DK118464B - Fremgangsmåde til fremstilling af 2,3,5,6-tetraamino-1,4-benzoquinon. - Google Patents
Fremgangsmåde til fremstilling af 2,3,5,6-tetraamino-1,4-benzoquinon.Info
- Publication number
- DK118464B DK118464B DK573863AA DK573863A DK118464B DK 118464 B DK118464 B DK 118464B DK 573863A A DK573863A A DK 573863AA DK 573863 A DK573863 A DK 573863A DK 118464 B DK118464 B DK 118464B
- Authority
- DK
- Denmark
- Prior art keywords
- tetraamino
- benzoquinone
- preparation
- Prior art date
Links
- DNHCPEFCQYRQQN-UHFFFAOYSA-N 2,3,5,6-tetraaminocyclohexa-2,5-diene-1,4-dione Chemical compound NC1=C(N)C(=O)C(N)=C(N)C1=O DNHCPEFCQYRQQN-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/74—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C215/76—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring
- C07C215/80—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring containing at least two amino groups bound to the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF38586A DE1221237B (de) | 1962-12-18 | 1962-12-18 | Verfahren zur Herstellung von Tetraamino-benzochinon-1, 4 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK118464B true DK118464B (da) | 1970-08-24 |
Family
ID=7097408
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK573863AA DK118464B (da) | 1962-12-18 | 1963-12-09 | Fremgangsmåde til fremstilling af 2,3,5,6-tetraamino-1,4-benzoquinon. |
Country Status (7)
| Country | Link |
|---|---|
| AT (1) | AT244937B (enExample) |
| BE (1) | BE641492A (enExample) |
| CH (1) | CH441357A (enExample) |
| DE (1) | DE1221237B (enExample) |
| DK (1) | DK118464B (enExample) |
| GB (1) | GB1037778A (enExample) |
| SE (1) | SE327418B (enExample) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1109176B (de) * | 1958-02-14 | 1961-06-22 | Ciba Geigy | Verfahren zur Herstellung neuer Imidazole |
-
1962
- 1962-12-18 DE DEF38586A patent/DE1221237B/de active Pending
-
1963
- 1963-12-09 DK DK573863AA patent/DK118464B/da unknown
- 1963-12-16 AT AT1007563A patent/AT244937B/de active
- 1963-12-16 CH CH1540663A patent/CH441357A/de unknown
- 1963-12-18 BE BE641492A patent/BE641492A/xx unknown
- 1963-12-18 GB GB50051/63A patent/GB1037778A/en not_active Expired
-
1965
- 1965-12-18 SE SE09962/65A patent/SE327418B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH441357A (de) | 1967-08-15 |
| DE1221237B (de) | 1966-07-21 |
| AT244937B (de) | 1966-02-10 |
| BE641492A (enExample) | 1964-06-18 |
| SE327418B (enExample) | 1970-08-24 |
| GB1037778A (en) | 1966-08-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK115403B (da) | Fremgangsmåde til fremstilling af (3-amino-pyrazinoyl)-guanidiner. | |
| DK104675C (da) | Fremgangsmåde til fremstilling af 3-hydroxy-N-nitro-picolinamid. | |
| DK114058B (da) | Fremgangsmåde til fremstilling af 2,4-disulfamyl-N-(3-hydroxy-2-propenyliden)-anilinderivater. | |
| DK122319B (da) | Fremgangsmåde til fremstilling af L-α-methyl-3,4-dihydroxyphenylalanin. | |
| DK115325B (da) | Fremgangsmåde til fremstilling af fenylalkylsulfamider. | |
| DK105471C (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepin-3H-forbindelser. | |
| DK111447B (da) | Fremgangsmåde til fremstilling af 17α-vinyl-5(10)-østren-17β-ol-3-on. | |
| DK119702B (da) | Fremgangsmåde til fremstilling af 2,6-dichlorbenzonitril. | |
| DK115265B (da) | Fremgangsmåde til fremstilling af substituerede 1,3-propandioler. | |
| DK111487B (da) | Fremgangsmåde til fremstilling af 17β-hydroxy- eller 17β-alkanoyloxy-3-keto-Δ<4,8(14),9>-gonatriener. | |
| DK103476C (da) | Fremgangsmåde til fremstilling af 2-oxa-3-oxo-steroider. | |
| DK124753B (da) | Analogifremgangsmåde til fremstilling af 13-alkyl-gonen-3,17-dioler. | |
| DK108915C (da) | Fremgangsmåde til fremstilling af 21-acyloxy-acetyloxy-corticosteroider. | |
| DK103512C (da) | Fremgangsmåde til fremstilling af 3-nitroso-2-oxazolidon. | |
| DK119354B (da) | Fremgangsmåde til fremstilling af 3-sulfamoyl-5-tert.-aminopropyliden-5H-dibenzo-[a,d]-cycloheptener. | |
| DK103081C (da) | Fremgangsmåde til fremstilling af 2,6-diketo-8-thiapuriner. | |
| DK115852B (da) | Fremgangsmåde til fremstilling af 2,4-diamino-6-hydroxymethyl-7,8-dihydropteridin. | |
| DK118464B (da) | Fremgangsmåde til fremstilling af 2,3,5,6-tetraamino-1,4-benzoquinon. | |
| DK111175B (da) | Fremgangsmåde til fremstilling af 4',19-diacylcymaroler. | |
| DK122524B (da) | Fremgangsmåde til fremstilling af 3,8-diazabicyklo-(3,2,1)-oktaner. | |
| DK108682C (da) | Fremgangsmåde til fremstilling af substituerede 9,10-dichlor-triphendioxazinfarvestoffer. | |
| DK116280B (da) | Fremgangsmåde til fremstilling af 4,5-dehydro-3-keto-19-nor-steroider. | |
| DK104063C (da) | Fremgangsmåde til fremstilling af 4-hydroxy-5-halogenpyrimidiner. | |
| DK113647B (da) | Fremgangsmåde til fremstilling af 2-sulfanilamido-5-metoxypyrimidin. | |
| DK115620B (da) | Fremgangsmåde til fremstilling af 17α-klorætynyl-17βalkoksysteroider. |