DK118876B - Analogifremgangsmåde til fremstilling af substituerede benzylpyridiniumsalte. - Google Patents
Analogifremgangsmåde til fremstilling af substituerede benzylpyridiniumsalte.Info
- Publication number
- DK118876B DK118876B DK638267A DK638267A DK118876B DK 118876 B DK118876 B DK 118876B DK 638267 A DK638267 A DK 638267A DK 638267 A DK638267 A DK 638267A DK 118876 B DK118876 B DK 118876B
- Authority
- DK
- Denmark
- Prior art keywords
- substituted
- preparation
- analogous process
- benzylpyridinium salts
- benzylpyridinium
- Prior art date
Links
- NDZFNTHGIIQMQI-UHFFFAOYSA-N 1-benzylpyridin-1-ium Chemical class C=1C=CC=C[N+]=1CC1=CC=CC=C1 NDZFNTHGIIQMQI-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/53—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/46—Oxygen atoms
- C07D213/48—Aldehydo radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/46—Oxygen atoms
- C07D213/51—Acetal radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D455/00—Heterocyclic compounds containing quinolizine ring systems, e.g. emetine alkaloids, protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine
- C07D455/03—Heterocyclic compounds containing quinolizine ring systems, e.g. emetine alkaloids, protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine containing quinolizine ring systems directly condensed with at least one six-membered carbocyclic ring, e.g. protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine
- C07D455/04—Heterocyclic compounds containing quinolizine ring systems, e.g. emetine alkaloids, protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine containing quinolizine ring systems directly condensed with at least one six-membered carbocyclic ring, e.g. protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine containing a quinolizine ring system condensed with only one six-membered carbocyclic ring, e.g. julolidine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US60341866A | 1966-12-21 | 1966-12-21 | |
| US68531767A | 1967-11-24 | 1967-11-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK118876B true DK118876B (da) | 1970-10-19 |
Family
ID=27084423
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK638267A DK118876B (da) | 1966-12-21 | 1967-12-20 | Analogifremgangsmåde til fremstilling af substituerede benzylpyridiniumsalte. |
Country Status (13)
| Country | Link |
|---|---|
| AT (1) | AT278783B (https=) |
| BE (1) | BE708316A (https=) |
| CH (1) | CH487154A (https=) |
| DE (1) | DE1695101A1 (https=) |
| DK (1) | DK118876B (https=) |
| ES (1) | ES348464A1 (https=) |
| FR (2) | FR1550578A (https=) |
| GB (1) | GB1210519A (https=) |
| GR (1) | GR37786B (https=) |
| IL (1) | IL29176A (https=) |
| NL (2) | NL6717413A (https=) |
| NO (1) | NO123894B (https=) |
| SE (1) | SE337373B (https=) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1600969A (en) * | 1977-01-07 | 1981-10-21 | Acf Chemiefarma Nv | Heterocyclic compounds |
| NL7905789A (nl) | 1979-07-26 | 1981-01-28 | Tno | 1-gesubstitueerde-hydroxyiminomethyl-pyridinium zouten, werkwijze voor het bereiden van deze verbindingen, preparaten tegen organo-fosfaatvergiftingingen, alsmede werkwijze voor het bereiden van dergelijke preparaten. |
| US5206371A (en) * | 1990-08-10 | 1993-04-27 | Georgia Tech Research Corporation | Quaternary pyridinium compounds |
-
1967
- 1967-12-20 IL IL2917667A patent/IL29176A/en unknown
- 1967-12-20 GR GR670137786A patent/GR37786B/el unknown
- 1967-12-20 CH CH1788967A patent/CH487154A/de not_active IP Right Cessation
- 1967-12-20 DK DK638267A patent/DK118876B/da unknown
- 1967-12-20 FR FR1550578D patent/FR1550578A/fr not_active Expired
- 1967-12-20 DE DE19671695101 patent/DE1695101A1/de active Pending
- 1967-12-20 ES ES348464A patent/ES348464A1/es not_active Expired
- 1967-12-20 NL NL6717413A patent/NL6717413A/xx unknown
- 1967-12-20 NO NO17107867A patent/NO123894B/no unknown
- 1967-12-20 BE BE708316D patent/BE708316A/xx unknown
- 1967-12-20 NL NL6717412A patent/NL6717412A/xx unknown
- 1967-12-20 AT AT1152067A patent/AT278783B/de not_active IP Right Cessation
- 1967-12-20 SE SE1747767A patent/SE337373B/xx unknown
- 1967-12-20 GB GB57747/67A patent/GB1210519A/en not_active Expired
-
1968
- 1968-03-19 FR FR144357A patent/FR7308M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GR37786B (el) | 1969-07-15 |
| ES348464A1 (es) | 1969-06-16 |
| AT278783B (de) | 1970-02-10 |
| FR1550578A (https=) | 1968-12-20 |
| BE708316A (https=) | 1968-06-20 |
| FR7308M (https=) | 1969-09-29 |
| NL6717413A (https=) | 1968-06-24 |
| NL6717412A (https=) | 1968-06-24 |
| DE1695101A1 (de) | 1971-03-18 |
| NO123894B (https=) | 1972-01-31 |
| CH487154A (de) | 1970-03-15 |
| GB1210519A (en) | 1970-10-28 |
| SE337373B (https=) | 1971-08-09 |
| IL29176A (en) | 1972-08-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK133618B (da) | Analogifremgangsmåde til fremstilling af 1-hydroxyaryl-2-aminoalkanoler. | |
| DK117954B (da) | Fremgangsmåde til fremstilling af 3-amino-2-cyanoacrylamid. | |
| DK124886B (da) | Fremgangsnmåde til fremstilling af 1-hydroxy-benzimidazol-N-oxider. | |
| DK135287B (da) | Analogifremgangsmåde til fremstilling af styrylthiazoliumsalte. | |
| DK118876B (da) | Analogifremgangsmåde til fremstilling af substituerede benzylpyridiniumsalte. | |
| DK115551B (da) | Fremgangsmåde til fremstilling af 6-aminouracil-5-carbonamid-N-sulfonamider. | |
| DK122761B (da) | Analogifremgangsmåde til fremstilling af arylsulfonylurinstofderivater. | |
| DK114063B (da) | Fremgangsmåde til fremstilling af 1-methyl-2-isopropyl-5-nitro-imidazol. | |
| DK120344B (da) | Fremgangsmåde til fremstilling af 5-benzyl-pyrimidiner. | |
| DK135449B (da) | Analogifremgangsmåde til fremstilling af kvaternære nitrogensalte. | |
| DK136644B (da) | Fremgangsmåde til fremstilling af 1-p-chlorbenzoyl-2-methyl-3-indolyl-eddikesyre-forbindelser. | |
| DK123021B (da) | Analogifremgangsmåde til fremstilling af syreadditionssalte af 2-aminoadamantan. | |
| DK121172B (da) | Fremgangsmåde til fremstilling af tiazoliumsalte. | |
| DK114626B (da) | Fremgangsmåde til fremstilling af 2-substitueret-4-amino-5-acylamidometylpyrimidin. | |
| DK120025B (da) | Fremgangsmåde til fremstilling af pyridoxal-5-phosphat. | |
| DK119830B (da) | Analogifremgangsmåde til fremstilling af arylsulfonylsemicarbazider. | |
| DK126378B (da) | Analogifremgangsmåde til fremstilling af 17α-acyloxy-9α-chlor-11β-hydroxy-progesteroner. | |
| DK130296B (da) | Analogifremgangsmåde til fremstilling af substituerede 3-amino-4-halogen-sydnoniminsalte. | |
| DK114555B (da) | Fremgangsmåde til fremstilling af isoxazolylpyridiniumsalte. | |
| DK120239B (da) | Fremgangsmåde til fremstilling af piperazin-fenylætanolderivater. | |
| DK112172B (da) | Fremgangsmåde til fremstilling af (5-nitro-2-furfurylidenamino)-triazolonforbindelser. | |
| DK124405B (da) | Fremgangsmåde til fremstilling af 2-trifluormethyl- eller 2-pentafluorethyl-benzimidazoler. | |
| DK114133B (da) | Fremgangsmåde til fremstilling af 6-ketosteroider. | |
| DK116733B (da) | Fremgangsmåde til fremstilling af steroid-17-butenolider. | |
| DK123103B (da) | Fremgangsmåde til fremstilling af substituerede 3-amino-sydnoniminer. |