DK115706B - Fremgangsmåde til fremstilling af den L-isomere af α-methyl-3,4-dihydroxyphenylalanin. - Google Patents
Fremgangsmåde til fremstilling af den L-isomere af α-methyl-3,4-dihydroxyphenylalanin.Info
- Publication number
- DK115706B DK115706B DK308362AA DK308362A DK115706B DK 115706 B DK115706 B DK 115706B DK 308362A A DK308362A A DK 308362AA DK 308362 A DK308362 A DK 308362A DK 115706 B DK115706 B DK 115706B
- Authority
- DK
- Denmark
- Prior art keywords
- dihydroxyphenylalanine
- isomer
- methyl
- preparation
- Prior art date
Links
- VWZUIIYOJGQRBR-UHFFFAOYSA-N 2-(3,4-dihydroxyanilino)-2-methylpropanoic acid Chemical compound OC(=O)C(C)(C)NC1=CC=C(O)C(O)=C1 VWZUIIYOJGQRBR-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/02—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C229/34—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton containing six-membered aromatic rings
- C07C229/36—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton containing six-membered aromatic rings with at least one amino group and one carboxyl group bound to the same carbon atom of the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US12311561A | 1961-07-11 | 1961-07-11 | |
| US185815A US3158648A (en) | 1962-04-09 | 1962-04-09 | Direct resolution of alpha-methyl-3, 4-dihydroxyphenylalanine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK115706B true DK115706B (da) | 1969-11-03 |
Family
ID=26821258
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK308362AA DK115706B (da) | 1961-07-11 | 1962-07-10 | Fremgangsmåde til fremstilling af den L-isomere af α-methyl-3,4-dihydroxyphenylalanin. |
Country Status (7)
| Country | Link |
|---|---|
| AT (1) | AT254174B (da) |
| CH (1) | CH429753A (da) |
| CY (1) | CY359A (da) |
| DK (1) | DK115706B (da) |
| FR (1) | FR1500756A (da) |
| GB (1) | GB983815A (da) |
| MY (1) | MY6700040A (da) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1241405A (en) * | 1969-04-23 | 1971-08-04 | Ajinomoto Kk | Resolution of phenylalanine derivatives |
-
1962
- 1962-07-02 AT AT530362A patent/AT254174B/de active
- 1962-07-05 GB GB25884/62A patent/GB983815A/en not_active Expired
- 1962-07-09 FR FR903411A patent/FR1500756A/fr not_active Expired
- 1962-07-10 DK DK308362AA patent/DK115706B/da unknown
- 1962-07-11 CH CH836262A patent/CH429753A/de unknown
-
1967
- 1967-01-13 CY CY35967A patent/CY359A/xx unknown
- 1967-12-31 MY MY196740A patent/MY6700040A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR1500756A (fr) | 1967-11-10 |
| CY359A (en) | 1967-01-13 |
| CH429753A (de) | 1967-02-15 |
| AT254174B (de) | 1967-05-10 |
| GB983815A (en) | 1965-02-17 |
| MY6700040A (en) | 1967-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK104168C (da) | Fremgangsmåde til fremstilling af mono-biguanider. | |
| DK118242B (da) | Fremgangsmåde til fremstilling af anhydropenicilliner. | |
| DK108976C (da) | Fremgangsmåde til fremstilling af hendecapeptider. | |
| DK119882B (da) | Fremgangsmåde til fremstilling af L-α-methyl-3,4-dihydroxyphenylalanin. | |
| DK107027C (da) | Fremgangsmåde til fremstilling af 3-hydroxy-benzisoxazoler. | |
| DK108455C (da) | Fremgangsmåde til fremstilling af i 5-stillingen usubstituerede 2-amino-benzophenoner. | |
| DK108227C (da) | Fremgangsmåde til fremstilling af 3-carbonhydridoxy-17α-halogenethinyl-19-nor-3,5-androstadien-17β-oler. | |
| DK115706B (da) | Fremgangsmåde til fremstilling af den L-isomere af α-methyl-3,4-dihydroxyphenylalanin. | |
| DK124753B (da) | Analogifremgangsmåde til fremstilling af 13-alkyl-gonen-3,17-dioler. | |
| DK106184C (da) | Fremgangsmåde til fremstilling af alkylaralkylftalater. | |
| DK118082B (da) | Fremgangsmåde til fremstilling af 4-cyanthiazol. | |
| DK104726C (da) | Fremgangsmåde til fremstilling af L-aminosyrer. | |
| DK116280B (da) | Fremgangsmåde til fremstilling af 4,5-dehydro-3-keto-19-nor-steroider. | |
| DK104178C (da) | Fremgangsmåde til fremstilling af asymmetriske nitrofurfuralaziner. | |
| DK104136C (da) | Fremgangsmåde til fremstilling af benzensulfonylsemicarbazider. | |
| DK104055C (da) | Fremgangsmåde til fremstilling af 6-methoxytetraloner. | |
| DK104347C (da) | Fremgangsmåde til fremstilling af 16α-hydroxysteroider. | |
| DK98328C (da) | Fremgangsmåde til fremstilling af 3α-acyloxy-11-oxo-20,20-bis-phosphatomethyl-21-hydroxy-5β-pregnaner. | |
| DK99508C (da) | Fremgangsmåde til fremstilling af 7-halogen-2-dimethylamino-5-phenyl-3H-1,4-benzodiazepin-4-oxider. | |
| DK96833C (da) | Fremgangsmåde til fremstilling af 2-klorazacyklo-2,3-alken-N-karboklorider. | |
| DK99984C (da) | Fremgangsmåde til fremstilling af N,N-diphenylisonicotinamid. | |
| DK99630C (da) | Fremgangsmåde til fremstilling af 2-brom-4,17β-dihydroxy-17α-methyl-3-oxo-4-androsten- eller 2-brom-4-acyloxy-17β-hydroxy-17α-methyl-3-oxo-4-androsten-forbindelser. | |
| DK115253B (da) | Fremgangsmåde til fremstilling af alkener. | |
| DK96599C (da) | Fremgangsmåde til fremstilling af 7α-alkylthio-3-keto-4-androsten- eller 7α-alkylthio-3-keto-1,4-androstadienforbindelser. | |
| DK98363C (da) | Fremgangsmåde til fremstilling af cycloserin. |