DK120897B - Analogifremgangsmåde til fremstilling af bis-(hydroxymethyl)-pyridin-dicarbamatderivater. - Google Patents
Analogifremgangsmåde til fremstilling af bis-(hydroxymethyl)-pyridin-dicarbamatderivater.Info
- Publication number
- DK120897B DK120897B DK181264AA DK181264A DK120897B DK 120897 B DK120897 B DK 120897B DK 181264A A DK181264A A DK 181264AA DK 181264 A DK181264 A DK 181264A DK 120897 B DK120897 B DK 120897B
- Authority
- DK
- Denmark
- Prior art keywords
- hydroxymethyl
- pyridine
- bis
- preparation
- analogous process
- Prior art date
Links
- LUJAELQEMVNSCS-UHFFFAOYSA-N carbamic acid [2-(hydroxymethyl)pyridin-3-yl]methanol Chemical class C(N)(O)=O.C(N)(O)=O.OCC=1C(=NC=CC1)CO LUJAELQEMVNSCS-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/40—Acylated substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/61—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/68—One oxygen atom attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
- C07D213/71—Sulfur atoms to which a second hetero atom is attached
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1797963 | 1963-04-13 | ||
| JP1797863 | 1963-04-13 | ||
| JP1798063 | 1963-04-13 | ||
| JP1933064 | 1964-04-07 | ||
| JP1932964 | 1964-04-07 | ||
| JP1933164 | 1964-04-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK120897B true DK120897B (da) | 1971-08-02 |
Family
ID=27548756
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK181264AA DK120897B (da) | 1963-04-13 | 1964-04-11 | Analogifremgangsmåde til fremstilling af bis-(hydroxymethyl)-pyridin-dicarbamatderivater. |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3467663A (show.php) |
| BE (1) | BE646457A (show.php) |
| BR (1) | BR6458391D0 (show.php) |
| CH (1) | CH467259A (show.php) |
| DE (1) | DE1445950C3 (show.php) |
| DK (1) | DK120897B (show.php) |
| FI (1) | FI43735B (show.php) |
| FR (2) | FR1396624A (show.php) |
| GB (1) | GB1022216A (show.php) |
| NL (2) | NL6403905A (show.php) |
| SE (1) | SE311900B (show.php) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3290319A (en) * | 1965-02-26 | 1966-12-06 | Bristol Myers Co | Substituted carbamates of pyridine 2, 6-dimethanethiols |
| US3418328A (en) * | 1965-07-01 | 1968-12-24 | Bristol Myers Co | Dicarbamates of pyridine-2,6-dimethanol |
| US3875170A (en) * | 1971-05-25 | 1975-04-01 | Banyu Pharma Co Ltd | Pyridine bis (dithiocarbamate) derivatives |
| HU171664B (hu) * | 1976-01-24 | 1978-02-28 | Richter Gedeon Vegyeszet | Sposob poluchenija 2,6-digidroksimetil-piridin-bis/n-metilkarbamata/ v gamma 2 kristallicheskoj forme dlja neposredstvennogo tabletirovanija |
| US4347372A (en) * | 1978-09-01 | 1982-08-31 | Ciba-Geigy Corporation | Benzoxazolyl-glyoxylonitrile-2-oxime ether derivatives |
| US4477673A (en) * | 1982-01-27 | 1984-10-16 | Ciba-Geigy Corporation | Process for the preparation of substituted divinylpyridines and novel substituted divinylpyridines |
| DE3604873A1 (de) * | 1986-02-15 | 1987-08-20 | Basf Ag | Verfahren zur herstellung von 2,6-bis (hydroxymethyl)-pyridin-2,6-bis-(n-methylcarbamat) |
| IT1239475B (it) * | 1989-11-07 | 1993-11-02 | Ruggero Angeletti | Formulazioni farmaceutiche per uso topico a base di piridinolcarbammato e suoi polimeri instabili |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2839536A (en) * | 1958-06-17 | Salts of disubstituted carbamic acid | ||
| US3029246A (en) * | 1960-04-01 | 1962-04-10 | Searle & Co | Omega-phenyl-4-pyridinealkyl alkoxy-carbanilates |
-
0
- NL NL126013D patent/NL126013C/xx active
-
1964
- 1964-04-08 GB GB14566/64A patent/GB1022216A/en not_active Expired
- 1964-04-10 NL NL6403905A patent/NL6403905A/xx unknown
- 1964-04-10 CH CH460964A patent/CH467259A/de unknown
- 1964-04-10 US US358923A patent/US3467663A/en not_active Expired - Lifetime
- 1964-04-11 DK DK181264AA patent/DK120897B/da unknown
- 1964-04-13 BR BR158391/64A patent/BR6458391D0/pt unknown
- 1964-04-13 FR FR970774A patent/FR1396624A/fr not_active Expired
- 1964-04-13 FI FI0776/64A patent/FI43735B/fi active
- 1964-04-13 BE BE646457D patent/BE646457A/xx unknown
- 1964-04-13 DE DE1445950A patent/DE1445950C3/de not_active Expired
- 1964-06-30 FR FR980184A patent/FR5658M/fr not_active Expired
-
1965
- 1965-11-18 SE SE14911/65A patent/SE311900B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3467663A (en) | 1969-09-16 |
| BR6458391D0 (pt) | 1973-08-09 |
| DE1445950C3 (de) | 1974-01-24 |
| CH467259A (de) | 1969-01-15 |
| GB1022216A (en) | 1966-03-09 |
| SE311900B (show.php) | 1969-06-30 |
| BE646457A (show.php) | 1964-07-31 |
| NL6403905A (show.php) | 1964-10-14 |
| FR5658M (show.php) | 1968-01-02 |
| DE1445950B2 (de) | 1973-06-28 |
| NL126013C (show.php) | 1900-01-01 |
| FR1396624A (fr) | 1965-04-23 |
| DE1445950A1 (de) | 1969-03-20 |
| FI43735B (show.php) | 1971-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK113703B (da) | Fremgangsmåde til fremstilling af et humlekoncentrat. | |
| DK114837B (da) | Fremgangsmåde til fremstilling af mitosanforbindelser. | |
| DK108500C (da) | Fremgangsmåde til fremstilling af 1-glykosyl-5-azacytosiner. | |
| DK127726B (da) | Analogifremgangsmåde til fremstilling af 1-halogenbenzoylaminomethyl-2-phenyl-cyclopropan-forbindelser. | |
| DK111889B (da) | Fremgangsmåde til fremstilling af 3-N-substituerede tricycloundecaner. | |
| DK116292B (da) | Fremgangsmåde til fremstilling af phenylalkanolaminderivater. | |
| DK120897B (da) | Analogifremgangsmåde til fremstilling af bis-(hydroxymethyl)-pyridin-dicarbamatderivater. | |
| DK121708B (da) | Analogifremgangsmåde til fremstilling af terapeutisk virksomme 22-aza-cholestanderivater. | |
| DK120596B (da) | Fremgangsmåde til fremstilling af acetoxymethylbenzylpenicillinat. | |
| DK116443B (da) | Fremgangsmåde til fremstilling af 3-amino-N-carbamylpyrazolderivater. | |
| DK106240C (da) | Fremgangsmåde til fremstilling af et jern-pectin-kompleks. | |
| DK104461C (da) | Fremgangsmåde til fremstilling af 3-amino-isoxazoler. | |
| DK112321B (da) | Fremgangsmåde til fremstilling af 2-methyl-2-alkenyl-chromanderivater. | |
| DK107031C (da) | Fremgangsmåde til fremstilling af 2-halogenmethyl-quinazolin-3-oxider. | |
| DK105592C (da) | Fremgangsmåde til fremstilling af substituerede 5-fluor-pyrimidiner. | |
| DK111292B (da) | Fremgangsmåde til fremstilling af chlortrifluorethylen. | |
| DK106328C (da) | Fremgangsmåde til fremstilling af 17α-alkoxy-16-methylen-3,20-diketopregnanderivater. | |
| DK104571C (da) | Fremgangsmåde til fremstilling af trans-2-phenyl-3-methylmorpholin. | |
| DK115327B (da) | Fremgangsmåde til fremstilling af hydroxyphenylalkylphosphonater. | |
| DK113991B (da) | Fremgangsmåde til fremstilling af 2-chlor-3-oxo-butanamider. | |
| DK122883B (da) | Fremgangsmåde til fremstilling af ω-lactamer. | |
| DK120764B (da) | Fremgangsmåde til fremstilling af 2-amino-5-nitro-benzophenoner. | |
| DK106183C (da) | Fremgangsmåde til fremstilling af kaliummetafosfat. | |
| DK122458B (da) | Fremgangsmåde til fremstilling af nitrofurylalkenylenpyridinderivater. | |
| DK104629C (da) | Fremgangsmåde til fremstilling af 7-oxodesacetamidocolchicinderivater. |