) | 1967-06-09 |
| MY6900335A (en) | 1969-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK130070B (da) | Analogifremgangsmåde til fremstilling af 3,4-dihydroxyphenylalkanolaminer eller syreadditionssalte deraf. | |
| DK115473B (da) | Fremgangsmåde til fremstilling af 2,3,4,5-tetrahydro-1H-3-benzazepiner eller syreadditionssalte deraf. | |
| DK121365B (da) | Analogifremgangsmåde til fremstilling af 4-chlor-5-sulfamylsalicylsyrederivater eller salte deraf. | |
| DK128078B (da) | Analogifremgangsmåde til fremstilling af 1,2,3,4-tetrahydroisoquinolinderivater eller salte deraf. | |
| DK131373B (da) | Analogifremgangsmåde til fremstilling af 3,4-dihydroisoquinoleinderivater eller syreadditionssalte eller kvaternære ammoniumsalte deraf. | |
| DK119059B (da) | Fremgangsmåde til fremstilling af 2-nitro-imidazolderivater eller syreadditionssalte deraf. | |
| DK117427B (da) | Fremgangsmåde til fremstilling af phenoxypropanolaminer eller syreadditionssalte deraf. | |
| DK131721B (da) | Analogifremgangsmåde til fremstilling af adamantanylaminer eller 3,5,7-trimethylhomologe eller syreadditionssalte deraf. | |
| DK123031B (da) | Analogifremgangsmåde til fremstilling af derivater af 1-benzyl-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinolin eller syreadditionssalte deraf. | |
| DK120548B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater eller 4-oxider eller syreadditionssalte deraf. | |
| DK129994B (da) | Analogifremgangsmåde til fremstilling af 1-trimethoxybenzyl-6,7-dialkanoyl-1,2,3,4-tetrahydroisoquinoliner eller syreadditionssalte deraf. | |
| DK123032B (da) | Analogifremgangsmåde til fremstilling af 1-phenoxymethyl-3,4-dihydro- og -1,2,3,4-tetrahydro-isoquinolin-forbindelser eller salte deraf. | |
| DK129924B (da) | Analogifremgangsmåde til fremstilling af aminoalkylaminobenzophenonderivater eller syreadditionssalte deraf. | |
| DK121367B (da) | Analogifremgangsmåde til fremstilling af 3,3-difenylallylaminderivater eller syreadditionssalte deraf. | |
| DK125555B (da) | Fremgangsmåde til fremstilling af 1,2-dihydro-5-aryl-5H- eller 1,2-dihydro-5-aryl-3H-1,4-benzodiazepin-4-oxider, 4-deoxyderivater deraf eller syreadditionssalte deraf. | |
| DK116587B (da) | Analogifremgangsmåde til fremstilling af pyridyl-dihydroisoquinoliner eller syreadditionssalte deraf. | |
| DK120702B (da) | Analogifremgangsmåde til fremstilling af pyridyl-tetrahydroisochinoliner eller syreadditionssalte deraf. | |
| DK118663B (da) | Analogifremgangsmåde til fremstilling af basisk substituerede derivater af 5,6-dihydro-dibenz-[b,e]-azepin-6, 11-dion-11-oxim eller syreadditionssalte deraf. | |
| DK119505B (da) | Analogifremgangsmåde til fremstilling af s-triazolo[3,4-a]isoquinoliner eller syreadditionssalte deraf. | |
| DK133778B (da) | Analogifremgangsmåde til fremstilling af substituerede isoquinoliner eller salte heraf. | |
| DK115840B (da) | Fremgangsmåde til fremstilling af phenylcyclohexylalkylaminer eller syreadditionssalte deraf. | |
| DK115627B (da) | Fremgangsmåde til fremstilling af derivater af 2-anilino-1,3-diazacyclopenten-(2) eller syreadditionssalte heraf. | |
| DK121955B (da) | Analogifremgangsmåde til fremstilling af 1,4-substituerede phenylpiperaziner eller syreadditionssalte deraf. | |
| DK118509B (da) | Fremgangsmåde til fremstilling af 1,1-diphenyl-1-metoxy-3-benzylaminopropan eller salte heraf. | |
| DK135765B (da) | Fremgangsmåde til fremstilling af 1-substituerede 6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoliner eller syreadditionssalte deraf. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUP | Patent expired |